@@ -14,9 +16,8 @@ Join us on Discord: [GURPS Foundry-VTT Discord](https://discord.gg/6xJBcYWyED)
[Current GCA4 Export version: 'GCA-11' 12/23/2021 / Current GCA5 Export version: 'GCA5-13' 4/26/2022 / Current GCS Export version: 'GCS-5' 3/8/2021](https://drive.google.com/file/d/1vbDb9WtYQiZI78Pwa_TlEvYpJnR_S67B/view?usp=sharing)
-
-
#### Legal
+
The material presented here is my original creation, intended for use with the [GURPS](http://www.sjgames.com/gurps) system from [Steve Jackson Games](ttp://www.sjgames.com). This material is not official and is not endorsed by Steve Jackson Games.
[GURPS](http://www.sjgames.com/gurps) is a trademark of Steve Jackson Games, and its rules and art are copyrighted by Steve Jackson Games. All rights are reserved by Steve Jackson Games. This game aid is the original creation of Chris Normand/Nose66 and is released for free distribution, and not for resale, under the permissions granted in the [Steve Jackson Games Online Policy](http://www.sjgames.com/general/online_policy.html)
diff --git a/changelog.md b/changelog.md
index 20d8540f1..39cb619e5 100644
--- a/changelog.md
+++ b/changelog.md
@@ -16,7 +16,7 @@ Release 0.14.10 - 9/07/2022
- Fixed, reinstalled individual dice results on targetted rolls.
- Enhanced /show to accept -a (sort alphabetically), -pc and -npc flags
- Fixed import of usage notes for melee and ranged weapons
-- Fixed /anim file selection algorithm (to determine best fit). NOTE: You may need to adjust your current targeted /anim commands to get the right "look".
+- Fixed /anim file selection algorithm (to determine best fit). NOTE: You may need to adjust your current targeted /anim commands to get the right "look".
- Added 'Show?' button to tooltip
- Holding CTRL/CMD and clicking a "send to" will add, not replace player's bucket
- Update to JB2A 0.4.9
@@ -39,7 +39,7 @@ Release 0.14.7 - 7/28/2022
- Added 'disarmed' status effect icon
- Fixed /pr (private roll), and /psr (private selected roll)
-- Update JB2A to 0.4.6
+- Update JB2A to 0.4.6
Release 0.14.6 - 7/24/2022
@@ -56,14 +56,14 @@ Release 0.14.5 - 7/24/2022
- Holding CTRL shows changes in roll mode (GM roll for GMs, Blind roll for Players), w/system setting
- Fix /hp +1 @target for good?
- Damage column can now execute OTFs (ex: PDF:B405)
-- OTF now handles HTTP URLs. [http://google.com], as well as labeled ["Google!"http://google.com]
+- OTF now handles HTTP URLs. [http://google.com], as well as labeled ["Google!"http://google.com]
- Drag and drop PDF Journal links now open PDFoundry, and not the placeholder Journal
- Show "flavor" text below roll (issue #1426)
- Add ability to roll dice or damage multiple times from chat "/r [3d] 5" or "/r [3d cut] 5"
- Add ability to roll dice or damage multiple times from chat (using compact syntax) "/3d 5" or "/3d cut 5"
- Fixed initial vtt-notes import from GCS
- Added warning for /repeat X /anim ... when actor not linked
-- Added "selected roll", /sr [otf], /psr [otf] . "rolls" (executes) OTF against the selected actors. /sr [per], /sr [/hp -1d-3!], /sr [/hp reset]
+- Added "selected roll", /sr [otf], /psr [otf] . "rolls" (executes) OTF against the selected actors. /sr [per], /sr [/hp -1d-3!], /sr [/hp reset]
Release 0.14.4 7/7/2022
diff --git a/lib/change-log.js b/lib/change-log.js
index 5ca41176b..b4580c913 100755
--- a/lib/change-log.js
+++ b/lib/change-log.js
@@ -1,69 +1,69 @@
-import "./markdown-it.js";
-import { SemanticVersion } from "./semver.js";
+import './markdown-it.js'
+import { SemanticVersion } from './semver.js'
export class ChangeLogWindow extends FormApplication {
constructor(lastVersion) {
- super({}, {});
-
- this.lastVersion = lastVersion;
+ super({}, {})
+
+ this.lastVersion = lastVersion
}
static get defaultOptions() {
- const options = super.defaultOptions;
+ const options = super.defaultOptions
return mergeObject(options, {
- id: "changelog",
- classes: ["gurps", "changelog"],
- template: "systems/gurps/templates/changelog.html",
+ id: 'changelog',
+ classes: ['gurps', 'changelog'],
+ template: 'systems/gurps/templates/changelog.html',
width: 700,
submitOnChange: true,
closeOnSubmit: false,
- });
+ })
}
get title() {
- return `${game.i18n.localize("GURPS.title")} ~ ${game.i18n.localize("GURPS.changelog")}`;
+ return `${game.i18n.localize('GURPS.title')} ~ ${game.i18n.localize('GURPS.changelog')}`
}
async getData() {
- let data = await super.getData();
+ let data = await super.getData()
- let xhr = new XMLHttpRequest();
- xhr.open("GET", "systems/gurps/changelog.md");
+ let xhr = new XMLHttpRequest()
+ xhr.open('GET', 'systems/gurps/changelog.md')
let promise = new Promise(resolve => {
xhr.onload = () => {
if (xhr.status === 200) {
- data.changelog = this._processChangelog(xhr.response);
- resolve(data);
+ data.changelog = this._processChangelog(xhr.response)
+ resolve(data)
}
- };
- });
- xhr.send(null);
+ }
+ })
+ xhr.send(null)
- return promise;
+ return promise
}
_processChangelog(md) {
- const MD = window.markdownit();
- md = md.replace(//g,""); // Remove HTML link from internal changelog display
+ const MD = window.markdownit()
+ md = md.replace(//g, '') // Remove HTML link from internal changelog display
// Cut off irrelevant changelog entries
- let lines = md.split(/[\n\r]/);
- let count = 0 // Max at 5
+ let lines = md.split(/[\n\r]/)
+ let count = 0 // Max at 5
if (this.lastVersion) {
for (let a = 0; a < lines.length; a++) {
- let line = lines[a];
+ let line = lines[a]
if (line.match(/([0-9]+\.[0-9]+\.[0-9]+)/)) {
count++
- const version = SemanticVersion.fromString(RegExp.$1);
+ const version = SemanticVersion.fromString(RegExp.$1)
if (count > 5 || !version.isHigherThan(this.lastVersion)) {
- lines = lines.slice(0, a);
- break;
+ lines = lines.slice(0, a)
+ break
}
}
}
}
- return MD.render(lines.join("\n"));
+ return MD.render(lines.join('\n'))
}
}
diff --git a/lib/hitpoints.js b/lib/hitpoints.js
index 55f25b6aa..c7915de86 100755
--- a/lib/hitpoints.js
+++ b/lib/hitpoints.js
@@ -17,7 +17,7 @@ const hpConditions = {
style: 'normal',
},
REELING: {
- breakpoint: HP => Math.ceil(HP.max / 3)-1,
+ breakpoint: HP => Math.ceil(HP.max / 3) - 1,
label: 'GURPS.STATUSReeling',
style: 'reeling',
},
@@ -66,14 +66,14 @@ const fpConditions = {
style: 'normal',
},
REELING: {
- breakpoint: FP => Math.ceil(FP.max / 3)-1,
+ breakpoint: FP => Math.ceil(FP.max / 3) - 1,
label: 'GURPS.tired',
style: 'tired',
},
COLLAPSE: {
breakpoint: _ => 0,
label: 'GURPS.collapse',
-
+
style: 'collapse',
},
UNCONSCIOUS: {
diff --git a/lib/initiative.js b/lib/initiative.js
index 1ad6b2d29..bc29a2b3e 100755
--- a/lib/initiative.js
+++ b/lib/initiative.js
@@ -6,16 +6,16 @@ export default class Initiative {
constructor() {
this.setup()
}
-
+
static defaultFormula() {
- return "((@basicspeed.value*100) + (@attributes.DX.value / 100) + (1d6 / 1000)) / 100"
+ return '((@basicspeed.value*100) + (@attributes.DX.value / 100) + (1d6 / 1000)) / 100'
}
setup() {
- Hooks.once("init", () => {
+ Hooks.once('init', () => {
CONFIG.Combat.initiative = {
formula: Initiative.defaultFormula(),
- decimals: 5 // Important to be able to maintain resolution
+ decimals: 5, // Important to be able to maintain resolution
}
})
}
diff --git a/lib/markdown-it.js b/lib/markdown-it.js
index dc2db5f76..dac66ae8d 100755
--- a/lib/markdown-it.js
+++ b/lib/markdown-it.js
@@ -1,8160 +1,10978 @@
-/*! markdown-it 11.0.1 https://github.com//markdown-it/markdown-it @license MIT */(function(f){if(typeof exports==="object"&&typeof module!=="undefined"){module.exports=f()}else if(typeof define==="function"&&define.amd){define([],f)}else{var g;if(typeof window!=="undefined"){g=window}else if(typeof global!=="undefined"){g=global}else if(typeof self!=="undefined"){g=self}else{g=this}g.markdownit = f()}})(function(){var define,module,exports;return (function(){function r(e,n,t){function o(i,f){if(!n[i]){if(!e[i]){var c="function"==typeof require&&require;if(!f&&c)return c(i,!0);if(u)return u(i,!0);var a=new Error("Cannot find module '"+i+"'");throw a.code="MODULE_NOT_FOUND",a}var p=n[i]={exports:{}};e[i][0].call(p.exports,function(r){var n=e[i][1][r];return o(n||r)},p,p.exports,r,e,n,t)}return n[i].exports}for(var u="function"==typeof require&&require,i=0;i' +
- * hljs.highlight(lang, str, true).value +
- * '' + md.utils.escapeHtml(str) + '' +
+ * hljs.highlight(lang, str, true).value +
+ * '' + md.utils.escapeHtml(str) + '` tags. - **/ -MarkdownIt.prototype.renderInline = function (src, env) { - env = env || {}; - - return this.renderer.render(this.parseInline(src, env), this.options, env); -}; - - -module.exports = MarkdownIt; - -},{"./common/utils":4,"./helpers":5,"./parser_block":10,"./parser_core":11,"./parser_inline":12,"./presets/commonmark":13,"./presets/default":14,"./presets/zero":15,"./renderer":16,"linkify-it":53,"mdurl":58,"punycode":60}],10:[function(require,module,exports){ -/** internal - * class ParserBlock - * - * Block-level tokenizer. - **/ -'use strict'; - - -var Ruler = require('./ruler'); - - -var _rules = [ - // First 2 params - rule name & source. Secondary array - list of rules, - // which can be terminated by this one. - [ 'table', require('./rules_block/table'), [ 'paragraph', 'reference' ] ], - [ 'code', require('./rules_block/code') ], - [ 'fence', require('./rules_block/fence'), [ 'paragraph', 'reference', 'blockquote', 'list' ] ], - [ 'blockquote', require('./rules_block/blockquote'), [ 'paragraph', 'reference', 'blockquote', 'list' ] ], - [ 'hr', require('./rules_block/hr'), [ 'paragraph', 'reference', 'blockquote', 'list' ] ], - [ 'list', require('./rules_block/list'), [ 'paragraph', 'reference', 'blockquote' ] ], - [ 'reference', require('./rules_block/reference') ], - [ 'heading', require('./rules_block/heading'), [ 'paragraph', 'reference', 'blockquote' ] ], - [ 'lheading', require('./rules_block/lheading') ], - [ 'html_block', require('./rules_block/html_block'), [ 'paragraph', 'reference', 'blockquote' ] ], - [ 'paragraph', require('./rules_block/paragraph') ] -]; - - -/** - * new ParserBlock() - **/ -function ParserBlock() { - /** - * ParserBlock#ruler -> Ruler - * - * [[Ruler]] instance. Keep configuration of block rules. - **/ - this.ruler = new Ruler(); - - for (var i = 0; i < _rules.length; i++) { - this.ruler.push(_rules[i][0], _rules[i][1], { alt: (_rules[i][2] || []).slice() }); - } -} - - -// Generate tokens for input range -// -ParserBlock.prototype.tokenize = function (state, startLine, endLine) { - var ok, i, - rules = this.ruler.getRules(''), - len = rules.length, - line = startLine, - hasEmptyLines = false, - maxNesting = state.md.options.maxNesting; - - while (line < endLine) { - state.line = line = state.skipEmptyLines(line); - if (line >= endLine) { break; } - - // Termination condition for nested calls. - // Nested calls currently used for blockquotes & lists - if (state.sCount[line] < state.blkIndent) { break; } - - // If nesting level exceeded - skip tail to the end. That's not ordinary - // situation and we should not care about content. - if (state.level >= maxNesting) { - state.line = endLine; - break; - } + /** chainable, internal + * MarkdownIt.configure(presets) + * + * Batch load of all options and compenent settings. This is internal method, + * and you probably will not need it. But if you will - see available presets + * and data structure [here](https://github.com/markdown-it/markdown-it/tree/master/lib/presets) + * + * We strongly recommend to use presets instead of direct config loads. That + * will give better compatibility with next versions. + **/ + MarkdownIt.prototype.configure = function (presets) { + var self = this, + presetName + + if (utils.isString(presets)) { + presetName = presets + presets = config[presetName] + if (!presets) { + throw new Error('Wrong `markdown-it` preset "' + presetName + '", check name') + } + } - // Try all possible rules. - // On success, rule should: - // - // - update `state.line` - // - update `state.tokens` - // - return true + if (!presets) { + throw new Error("Wrong `markdown-it` preset, can't be empty") + } - for (i = 0; i < len; i++) { - ok = rules[i](state, line, endLine, false); - if (ok) { break; } - } + if (presets.options) { + self.set(presets.options) + } - // set state.tight if we had an empty line before current tag - // i.e. latest empty line should not count - state.tight = !hasEmptyLines; + if (presets.components) { + Object.keys(presets.components).forEach(function (name) { + if (presets.components[name].rules) { + self[name].ruler.enableOnly(presets.components[name].rules) + } + if (presets.components[name].rules2) { + self[name].ruler2.enableOnly(presets.components[name].rules2) + } + }) + } + return this + } - // paragraph might "eat" one newline after it in nested lists - if (state.isEmpty(state.line - 1)) { - hasEmptyLines = true; - } + /** chainable + * MarkdownIt.enable(list, ignoreInvalid) + * - list (String|Array): rule name or list of rule names to enable + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * Enable list or rules. It will automatically find appropriate components, + * containing rules with given names. If rule not found, and `ignoreInvalid` + * not set - throws exception. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')() + * .enable(['sub', 'sup']) + * .disable('smartquotes'); + * ``` + **/ + MarkdownIt.prototype.enable = function (list, ignoreInvalid) { + var result = [] + + if (!Array.isArray(list)) { + list = [list] + } - line = state.line; + ;['core', 'block', 'inline'].forEach(function (chain) { + result = result.concat(this[chain].ruler.enable(list, true)) + }, this) - if (line < endLine && state.isEmpty(line)) { - hasEmptyLines = true; - line++; - state.line = line; - } - } -}; + result = result.concat(this.inline.ruler2.enable(list, true)) + var missed = list.filter(function (name) { + return result.indexOf(name) < 0 + }) -/** - * ParserBlock.parse(str, md, env, outTokens) - * - * Process input string and push block tokens into `outTokens` - **/ -ParserBlock.prototype.parse = function (src, md, env, outTokens) { - var state; + if (missed.length && !ignoreInvalid) { + throw new Error('MarkdownIt. Failed to enable unknown rule(s): ' + missed) + } - if (!src) { return; } + return this + } - state = new this.State(src, md, env, outTokens); + /** chainable + * MarkdownIt.disable(list, ignoreInvalid) + * - list (String|Array): rule name or list of rule names to disable. + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * The same as [[MarkdownIt.enable]], but turn specified rules off. + **/ + MarkdownIt.prototype.disable = function (list, ignoreInvalid) { + var result = [] + + if (!Array.isArray(list)) { + list = [list] + } - this.tokenize(state, state.line, state.lineMax); -}; + ;['core', 'block', 'inline'].forEach(function (chain) { + result = result.concat(this[chain].ruler.disable(list, true)) + }, this) + result = result.concat(this.inline.ruler2.disable(list, true)) -ParserBlock.prototype.State = require('./rules_block/state_block'); + var missed = list.filter(function (name) { + return result.indexOf(name) < 0 + }) + if (missed.length && !ignoreInvalid) { + throw new Error('MarkdownIt. Failed to disable unknown rule(s): ' + missed) + } + return this + } -module.exports = ParserBlock; + /** chainable + * MarkdownIt.use(plugin, params) + * + * Load specified plugin with given params into current parser instance. + * It's just a sugar to call `plugin(md, params)` with curring. + * + * ##### Example + * + * ```javascript + * var iterator = require('markdown-it-for-inline'); + * var md = require('markdown-it')() + * .use(iterator, 'foo_replace', 'text', function (tokens, idx) { + * tokens[idx].content = tokens[idx].content.replace(/foo/g, 'bar'); + * }); + * ``` + **/ + MarkdownIt.prototype.use = function (plugin /*, params, ... */) { + var args = [this].concat(Array.prototype.slice.call(arguments, 1)) + plugin.apply(plugin, args) + return this + } -},{"./ruler":17,"./rules_block/blockquote":18,"./rules_block/code":19,"./rules_block/fence":20,"./rules_block/heading":21,"./rules_block/hr":22,"./rules_block/html_block":23,"./rules_block/lheading":24,"./rules_block/list":25,"./rules_block/paragraph":26,"./rules_block/reference":27,"./rules_block/state_block":28,"./rules_block/table":29}],11:[function(require,module,exports){ -/** internal - * class Core - * - * Top-level rules executor. Glues block/inline parsers and does intermediate - * transformations. - **/ -'use strict'; + /** internal + * MarkdownIt.parse(src, env) -> Array + * - src (String): source string + * - env (Object): environment sandbox + * + * Parse input string and return list of block tokens (special token type + * "inline" will contain list of inline tokens). You should not call this + * method directly, until you write custom renderer (for example, to produce + * AST). + * + * `env` is used to pass data between "distributed" rules and return additional + * metadata like reference info, needed for the renderer. It also can be used to + * inject data in specific cases. Usually, you will be ok to pass `{}`, + * and then pass updated object to renderer. + **/ + MarkdownIt.prototype.parse = function (src, env) { + if (typeof src !== 'string') { + throw new Error('Input data should be a String') + } + var state = new this.core.State(src, this, env) -var Ruler = require('./ruler'); + this.core.process(state) + return state.tokens + } -var _rules = [ - [ 'normalize', require('./rules_core/normalize') ], - [ 'block', require('./rules_core/block') ], - [ 'inline', require('./rules_core/inline') ], - [ 'linkify', require('./rules_core/linkify') ], - [ 'replacements', require('./rules_core/replacements') ], - [ 'smartquotes', require('./rules_core/smartquotes') ] -]; + /** + * MarkdownIt.render(src [, env]) -> String + * - src (String): source string + * - env (Object): environment sandbox + * + * Render markdown string into html. It does all magic for you :). + * + * `env` can be used to inject additional metadata (`{}` by default). + * But you will not need it with high probability. See also comment + * in [[MarkdownIt.parse]]. + **/ + MarkdownIt.prototype.render = function (src, env) { + env = env || {} + + return this.renderer.render(this.parse(src, env), this.options, env) + } + /** internal + * MarkdownIt.parseInline(src, env) -> Array + * - src (String): source string + * - env (Object): environment sandbox + * + * The same as [[MarkdownIt.parse]] but skip all block rules. It returns the + * block tokens list with the single `inline` element, containing parsed inline + * tokens in `children` property. Also updates `env` object. + **/ + MarkdownIt.prototype.parseInline = function (src, env) { + var state = new this.core.State(src, this, env) + + state.inlineMode = true + this.core.process(state) + + return state.tokens + } -/** - * new Core() - **/ -function Core() { - /** - * Core#ruler -> Ruler - * - * [[Ruler]] instance. Keep configuration of core rules. - **/ - this.ruler = new Ruler(); + /** + * MarkdownIt.renderInline(src [, env]) -> String + * - src (String): source string + * - env (Object): environment sandbox + * + * Similar to [[MarkdownIt.render]] but for single paragraph content. Result + * will NOT be wrapped into `
` tags.
+ **/
+ MarkdownIt.prototype.renderInline = function (src, env) {
+ env = env || {}
+
+ return this.renderer.render(this.parseInline(src, env), this.options, env)
+ }
- for (var i = 0; i < _rules.length; i++) {
- this.ruler.push(_rules[i][0], _rules[i][1]);
- }
-}
+ module.exports = MarkdownIt
+ },
+ {
+ './common/utils': 4,
+ './helpers': 5,
+ './parser_block': 10,
+ './parser_core': 11,
+ './parser_inline': 12,
+ './presets/commonmark': 13,
+ './presets/default': 14,
+ './presets/zero': 15,
+ './renderer': 16,
+ 'linkify-it': 53,
+ mdurl: 58,
+ punycode: 60,
+ },
+ ],
+ 10: [
+ function (require, module, exports) {
+ /** internal
+ * class ParserBlock
+ *
+ * Block-level tokenizer.
+ **/
+ 'use strict'
+
+ var Ruler = require('./ruler')
+
+ var _rules = [
+ // First 2 params - rule name & source. Secondary array - list of rules,
+ // which can be terminated by this one.
+ ['table', require('./rules_block/table'), ['paragraph', 'reference']],
+ ['code', require('./rules_block/code')],
+ ['fence', require('./rules_block/fence'), ['paragraph', 'reference', 'blockquote', 'list']],
+ ['blockquote', require('./rules_block/blockquote'), ['paragraph', 'reference', 'blockquote', 'list']],
+ ['hr', require('./rules_block/hr'), ['paragraph', 'reference', 'blockquote', 'list']],
+ ['list', require('./rules_block/list'), ['paragraph', 'reference', 'blockquote']],
+ ['reference', require('./rules_block/reference')],
+ ['heading', require('./rules_block/heading'), ['paragraph', 'reference', 'blockquote']],
+ ['lheading', require('./rules_block/lheading')],
+ ['html_block', require('./rules_block/html_block'), ['paragraph', 'reference', 'blockquote']],
+ ['paragraph', require('./rules_block/paragraph')],
+ ]
+
+ /**
+ * new ParserBlock()
+ **/
+ function ParserBlock() {
+ /**
+ * ParserBlock#ruler -> Ruler
+ *
+ * [[Ruler]] instance. Keep configuration of block rules.
+ **/
+ this.ruler = new Ruler()
+
+ for (var i = 0; i < _rules.length; i++) {
+ this.ruler.push(_rules[i][0], _rules[i][1], { alt: (_rules[i][2] || []).slice() })
+ }
+ }
+ // Generate tokens for input range
+ //
+ ParserBlock.prototype.tokenize = function (state, startLine, endLine) {
+ var ok,
+ i,
+ rules = this.ruler.getRules(''),
+ len = rules.length,
+ line = startLine,
+ hasEmptyLines = false,
+ maxNesting = state.md.options.maxNesting
+
+ while (line < endLine) {
+ state.line = line = state.skipEmptyLines(line)
+ if (line >= endLine) {
+ break
+ }
+
+ // Termination condition for nested calls.
+ // Nested calls currently used for blockquotes & lists
+ if (state.sCount[line] < state.blkIndent) {
+ break
+ }
+
+ // If nesting level exceeded - skip tail to the end. That's not ordinary
+ // situation and we should not care about content.
+ if (state.level >= maxNesting) {
+ state.line = endLine
+ break
+ }
+
+ // Try all possible rules.
+ // On success, rule should:
+ //
+ // - update `state.line`
+ // - update `state.tokens`
+ // - return true
+
+ for (i = 0; i < len; i++) {
+ ok = rules[i](state, line, endLine, false)
+ if (ok) {
+ break
+ }
+ }
+
+ // set state.tight if we had an empty line before current tag
+ // i.e. latest empty line should not count
+ state.tight = !hasEmptyLines
+
+ // paragraph might "eat" one newline after it in nested lists
+ if (state.isEmpty(state.line - 1)) {
+ hasEmptyLines = true
+ }
+
+ line = state.line
+
+ if (line < endLine && state.isEmpty(line)) {
+ hasEmptyLines = true
+ line++
+ state.line = line
+ }
+ }
+ }
-/**
- * Core.process(state)
- *
- * Executes core chain rules.
- **/
-Core.prototype.process = function (state) {
- var i, l, rules;
+ /**
+ * ParserBlock.parse(str, md, env, outTokens)
+ *
+ * Process input string and push block tokens into `outTokens`
+ **/
+ ParserBlock.prototype.parse = function (src, md, env, outTokens) {
+ var state
- rules = this.ruler.getRules('');
+ if (!src) {
+ return
+ }
- for (i = 0, l = rules.length; i < l; i++) {
- rules[i](state);
- }
-};
+ state = new this.State(src, md, env, outTokens)
-Core.prototype.State = require('./rules_core/state_core');
+ this.tokenize(state, state.line, state.lineMax)
+ }
+ ParserBlock.prototype.State = require('./rules_block/state_block')
+
+ module.exports = ParserBlock
+ },
+ {
+ './ruler': 17,
+ './rules_block/blockquote': 18,
+ './rules_block/code': 19,
+ './rules_block/fence': 20,
+ './rules_block/heading': 21,
+ './rules_block/hr': 22,
+ './rules_block/html_block': 23,
+ './rules_block/lheading': 24,
+ './rules_block/list': 25,
+ './rules_block/paragraph': 26,
+ './rules_block/reference': 27,
+ './rules_block/state_block': 28,
+ './rules_block/table': 29,
+ },
+ ],
+ 11: [
+ function (require, module, exports) {
+ /** internal
+ * class Core
+ *
+ * Top-level rules executor. Glues block/inline parsers and does intermediate
+ * transformations.
+ **/
+ 'use strict'
+
+ var Ruler = require('./ruler')
+
+ var _rules = [
+ ['normalize', require('./rules_core/normalize')],
+ ['block', require('./rules_core/block')],
+ ['inline', require('./rules_core/inline')],
+ ['linkify', require('./rules_core/linkify')],
+ ['replacements', require('./rules_core/replacements')],
+ ['smartquotes', require('./rules_core/smartquotes')],
+ ]
+
+ /**
+ * new Core()
+ **/
+ function Core() {
+ /**
+ * Core#ruler -> Ruler
+ *
+ * [[Ruler]] instance. Keep configuration of core rules.
+ **/
+ this.ruler = new Ruler()
+
+ for (var i = 0; i < _rules.length; i++) {
+ this.ruler.push(_rules[i][0], _rules[i][1])
+ }
+ }
-module.exports = Core;
+ /**
+ * Core.process(state)
+ *
+ * Executes core chain rules.
+ **/
+ Core.prototype.process = function (state) {
+ var i, l, rules
-},{"./ruler":17,"./rules_core/block":30,"./rules_core/inline":31,"./rules_core/linkify":32,"./rules_core/normalize":33,"./rules_core/replacements":34,"./rules_core/smartquotes":35,"./rules_core/state_core":36}],12:[function(require,module,exports){
-/** internal
- * class ParserInline
- *
- * Tokenizes paragraph content.
- **/
-'use strict';
+ rules = this.ruler.getRules('')
+ for (i = 0, l = rules.length; i < l; i++) {
+ rules[i](state)
+ }
+ }
-var Ruler = require('./ruler');
+ Core.prototype.State = require('./rules_core/state_core')
+
+ module.exports = Core
+ },
+ {
+ './ruler': 17,
+ './rules_core/block': 30,
+ './rules_core/inline': 31,
+ './rules_core/linkify': 32,
+ './rules_core/normalize': 33,
+ './rules_core/replacements': 34,
+ './rules_core/smartquotes': 35,
+ './rules_core/state_core': 36,
+ },
+ ],
+ 12: [
+ function (require, module, exports) {
+ /** internal
+ * class ParserInline
+ *
+ * Tokenizes paragraph content.
+ **/
+ 'use strict'
+
+ var Ruler = require('./ruler')
+
+ ////////////////////////////////////////////////////////////////////////////////
+ // Parser rules
+
+ var _rules = [
+ ['text', require('./rules_inline/text')],
+ ['newline', require('./rules_inline/newline')],
+ ['escape', require('./rules_inline/escape')],
+ ['backticks', require('./rules_inline/backticks')],
+ ['strikethrough', require('./rules_inline/strikethrough').tokenize],
+ ['emphasis', require('./rules_inline/emphasis').tokenize],
+ ['link', require('./rules_inline/link')],
+ ['image', require('./rules_inline/image')],
+ ['autolink', require('./rules_inline/autolink')],
+ ['html_inline', require('./rules_inline/html_inline')],
+ ['entity', require('./rules_inline/entity')],
+ ]
+
+ var _rules2 = [
+ ['balance_pairs', require('./rules_inline/balance_pairs')],
+ ['strikethrough', require('./rules_inline/strikethrough').postProcess],
+ ['emphasis', require('./rules_inline/emphasis').postProcess],
+ ['text_collapse', require('./rules_inline/text_collapse')],
+ ]
+
+ /**
+ * new ParserInline()
+ **/
+ function ParserInline() {
+ var i
+
+ /**
+ * ParserInline#ruler -> Ruler
+ *
+ * [[Ruler]] instance. Keep configuration of inline rules.
+ **/
+ this.ruler = new Ruler()
+
+ for (i = 0; i < _rules.length; i++) {
+ this.ruler.push(_rules[i][0], _rules[i][1])
+ }
+ /**
+ * ParserInline#ruler2 -> Ruler
+ *
+ * [[Ruler]] instance. Second ruler used for post-processing
+ * (e.g. in emphasis-like rules).
+ **/
+ this.ruler2 = new Ruler()
-////////////////////////////////////////////////////////////////////////////////
-// Parser rules
+ for (i = 0; i < _rules2.length; i++) {
+ this.ruler2.push(_rules2[i][0], _rules2[i][1])
+ }
+ }
-var _rules = [
- [ 'text', require('./rules_inline/text') ],
- [ 'newline', require('./rules_inline/newline') ],
- [ 'escape', require('./rules_inline/escape') ],
- [ 'backticks', require('./rules_inline/backticks') ],
- [ 'strikethrough', require('./rules_inline/strikethrough').tokenize ],
- [ 'emphasis', require('./rules_inline/emphasis').tokenize ],
- [ 'link', require('./rules_inline/link') ],
- [ 'image', require('./rules_inline/image') ],
- [ 'autolink', require('./rules_inline/autolink') ],
- [ 'html_inline', require('./rules_inline/html_inline') ],
- [ 'entity', require('./rules_inline/entity') ]
-];
+ // Skip single token by running all rules in validation mode;
+ // returns `true` if any rule reported success
+ //
+ ParserInline.prototype.skipToken = function (state) {
+ var ok,
+ i,
+ pos = state.pos,
+ rules = this.ruler.getRules(''),
+ len = rules.length,
+ maxNesting = state.md.options.maxNesting,
+ cache = state.cache
+
+ if (typeof cache[pos] !== 'undefined') {
+ state.pos = cache[pos]
+ return
+ }
-var _rules2 = [
- [ 'balance_pairs', require('./rules_inline/balance_pairs') ],
- [ 'strikethrough', require('./rules_inline/strikethrough').postProcess ],
- [ 'emphasis', require('./rules_inline/emphasis').postProcess ],
- [ 'text_collapse', require('./rules_inline/text_collapse') ]
-];
+ if (state.level < maxNesting) {
+ for (i = 0; i < len; i++) {
+ // Increment state.level and decrement it later to limit recursion.
+ // It's harmless to do here, because no tokens are created. But ideally,
+ // we'd need a separate private state variable for this purpose.
+ //
+ state.level++
+ ok = rules[i](state, true)
+ state.level--
+
+ if (ok) {
+ break
+ }
+ }
+ } else {
+ // Too much nesting, just skip until the end of the paragraph.
+ //
+ // NOTE: this will cause links to behave incorrectly in the following case,
+ // when an amount of `[` is exactly equal to `maxNesting + 1`:
+ //
+ // [[[[[[[[[[[[[[[[[[[[[foo]()
+ //
+ // TODO: remove this workaround when CM standard will allow nested links
+ // (we can replace it by preventing links from being parsed in
+ // validation mode)
+ //
+ state.pos = state.posMax
+ }
+ if (!ok) {
+ state.pos++
+ }
+ cache[pos] = state.pos
+ }
-/**
- * new ParserInline()
- **/
-function ParserInline() {
- var i;
+ // Generate tokens for input range
+ //
+ ParserInline.prototype.tokenize = function (state) {
+ var ok,
+ i,
+ rules = this.ruler.getRules(''),
+ len = rules.length,
+ end = state.posMax,
+ maxNesting = state.md.options.maxNesting
+
+ while (state.pos < end) {
+ // Try all possible rules.
+ // On success, rule should:
+ //
+ // - update `state.pos`
+ // - update `state.tokens`
+ // - return true
+
+ if (state.level < maxNesting) {
+ for (i = 0; i < len; i++) {
+ ok = rules[i](state, false)
+ if (ok) {
+ break
+ }
+ }
+ }
+
+ if (ok) {
+ if (state.pos >= end) {
+ break
+ }
+ continue
+ }
+
+ state.pending += state.src[state.pos++]
+ }
- /**
- * ParserInline#ruler -> Ruler
- *
- * [[Ruler]] instance. Keep configuration of inline rules.
- **/
- this.ruler = new Ruler();
+ if (state.pending) {
+ state.pushPending()
+ }
+ }
- for (i = 0; i < _rules.length; i++) {
- this.ruler.push(_rules[i][0], _rules[i][1]);
- }
+ /**
+ * ParserInline.parse(str, md, env, outTokens)
+ *
+ * Process input string and push inline tokens into `outTokens`
+ **/
+ ParserInline.prototype.parse = function (str, md, env, outTokens) {
+ var i, rules, len
+ var state = new this.State(str, md, env, outTokens)
- /**
- * ParserInline#ruler2 -> Ruler
- *
- * [[Ruler]] instance. Second ruler used for post-processing
- * (e.g. in emphasis-like rules).
- **/
- this.ruler2 = new Ruler();
+ this.tokenize(state)
- for (i = 0; i < _rules2.length; i++) {
- this.ruler2.push(_rules2[i][0], _rules2[i][1]);
- }
-}
+ rules = this.ruler2.getRules('')
+ len = rules.length
+ for (i = 0; i < len; i++) {
+ rules[i](state)
+ }
+ }
-// Skip single token by running all rules in validation mode;
-// returns `true` if any rule reported success
-//
-ParserInline.prototype.skipToken = function (state) {
- var ok, i, pos = state.pos,
- rules = this.ruler.getRules(''),
- len = rules.length,
- maxNesting = state.md.options.maxNesting,
- cache = state.cache;
+ ParserInline.prototype.State = require('./rules_inline/state_inline')
+
+ module.exports = ParserInline
+ },
+ {
+ './ruler': 17,
+ './rules_inline/autolink': 37,
+ './rules_inline/backticks': 38,
+ './rules_inline/balance_pairs': 39,
+ './rules_inline/emphasis': 40,
+ './rules_inline/entity': 41,
+ './rules_inline/escape': 42,
+ './rules_inline/html_inline': 43,
+ './rules_inline/image': 44,
+ './rules_inline/link': 45,
+ './rules_inline/newline': 46,
+ './rules_inline/state_inline': 47,
+ './rules_inline/strikethrough': 48,
+ './rules_inline/text': 49,
+ './rules_inline/text_collapse': 50,
+ },
+ ],
+ 13: [
+ function (require, module, exports) {
+ // Commonmark default options
+
+ 'use strict'
+
+ module.exports = {
+ options: {
+ html: true, // Enable HTML tags in source
+ xhtmlOut: true, // Use '/' to close single tags ( ${i18n('GURPS.dropResolve')} ${i18n('GURPS.dropResolve')} and replace Where do you want to place this? and replace Where do you want to place this?
)
+ breaks: false, // Convert '\n' in paragraphs into
+ langPrefix: 'language-', // CSS language prefix for fenced blocks
+ linkify: false, // autoconvert URL-like texts to links
+
+ // Enable some language-neutral replacements + quotes beautification
+ typographer: false,
+
+ // Double + single quotes replacement pairs, when typographer enabled,
+ // and smartquotes on. Could be either a String or an Array.
+ //
+ // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+ // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+ quotes: '\u201c\u201d\u2018\u2019' /* “”‘’ */,
+
+ // Highlighter function. Should return escaped HTML,
+ // or '' if the source string is not changed and should be escaped externaly.
+ // If result starts with
+ langPrefix: 'language-', // CSS language prefix for fenced blocks
+ linkify: false, // autoconvert URL-like texts to links
+
+ // Enable some language-neutral replacements + quotes beautification
+ typographer: false,
+
+ // Double + single quotes replacement pairs, when typographer enabled,
+ // and smartquotes on. Could be either a String or an Array.
+ //
+ // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+ // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+ quotes: '\u201c\u201d\u2018\u2019' /* “”‘’ */,
+
+ // Highlighter function. Should return escaped HTML,
+ // or '' if the source string is not changed and should be escaped externaly.
+ // If result starts with
+ langPrefix: 'language-', // CSS language prefix for fenced blocks
+ linkify: false, // autoconvert URL-like texts to links
+
+ // Enable some language-neutral replacements + quotes beautification
+ typographer: false,
+
+ // Double + single quotes replacement pairs, when typographer enabled,
+ // and smartquotes on. Could be either a String or an Array.
+ //
+ // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+ // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+ quotes: '\u201c\u201d\u2018\u2019' /* “”‘’ */,
+
+ // Highlighter function. Should return escaped HTML,
+ // or '' if the source string is not changed and should be escaped externaly.
+ // If result starts with ' + escapeHtml(tokens[idx].content) + '\n'
+ }
+ default_rules.fence = function (tokens, idx, options, env, slf) {
+ var token = tokens[idx],
+ info = token.info ? unescapeAll(token.info).trim() : '',
+ langName = '',
+ highlighted,
+ i,
+ tmpAttrs,
+ tmpToken
+
+ if (info) {
+ langName = info.split(/\s+/g)[0]
+ }
-/**
- * ParserInline.parse(str, md, env, outTokens)
- *
- * Process input string and push inline tokens into `outTokens`
- **/
-ParserInline.prototype.parse = function (str, md, env, outTokens) {
- var i, rules, len;
- var state = new this.State(str, md, env, outTokens);
+ if (options.highlight) {
+ highlighted = options.highlight(token.content, langName) || escapeHtml(token.content)
+ } else {
+ highlighted = escapeHtml(token.content)
+ }
- this.tokenize(state);
+ if (highlighted.indexOf('
\n'
+ }
+ default_rules.image = function (tokens, idx, options, env, slf) {
+ var token = tokens[idx]
-ParserInline.prototype.State = require('./rules_inline/state_inline');
+ // "alt" attr MUST be set, even if empty. Because it's mandatory and
+ // should be placed on proper position for tests.
+ //
+ // Replace content with actual value
+ token.attrs[token.attrIndex('alt')][1] = slf.renderInlineAsText(token.children, options, env)
-module.exports = ParserInline;
+ return slf.renderToken(tokens, idx, options)
+ }
-},{"./ruler":17,"./rules_inline/autolink":37,"./rules_inline/backticks":38,"./rules_inline/balance_pairs":39,"./rules_inline/emphasis":40,"./rules_inline/entity":41,"./rules_inline/escape":42,"./rules_inline/html_inline":43,"./rules_inline/image":44,"./rules_inline/link":45,"./rules_inline/newline":46,"./rules_inline/state_inline":47,"./rules_inline/strikethrough":48,"./rules_inline/text":49,"./rules_inline/text_collapse":50}],13:[function(require,module,exports){
-// Commonmark default options
+ default_rules.hardbreak = function (tokens, idx, options /*, env */) {
+ return options.xhtmlOut ? '
\n' : '
\n'
+ }
+ default_rules.softbreak = function (tokens, idx, options /*, env */) {
+ return options.breaks ? (options.xhtmlOut ? '
\n' : '
\n') : '\n'
+ }
-'use strict';
+ default_rules.text = function (tokens, idx /*, options, env */) {
+ return escapeHtml(tokens[idx].content)
+ }
+ default_rules.html_block = function (tokens, idx /*, options, env */) {
+ return tokens[idx].content
+ }
+ default_rules.html_inline = function (tokens, idx /*, options, env */) {
+ return tokens[idx].content
+ }
-module.exports = {
- options: {
- html: true, // Enable HTML tags in source
- xhtmlOut: true, // Use '/' to close single tags (
)
- breaks: false, // Convert '\n' in paragraphs into
- langPrefix: 'language-', // CSS language prefix for fenced blocks
- linkify: false, // autoconvert URL-like texts to links
+ /**
+ * new Renderer()
+ *
+ * Creates new [[Renderer]] instance and fill [[Renderer#rules]] with defaults.
+ **/
+ function Renderer() {
+ /**
+ * Renderer#rules -> Object
+ *
+ * Contains render rules for tokens. Can be updated and extended.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.renderer.rules.strong_open = function () { return ''; };
+ * md.renderer.rules.strong_close = function () { return ''; };
+ *
+ * var result = md.renderInline(...);
+ * ```
+ *
+ * Each rule is called as independent static function with fixed signature:
+ *
+ * ```javascript
+ * function my_token_render(tokens, idx, options, env, renderer) {
+ * // ...
+ * return renderedHTML;
+ * }
+ * ```
+ *
+ * See [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js)
+ * for more details and examples.
+ **/
+ this.rules = assign({}, default_rules)
+ }
- // Enable some language-neutral replacements + quotes beautification
- typographer: false,
+ /**
+ * Renderer.renderAttrs(token) -> String
+ *
+ * Render token attributes to string.
+ **/
+ Renderer.prototype.renderAttrs = function renderAttrs(token) {
+ var i, l, result
- // Double + single quotes replacement pairs, when typographer enabled,
- // and smartquotes on. Could be either a String or an Array.
- //
- // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
- // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
- quotes: '\u201c\u201d\u2018\u2019', /* “”‘’ */
+ if (!token.attrs) {
+ return ''
+ }
- // Highlighter function. Should return escaped HTML,
- // or '' if the source string is not changed and should be escaped externaly.
- // If result starts with
)
- breaks: false, // Convert '\n' in paragraphs into
- langPrefix: 'language-', // CSS language prefix for fenced blocks
- linkify: false, // autoconvert URL-like texts to links
+ result += needLf ? '>\n' : '>'
- // Enable some language-neutral replacements + quotes beautification
- typographer: false,
+ return result
+ }
- // Double + single quotes replacement pairs, when typographer enabled,
- // and smartquotes on. Could be either a String or an Array.
- //
- // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
- // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
- quotes: '\u201c\u201d\u2018\u2019', /* “”‘’ */
+ /**
+ * Renderer.renderInline(tokens, options, env) -> String
+ * - tokens (Array): list on block tokens to renter
+ * - options (Object): params of parser instance
+ * - env (Object): additional data from parsed input (references, for example)
+ *
+ * The same as [[Renderer.render]], but for single token of `inline` type.
+ **/
+ Renderer.prototype.renderInline = function (tokens, options, env) {
+ var type,
+ result = '',
+ rules = this.rules
+
+ for (var i = 0, len = tokens.length; i < len; i++) {
+ type = tokens[i].type
+
+ if (typeof rules[type] !== 'undefined') {
+ result += rules[type](tokens, i, options, env, this)
+ } else {
+ result += this.renderToken(tokens, i, options)
+ }
+ }
- // Highlighter function. Should return escaped HTML,
- // or '' if the source string is not changed and should be escaped externaly.
- // If result starts with
)
- breaks: false, // Convert '\n' in paragraphs into
- langPrefix: 'language-', // CSS language prefix for fenced blocks
- linkify: false, // autoconvert URL-like texts to links
-
- // Enable some language-neutral replacements + quotes beautification
- typographer: false,
-
- // Double + single quotes replacement pairs, when typographer enabled,
- // and smartquotes on. Could be either a String or an Array.
- //
- // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
- // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
- quotes: '\u201c\u201d\u2018\u2019', /* “”‘’ */
-
- // Highlighter function. Should return escaped HTML,
- // or '' if the source string is not changed and should be escaped externaly.
- // If result starts with ' +
- escapeHtml(tokens[idx].content) +
- '\n';
-};
+ /**
+ * Ruler.push(ruleName, fn [, options])
+ * - ruleName (String): name of added rule.
+ * - fn (Function): rule function.
+ * - options (Object): rule options (not mandatory).
+ *
+ * Push new rule to the end of chain. See also
+ * [[Ruler.before]], [[Ruler.after]].
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.core.ruler.push('my_rule', function replace(state) {
+ * //...
+ * });
+ * ```
+ **/
+ Ruler.prototype.push = function (ruleName, fn, options) {
+ var opt = options || {}
+
+ this.__rules__.push({
+ name: ruleName,
+ enabled: true,
+ fn: fn,
+ alt: opt.alt || [],
+ })
+
+ this.__cache__ = null
+ }
+ /**
+ * Ruler.enable(list [, ignoreInvalid]) -> Array
+ * - list (String|Array): list of rule names to enable.
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Enable rules with given names. If any rule name not found - throw Error.
+ * Errors can be disabled by second param.
+ *
+ * Returns list of found rule names (if no exception happened).
+ *
+ * See also [[Ruler.disable]], [[Ruler.enableOnly]].
+ **/
+ Ruler.prototype.enable = function (list, ignoreInvalid) {
+ if (!Array.isArray(list)) {
+ list = [list]
+ }
-default_rules.fence = function (tokens, idx, options, env, slf) {
- var token = tokens[idx],
- info = token.info ? unescapeAll(token.info).trim() : '',
- langName = '',
- highlighted, i, tmpAttrs, tmpToken;
+ var result = []
- if (info) {
- langName = info.split(/\s+/g)[0];
- }
+ // Search by name and enable
+ list.forEach(function (name) {
+ var idx = this.__find__(name)
- if (options.highlight) {
- highlighted = options.highlight(token.content, langName) || escapeHtml(token.content);
- } else {
- highlighted = escapeHtml(token.content);
- }
+ if (idx < 0) {
+ if (ignoreInvalid) {
+ return
+ }
+ throw new Error('Rules manager: invalid rule name ' + name)
+ }
+ this.__rules__[idx].enabled = true
+ result.push(name)
+ }, this)
- if (highlighted.indexOf('
\n';
-};
-
-
-default_rules.image = function (tokens, idx, options, env, slf) {
- var token = tokens[idx];
-
- // "alt" attr MUST be set, even if empty. Because it's mandatory and
- // should be placed on proper position for tests.
- //
- // Replace content with actual value
-
- token.attrs[token.attrIndex('alt')][1] =
- slf.renderInlineAsText(token.children, options, env);
-
- return slf.renderToken(tokens, idx, options);
-};
-
-
-default_rules.hardbreak = function (tokens, idx, options /*, env */) {
- return options.xhtmlOut ? '
\n' : '
\n';
-};
-default_rules.softbreak = function (tokens, idx, options /*, env */) {
- return options.breaks ? (options.xhtmlOut ? '
\n' : '
\n') : '\n';
-};
-
-
-default_rules.text = function (tokens, idx /*, options, env */) {
- return escapeHtml(tokens[idx].content);
-};
-
-
-default_rules.html_block = function (tokens, idx /*, options, env */) {
- return tokens[idx].content;
-};
-default_rules.html_inline = function (tokens, idx /*, options, env */) {
- return tokens[idx].content;
-};
-
-
-/**
- * new Renderer()
- *
- * Creates new [[Renderer]] instance and fill [[Renderer#rules]] with defaults.
- **/
-function Renderer() {
-
- /**
- * Renderer#rules -> Object
- *
- * Contains render rules for tokens. Can be updated and extended.
- *
- * ##### Example
- *
- * ```javascript
- * var md = require('markdown-it')();
- *
- * md.renderer.rules.strong_open = function () { return ''; };
- * md.renderer.rules.strong_close = function () { return ''; };
- *
- * var result = md.renderInline(...);
- * ```
- *
- * Each rule is called as independent static function with fixed signature:
- *
- * ```javascript
- * function my_token_render(tokens, idx, options, env, renderer) {
- * // ...
- * return renderedHTML;
- * }
- * ```
- *
- * See [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js)
- * for more details and examples.
- **/
- this.rules = assign({}, default_rules);
-}
-
-
-/**
- * Renderer.renderAttrs(token) -> String
- *
- * Render token attributes to string.
- **/
-Renderer.prototype.renderAttrs = function renderAttrs(token) {
- var i, l, result;
-
- if (!token.attrs) { return ''; }
-
- result = '';
-
- for (i = 0, l = token.attrs.length; i < l; i++) {
- result += ' ' + escapeHtml(token.attrs[i][0]) + '="' + escapeHtml(token.attrs[i][1]) + '"';
- }
+ // Search by name and disable
+ list.forEach(function (name) {
+ var idx = this.__find__(name)
- return result;
-};
-
-
-/**
- * Renderer.renderToken(tokens, idx, options) -> String
- * - tokens (Array): list of tokens
- * - idx (Numbed): token index to render
- * - options (Object): params of parser instance
- *
- * Default token renderer. Can be overriden by custom function
- * in [[Renderer#rules]].
- **/
-Renderer.prototype.renderToken = function renderToken(tokens, idx, options) {
- var nextToken,
- result = '',
- needLf = false,
- token = tokens[idx];
-
- // Tight list paragraphs
- if (token.hidden) {
- return '';
- }
+ if (idx < 0) {
+ if (ignoreInvalid) {
+ return
+ }
+ throw new Error('Rules manager: invalid rule name ' + name)
+ }
+ this.__rules__[idx].enabled = false
+ result.push(name)
+ }, this)
- // Insert a newline between hidden paragraph and subsequent opening
- // block-level tag.
- //
- // For example, here we should insert a newline before blockquote:
- // - a
- // >
- //
- if (token.block && token.nesting !== -1 && idx && tokens[idx - 1].hidden) {
- result += '\n';
- }
+ this.__cache__ = null
+ return result
+ }
- // Add token name, e.g. `= 4) {
+ return false
+ }
- // Check if we need to add a newline after this tag
- if (token.block) {
- needLf = true;
+ // check the block quote marker
+ if (state.src.charCodeAt(pos++) !== 0x3e /* > */) {
+ return false
+ }
- if (token.nesting === 1) {
- if (idx + 1 < tokens.length) {
- nextToken = tokens[idx + 1];
+ // we know that it's going to be a valid blockquote,
+ // so no point trying to find the end of it in silent mode
+ if (silent) {
+ return true
+ }
- if (nextToken.type === 'inline' || nextToken.hidden) {
- // Block-level tag containing an inline tag.
- //
- needLf = false;
+ // set offset past spaces and ">"
+ initial = offset = state.sCount[startLine] + 1
+
+ // skip one optional space after '>'
+ if (state.src.charCodeAt(pos) === 0x20 /* space */) {
+ // ' > test '
+ // ^ -- position start of line here:
+ pos++
+ initial++
+ offset++
+ adjustTab = false
+ spaceAfterMarker = true
+ } else if (state.src.charCodeAt(pos) === 0x09 /* tab */) {
+ spaceAfterMarker = true
+
+ if ((state.bsCount[startLine] + offset) % 4 === 3) {
+ // ' >\t test '
+ // ^ -- position start of line here (tab has width===1)
+ pos++
+ initial++
+ offset++
+ adjustTab = false
+ } else {
+ // ' >\t test '
+ // ^ -- position start of line here + shift bsCount slightly
+ // to make extra space appear
+ adjustTab = true
+ }
+ } else {
+ spaceAfterMarker = false
+ }
- } else if (nextToken.nesting === -1 && nextToken.tag === token.tag) {
- // Opening tag + closing tag of the same type. E.g. ``.
- //
- needLf = false;
- }
- }
- }
- }
+ oldBMarks = [state.bMarks[startLine]]
+ state.bMarks[startLine] = pos
- result += needLf ? '>\n' : '>';
+ while (pos < max) {
+ ch = state.src.charCodeAt(pos)
- return result;
-};
+ if (isSpace(ch)) {
+ if (ch === 0x09) {
+ offset += 4 - ((offset + state.bsCount[startLine] + (adjustTab ? 1 : 0)) % 4)
+ } else {
+ offset++
+ }
+ } else {
+ break
+ }
+ pos++
+ }
-/**
- * Renderer.renderInline(tokens, options, env) -> String
- * - tokens (Array): list on block tokens to renter
- * - options (Object): params of parser instance
- * - env (Object): additional data from parsed input (references, for example)
- *
- * The same as [[Renderer.render]], but for single token of `inline` type.
- **/
-Renderer.prototype.renderInline = function (tokens, options, env) {
- var type,
- result = '',
- rules = this.rules;
+ oldBSCount = [state.bsCount[startLine]]
+ state.bsCount[startLine] = state.sCount[startLine] + 1 + (spaceAfterMarker ? 1 : 0)
+
+ lastLineEmpty = pos >= max
+
+ oldSCount = [state.sCount[startLine]]
+ state.sCount[startLine] = offset - initial
+
+ oldTShift = [state.tShift[startLine]]
+ state.tShift[startLine] = pos - state.bMarks[startLine]
+
+ terminatorRules = state.md.block.ruler.getRules('blockquote')
+
+ oldParentType = state.parentType
+ state.parentType = 'blockquote'
+
+ // Search the end of the block
+ //
+ // Block ends with either:
+ // 1. an empty line outside:
+ // ```
+ // > test
+ //
+ // ```
+ // 2. an empty line inside:
+ // ```
+ // >
+ // test
+ // ```
+ // 3. another tag:
+ // ```
+ // > test
+ // - - -
+ // ```
+ for (nextLine = startLine + 1; nextLine < endLine; nextLine++) {
+ // check if it's outdented, i.e. it's inside list item and indented
+ // less than said list item:
+ //
+ // ```
+ // 1. anything
+ // > current blockquote
+ // 2. checking this line
+ // ```
+ isOutdented = state.sCount[nextLine] < state.blkIndent
+
+ pos = state.bMarks[nextLine] + state.tShift[nextLine]
+ max = state.eMarks[nextLine]
+
+ if (pos >= max) {
+ // Case 1: line is not inside the blockquote, and this line is empty.
+ break
+ }
+
+ if (state.src.charCodeAt(pos++) === 0x3e /* > */ && !isOutdented) {
+ // This line is inside the blockquote.
+
+ // set offset past spaces and ">"
+ initial = offset = state.sCount[nextLine] + 1
+
+ // skip one optional space after '>'
+ if (state.src.charCodeAt(pos) === 0x20 /* space */) {
+ // ' > test '
+ // ^ -- position start of line here:
+ pos++
+ initial++
+ offset++
+ adjustTab = false
+ spaceAfterMarker = true
+ } else if (state.src.charCodeAt(pos) === 0x09 /* tab */) {
+ spaceAfterMarker = true
+
+ if ((state.bsCount[nextLine] + offset) % 4 === 3) {
+ // ' >\t test '
+ // ^ -- position start of line here (tab has width===1)
+ pos++
+ initial++
+ offset++
+ adjustTab = false
+ } else {
+ // ' >\t test '
+ // ^ -- position start of line here + shift bsCount slightly
+ // to make extra space appear
+ adjustTab = true
+ }
+ } else {
+ spaceAfterMarker = false
+ }
+
+ oldBMarks.push(state.bMarks[nextLine])
+ state.bMarks[nextLine] = pos
+
+ while (pos < max) {
+ ch = state.src.charCodeAt(pos)
+
+ if (isSpace(ch)) {
+ if (ch === 0x09) {
+ offset += 4 - ((offset + state.bsCount[nextLine] + (adjustTab ? 1 : 0)) % 4)
+ } else {
+ offset++
+ }
+ } else {
+ break
+ }
+
+ pos++
+ }
+
+ lastLineEmpty = pos >= max
+
+ oldBSCount.push(state.bsCount[nextLine])
+ state.bsCount[nextLine] = state.sCount[nextLine] + 1 + (spaceAfterMarker ? 1 : 0)
+
+ oldSCount.push(state.sCount[nextLine])
+ state.sCount[nextLine] = offset - initial
+
+ oldTShift.push(state.tShift[nextLine])
+ state.tShift[nextLine] = pos - state.bMarks[nextLine]
+ continue
+ }
+
+ // Case 2: line is not inside the blockquote, and the last line was empty.
+ if (lastLineEmpty) {
+ break
+ }
+
+ // Case 3: another tag found.
+ terminate = false
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true
+ break
+ }
+ }
+
+ if (terminate) {
+ // Quirk to enforce "hard termination mode" for paragraphs;
+ // normally if you call `tokenize(state, startLine, nextLine)`,
+ // paragraphs will look below nextLine for paragraph continuation,
+ // but if blockquote is terminated by another tag, they shouldn't
+ state.lineMax = nextLine
+
+ if (state.blkIndent !== 0) {
+ // state.blkIndent was non-zero, we now set it to zero,
+ // so we need to re-calculate all offsets to appear as
+ // if indent wasn't changed
+ oldBMarks.push(state.bMarks[nextLine])
+ oldBSCount.push(state.bsCount[nextLine])
+ oldTShift.push(state.tShift[nextLine])
+ oldSCount.push(state.sCount[nextLine])
+ state.sCount[nextLine] -= state.blkIndent
+ }
+
+ break
+ }
+
+ oldBMarks.push(state.bMarks[nextLine])
+ oldBSCount.push(state.bsCount[nextLine])
+ oldTShift.push(state.tShift[nextLine])
+ oldSCount.push(state.sCount[nextLine])
+
+ // A negative indentation means that this is a paragraph continuation
+ //
+ state.sCount[nextLine] = -1
+ }
- for (var i = 0, len = tokens.length; i < len; i++) {
- type = tokens[i].type;
+ oldIndent = state.blkIndent
+ state.blkIndent = 0
- if (typeof rules[type] !== 'undefined') {
- result += rules[type](tokens, i, options, env, this);
- } else {
- result += this.renderToken(tokens, i, options);
- }
- }
+ token = state.push('blockquote_open', 'blockquote', 1)
+ token.markup = '>'
+ token.map = lines = [startLine, 0]
- return result;
-};
-
-
-/** internal
- * Renderer.renderInlineAsText(tokens, options, env) -> String
- * - tokens (Array): list on block tokens to renter
- * - options (Object): params of parser instance
- * - env (Object): additional data from parsed input (references, for example)
- *
- * Special kludge for image `alt` attributes to conform CommonMark spec.
- * Don't try to use it! Spec requires to show `alt` content with stripped markup,
- * instead of simple escaping.
- **/
-Renderer.prototype.renderInlineAsText = function (tokens, options, env) {
- var result = '';
-
- for (var i = 0, len = tokens.length; i < len; i++) {
- if (tokens[i].type === 'text') {
- result += tokens[i].content;
- } else if (tokens[i].type === 'image') {
- result += this.renderInlineAsText(tokens[i].children, options, env);
- }
- }
+ state.md.block.tokenize(state, startLine, nextLine)
- return result;
-};
-
-
-/**
- * Renderer.render(tokens, options, env) -> String
- * - tokens (Array): list on block tokens to renter
- * - options (Object): params of parser instance
- * - env (Object): additional data from parsed input (references, for example)
- *
- * Takes token stream and generates HTML. Probably, you will never need to call
- * this method directly.
- **/
-Renderer.prototype.render = function (tokens, options, env) {
- var i, len, type,
- result = '',
- rules = this.rules;
-
- for (i = 0, len = tokens.length; i < len; i++) {
- type = tokens[i].type;
-
- if (type === 'inline') {
- result += this.renderInline(tokens[i].children, options, env);
- } else if (typeof rules[type] !== 'undefined') {
- result += rules[tokens[i].type](tokens, i, options, env, this);
- } else {
- result += this.renderToken(tokens, i, options, env);
- }
- }
+ token = state.push('blockquote_close', 'blockquote', -1)
+ token.markup = '>'
- return result;
-};
-
-module.exports = Renderer;
-
-},{"./common/utils":4}],17:[function(require,module,exports){
-/**
- * class Ruler
- *
- * Helper class, used by [[MarkdownIt#core]], [[MarkdownIt#block]] and
- * [[MarkdownIt#inline]] to manage sequences of functions (rules):
- *
- * - keep rules in defined order
- * - assign the name to each rule
- * - enable/disable rules
- * - add/replace rules
- * - allow assign rules to additional named chains (in the same)
- * - cacheing lists of active rules
- *
- * You will not need use this class directly until write plugins. For simple
- * rules control use [[MarkdownIt.disable]], [[MarkdownIt.enable]] and
- * [[MarkdownIt.use]].
- **/
-'use strict';
-
-
-/**
- * new Ruler()
- **/
-function Ruler() {
- // List of added rules. Each element is:
- //
- // {
- // name: XXX,
- // enabled: Boolean,
- // fn: Function(),
- // alt: [ name2, name3 ]
- // }
- //
- this.__rules__ = [];
-
- // Cached rule chains.
- //
- // First level - chain name, '' for default.
- // Second level - diginal anchor for fast filtering by charcodes.
- //
- this.__cache__ = null;
-}
-
-////////////////////////////////////////////////////////////////////////////////
-// Helper methods, should not be used directly
-
-
-// Find rule index by name
-//
-Ruler.prototype.__find__ = function (name) {
- for (var i = 0; i < this.__rules__.length; i++) {
- if (this.__rules__[i].name === name) {
- return i;
- }
- }
- return -1;
-};
+ state.lineMax = oldLineMax
+ state.parentType = oldParentType
+ lines[1] = state.line
+ // Restore original tShift; this might not be necessary since the parser
+ // has already been here, but just to make sure we can do that.
+ for (i = 0; i < oldTShift.length; i++) {
+ state.bMarks[i + startLine] = oldBMarks[i]
+ state.tShift[i + startLine] = oldTShift[i]
+ state.sCount[i + startLine] = oldSCount[i]
+ state.bsCount[i + startLine] = oldBSCount[i]
+ }
+ state.blkIndent = oldIndent
-// Build rules lookup cache
-//
-Ruler.prototype.__compile__ = function () {
- var self = this;
- var chains = [ '' ];
+ return true
+ }
+ },
+ { '../common/utils': 4 },
+ ],
+ 19: [
+ function (require, module, exports) {
+ // Code block (4 spaces padded)
- // collect unique names
- self.__rules__.forEach(function (rule) {
- if (!rule.enabled) { return; }
+ 'use strict'
- rule.alt.forEach(function (altName) {
- if (chains.indexOf(altName) < 0) {
- chains.push(altName);
- }
- });
- });
-
- self.__cache__ = {};
-
- chains.forEach(function (chain) {
- self.__cache__[chain] = [];
- self.__rules__.forEach(function (rule) {
- if (!rule.enabled) { return; }
-
- if (chain && rule.alt.indexOf(chain) < 0) { return; }
-
- self.__cache__[chain].push(rule.fn);
- });
- });
-};
-
-
-/**
- * Ruler.at(name, fn [, options])
- * - name (String): rule name to replace.
- * - fn (Function): new rule function.
- * - options (Object): new rule options (not mandatory).
- *
- * Replace rule by name with new function & options. Throws error if name not
- * found.
- *
- * ##### Options:
- *
- * - __alt__ - array with names of "alternate" chains.
- *
- * ##### Example
- *
- * Replace existing typographer replacement rule with new one:
- *
- * ```javascript
- * var md = require('markdown-it')();
- *
- * md.core.ruler.at('replacements', function replace(state) {
- * //...
- * });
- * ```
- **/
-Ruler.prototype.at = function (name, fn, options) {
- var index = this.__find__(name);
- var opt = options || {};
-
- if (index === -1) { throw new Error('Parser rule not found: ' + name); }
-
- this.__rules__[index].fn = fn;
- this.__rules__[index].alt = opt.alt || [];
- this.__cache__ = null;
-};
-
-
-/**
- * Ruler.before(beforeName, ruleName, fn [, options])
- * - beforeName (String): new rule will be added before this one.
- * - ruleName (String): name of added rule.
- * - fn (Function): rule function.
- * - options (Object): rule options (not mandatory).
- *
- * Add new rule to chain before one with given name. See also
- * [[Ruler.after]], [[Ruler.push]].
- *
- * ##### Options:
- *
- * - __alt__ - array with names of "alternate" chains.
- *
- * ##### Example
- *
- * ```javascript
- * var md = require('markdown-it')();
- *
- * md.block.ruler.before('paragraph', 'my_rule', function replace(state) {
- * //...
- * });
- * ```
- **/
-Ruler.prototype.before = function (beforeName, ruleName, fn, options) {
- var index = this.__find__(beforeName);
- var opt = options || {};
-
- if (index === -1) { throw new Error('Parser rule not found: ' + beforeName); }
-
- this.__rules__.splice(index, 0, {
- name: ruleName,
- enabled: true,
- fn: fn,
- alt: opt.alt || []
- });
-
- this.__cache__ = null;
-};
-
-
-/**
- * Ruler.after(afterName, ruleName, fn [, options])
- * - afterName (String): new rule will be added after this one.
- * - ruleName (String): name of added rule.
- * - fn (Function): rule function.
- * - options (Object): rule options (not mandatory).
- *
- * Add new rule to chain after one with given name. See also
- * [[Ruler.before]], [[Ruler.push]].
- *
- * ##### Options:
- *
- * - __alt__ - array with names of "alternate" chains.
- *
- * ##### Example
- *
- * ```javascript
- * var md = require('markdown-it')();
- *
- * md.inline.ruler.after('text', 'my_rule', function replace(state) {
- * //...
- * });
- * ```
- **/
-Ruler.prototype.after = function (afterName, ruleName, fn, options) {
- var index = this.__find__(afterName);
- var opt = options || {};
-
- if (index === -1) { throw new Error('Parser rule not found: ' + afterName); }
-
- this.__rules__.splice(index + 1, 0, {
- name: ruleName,
- enabled: true,
- fn: fn,
- alt: opt.alt || []
- });
-
- this.__cache__ = null;
-};
-
-/**
- * Ruler.push(ruleName, fn [, options])
- * - ruleName (String): name of added rule.
- * - fn (Function): rule function.
- * - options (Object): rule options (not mandatory).
- *
- * Push new rule to the end of chain. See also
- * [[Ruler.before]], [[Ruler.after]].
- *
- * ##### Options:
- *
- * - __alt__ - array with names of "alternate" chains.
- *
- * ##### Example
- *
- * ```javascript
- * var md = require('markdown-it')();
- *
- * md.core.ruler.push('my_rule', function replace(state) {
- * //...
- * });
- * ```
- **/
-Ruler.prototype.push = function (ruleName, fn, options) {
- var opt = options || {};
-
- this.__rules__.push({
- name: ruleName,
- enabled: true,
- fn: fn,
- alt: opt.alt || []
- });
-
- this.__cache__ = null;
-};
-
-
-/**
- * Ruler.enable(list [, ignoreInvalid]) -> Array
- * - list (String|Array): list of rule names to enable.
- * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
- *
- * Enable rules with given names. If any rule name not found - throw Error.
- * Errors can be disabled by second param.
- *
- * Returns list of found rule names (if no exception happened).
- *
- * See also [[Ruler.disable]], [[Ruler.enableOnly]].
- **/
-Ruler.prototype.enable = function (list, ignoreInvalid) {
- if (!Array.isArray(list)) { list = [ list ]; }
-
- var result = [];
-
- // Search by name and enable
- list.forEach(function (name) {
- var idx = this.__find__(name);
-
- if (idx < 0) {
- if (ignoreInvalid) { return; }
- throw new Error('Rules manager: invalid rule name ' + name);
- }
- this.__rules__[idx].enabled = true;
- result.push(name);
- }, this);
-
- this.__cache__ = null;
- return result;
-};
-
-
-/**
- * Ruler.enableOnly(list [, ignoreInvalid])
- * - list (String|Array): list of rule names to enable (whitelist).
- * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
- *
- * Enable rules with given names, and disable everything else. If any rule name
- * not found - throw Error. Errors can be disabled by second param.
- *
- * See also [[Ruler.disable]], [[Ruler.enable]].
- **/
-Ruler.prototype.enableOnly = function (list, ignoreInvalid) {
- if (!Array.isArray(list)) { list = [ list ]; }
-
- this.__rules__.forEach(function (rule) { rule.enabled = false; });
-
- this.enable(list, ignoreInvalid);
-};
-
-
-/**
- * Ruler.disable(list [, ignoreInvalid]) -> Array
- * - list (String|Array): list of rule names to disable.
- * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
- *
- * Disable rules with given names. If any rule name not found - throw Error.
- * Errors can be disabled by second param.
- *
- * Returns list of found rule names (if no exception happened).
- *
- * See also [[Ruler.enable]], [[Ruler.enableOnly]].
- **/
-Ruler.prototype.disable = function (list, ignoreInvalid) {
- if (!Array.isArray(list)) { list = [ list ]; }
-
- var result = [];
-
- // Search by name and disable
- list.forEach(function (name) {
- var idx = this.__find__(name);
-
- if (idx < 0) {
- if (ignoreInvalid) { return; }
- throw new Error('Rules manager: invalid rule name ' + name);
- }
- this.__rules__[idx].enabled = false;
- result.push(name);
- }, this);
-
- this.__cache__ = null;
- return result;
-};
-
-
-/**
- * Ruler.getRules(chainName) -> Array
- *
- * Return array of active functions (rules) for given chain name. It analyzes
- * rules configuration, compiles caches if not exists and returns result.
- *
- * Default chain name is `''` (empty string). It can't be skipped. That's
- * done intentionally, to keep signature monomorphic for high speed.
- **/
-Ruler.prototype.getRules = function (chainName) {
- if (this.__cache__ === null) {
- this.__compile__();
- }
+ module.exports = function code(state, startLine, endLine /*, silent*/) {
+ var nextLine, last, token
- // Chain can be empty, if rules disabled. But we still have to return Array.
- return this.__cache__[chainName] || [];
-};
-
-module.exports = Ruler;
-
-},{}],18:[function(require,module,exports){
-// Block quotes
-
-'use strict';
-
-var isSpace = require('../common/utils').isSpace;
-
-
-module.exports = function blockquote(state, startLine, endLine, silent) {
- var adjustTab,
- ch,
- i,
- initial,
- l,
- lastLineEmpty,
- lines,
- nextLine,
- offset,
- oldBMarks,
- oldBSCount,
- oldIndent,
- oldParentType,
- oldSCount,
- oldTShift,
- spaceAfterMarker,
- terminate,
- terminatorRules,
- token,
- isOutdented,
- oldLineMax = state.lineMax,
- pos = state.bMarks[startLine] + state.tShift[startLine],
- max = state.eMarks[startLine];
-
- // if it's indented more than 3 spaces, it should be a code block
- if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
-
- // check the block quote marker
- if (state.src.charCodeAt(pos++) !== 0x3E/* > */) { return false; }
-
- // we know that it's going to be a valid blockquote,
- // so no point trying to find the end of it in silent mode
- if (silent) { return true; }
-
- // set offset past spaces and ">"
- initial = offset = state.sCount[startLine] + 1;
-
- // skip one optional space after '>'
- if (state.src.charCodeAt(pos) === 0x20 /* space */) {
- // ' > test '
- // ^ -- position start of line here:
- pos++;
- initial++;
- offset++;
- adjustTab = false;
- spaceAfterMarker = true;
- } else if (state.src.charCodeAt(pos) === 0x09 /* tab */) {
- spaceAfterMarker = true;
-
- if ((state.bsCount[startLine] + offset) % 4 === 3) {
- // ' >\t test '
- // ^ -- position start of line here (tab has width===1)
- pos++;
- initial++;
- offset++;
- adjustTab = false;
- } else {
- // ' >\t test '
- // ^ -- position start of line here + shift bsCount slightly
- // to make extra space appear
- adjustTab = true;
- }
- } else {
- spaceAfterMarker = false;
- }
+ if (state.sCount[startLine] - state.blkIndent < 4) {
+ return false
+ }
- oldBMarks = [ state.bMarks[startLine] ];
- state.bMarks[startLine] = pos;
+ last = nextLine = startLine + 1
- while (pos < max) {
- ch = state.src.charCodeAt(pos);
+ while (nextLine < endLine) {
+ if (state.isEmpty(nextLine)) {
+ nextLine++
+ continue
+ }
- if (isSpace(ch)) {
- if (ch === 0x09) {
- offset += 4 - (offset + state.bsCount[startLine] + (adjustTab ? 1 : 0)) % 4;
- } else {
- offset++;
- }
- } else {
- break;
- }
+ if (state.sCount[nextLine] - state.blkIndent >= 4) {
+ nextLine++
+ last = nextLine
+ continue
+ }
+ break
+ }
- pos++;
- }
+ state.line = last
- oldBSCount = [ state.bsCount[startLine] ];
- state.bsCount[startLine] = state.sCount[startLine] + 1 + (spaceAfterMarker ? 1 : 0);
-
- lastLineEmpty = pos >= max;
-
- oldSCount = [ state.sCount[startLine] ];
- state.sCount[startLine] = offset - initial;
-
- oldTShift = [ state.tShift[startLine] ];
- state.tShift[startLine] = pos - state.bMarks[startLine];
-
- terminatorRules = state.md.block.ruler.getRules('blockquote');
-
- oldParentType = state.parentType;
- state.parentType = 'blockquote';
-
- // Search the end of the block
- //
- // Block ends with either:
- // 1. an empty line outside:
- // ```
- // > test
- //
- // ```
- // 2. an empty line inside:
- // ```
- // >
- // test
- // ```
- // 3. another tag:
- // ```
- // > test
- // - - -
- // ```
- for (nextLine = startLine + 1; nextLine < endLine; nextLine++) {
- // check if it's outdented, i.e. it's inside list item and indented
- // less than said list item:
- //
- // ```
- // 1. anything
- // > current blockquote
- // 2. checking this line
- // ```
- isOutdented = state.sCount[nextLine] < state.blkIndent;
-
- pos = state.bMarks[nextLine] + state.tShift[nextLine];
- max = state.eMarks[nextLine];
-
- if (pos >= max) {
- // Case 1: line is not inside the blockquote, and this line is empty.
- break;
- }
+ token = state.push('code_block', 'code', 0)
+ token.content = state.getLines(startLine, last, 4 + state.blkIndent, true)
+ token.map = [startLine, state.line]
- if (state.src.charCodeAt(pos++) === 0x3E/* > */ && !isOutdented) {
- // This line is inside the blockquote.
-
- // set offset past spaces and ">"
- initial = offset = state.sCount[nextLine] + 1;
-
- // skip one optional space after '>'
- if (state.src.charCodeAt(pos) === 0x20 /* space */) {
- // ' > test '
- // ^ -- position start of line here:
- pos++;
- initial++;
- offset++;
- adjustTab = false;
- spaceAfterMarker = true;
- } else if (state.src.charCodeAt(pos) === 0x09 /* tab */) {
- spaceAfterMarker = true;
-
- if ((state.bsCount[nextLine] + offset) % 4 === 3) {
- // ' >\t test '
- // ^ -- position start of line here (tab has width===1)
- pos++;
- initial++;
- offset++;
- adjustTab = false;
- } else {
- // ' >\t test '
- // ^ -- position start of line here + shift bsCount slightly
- // to make extra space appear
- adjustTab = true;
- }
- } else {
- spaceAfterMarker = false;
- }
+ return true
+ }
+ },
+ {},
+ ],
+ 20: [
+ function (require, module, exports) {
+ // fences (``` lang, ~~~ lang)
+
+ 'use strict'
+
+ module.exports = function fence(state, startLine, endLine, silent) {
+ var marker,
+ len,
+ params,
+ nextLine,
+ mem,
+ token,
+ markup,
+ haveEndMarker = false,
+ pos = state.bMarks[startLine] + state.tShift[startLine],
+ max = state.eMarks[startLine]
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false
+ }
- oldBMarks.push(state.bMarks[nextLine]);
- state.bMarks[nextLine] = pos;
+ if (pos + 3 > max) {
+ return false
+ }
- while (pos < max) {
- ch = state.src.charCodeAt(pos);
+ marker = state.src.charCodeAt(pos)
- if (isSpace(ch)) {
- if (ch === 0x09) {
- offset += 4 - (offset + state.bsCount[nextLine] + (adjustTab ? 1 : 0)) % 4;
- } else {
- offset++;
- }
- } else {
- break;
- }
+ if (marker !== 0x7e /* ~ */ && marker !== 0x60 /* ` */) {
+ return false
+ }
- pos++;
- }
+ // scan marker length
+ mem = pos
+ pos = state.skipChars(pos, marker)
- lastLineEmpty = pos >= max;
+ len = pos - mem
- oldBSCount.push(state.bsCount[nextLine]);
- state.bsCount[nextLine] = state.sCount[nextLine] + 1 + (spaceAfterMarker ? 1 : 0);
+ if (len < 3) {
+ return false
+ }
- oldSCount.push(state.sCount[nextLine]);
- state.sCount[nextLine] = offset - initial;
+ markup = state.src.slice(mem, pos)
+ params = state.src.slice(pos, max)
- oldTShift.push(state.tShift[nextLine]);
- state.tShift[nextLine] = pos - state.bMarks[nextLine];
- continue;
- }
+ if (marker === 0x60 /* ` */) {
+ if (params.indexOf(String.fromCharCode(marker)) >= 0) {
+ return false
+ }
+ }
- // Case 2: line is not inside the blockquote, and the last line was empty.
- if (lastLineEmpty) { break; }
+ // Since start is found, we can report success here in validation mode
+ if (silent) {
+ return true
+ }
- // Case 3: another tag found.
- terminate = false;
- for (i = 0, l = terminatorRules.length; i < l; i++) {
- if (terminatorRules[i](state, nextLine, endLine, true)) {
- terminate = true;
- break;
- }
- }
+ // search end of block
+ nextLine = startLine
+
+ for (;;) {
+ nextLine++
+ if (nextLine >= endLine) {
+ // unclosed block should be autoclosed by end of document.
+ // also block seems to be autoclosed by end of parent
+ break
+ }
+
+ pos = mem = state.bMarks[nextLine] + state.tShift[nextLine]
+ max = state.eMarks[nextLine]
+
+ if (pos < max && state.sCount[nextLine] < state.blkIndent) {
+ // non-empty line with negative indent should stop the list:
+ // - ```
+ // test
+ break
+ }
+
+ if (state.src.charCodeAt(pos) !== marker) {
+ continue
+ }
+
+ if (state.sCount[nextLine] - state.blkIndent >= 4) {
+ // closing fence should be indented less than 4 spaces
+ continue
+ }
+
+ pos = state.skipChars(pos, marker)
+
+ // closing code fence must be at least as long as the opening one
+ if (pos - mem < len) {
+ continue
+ }
+
+ // make sure tail has spaces only
+ pos = state.skipSpaces(pos)
+
+ if (pos < max) {
+ continue
+ }
+
+ haveEndMarker = true
+ // found!
+ break
+ }
- if (terminate) {
- // Quirk to enforce "hard termination mode" for paragraphs;
- // normally if you call `tokenize(state, startLine, nextLine)`,
- // paragraphs will look below nextLine for paragraph continuation,
- // but if blockquote is terminated by another tag, they shouldn't
- state.lineMax = nextLine;
-
- if (state.blkIndent !== 0) {
- // state.blkIndent was non-zero, we now set it to zero,
- // so we need to re-calculate all offsets to appear as
- // if indent wasn't changed
- oldBMarks.push(state.bMarks[nextLine]);
- oldBSCount.push(state.bsCount[nextLine]);
- oldTShift.push(state.tShift[nextLine]);
- oldSCount.push(state.sCount[nextLine]);
- state.sCount[nextLine] -= state.blkIndent;
- }
+ // If a fence has heading spaces, they should be removed from its inner block
+ len = state.sCount[startLine]
- break;
- }
+ state.line = nextLine + (haveEndMarker ? 1 : 0)
- oldBMarks.push(state.bMarks[nextLine]);
- oldBSCount.push(state.bsCount[nextLine]);
- oldTShift.push(state.tShift[nextLine]);
- oldSCount.push(state.sCount[nextLine]);
+ token = state.push('fence', 'code', 0)
+ token.info = params
+ token.content = state.getLines(startLine + 1, nextLine, len, true)
+ token.markup = markup
+ token.map = [startLine, state.line]
- // A negative indentation means that this is a paragraph continuation
- //
- state.sCount[nextLine] = -1;
- }
+ return true
+ }
+ },
+ {},
+ ],
+ 21: [
+ function (require, module, exports) {
+ // heading (#, ##, ...)
- oldIndent = state.blkIndent;
- state.blkIndent = 0;
+ 'use strict'
- token = state.push('blockquote_open', 'blockquote', 1);
- token.markup = '>';
- token.map = lines = [ startLine, 0 ];
+ var isSpace = require('../common/utils').isSpace
- state.md.block.tokenize(state, startLine, nextLine);
+ module.exports = function heading(state, startLine, endLine, silent) {
+ var ch,
+ level,
+ tmp,
+ token,
+ pos = state.bMarks[startLine] + state.tShift[startLine],
+ max = state.eMarks[startLine]
- token = state.push('blockquote_close', 'blockquote', -1);
- token.markup = '>';
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false
+ }
- state.lineMax = oldLineMax;
- state.parentType = oldParentType;
- lines[1] = state.line;
+ ch = state.src.charCodeAt(pos)
- // Restore original tShift; this might not be necessary since the parser
- // has already been here, but just to make sure we can do that.
- for (i = 0; i < oldTShift.length; i++) {
- state.bMarks[i + startLine] = oldBMarks[i];
- state.tShift[i + startLine] = oldTShift[i];
- state.sCount[i + startLine] = oldSCount[i];
- state.bsCount[i + startLine] = oldBSCount[i];
- }
- state.blkIndent = oldIndent;
+ if (ch !== 0x23 /* # */ || pos >= max) {
+ return false
+ }
- return true;
-};
+ // count heading level
+ level = 1
+ ch = state.src.charCodeAt(++pos)
+ while (ch === 0x23 /* # */ && pos < max && level <= 6) {
+ level++
+ ch = state.src.charCodeAt(++pos)
+ }
-},{"../common/utils":4}],19:[function(require,module,exports){
-// Code block (4 spaces padded)
+ if (level > 6 || (pos < max && !isSpace(ch))) {
+ return false
+ }
-'use strict';
+ if (silent) {
+ return true
+ }
+ // Let's cut tails like ' ### ' from the end of string
-module.exports = function code(state, startLine, endLine/*, silent*/) {
- var nextLine, last, token;
+ max = state.skipSpacesBack(max, pos)
+ tmp = state.skipCharsBack(max, 0x23, pos) // #
+ if (tmp > pos && isSpace(state.src.charCodeAt(tmp - 1))) {
+ max = tmp
+ }
- if (state.sCount[startLine] - state.blkIndent < 4) { return false; }
+ state.line = startLine + 1
- last = nextLine = startLine + 1;
+ token = state.push('heading_open', 'h' + String(level), 1)
+ token.markup = '########'.slice(0, level)
+ token.map = [startLine, state.line]
- while (nextLine < endLine) {
- if (state.isEmpty(nextLine)) {
- nextLine++;
- continue;
- }
+ token = state.push('inline', '', 0)
+ token.content = state.src.slice(pos, max).trim()
+ token.map = [startLine, state.line]
+ token.children = []
- if (state.sCount[nextLine] - state.blkIndent >= 4) {
- nextLine++;
- last = nextLine;
- continue;
- }
- break;
- }
+ token = state.push('heading_close', 'h' + String(level), -1)
+ token.markup = '########'.slice(0, level)
- state.line = last;
+ return true
+ }
+ },
+ { '../common/utils': 4 },
+ ],
+ 22: [
+ function (require, module, exports) {
+ // Horizontal rule
- token = state.push('code_block', 'code', 0);
- token.content = state.getLines(startLine, last, 4 + state.blkIndent, true);
- token.map = [ startLine, state.line ];
+ 'use strict'
- return true;
-};
+ var isSpace = require('../common/utils').isSpace
-},{}],20:[function(require,module,exports){
-// fences (``` lang, ~~~ lang)
+ module.exports = function hr(state, startLine, endLine, silent) {
+ var marker,
+ cnt,
+ ch,
+ token,
+ pos = state.bMarks[startLine] + state.tShift[startLine],
+ max = state.eMarks[startLine]
-'use strict';
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false
+ }
+ marker = state.src.charCodeAt(pos++)
-module.exports = function fence(state, startLine, endLine, silent) {
- var marker, len, params, nextLine, mem, token, markup,
- haveEndMarker = false,
- pos = state.bMarks[startLine] + state.tShift[startLine],
- max = state.eMarks[startLine];
+ // Check hr marker
+ if (marker !== 0x2a /* * */ && marker !== 0x2d /* - */ && marker !== 0x5f /* _ */) {
+ return false
+ }
- // if it's indented more than 3 spaces, it should be a code block
- if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+ // markers can be mixed with spaces, but there should be at least 3 of them
+
+ cnt = 1
+ while (pos < max) {
+ ch = state.src.charCodeAt(pos++)
+ if (ch !== marker && !isSpace(ch)) {
+ return false
+ }
+ if (ch === marker) {
+ cnt++
+ }
+ }
- if (pos + 3 > max) { return false; }
+ if (cnt < 3) {
+ return false
+ }
- marker = state.src.charCodeAt(pos);
+ if (silent) {
+ return true
+ }
- if (marker !== 0x7E/* ~ */ && marker !== 0x60 /* ` */) {
- return false;
- }
+ state.line = startLine + 1
- // scan marker length
- mem = pos;
- pos = state.skipChars(pos, marker);
+ token = state.push('hr', 'hr', 0)
+ token.map = [startLine, state.line]
+ token.markup = Array(cnt + 1).join(String.fromCharCode(marker))
- len = pos - mem;
+ return true
+ }
+ },
+ { '../common/utils': 4 },
+ ],
+ 23: [
+ function (require, module, exports) {
+ // HTML block
- if (len < 3) { return false; }
+ 'use strict'
- markup = state.src.slice(mem, pos);
- params = state.src.slice(pos, max);
+ var block_names = require('../common/html_blocks')
+ var HTML_OPEN_CLOSE_TAG_RE = require('../common/html_re').HTML_OPEN_CLOSE_TAG_RE
- if (marker === 0x60 /* ` */) {
- if (params.indexOf(String.fromCharCode(marker)) >= 0) {
- return false;
- }
- }
+ // An array of opening and corresponding closing sequences for html tags,
+ // last argument defines whether it can terminate a paragraph or not
+ //
+ var HTML_SEQUENCES = [
+ [/^<(script|pre|style)(?=(\s|>|$))/i, /<\/(script|pre|style)>/i, true],
+ [/^/, true],
+ [/^<\?/, /\?>/, true],
+ [/^/, true],
+ [/^/, true],
+ [new RegExp('^|$))', 'i'), /^$/, true],
+ [new RegExp(HTML_OPEN_CLOSE_TAG_RE.source + '\\s*$'), /^$/, false],
+ ]
+
+ module.exports = function html_block(state, startLine, endLine, silent) {
+ var i,
+ nextLine,
+ token,
+ lineText,
+ pos = state.bMarks[startLine] + state.tShift[startLine],
+ max = state.eMarks[startLine]
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false
+ }
- // Since start is found, we can report success here in validation mode
- if (silent) { return true; }
+ if (!state.md.options.html) {
+ return false
+ }
- // search end of block
- nextLine = startLine;
+ if (state.src.charCodeAt(pos) !== 0x3c /* < */) {
+ return false
+ }
- for (;;) {
- nextLine++;
- if (nextLine >= endLine) {
- // unclosed block should be autoclosed by end of document.
- // also block seems to be autoclosed by end of parent
- break;
- }
+ lineText = state.src.slice(pos, max)
- pos = mem = state.bMarks[nextLine] + state.tShift[nextLine];
- max = state.eMarks[nextLine];
+ for (i = 0; i < HTML_SEQUENCES.length; i++) {
+ if (HTML_SEQUENCES[i][0].test(lineText)) {
+ break
+ }
+ }
- if (pos < max && state.sCount[nextLine] < state.blkIndent) {
- // non-empty line with negative indent should stop the list:
- // - ```
- // test
- break;
- }
+ if (i === HTML_SEQUENCES.length) {
+ return false
+ }
- if (state.src.charCodeAt(pos) !== marker) { continue; }
+ if (silent) {
+ // true if this sequence can be a terminator, false otherwise
+ return HTML_SEQUENCES[i][2]
+ }
- if (state.sCount[nextLine] - state.blkIndent >= 4) {
- // closing fence should be indented less than 4 spaces
- continue;
- }
+ nextLine = startLine + 1
+
+ // If we are here - we detected HTML block.
+ // Let's roll down till block end.
+ if (!HTML_SEQUENCES[i][1].test(lineText)) {
+ for (; nextLine < endLine; nextLine++) {
+ if (state.sCount[nextLine] < state.blkIndent) {
+ break
+ }
+
+ pos = state.bMarks[nextLine] + state.tShift[nextLine]
+ max = state.eMarks[nextLine]
+ lineText = state.src.slice(pos, max)
+
+ if (HTML_SEQUENCES[i][1].test(lineText)) {
+ if (lineText.length !== 0) {
+ nextLine++
+ }
+ break
+ }
+ }
+ }
- pos = state.skipChars(pos, marker);
+ state.line = nextLine
- // closing code fence must be at least as long as the opening one
- if (pos - mem < len) { continue; }
+ token = state.push('html_block', '', 0)
+ token.map = [startLine, nextLine]
+ token.content = state.getLines(startLine, nextLine, state.blkIndent, true)
- // make sure tail has spaces only
- pos = state.skipSpaces(pos);
+ return true
+ }
+ },
+ { '../common/html_blocks': 2, '../common/html_re': 3 },
+ ],
+ 24: [
+ function (require, module, exports) {
+ // lheading (---, ===)
+
+ 'use strict'
+
+ module.exports = function lheading(state, startLine, endLine /*, silent*/) {
+ var content,
+ terminate,
+ i,
+ l,
+ token,
+ pos,
+ max,
+ level,
+ marker,
+ nextLine = startLine + 1,
+ oldParentType,
+ terminatorRules = state.md.block.ruler.getRules('paragraph')
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false
+ }
- if (pos < max) { continue; }
+ oldParentType = state.parentType
+ state.parentType = 'paragraph' // use paragraph to match terminatorRules
+
+ // jump line-by-line until empty one or EOF
+ for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
+ // this would be a code block normally, but after paragraph
+ // it's considered a lazy continuation regardless of what's there
+ if (state.sCount[nextLine] - state.blkIndent > 3) {
+ continue
+ }
+
+ //
+ // Check for underline in setext header
+ //
+ if (state.sCount[nextLine] >= state.blkIndent) {
+ pos = state.bMarks[nextLine] + state.tShift[nextLine]
+ max = state.eMarks[nextLine]
+
+ if (pos < max) {
+ marker = state.src.charCodeAt(pos)
+
+ if (marker === 0x2d /* - */ || marker === 0x3d /* = */) {
+ pos = state.skipChars(pos, marker)
+ pos = state.skipSpaces(pos)
+
+ if (pos >= max) {
+ level = marker === 0x3d /* = */ ? 1 : 2
+ break
+ }
+ }
+ }
+ }
+
+ // quirk for blockquotes, this line should already be checked by that rule
+ if (state.sCount[nextLine] < 0) {
+ continue
+ }
+
+ // Some tags can terminate paragraph without empty line.
+ terminate = false
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true
+ break
+ }
+ }
+ if (terminate) {
+ break
+ }
+ }
- haveEndMarker = true;
- // found!
- break;
- }
+ if (!level) {
+ // Didn't find valid underline
+ return false
+ }
- // If a fence has heading spaces, they should be removed from its inner block
- len = state.sCount[startLine];
+ content = state.getLines(startLine, nextLine, state.blkIndent, false).trim()
- state.line = nextLine + (haveEndMarker ? 1 : 0);
+ state.line = nextLine + 1
- token = state.push('fence', 'code', 0);
- token.info = params;
- token.content = state.getLines(startLine + 1, nextLine, len, true);
- token.markup = markup;
- token.map = [ startLine, state.line ];
+ token = state.push('heading_open', 'h' + String(level), 1)
+ token.markup = String.fromCharCode(marker)
+ token.map = [startLine, state.line]
- return true;
-};
+ token = state.push('inline', '', 0)
+ token.content = content
+ token.map = [startLine, state.line - 1]
+ token.children = []
-},{}],21:[function(require,module,exports){
-// heading (#, ##, ...)
+ token = state.push('heading_close', 'h' + String(level), -1)
+ token.markup = String.fromCharCode(marker)
-'use strict';
+ state.parentType = oldParentType
-var isSpace = require('../common/utils').isSpace;
+ return true
+ }
+ },
+ {},
+ ],
+ 25: [
+ function (require, module, exports) {
+ // Lists
+ 'use strict'
-module.exports = function heading(state, startLine, endLine, silent) {
- var ch, level, tmp, token,
- pos = state.bMarks[startLine] + state.tShift[startLine],
- max = state.eMarks[startLine];
+ var isSpace = require('../common/utils').isSpace
- // if it's indented more than 3 spaces, it should be a code block
- if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+ // Search `[-+*][\n ]`, returns next pos after marker on success
+ // or -1 on fail.
+ function skipBulletListMarker(state, startLine) {
+ var marker, pos, max, ch
- ch = state.src.charCodeAt(pos);
+ pos = state.bMarks[startLine] + state.tShift[startLine]
+ max = state.eMarks[startLine]
- if (ch !== 0x23/* # */ || pos >= max) { return false; }
+ marker = state.src.charCodeAt(pos++)
+ // Check bullet
+ if (marker !== 0x2a /* * */ && marker !== 0x2d /* - */ && marker !== 0x2b /* + */) {
+ return -1
+ }
- // count heading level
- level = 1;
- ch = state.src.charCodeAt(++pos);
- while (ch === 0x23/* # */ && pos < max && level <= 6) {
- level++;
- ch = state.src.charCodeAt(++pos);
- }
+ if (pos < max) {
+ ch = state.src.charCodeAt(pos)
- if (level > 6 || (pos < max && !isSpace(ch))) { return false; }
+ if (!isSpace(ch)) {
+ // " -test " - is not a list item
+ return -1
+ }
+ }
- if (silent) { return true; }
+ return pos
+ }
- // Let's cut tails like ' ### ' from the end of string
+ // Search `\d+[.)][\n ]`, returns next pos after marker on success
+ // or -1 on fail.
+ function skipOrderedListMarker(state, startLine) {
+ var ch,
+ start = state.bMarks[startLine] + state.tShift[startLine],
+ pos = start,
+ max = state.eMarks[startLine]
+
+ // List marker should have at least 2 chars (digit + dot)
+ if (pos + 1 >= max) {
+ return -1
+ }
- max = state.skipSpacesBack(max, pos);
- tmp = state.skipCharsBack(max, 0x23, pos); // #
- if (tmp > pos && isSpace(state.src.charCodeAt(tmp - 1))) {
- max = tmp;
- }
+ ch = state.src.charCodeAt(pos++)
- state.line = startLine + 1;
+ if (ch < 0x30 /* 0 */ || ch > 0x39 /* 9 */) {
+ return -1
+ }
- token = state.push('heading_open', 'h' + String(level), 1);
- token.markup = '########'.slice(0, level);
- token.map = [ startLine, state.line ];
+ for (;;) {
+ // EOL -> fail
+ if (pos >= max) {
+ return -1
+ }
- token = state.push('inline', '', 0);
- token.content = state.src.slice(pos, max).trim();
- token.map = [ startLine, state.line ];
- token.children = [];
+ ch = state.src.charCodeAt(pos++)
- token = state.push('heading_close', 'h' + String(level), -1);
- token.markup = '########'.slice(0, level);
+ if (ch >= 0x30 /* 0 */ && ch <= 0x39 /* 9 */) {
+ // List marker should have no more than 9 digits
+ // (prevents integer overflow in browsers)
+ if (pos - start >= 10) {
+ return -1
+ }
- return true;
-};
+ continue
+ }
-},{"../common/utils":4}],22:[function(require,module,exports){
-// Horizontal rule
+ // found valid marker
+ if (ch === 0x29 /* ) */ || ch === 0x2e /* . */) {
+ break
+ }
-'use strict';
+ return -1
+ }
-var isSpace = require('../common/utils').isSpace;
+ if (pos < max) {
+ ch = state.src.charCodeAt(pos)
+ if (!isSpace(ch)) {
+ // " 1.test " - is not a list item
+ return -1
+ }
+ }
+ return pos
+ }
-module.exports = function hr(state, startLine, endLine, silent) {
- var marker, cnt, ch, token,
- pos = state.bMarks[startLine] + state.tShift[startLine],
- max = state.eMarks[startLine];
+ function markTightParagraphs(state, idx) {
+ var i,
+ l,
+ level = state.level + 2
+
+ for (i = idx + 2, l = state.tokens.length - 2; i < l; i++) {
+ if (state.tokens[i].level === level && state.tokens[i].type === 'paragraph_open') {
+ state.tokens[i + 2].hidden = true
+ state.tokens[i].hidden = true
+ i += 2
+ }
+ }
+ }
- // if it's indented more than 3 spaces, it should be a code block
- if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+ module.exports = function list(state, startLine, endLine, silent) {
+ var ch,
+ contentStart,
+ i,
+ indent,
+ indentAfterMarker,
+ initial,
+ isOrdered,
+ itemLines,
+ l,
+ listLines,
+ listTokIdx,
+ markerCharCode,
+ markerValue,
+ max,
+ nextLine,
+ offset,
+ oldListIndent,
+ oldParentType,
+ oldSCount,
+ oldTShift,
+ oldTight,
+ pos,
+ posAfterMarker,
+ prevEmptyEnd,
+ start,
+ terminate,
+ terminatorRules,
+ token,
+ isTerminatingParagraph = false,
+ tight = true
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false
+ }
- marker = state.src.charCodeAt(pos++);
+ // Special case:
+ // - item 1
+ // - item 2
+ // - item 3
+ // - item 4
+ // - this one is a paragraph continuation
+ if (
+ state.listIndent >= 0 &&
+ state.sCount[startLine] - state.listIndent >= 4 &&
+ state.sCount[startLine] < state.blkIndent
+ ) {
+ return false
+ }
- // Check hr marker
- if (marker !== 0x2A/* * */ &&
- marker !== 0x2D/* - */ &&
- marker !== 0x5F/* _ */) {
- return false;
- }
+ // limit conditions when list can interrupt
+ // a paragraph (validation mode only)
+ if (silent && state.parentType === 'paragraph') {
+ // Next list item should still terminate previous list item;
+ //
+ // This code can fail if plugins use blkIndent as well as lists,
+ // but I hope the spec gets fixed long before that happens.
+ //
+ if (state.tShift[startLine] >= state.blkIndent) {
+ isTerminatingParagraph = true
+ }
+ }
- // markers can be mixed with spaces, but there should be at least 3 of them
+ // Detect list type and position after marker
+ if ((posAfterMarker = skipOrderedListMarker(state, startLine)) >= 0) {
+ isOrdered = true
+ start = state.bMarks[startLine] + state.tShift[startLine]
+ markerValue = Number(state.src.substr(start, posAfterMarker - start - 1))
+
+ // If we're starting a new ordered list right after
+ // a paragraph, it should start with 1.
+ if (isTerminatingParagraph && markerValue !== 1) return false
+ } else if ((posAfterMarker = skipBulletListMarker(state, startLine)) >= 0) {
+ isOrdered = false
+ } else {
+ return false
+ }
- cnt = 1;
- while (pos < max) {
- ch = state.src.charCodeAt(pos++);
- if (ch !== marker && !isSpace(ch)) { return false; }
- if (ch === marker) { cnt++; }
- }
+ // If we're starting a new unordered list right after
+ // a paragraph, first line should not be empty.
+ if (isTerminatingParagraph) {
+ if (state.skipSpaces(posAfterMarker) >= state.eMarks[startLine]) return false
+ }
- if (cnt < 3) { return false; }
+ // We should terminate list on style change. Remember first one to compare.
+ markerCharCode = state.src.charCodeAt(posAfterMarker - 1)
- if (silent) { return true; }
+ // For validation mode we can terminate immediately
+ if (silent) {
+ return true
+ }
- state.line = startLine + 1;
+ // Start list
+ listTokIdx = state.tokens.length
- token = state.push('hr', 'hr', 0);
- token.map = [ startLine, state.line ];
- token.markup = Array(cnt + 1).join(String.fromCharCode(marker));
+ if (isOrdered) {
+ token = state.push('ordered_list_open', 'ol', 1)
+ if (markerValue !== 1) {
+ token.attrs = [['start', markerValue]]
+ }
+ } else {
+ token = state.push('bullet_list_open', 'ul', 1)
+ }
- return true;
-};
+ token.map = listLines = [startLine, 0]
+ token.markup = String.fromCharCode(markerCharCode)
+
+ //
+ // Iterate list items
+ //
+
+ nextLine = startLine
+ prevEmptyEnd = false
+ terminatorRules = state.md.block.ruler.getRules('list')
+
+ oldParentType = state.parentType
+ state.parentType = 'list'
+
+ while (nextLine < endLine) {
+ pos = posAfterMarker
+ max = state.eMarks[nextLine]
+
+ initial = offset =
+ state.sCount[nextLine] + posAfterMarker - (state.bMarks[startLine] + state.tShift[startLine])
+
+ while (pos < max) {
+ ch = state.src.charCodeAt(pos)
+
+ if (ch === 0x09) {
+ offset += 4 - ((offset + state.bsCount[nextLine]) % 4)
+ } else if (ch === 0x20) {
+ offset++
+ } else {
+ break
+ }
+
+ pos++
+ }
+
+ contentStart = pos
+
+ if (contentStart >= max) {
+ // trimming space in "- \n 3" case, indent is 1 here
+ indentAfterMarker = 1
+ } else {
+ indentAfterMarker = offset - initial
+ }
+
+ // If we have more than 4 spaces, the indent is 1
+ // (the rest is just indented code block)
+ if (indentAfterMarker > 4) {
+ indentAfterMarker = 1
+ }
+
+ // " - test"
+ // ^^^^^ - calculating total length of this thing
+ indent = initial + indentAfterMarker
+
+ // Run subparser & write tokens
+ token = state.push('list_item_open', 'li', 1)
+ token.markup = String.fromCharCode(markerCharCode)
+ token.map = itemLines = [startLine, 0]
+
+ // change current state, then restore it after parser subcall
+ oldTight = state.tight
+ oldTShift = state.tShift[startLine]
+ oldSCount = state.sCount[startLine]
+
+ // - example list
+ // ^ listIndent position will be here
+ // ^ blkIndent position will be here
+ //
+ oldListIndent = state.listIndent
+ state.listIndent = state.blkIndent
+ state.blkIndent = indent
+
+ state.tight = true
+ state.tShift[startLine] = contentStart - state.bMarks[startLine]
+ state.sCount[startLine] = offset
+
+ if (contentStart >= max && state.isEmpty(startLine + 1)) {
+ // workaround for this case
+ // (list item is empty, list terminates before "foo"):
+ // ~~~~~~~~
+ // -
+ //
+ // foo
+ // ~~~~~~~~
+ state.line = Math.min(state.line + 2, endLine)
+ } else {
+ state.md.block.tokenize(state, startLine, endLine, true)
+ }
+
+ // If any of list item is tight, mark list as tight
+ if (!state.tight || prevEmptyEnd) {
+ tight = false
+ }
+ // Item become loose if finish with empty line,
+ // but we should filter last element, because it means list finish
+ prevEmptyEnd = state.line - startLine > 1 && state.isEmpty(state.line - 1)
+
+ state.blkIndent = state.listIndent
+ state.listIndent = oldListIndent
+ state.tShift[startLine] = oldTShift
+ state.sCount[startLine] = oldSCount
+ state.tight = oldTight
+
+ token = state.push('list_item_close', 'li', -1)
+ token.markup = String.fromCharCode(markerCharCode)
+
+ nextLine = startLine = state.line
+ itemLines[1] = nextLine
+ contentStart = state.bMarks[startLine]
+
+ if (nextLine >= endLine) {
+ break
+ }
+
+ //
+ // Try to check if list is terminated or continued.
+ //
+ if (state.sCount[nextLine] < state.blkIndent) {
+ break
+ }
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ break
+ }
+
+ // fail if terminating block found
+ terminate = false
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true
+ break
+ }
+ }
+ if (terminate) {
+ break
+ }
+
+ // fail if list has another type
+ if (isOrdered) {
+ posAfterMarker = skipOrderedListMarker(state, nextLine)
+ if (posAfterMarker < 0) {
+ break
+ }
+ } else {
+ posAfterMarker = skipBulletListMarker(state, nextLine)
+ if (posAfterMarker < 0) {
+ break
+ }
+ }
+
+ if (markerCharCode !== state.src.charCodeAt(posAfterMarker - 1)) {
+ break
+ }
+ }
-},{"../common/utils":4}],23:[function(require,module,exports){
-// HTML block
+ // Finalize list
+ if (isOrdered) {
+ token = state.push('ordered_list_close', 'ol', -1)
+ } else {
+ token = state.push('bullet_list_close', 'ul', -1)
+ }
+ token.markup = String.fromCharCode(markerCharCode)
-'use strict';
+ listLines[1] = nextLine
+ state.line = nextLine
+ state.parentType = oldParentType
-var block_names = require('../common/html_blocks');
-var HTML_OPEN_CLOSE_TAG_RE = require('../common/html_re').HTML_OPEN_CLOSE_TAG_RE;
+ // mark paragraphs tight if needed
+ if (tight) {
+ markTightParagraphs(state, listTokIdx)
+ }
-// An array of opening and corresponding closing sequences for html tags,
-// last argument defines whether it can terminate a paragraph or not
-//
-var HTML_SEQUENCES = [
- [ /^<(script|pre|style)(?=(\s|>|$))/i, /<\/(script|pre|style)>/i, true ],
- [ /^/, true ],
- [ /^<\?/, /\?>/, true ],
- [ /^/, true ],
- [ /^/, true ],
- [ new RegExp('^|$))', 'i'), /^$/, true ],
- [ new RegExp(HTML_OPEN_CLOSE_TAG_RE.source + '\\s*$'), /^$/, false ]
-];
+ return true
+ }
+ },
+ { '../common/utils': 4 },
+ ],
+ 26: [
+ function (require, module, exports) {
+ // Paragraph
+
+ 'use strict'
+
+ module.exports = function paragraph(state, startLine /*, endLine*/) {
+ var content,
+ terminate,
+ i,
+ l,
+ token,
+ oldParentType,
+ nextLine = startLine + 1,
+ terminatorRules = state.md.block.ruler.getRules('paragraph'),
+ endLine = state.lineMax
+
+ oldParentType = state.parentType
+ state.parentType = 'paragraph'
+
+ // jump line-by-line until empty one or EOF
+ for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
+ // this would be a code block normally, but after paragraph
+ // it's considered a lazy continuation regardless of what's there
+ if (state.sCount[nextLine] - state.blkIndent > 3) {
+ continue
+ }
+
+ // quirk for blockquotes, this line should already be checked by that rule
+ if (state.sCount[nextLine] < 0) {
+ continue
+ }
+
+ // Some tags can terminate paragraph without empty line.
+ terminate = false
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true
+ break
+ }
+ }
+ if (terminate) {
+ break
+ }
+ }
+ content = state.getLines(startLine, nextLine, state.blkIndent, false).trim()
-module.exports = function html_block(state, startLine, endLine, silent) {
- var i, nextLine, token, lineText,
- pos = state.bMarks[startLine] + state.tShift[startLine],
- max = state.eMarks[startLine];
+ state.line = nextLine
- // if it's indented more than 3 spaces, it should be a code block
- if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+ token = state.push('paragraph_open', 'p', 1)
+ token.map = [startLine, state.line]
- if (!state.md.options.html) { return false; }
+ token = state.push('inline', '', 0)
+ token.content = content
+ token.map = [startLine, state.line]
+ token.children = []
- if (state.src.charCodeAt(pos) !== 0x3C/* < */) { return false; }
+ token = state.push('paragraph_close', 'p', -1)
- lineText = state.src.slice(pos, max);
+ state.parentType = oldParentType
- for (i = 0; i < HTML_SEQUENCES.length; i++) {
- if (HTML_SEQUENCES[i][0].test(lineText)) { break; }
- }
+ return true
+ }
+ },
+ {},
+ ],
+ 27: [
+ function (require, module, exports) {
+ 'use strict'
+
+ var normalizeReference = require('../common/utils').normalizeReference
+ var isSpace = require('../common/utils').isSpace
+
+ module.exports = function reference(state, startLine, _endLine, silent) {
+ var ch,
+ destEndPos,
+ destEndLineNo,
+ endLine,
+ href,
+ i,
+ l,
+ label,
+ labelEnd,
+ oldParentType,
+ res,
+ start,
+ str,
+ terminate,
+ terminatorRules,
+ title,
+ lines = 0,
+ pos = state.bMarks[startLine] + state.tShift[startLine],
+ max = state.eMarks[startLine],
+ nextLine = startLine + 1
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false
+ }
- if (i === HTML_SEQUENCES.length) { return false; }
+ if (state.src.charCodeAt(pos) !== 0x5b /* [ */) {
+ return false
+ }
- if (silent) {
- // true if this sequence can be a terminator, false otherwise
- return HTML_SEQUENCES[i][2];
- }
+ // Simple check to quickly interrupt scan on [link](url) at the start of line.
+ // Can be useful on practice: https://github.com/markdown-it/markdown-it/issues/54
+ while (++pos < max) {
+ if (state.src.charCodeAt(pos) === 0x5d /* ] */ && state.src.charCodeAt(pos - 1) !== 0x5c /* \ */) {
+ if (pos + 1 === max) {
+ return false
+ }
+ if (state.src.charCodeAt(pos + 1) !== 0x3a /* : */) {
+ return false
+ }
+ break
+ }
+ }
- nextLine = startLine + 1;
+ endLine = state.lineMax
+
+ // jump line-by-line until empty one or EOF
+ terminatorRules = state.md.block.ruler.getRules('reference')
+
+ oldParentType = state.parentType
+ state.parentType = 'reference'
+
+ for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
+ // this would be a code block normally, but after paragraph
+ // it's considered a lazy continuation regardless of what's there
+ if (state.sCount[nextLine] - state.blkIndent > 3) {
+ continue
+ }
+
+ // quirk for blockquotes, this line should already be checked by that rule
+ if (state.sCount[nextLine] < 0) {
+ continue
+ }
+
+ // Some tags can terminate paragraph without empty line.
+ terminate = false
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true
+ break
+ }
+ }
+ if (terminate) {
+ break
+ }
+ }
- // If we are here - we detected HTML block.
- // Let's roll down till block end.
- if (!HTML_SEQUENCES[i][1].test(lineText)) {
- for (; nextLine < endLine; nextLine++) {
- if (state.sCount[nextLine] < state.blkIndent) { break; }
+ str = state.getLines(startLine, nextLine, state.blkIndent, false).trim()
+ max = str.length
+
+ for (pos = 1; pos < max; pos++) {
+ ch = str.charCodeAt(pos)
+ if (ch === 0x5b /* [ */) {
+ return false
+ } else if (ch === 0x5d /* ] */) {
+ labelEnd = pos
+ break
+ } else if (ch === 0x0a /* \n */) {
+ lines++
+ } else if (ch === 0x5c /* \ */) {
+ pos++
+ if (pos < max && str.charCodeAt(pos) === 0x0a) {
+ lines++
+ }
+ }
+ }
- pos = state.bMarks[nextLine] + state.tShift[nextLine];
- max = state.eMarks[nextLine];
- lineText = state.src.slice(pos, max);
+ if (labelEnd < 0 || str.charCodeAt(labelEnd + 1) !== 0x3a /* : */) {
+ return false
+ }
- if (HTML_SEQUENCES[i][1].test(lineText)) {
- if (lineText.length !== 0) { nextLine++; }
- break;
- }
- }
- }
+ // [label]: destination 'title'
+ // ^^^ skip optional whitespace here
+ for (pos = labelEnd + 2; pos < max; pos++) {
+ ch = str.charCodeAt(pos)
+ if (ch === 0x0a) {
+ lines++
+ } else if (isSpace(ch)) {
+ /*eslint no-empty:0*/
+ } else {
+ break
+ }
+ }
- state.line = nextLine;
+ // [label]: destination 'title'
+ // ^^^^^^^^^^^ parse this
+ res = state.md.helpers.parseLinkDestination(str, pos, max)
+ if (!res.ok) {
+ return false
+ }
- token = state.push('html_block', '', 0);
- token.map = [ startLine, nextLine ];
- token.content = state.getLines(startLine, nextLine, state.blkIndent, true);
+ href = state.md.normalizeLink(res.str)
+ if (!state.md.validateLink(href)) {
+ return false
+ }
- return true;
-};
+ pos = res.pos
+ lines += res.lines
+
+ // save cursor state, we could require to rollback later
+ destEndPos = pos
+ destEndLineNo = lines
+
+ // [label]: destination 'title'
+ // ^^^ skipping those spaces
+ start = pos
+ for (; pos < max; pos++) {
+ ch = str.charCodeAt(pos)
+ if (ch === 0x0a) {
+ lines++
+ } else if (isSpace(ch)) {
+ /*eslint no-empty:0*/
+ } else {
+ break
+ }
+ }
-},{"../common/html_blocks":2,"../common/html_re":3}],24:[function(require,module,exports){
-// lheading (---, ===)
+ // [label]: destination 'title'
+ // ^^^^^^^ parse this
+ res = state.md.helpers.parseLinkTitle(str, pos, max)
+ if (pos < max && start !== pos && res.ok) {
+ title = res.str
+ pos = res.pos
+ lines += res.lines
+ } else {
+ title = ''
+ pos = destEndPos
+ lines = destEndLineNo
+ }
-'use strict';
+ // skip trailing spaces until the rest of the line
+ while (pos < max) {
+ ch = str.charCodeAt(pos)
+ if (!isSpace(ch)) {
+ break
+ }
+ pos++
+ }
+ if (pos < max && str.charCodeAt(pos) !== 0x0a) {
+ if (title) {
+ // garbage at the end of the line after title,
+ // but it could still be a valid reference if we roll back
+ title = ''
+ pos = destEndPos
+ lines = destEndLineNo
+ while (pos < max) {
+ ch = str.charCodeAt(pos)
+ if (!isSpace(ch)) {
+ break
+ }
+ pos++
+ }
+ }
+ }
-module.exports = function lheading(state, startLine, endLine/*, silent*/) {
- var content, terminate, i, l, token, pos, max, level, marker,
- nextLine = startLine + 1, oldParentType,
- terminatorRules = state.md.block.ruler.getRules('paragraph');
+ if (pos < max && str.charCodeAt(pos) !== 0x0a) {
+ // garbage at the end of the line
+ return false
+ }
- // if it's indented more than 3 spaces, it should be a code block
- if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+ label = normalizeReference(str.slice(1, labelEnd))
+ if (!label) {
+ // CommonMark 0.20 disallows empty labels
+ return false
+ }
- oldParentType = state.parentType;
- state.parentType = 'paragraph'; // use paragraph to match terminatorRules
+ // Reference can not terminate anything. This check is for safety only.
+ /*istanbul ignore if*/
+ if (silent) {
+ return true
+ }
- // jump line-by-line until empty one or EOF
- for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
- // this would be a code block normally, but after paragraph
- // it's considered a lazy continuation regardless of what's there
- if (state.sCount[nextLine] - state.blkIndent > 3) { continue; }
+ if (typeof state.env.references === 'undefined') {
+ state.env.references = {}
+ }
+ if (typeof state.env.references[label] === 'undefined') {
+ state.env.references[label] = { title: title, href: href }
+ }
- //
- // Check for underline in setext header
- //
- if (state.sCount[nextLine] >= state.blkIndent) {
- pos = state.bMarks[nextLine] + state.tShift[nextLine];
- max = state.eMarks[nextLine];
+ state.parentType = oldParentType
- if (pos < max) {
- marker = state.src.charCodeAt(pos);
+ state.line = startLine + lines + 1
+ return true
+ }
+ },
+ { '../common/utils': 4 },
+ ],
+ 28: [
+ function (require, module, exports) {
+ // Parser state class
+
+ 'use strict'
+
+ var Token = require('../token')
+ var isSpace = require('../common/utils').isSpace
+
+ function StateBlock(src, md, env, tokens) {
+ var ch, s, start, pos, len, indent, offset, indent_found
+
+ this.src = src
+
+ // link to parser instance
+ this.md = md
+
+ this.env = env
+
+ //
+ // Internal state vartiables
+ //
+
+ this.tokens = tokens
+
+ this.bMarks = [] // line begin offsets for fast jumps
+ this.eMarks = [] // line end offsets for fast jumps
+ this.tShift = [] // offsets of the first non-space characters (tabs not expanded)
+ this.sCount = [] // indents for each line (tabs expanded)
+
+ // An amount of virtual spaces (tabs expanded) between beginning
+ // of each line (bMarks) and real beginning of that line.
+ //
+ // It exists only as a hack because blockquotes override bMarks
+ // losing information in the process.
+ //
+ // It's used only when expanding tabs, you can think about it as
+ // an initial tab length, e.g. bsCount=21 applied to string `\t123`
+ // means first tab should be expanded to 4-21%4 === 3 spaces.
+ //
+ this.bsCount = []
+
+ // block parser variables
+ this.blkIndent = 0 // required block content indent (for example, if we are
+ // inside a list, it would be positioned after list marker)
+ this.line = 0 // line index in src
+ this.lineMax = 0 // lines count
+ this.tight = false // loose/tight mode for lists
+ this.ddIndent = -1 // indent of the current dd block (-1 if there isn't any)
+ this.listIndent = -1 // indent of the current list block (-1 if there isn't any)
+
+ // can be 'blockquote', 'list', 'root', 'paragraph' or 'reference'
+ // used in lists to determine if they interrupt a paragraph
+ this.parentType = 'root'
+
+ this.level = 0
+
+ // renderer
+ this.result = ''
+
+ // Create caches
+ // Generate markers.
+ s = this.src
+ indent_found = false
+
+ for (start = pos = indent = offset = 0, len = s.length; pos < len; pos++) {
+ ch = s.charCodeAt(pos)
+
+ if (!indent_found) {
+ if (isSpace(ch)) {
+ indent++
+
+ if (ch === 0x09) {
+ offset += 4 - (offset % 4)
+ } else {
+ offset++
+ }
+ continue
+ } else {
+ indent_found = true
+ }
+ }
+
+ if (ch === 0x0a || pos === len - 1) {
+ if (ch !== 0x0a) {
+ pos++
+ }
+ this.bMarks.push(start)
+ this.eMarks.push(pos)
+ this.tShift.push(indent)
+ this.sCount.push(offset)
+ this.bsCount.push(0)
+
+ indent_found = false
+ indent = 0
+ offset = 0
+ start = pos + 1
+ }
+ }
- if (marker === 0x2D/* - */ || marker === 0x3D/* = */) {
- pos = state.skipChars(pos, marker);
- pos = state.skipSpaces(pos);
+ // Push fake entry to simplify cache bounds checks
+ this.bMarks.push(s.length)
+ this.eMarks.push(s.length)
+ this.tShift.push(0)
+ this.sCount.push(0)
+ this.bsCount.push(0)
- if (pos >= max) {
- level = (marker === 0x3D/* = */ ? 1 : 2);
- break;
+ this.lineMax = this.bMarks.length - 1 // don't count last fake line
}
- }
- }
- }
- // quirk for blockquotes, this line should already be checked by that rule
- if (state.sCount[nextLine] < 0) { continue; }
+ // Push new token to "stream".
+ //
+ StateBlock.prototype.push = function (type, tag, nesting) {
+ var token = new Token(type, tag, nesting)
+ token.block = true
- // Some tags can terminate paragraph without empty line.
- terminate = false;
- for (i = 0, l = terminatorRules.length; i < l; i++) {
- if (terminatorRules[i](state, nextLine, endLine, true)) {
- terminate = true;
- break;
- }
- }
- if (terminate) { break; }
- }
+ if (nesting < 0) this.level-- // closing tag
+ token.level = this.level
+ if (nesting > 0) this.level++ // opening tag
- if (!level) {
- // Didn't find valid underline
- return false;
- }
+ this.tokens.push(token)
+ return token
+ }
- content = state.getLines(startLine, nextLine, state.blkIndent, false).trim();
+ StateBlock.prototype.isEmpty = function isEmpty(line) {
+ return this.bMarks[line] + this.tShift[line] >= this.eMarks[line]
+ }
- state.line = nextLine + 1;
+ StateBlock.prototype.skipEmptyLines = function skipEmptyLines(from) {
+ for (var max = this.lineMax; from < max; from++) {
+ if (this.bMarks[from] + this.tShift[from] < this.eMarks[from]) {
+ break
+ }
+ }
+ return from
+ }
- token = state.push('heading_open', 'h' + String(level), 1);
- token.markup = String.fromCharCode(marker);
- token.map = [ startLine, state.line ];
+ // Skip spaces from given position.
+ StateBlock.prototype.skipSpaces = function skipSpaces(pos) {
+ var ch
- token = state.push('inline', '', 0);
- token.content = content;
- token.map = [ startLine, state.line - 1 ];
- token.children = [];
+ for (var max = this.src.length; pos < max; pos++) {
+ ch = this.src.charCodeAt(pos)
+ if (!isSpace(ch)) {
+ break
+ }
+ }
+ return pos
+ }
- token = state.push('heading_close', 'h' + String(level), -1);
- token.markup = String.fromCharCode(marker);
+ // Skip spaces from given position in reverse.
+ StateBlock.prototype.skipSpacesBack = function skipSpacesBack(pos, min) {
+ if (pos <= min) {
+ return pos
+ }
- state.parentType = oldParentType;
+ while (pos > min) {
+ if (!isSpace(this.src.charCodeAt(--pos))) {
+ return pos + 1
+ }
+ }
+ return pos
+ }
- return true;
-};
+ // Skip char codes from given position
+ StateBlock.prototype.skipChars = function skipChars(pos, code) {
+ for (var max = this.src.length; pos < max; pos++) {
+ if (this.src.charCodeAt(pos) !== code) {
+ break
+ }
+ }
+ return pos
+ }
-},{}],25:[function(require,module,exports){
-// Lists
+ // Skip char codes reverse from given position - 1
+ StateBlock.prototype.skipCharsBack = function skipCharsBack(pos, code, min) {
+ if (pos <= min) {
+ return pos
+ }
-'use strict';
+ while (pos > min) {
+ if (code !== this.src.charCodeAt(--pos)) {
+ return pos + 1
+ }
+ }
+ return pos
+ }
-var isSpace = require('../common/utils').isSpace;
+ // cut lines range from source.
+ StateBlock.prototype.getLines = function getLines(begin, end, indent, keepLastLF) {
+ var i,
+ lineIndent,
+ ch,
+ first,
+ last,
+ queue,
+ lineStart,
+ line = begin
+
+ if (begin >= end) {
+ return ''
+ }
+ queue = new Array(end - begin)
+
+ for (i = 0; line < end; line++, i++) {
+ lineIndent = 0
+ lineStart = first = this.bMarks[line]
+
+ if (line + 1 < end || keepLastLF) {
+ // No need for bounds check because we have fake entry on tail.
+ last = this.eMarks[line] + 1
+ } else {
+ last = this.eMarks[line]
+ }
+
+ while (first < last && lineIndent < indent) {
+ ch = this.src.charCodeAt(first)
+
+ if (isSpace(ch)) {
+ if (ch === 0x09) {
+ lineIndent += 4 - ((lineIndent + this.bsCount[line]) % 4)
+ } else {
+ lineIndent++
+ }
+ } else if (first - lineStart < this.tShift[line]) {
+ // patched tShift masked characters to look like spaces (blockquotes, list markers)
+ lineIndent++
+ } else {
+ break
+ }
+
+ first++
+ }
+
+ if (lineIndent > indent) {
+ // partially expanding tabs in code blocks, e.g '\t\tfoobar'
+ // with indent=2 becomes ' \tfoobar'
+ queue[i] = new Array(lineIndent - indent + 1).join(' ') + this.src.slice(first, last)
+ } else {
+ queue[i] = this.src.slice(first, last)
+ }
+ }
-// Search `[-+*][\n ]`, returns next pos after marker on success
-// or -1 on fail.
-function skipBulletListMarker(state, startLine) {
- var marker, pos, max, ch;
+ return queue.join('')
+ }
- pos = state.bMarks[startLine] + state.tShift[startLine];
- max = state.eMarks[startLine];
+ // re-export Token class to use in block rules
+ StateBlock.prototype.Token = Token
- marker = state.src.charCodeAt(pos++);
- // Check bullet
- if (marker !== 0x2A/* * */ &&
- marker !== 0x2D/* - */ &&
- marker !== 0x2B/* + */) {
- return -1;
- }
+ module.exports = StateBlock
+ },
+ { '../common/utils': 4, '../token': 51 },
+ ],
+ 29: [
+ function (require, module, exports) {
+ // GFM table, non-standard
- if (pos < max) {
- ch = state.src.charCodeAt(pos);
+ 'use strict'
- if (!isSpace(ch)) {
- // " -test " - is not a list item
- return -1;
- }
- }
+ var isSpace = require('../common/utils').isSpace
- return pos;
-}
+ function getLine(state, line) {
+ var pos = state.bMarks[line] + state.blkIndent,
+ max = state.eMarks[line]
-// Search `\d+[.)][\n ]`, returns next pos after marker on success
-// or -1 on fail.
-function skipOrderedListMarker(state, startLine) {
- var ch,
- start = state.bMarks[startLine] + state.tShift[startLine],
- pos = start,
- max = state.eMarks[startLine];
+ return state.src.substr(pos, max - pos)
+ }
- // List marker should have at least 2 chars (digit + dot)
- if (pos + 1 >= max) { return -1; }
+ function escapedSplit(str) {
+ var result = [],
+ pos = 0,
+ max = str.length,
+ ch,
+ escapes = 0,
+ lastPos = 0,
+ backTicked = false,
+ lastBackTick = 0
+
+ ch = str.charCodeAt(pos)
+
+ while (pos < max) {
+ if (ch === 0x60 /* ` */) {
+ if (backTicked) {
+ // make \` close code sequence, but not open it;
+ // the reason is: `\` is correct code block
+ backTicked = false
+ lastBackTick = pos
+ } else if (escapes % 2 === 0) {
+ backTicked = true
+ lastBackTick = pos
+ }
+ } else if (ch === 0x7c /* | */ && escapes % 2 === 0 && !backTicked) {
+ result.push(str.substring(lastPos, pos))
+ lastPos = pos + 1
+ }
+
+ if (ch === 0x5c /* \ */) {
+ escapes++
+ } else {
+ escapes = 0
+ }
+
+ pos++
+
+ // If there was an un-closed backtick, go back to just after
+ // the last backtick, but as if it was a normal character
+ if (pos === max && backTicked) {
+ backTicked = false
+ pos = lastBackTick + 1
+ }
+
+ ch = str.charCodeAt(pos)
+ }
- ch = state.src.charCodeAt(pos++);
+ result.push(str.substring(lastPos))
- if (ch < 0x30/* 0 */ || ch > 0x39/* 9 */) { return -1; }
+ return result
+ }
- for (;;) {
- // EOL -> fail
- if (pos >= max) { return -1; }
+ module.exports = function table(state, startLine, endLine, silent) {
+ var ch, lineText, pos, i, nextLine, columns, columnCount, token, aligns, t, tableLines, tbodyLines
- ch = state.src.charCodeAt(pos++);
+ // should have at least two lines
+ if (startLine + 2 > endLine) {
+ return false
+ }
- if (ch >= 0x30/* 0 */ && ch <= 0x39/* 9 */) {
+ nextLine = startLine + 1
- // List marker should have no more than 9 digits
- // (prevents integer overflow in browsers)
- if (pos - start >= 10) { return -1; }
+ if (state.sCount[nextLine] < state.blkIndent) {
+ return false
+ }
- continue;
- }
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[nextLine] - state.blkIndent >= 4) {
+ return false
+ }
- // found valid marker
- if (ch === 0x29/* ) */ || ch === 0x2e/* . */) {
- break;
- }
+ // first character of the second line should be '|', '-', ':',
+ // and no other characters are allowed but spaces;
+ // basically, this is the equivalent of /^[-:|][-:|\s]*$/ regexp
- return -1;
- }
+ pos = state.bMarks[nextLine] + state.tShift[nextLine]
+ if (pos >= state.eMarks[nextLine]) {
+ return false
+ }
+ ch = state.src.charCodeAt(pos++)
+ if (ch !== 0x7c /* | */ && ch !== 0x2d /* - */ && ch !== 0x3a /* : */) {
+ return false
+ }
- if (pos < max) {
- ch = state.src.charCodeAt(pos);
+ while (pos < state.eMarks[nextLine]) {
+ ch = state.src.charCodeAt(pos)
- if (!isSpace(ch)) {
- // " 1.test " - is not a list item
- return -1;
- }
- }
- return pos;
-}
-
-function markTightParagraphs(state, idx) {
- var i, l,
- level = state.level + 2;
-
- for (i = idx + 2, l = state.tokens.length - 2; i < l; i++) {
- if (state.tokens[i].level === level && state.tokens[i].type === 'paragraph_open') {
- state.tokens[i + 2].hidden = true;
- state.tokens[i].hidden = true;
- i += 2;
- }
- }
-}
-
-
-module.exports = function list(state, startLine, endLine, silent) {
- var ch,
- contentStart,
- i,
- indent,
- indentAfterMarker,
- initial,
- isOrdered,
- itemLines,
- l,
- listLines,
- listTokIdx,
- markerCharCode,
- markerValue,
- max,
- nextLine,
- offset,
- oldListIndent,
- oldParentType,
- oldSCount,
- oldTShift,
- oldTight,
- pos,
- posAfterMarker,
- prevEmptyEnd,
- start,
- terminate,
- terminatorRules,
- token,
- isTerminatingParagraph = false,
- tight = true;
-
- // if it's indented more than 3 spaces, it should be a code block
- if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
-
- // Special case:
- // - item 1
- // - item 2
- // - item 3
- // - item 4
- // - this one is a paragraph continuation
- if (state.listIndent >= 0 &&
- state.sCount[startLine] - state.listIndent >= 4 &&
- state.sCount[startLine] < state.blkIndent) {
- return false;
- }
+ if (ch !== 0x7c /* | */ && ch !== 0x2d /* - */ && ch !== 0x3a /* : */ && !isSpace(ch)) {
+ return false
+ }
- // limit conditions when list can interrupt
- // a paragraph (validation mode only)
- if (silent && state.parentType === 'paragraph') {
- // Next list item should still terminate previous list item;
- //
- // This code can fail if plugins use blkIndent as well as lists,
- // but I hope the spec gets fixed long before that happens.
- //
- if (state.tShift[startLine] >= state.blkIndent) {
- isTerminatingParagraph = true;
- }
- }
+ pos++
+ }
- // Detect list type and position after marker
- if ((posAfterMarker = skipOrderedListMarker(state, startLine)) >= 0) {
- isOrdered = true;
- start = state.bMarks[startLine] + state.tShift[startLine];
- markerValue = Number(state.src.substr(start, posAfterMarker - start - 1));
+ lineText = getLine(state, startLine + 1)
+
+ columns = lineText.split('|')
+ aligns = []
+ for (i = 0; i < columns.length; i++) {
+ t = columns[i].trim()
+ if (!t) {
+ // allow empty columns before and after table, but not in between columns;
+ // e.g. allow ` |---| `, disallow ` ---||--- `
+ if (i === 0 || i === columns.length - 1) {
+ continue
+ } else {
+ return false
+ }
+ }
+
+ if (!/^:?-+:?$/.test(t)) {
+ return false
+ }
+ if (t.charCodeAt(t.length - 1) === 0x3a /* : */) {
+ aligns.push(t.charCodeAt(0) === 0x3a /* : */ ? 'center' : 'right')
+ } else if (t.charCodeAt(0) === 0x3a /* : */) {
+ aligns.push('left')
+ } else {
+ aligns.push('')
+ }
+ }
- // If we're starting a new ordered list right after
- // a paragraph, it should start with 1.
- if (isTerminatingParagraph && markerValue !== 1) return false;
+ lineText = getLine(state, startLine).trim()
+ if (lineText.indexOf('|') === -1) {
+ return false
+ }
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false
+ }
+ columns = escapedSplit(lineText.replace(/^\||\|$/g, ''))
- } else if ((posAfterMarker = skipBulletListMarker(state, startLine)) >= 0) {
- isOrdered = false;
+ // header row will define an amount of columns in the entire table,
+ // and align row shouldn't be smaller than that (the rest of the rows can)
+ columnCount = columns.length
+ if (columnCount > aligns.length) {
+ return false
+ }
- } else {
- return false;
- }
+ if (silent) {
+ return true
+ }
- // If we're starting a new unordered list right after
- // a paragraph, first line should not be empty.
- if (isTerminatingParagraph) {
- if (state.skipSpaces(posAfterMarker) >= state.eMarks[startLine]) return false;
- }
+ token = state.push('table_open', 'table', 1)
+ token.map = tableLines = [startLine, 0]
- // We should terminate list on style change. Remember first one to compare.
- markerCharCode = state.src.charCodeAt(posAfterMarker - 1);
+ token = state.push('thead_open', 'thead', 1)
+ token.map = [startLine, startLine + 1]
- // For validation mode we can terminate immediately
- if (silent) { return true; }
+ token = state.push('tr_open', 'tr', 1)
+ token.map = [startLine, startLine + 1]
- // Start list
- listTokIdx = state.tokens.length;
+ for (i = 0; i < columns.length; i++) {
+ token = state.push('th_open', 'th', 1)
+ token.map = [startLine, startLine + 1]
+ if (aligns[i]) {
+ token.attrs = [['style', 'text-align:' + aligns[i]]]
+ }
- if (isOrdered) {
- token = state.push('ordered_list_open', 'ol', 1);
- if (markerValue !== 1) {
- token.attrs = [ [ 'start', markerValue ] ];
- }
+ token = state.push('inline', '', 0)
+ token.content = columns[i].trim()
+ token.map = [startLine, startLine + 1]
+ token.children = []
- } else {
- token = state.push('bullet_list_open', 'ul', 1);
- }
+ token = state.push('th_close', 'th', -1)
+ }
- token.map = listLines = [ startLine, 0 ];
- token.markup = String.fromCharCode(markerCharCode);
+ token = state.push('tr_close', 'tr', -1)
+ token = state.push('thead_close', 'thead', -1)
+
+ token = state.push('tbody_open', 'tbody', 1)
+ token.map = tbodyLines = [startLine + 2, 0]
+
+ for (nextLine = startLine + 2; nextLine < endLine; nextLine++) {
+ if (state.sCount[nextLine] < state.blkIndent) {
+ break
+ }
+
+ lineText = getLine(state, nextLine).trim()
+ if (lineText.indexOf('|') === -1) {
+ break
+ }
+ if (state.sCount[nextLine] - state.blkIndent >= 4) {
+ break
+ }
+ columns = escapedSplit(lineText.replace(/^\||\|$/g, ''))
+
+ token = state.push('tr_open', 'tr', 1)
+ for (i = 0; i < columnCount; i++) {
+ token = state.push('td_open', 'td', 1)
+ token.map = [nextLine, nextLine + 1]
+ if (aligns[i]) {
+ token.attrs = [['style', 'text-align:' + aligns[i]]]
+ }
+
+ token = state.push('inline', '', 0)
+ token.map = [nextLine, nextLine + 1]
+ token.content = columns[i] ? columns[i].trim() : ''
+ token.children = []
+
+ token = state.push('td_close', 'td', -1)
+ }
+ token = state.push('tr_close', 'tr', -1)
+ }
+ token = state.push('tbody_close', 'tbody', -1)
+ token = state.push('table_close', 'table', -1)
- //
- // Iterate list items
- //
+ tableLines[1] = tbodyLines[1] = nextLine
+ state.line = nextLine
+ return true
+ }
+ },
+ { '../common/utils': 4 },
+ ],
+ 30: [
+ function (require, module, exports) {
+ 'use strict'
+
+ module.exports = function block(state) {
+ var token
+
+ if (state.inlineMode) {
+ token = new state.Token('inline', '', 0)
+ token.content = state.src
+ token.map = [0, 1]
+ token.children = []
+ state.tokens.push(token)
+ } else {
+ state.md.block.parse(state.src, state.md, state.env, state.tokens)
+ }
+ }
+ },
+ {},
+ ],
+ 31: [
+ function (require, module, exports) {
+ 'use strict'
+
+ module.exports = function inline(state) {
+ var tokens = state.tokens,
+ tok,
+ i,
+ l
+
+ // Parse inlines
+ for (i = 0, l = tokens.length; i < l; i++) {
+ tok = tokens[i]
+ if (tok.type === 'inline') {
+ state.md.inline.parse(tok.content, state.md, state.env, tok.children)
+ }
+ }
+ }
+ },
+ {},
+ ],
+ 32: [
+ function (require, module, exports) {
+ // Replace link-like texts with link nodes.
+ //
+ // Currently restricted by `md.validateLink()` to http/https/ftp
+ //
+ 'use strict'
- nextLine = startLine;
- prevEmptyEnd = false;
- terminatorRules = state.md.block.ruler.getRules('list');
+ var arrayReplaceAt = require('../common/utils').arrayReplaceAt
- oldParentType = state.parentType;
- state.parentType = 'list';
+ function isLinkOpen(str) {
+ return /^
for large text values (notes)
- Handlebars.registerHelper('gurpslinkbr', function(str, root, clrdmods = false) {
- let actor = root?.data?.root?.actor
- if (!actor) actor = root?.actor
- return gurpslink(str, root == true || clrdmods == true).replace(/\n/g, '
')
- })
-
- Handlebars.registerHelper('listeqt', function(context, options) {
- var data
- if (options.data) data = Handlebars.createFrame(options.data)
-
- let ans = GURPS.listeqtrecurse(context, options, 0, data)
- return ans
- })
-
- /**
- * Convert a hierarchy of contained items into a flat map.
- *
- * The input is expected to be a map containing data elements; each element may also contain
- * another map of the exact same type as either a 'contains' or 'collapsed' property.
- *
- * What is returned is a single map in which all elements appear, with the appropriate property
- * keys. The individual elements will no longer contain the 'contains' or 'collapsed' properties.
- * The element will also be enhanced with the 'nesting level' of the data as an 'indent' property.
- */
- Handlebars.registerHelper('flatlist', function(context) {
- let data = {}
- flatlist(context, 0, '', data, false)
- return data
- })
-
- // Provides the same information as flatlist, but may check equipped status (based on system setting)
- Handlebars.registerHelper('attackflatlist', function(context) {
- let data = {}
- flatlist(
- context,
- 0,
- '',
- data,
- false,
- game.settings.get(settings.SYSTEM_NAME, settings.SETTING_REMOVE_UNEQUIPPED) ? this.actor : null
- )
- return data
- })
-
- const flatlist = function(context, level, parentkey, data, isCollapsed, actorToCheckEquipment) {
- if (!context) return data
-
- for (let key in context) {
- let item = context[key]
- let display = true
- if (actorToCheckEquipment) {
- // if we have been given an actor, then check to see if the melee or ranged item is equipped in the inventory
- let checked = false
- recurselist(actorToCheckEquipment.system.equipment.carried, e => {
- // check
- if (item.name.startsWith(e.name)) {
- checked = true
- if (!e.equipped) display = false
- }
- })
- if (!checked)
- recurselist(actorToCheckEquipment.system.equipment.other, e => {
- if (item.name.startsWith(e.name)) display = false
- })
- }
- if (display) {
- let newKey = parentkey + key
-
- let newItem = { indent: level }
- for (let propertyKey in item) {
- if (!['contains', 'collapsed', 'indent'].includes(propertyKey)) {
- newItem[propertyKey] = item[propertyKey]
- }
- }
- newItem['hasCollapsed'] = !!item?.collapsed && Object.values(item?.collapsed).length > 0
- newItem['hasContains'] = !!item?.contains && Object.values(item?.contains).length > 0
- newItem['isCollapsed'] = isCollapsed
-
- data[newKey] = newItem
-
- if (newItem['hasContains']) flatlist(item.contains, level + 1, newKey + '.contains.', data, isCollapsed)
- if (newItem['hasCollapsed']) flatlist(item.collapsed, level + 1, newKey + '.collapsed.', data, true)
- }
- }
- }
-
- Handlebars.registerHelper('listattack', function(src, key, options) {
- var data
- if (options.data) data = Handlebars.createFrame(options.data)
-
- let context = src[key]
- let ans = GURPS.listeqtrecurse(context, options, 0, data, '', src)
- return ans
- })
-
- // Only necessary because of the FG import
- Handlebars.registerHelper('hitlocationroll', function(loc, roll, data) {
- if (!roll) {
- // get hitlocation table name
- let tableName = data?.additionalresources?.bodyplan
- if (!tableName) tableName = 'humanoid'
- let table = HitLocations.hitlocationDictionary[tableName]
- if (!table) table = HitLocations.hitlocationDictionary['humanoid']
- roll = table[loc]?.roll
- }
- return roll
- })
-
- Handlebars.registerHelper('hitlocationpenalty', function(loc, penalty, data) {
- if (!penalty) {
- // get hitlocation table name
- let tableName = data?.additionalresources?.bodyplan
- if (!tableName) tableName = 'humanoid'
- let table = HitLocations.hitlocationDictionary[tableName]
- if (!table) table = HitLocations.hitlocationDictionary['humanoid']
- penalty = table[loc]?.penalty
- }
- return penalty
- })
-
- Handlebars.registerHelper('fractionalize', function(value, digits) {
- if (typeof value == 'number') {
- let wholeNumber = Math.floor(value)
- if (wholeNumber === value) {
- return value
- }
-
- let fraction = value - wholeNumber
- let wholeNumberText = wholeNumber === 0 ? '' : `${wholeNumber}`
- if (fraction === 1 / 3) return `${wholeNumberText} 1/3`.trim()
- if (fraction === 2 / 3) return `${wholeNumberText} 2/3`.trim()
- return parseFloat(value.toFixed(digits))
- }
- return value
- })
-
- /**
- * Helper for ADD wounding modifier row of the results table.
- */
- Handlebars.registerHelper('woundModifierText', function(calc) {
- let add = calc.additionalWoundModifier ? ` + ${calc.additionalWoundModifier} add` : ''
- let vul = calc.isVulnerable ? ` × ${calc.vulnerabilityMultiple} (Vuln.)` : ''
-
- if (vul.length + add.length === 0) return calc.damageType
-
- if (vul.length === 0) return `${calc.damageType}${add}`.trim()
-
- if (add.length === 0) return `${calc.damageType}${vul}`.trim()
-
- return `(${calc.damageType}${add})${vul}`.trim()
- })
-
- Handlebars.registerHelper('isWoundModAdjForLocation', function(calc) {
- if (calc.isWoundModifierAdjustedForLocation) {
- let location = calc.effectiveWoundModifiers[calc.damageType]
- return !!location && location.changed === 'hitlocation'
- }
- return false
- })
-
- Handlebars.registerHelper('isWoundModAdjForInjuryTol', function(calc) {
- if (calc.isWoundModifierAdjustedForInjuryTolerance) {
- let location = calc.effectiveWoundModifiers[calc.damageType]
- return !!location && location.changed === 'injury-tolerance'
- }
- return false
- })
-
- Handlebars.registerHelper('filter', function(objects, key) {
- // objects - array of object to filter
- // key - property to filter on
- // @ts-ignore
- if (isArray(objects)) return objects.filter(!isEmpty)
-
- // assume this is an object with numeric keys
- if (typeof objects === 'object' && objects !== null) {
- let results = []
- let index = 0
- let entry = objects[`${index}`]
-
- while (entry) {
- if (!isEmpty(entry.name)) results.push(entry)
- index++
- entry = objects[`${index}`]
- }
- return results
- }
- return []
- })
-
- Handlebars.registerHelper('listAllBodyPlans', function() {
- return HitLocations.getHitLocationTableNames()
- })
-
- Handlebars.registerHelper('listAllManeuvers', function() {
- return Maneuvers.getAllData()
- })
-
- Handlebars.registerHelper('listAllPostures', function() {
- let postures = GURPS.StatusEffect.getAllPostures()
- return postures
- })
-
- Handlebars.registerHelper('showTheMath', function() {
- return game.settings.get(settings.SYSTEM_NAME, settings.SETTING_SHOW_THE_MATH) ? 'checked' : ''
- })
-
- Handlebars.registerHelper('inCombat', function(data) {
- if (data.actor && !!game.combats.active) {
- return game.combats.active.combatants.contents.map(it => it.actor?.id).filter(e => !!e).includes(data?.actor?.id)
- }
- return false
- })
-
- // Allows handling of multiple page refs, e.g."B101,MA150"
- Handlebars.registerHelper('pdflink', function(link) {
- let txt = link
- if (Array.isArray(link)) txt = link.join(',')
- return !!txt
- ? txt
- .split(',')
- .map((/** @type {string} */ l) => gurpslink(`[PDF:${l}]`))
- .join(', ')
- : ''
- })
-
- // Allows handling of multiple page refs, e.g."B101,MA150" and external links
- Handlebars.registerHelper('pdflinkext', function(obj) {
- if (!obj) return ''
- let txt = obj.pageref
- if (Array.isArray(txt)) txt = txt.join(',')
- if (!txt) return ''
- return txt
- .split(',')
- .map((/** @type {string} */ l) => {
- if (!!obj.externallink) return `*Link`
- else if (l.match(/https?:\/\//i)) {
- return `*Link`
- } else return gurpslink(`[PDF:${l}]`)
- })
- .join(', ')
- })
-
- Handlebars.registerHelper('round', function(num) {
- // remove any commas, the grab any leading signed number
- let temp = (num + '')
- .trim()
- .replace(',', '')
- .replace(/^(-?\d+(?:\.\d+)*?) +.*/, '$1')
- // @ts-ignore
- return +(Math.round(temp + 'e+2') + 'e-2')
- })
-
- Handlebars.registerHelper('toLocaleString', function(number) {
- return !!number ? number.toLocaleString() : '' // Add data protection
- })
-
- Handlebars.registerHelper('displayNumber', function(num, options) {
- let showPlus = options.hash?.showPlus ?? false
- if (num != null) {
- if (parseInt(num) === 0) return showPlus ? '+0' : '0'
- if (parseInt(num) < 0) return num.toString().replace('-', '−')
- if (arguments[1] != false && num.toString()[0] !== '+') return `+${num}`
- return num.toString()
- } else return '' // null or undefined
- })
-
- Handlebars.registerHelper('invoke', function(object, options) {
- let name = options.hash?.method
- return object[name]()
- })
-
- Handlebars.registerHelper('displayDecimal', function(num, options) {
- if (num != null) {
- num = parseFloat(num.toString())
-
- let places = options.hash?.number ?? 1
- num = num.toFixed(places).toString()
- if (options.hash?.removeZeros) {
- while (num.toString().endsWith('0')) num = num.substr(0, num.length - 1)
- if (num.toString().endsWith('.')) num = num.substr(0, num.length - 1)
- }
-
- if (parseFloat(num) < 0) return num.toString().replace('-', '−')
-
- if (options.hash?.forceSign && num.toString()[0] !== '+') return `+${num}`
- return num.toString()
- } else return '' // null or undefined
- })
-
- Handlebars.registerHelper('optionSetStyle', function(boolean) {
- return !!boolean ? 'buttonpulsatingred' : 'buttongrey'
- })
-
- /**
- * Find the key of the tracker with the given name.
- */
- Handlebars.registerHelper('trackerIndex', function(data, trackerName) {
- if (!!data && !!data.additionalresources?.tracker) {
- let tracker = data.additionalresources.tracker
- // find the tracker with trackerName
- let found = Object.keys(tracker).find(it => tracker[it].name === trackerName)
- if (!!found) {
- return found
- }
- }
- return null
- })
-
- /**
- * Find the tracker with the given name.
- */
- Handlebars.registerHelper('tracker', function(data, trackerName) {
- if (!!data && !!data.additionalresources?.tracker) {
- // find the tracker with name 'Control Points'
- let tracker = Object.values(data.additionalresources?.tracker).find(it => it.name === trackerName)
- if (!!tracker) {
- return tracker
- }
- }
- return null
- })
-
- /**
- * Returns the index of the first threshold that matches the value.
- */
- Handlebars.registerHelper('threshold-of', function(thresholds, max, value) {
- // return the index of the threshold that the value falls into
- let result = null
- thresholds.some(function(
+export default function () {
+ // If you need to add Handlebars helpers, here are a few useful examples:
+ Handlebars.registerHelper('concat', function () {
+ var outStr = ''
+ for (var arg in arguments) {
+ if (typeof arguments[arg] != 'object') {
+ outStr += arguments[arg]
+ }
+ }
+ return outStr
+ })
+
+ /**
+ * move is a single entry of the form { mode: string, value: number }
+ * returns array of options.
+ */
+ Handlebars.registerHelper('moveOptions', function (move) {
+ let options = [MoveModes.Ground, MoveModes.Air, MoveModes.Water, MoveModes.Space]
+
+ if (options.includes(move.mode)) return options
+ options.push(move.mode)
+ return options
+ })
+
+ Handlebars.registerHelper('damageTypeOptions', function (type) {
+ let options = Object.values(GURPS.DamageTables.translationTable)
+ if (options.includes(type)) return options
+ options.push(type)
+ return options
+ })
+
+ // Add "@index to {{times}} function
+ Handlebars.registerHelper('times', function (n, content) {
+ let result = ''
+ for (let i = 0; i < n; i++) {
+ content.data.index = i + 1
+ result += content.fn(i)
+ }
+ return result
+ })
+
+ Handlebars.registerHelper('pluralize', function (word, quantity) {
+ if (quantity == 1) return word
+
+ if (word.slice(-1) == 's' || word.slice(-1) == 'x') return `${word}es`
+ return `${word}s`
+ })
+
+ Handlebars.registerHelper('chooseplural', function (quantity, single, plural) {
+ if (quantity == 1) return single
+ return plural
+ })
+
+ Handlebars.registerHelper('i18n', function (value, fallback) {
+ if (!!fallback?.hash)
+ // Allow i18n to work using the old localize syntax
+ return i18n_f(value, fallback.hash)
+ else return i18n(value, fallback)
+ })
+
+ Handlebars.registerHelper('i18n_f', function (value, data, fallback) {
+ return i18n_f(value, data, fallback)
+ })
+
+ Handlebars.registerHelper('defined', function (a) {
+ return a != undefined
+ })
+ Handlebars.registerHelper('gt', function (a, b) {
+ return a > b
+ })
+ Handlebars.registerHelper('lt', function (a, b) {
+ return a < b
+ })
+ Handlebars.registerHelper('eq', function (a, b) {
+ return a == b
+ })
+ Handlebars.registerHelper('ne', function (a, b) {
+ return a != b
+ })
+ Handlebars.registerHelper('abs', function (a) {
+ return Math.abs(a)
+ })
+ Handlebars.registerHelper('and', function () {
+ for (let arg in arguments) {
+ if (arguments[arg] == false) {
+ return false
+ }
+ }
+ return true
+ })
+ Handlebars.registerHelper('or', function () {
+ for (let arg in arguments) {
+ if (arguments[arg] == true) {
+ return true
+ }
+ }
+ return false
+ })
+ Handlebars.registerHelper('isNum', function (value) {
+ if (value == null) return false
+ if (value == '0') return true
+ if (value == '') return false
+ return !isNaN(parseInt(value)) // Used to allow "numbers" like '12F' or '11U' for fencing/unwieldy parry
+ })
+ Handlebars.registerHelper('not', function (value) {
+ return !value
+ })
+ Handlebars.registerHelper('includes', function (array, value) {
+ return array.includes(value)
+ })
+
+ Handlebars.registerHelper('toLowerCase', function (str) {
+ return str.toLowerCase()
+ })
+
+ Handlebars.registerHelper('zeroFill', function (number, width) {
+ return zeroFill(number, width)
+ })
+
+ Handlebars.registerHelper('toNumber', function (value) {
+ if (typeof value == 'string') return parseDecimalNumber(value)
+ return value
+ })
+
+ Handlebars.registerHelper('debug', function (value) {
+ if (GURPS.DEBUG == false) return
+ console.log('Current context:')
+ console.log('================')
+ // @ts-ignore
+ console.log(this)
+
+ if (value) {
+ console.log('Value:')
+ console.log('================')
+ console.log(value)
+ }
+ })
+
+ Handlebars.registerHelper('jsonStringify', function (object) {
+ return JSON.stringify(object)
+ })
+
+ Handlebars.registerHelper('jsonToObject', function (json) {
+ return JSON.parse(json)
+ })
+
+ Handlebars.registerHelper('replace', function () {
+ let format = arguments[0]
+ for (let index = 1; index < arguments.length; index++) {
+ let value = arguments[index]
+ format = format.replace(`$${index}`, arguments[index])
+ }
+ return format
+ })
+
+ /*
+ * if value is equal to compareTo, return _default; otherwise return the
+ * format string replacing '*' with value.
+ */
+ Handlebars.registerHelper('printIfNe', function (value, compareTo, format, _default = '') {
+ if (value === compareTo) return _default
+ let result = format.replace('*', value)
+ return result
+ })
+
+ Handlebars.registerHelper('objToString', function (str) {
+ let o = GURPS.objToString(str)
+ console.log(o)
+ return o
+ })
+
+ Handlebars.registerHelper('simpleRating', function (lvl) {
+ if (!lvl) return 'UNKNOWN'
+ let l = parseInt(lvl)
+ if (l < 10) return 'Poor'
+ if (l <= 11) return 'Fair'
+ if (l <= 13) return 'Good'
+ if (l <= 15) return 'Great'
+ if (l <= 18) return 'Super'
+ return 'Epic'
+ })
+
+ Handlebars.registerHelper('notEmpty', function (obj) {
+ return !!obj ? Object.values(obj).length > 0 : false
+ })
+
+ Handlebars.registerHelper('empty', function (obj) {
+ return !obj || Object.values(obj).length === 0
+ })
+
+ Handlebars.registerHelper('hasNoChildren', function (contains, collapsed) {
+ let c1 = !!contains ? Object.values(contains).length == 0 : true
+ let c2 = !!collapsed ? Object.values(collapsed).length == 0 : true
+ return c1 && c2
+ })
+
+ Handlebars.registerHelper('length', function (obj) {
+ if (getType(obj) === 'Object') return Object.values(obj).length
+ if (getType(obj) === 'Array') return obj.length
+ return 0
+ })
+
+ /// NOTE: To use this, you must use {{{gurpslink sometext}}}. The triple {{{}}} keeps it from interpreting the HTML
+ Handlebars.registerHelper('gurpslink', function (str, root, clrdmods = false) {
+ // this is a stupid trick to 'unescape' HTML entities, like converting 'ü' to 'ü'
+ var template = document.createElement('textarea')
+ template.innerHTML = str
+ str = template.childNodes[0]?.nodeValue || str // hack may not work, so default back to original string
+
+ let actor = root?.data?.root?.actor
+ if (!actor) actor = root?.actor
+ return new Handlebars.SafeString(gurpslink(str, root == true || clrdmods == true))
+ })
+
+ /// NOTE: To use this, you must use {{{gurpslinkbr sometext}}}. The triple {{{}}} keeps it from interpreting the HTML
+ // Same as gurpslink, but converts \n to
for large text values (notes)
+ Handlebars.registerHelper('gurpslinkbr', function (str, root, clrdmods = false) {
+ let actor = root?.data?.root?.actor
+ if (!actor) actor = root?.actor
+ return gurpslink(str, root == true || clrdmods == true).replace(/\n/g, '
')
+ })
+
+ Handlebars.registerHelper('listeqt', function (context, options) {
+ var data
+ if (options.data) data = Handlebars.createFrame(options.data)
+
+ let ans = GURPS.listeqtrecurse(context, options, 0, data)
+ return ans
+ })
+
+ /**
+ * Convert a hierarchy of contained items into a flat map.
+ *
+ * The input is expected to be a map containing data elements; each element may also contain
+ * another map of the exact same type as either a 'contains' or 'collapsed' property.
+ *
+ * What is returned is a single map in which all elements appear, with the appropriate property
+ * keys. The individual elements will no longer contain the 'contains' or 'collapsed' properties.
+ * The element will also be enhanced with the 'nesting level' of the data as an 'indent' property.
+ */
+ Handlebars.registerHelper('flatlist', function (context) {
+ let data = {}
+ flatlist(context, 0, '', data, false)
+ return data
+ })
+
+ // Provides the same information as flatlist, but may check equipped status (based on system setting)
+ Handlebars.registerHelper('attackflatlist', function (context) {
+ let data = {}
+ flatlist(
+ context,
+ 0,
+ '',
+ data,
+ false,
+ game.settings.get(settings.SYSTEM_NAME, settings.SETTING_REMOVE_UNEQUIPPED) ? this.actor : null
+ )
+ return data
+ })
+
+ const flatlist = function (context, level, parentkey, data, isCollapsed, actorToCheckEquipment) {
+ if (!context) return data
+
+ for (let key in context) {
+ let item = context[key]
+ let display = true
+ if (actorToCheckEquipment) {
+ // if we have been given an actor, then check to see if the melee or ranged item is equipped in the inventory
+ let checked = false
+ recurselist(actorToCheckEquipment.system.equipment.carried, e => {
+ // check
+ if (item.name.startsWith(e.name)) {
+ checked = true
+ if (!e.equipped) display = false
+ }
+ })
+ if (!checked)
+ recurselist(actorToCheckEquipment.system.equipment.other, e => {
+ if (item.name.startsWith(e.name)) display = false
+ })
+ }
+ if (display) {
+ let newKey = parentkey + key
+
+ let newItem = { indent: level }
+ for (let propertyKey in item) {
+ if (!['contains', 'collapsed', 'indent'].includes(propertyKey)) {
+ newItem[propertyKey] = item[propertyKey]
+ }
+ }
+ newItem['hasCollapsed'] = !!item?.collapsed && Object.values(item?.collapsed).length > 0
+ newItem['hasContains'] = !!item?.contains && Object.values(item?.contains).length > 0
+ newItem['isCollapsed'] = isCollapsed
+
+ data[newKey] = newItem
+
+ if (newItem['hasContains']) flatlist(item.contains, level + 1, newKey + '.contains.', data, isCollapsed)
+ if (newItem['hasCollapsed']) flatlist(item.collapsed, level + 1, newKey + '.collapsed.', data, true)
+ }
+ }
+ }
+
+ Handlebars.registerHelper('listattack', function (src, key, options) {
+ var data
+ if (options.data) data = Handlebars.createFrame(options.data)
+
+ let context = src[key]
+ let ans = GURPS.listeqtrecurse(context, options, 0, data, '', src)
+ return ans
+ })
+
+ // Only necessary because of the FG import
+ Handlebars.registerHelper('hitlocationroll', function (loc, roll, data) {
+ if (!roll) {
+ // get hitlocation table name
+ let tableName = data?.additionalresources?.bodyplan
+ if (!tableName) tableName = 'humanoid'
+ let table = HitLocations.hitlocationDictionary[tableName]
+ if (!table) table = HitLocations.hitlocationDictionary['humanoid']
+ roll = table[loc]?.roll
+ }
+ return roll
+ })
+
+ Handlebars.registerHelper('hitlocationpenalty', function (loc, penalty, data) {
+ if (!penalty) {
+ // get hitlocation table name
+ let tableName = data?.additionalresources?.bodyplan
+ if (!tableName) tableName = 'humanoid'
+ let table = HitLocations.hitlocationDictionary[tableName]
+ if (!table) table = HitLocations.hitlocationDictionary['humanoid']
+ penalty = table[loc]?.penalty
+ }
+ return penalty
+ })
+
+ Handlebars.registerHelper('fractionalize', function (value, digits) {
+ if (typeof value == 'number') {
+ let wholeNumber = Math.floor(value)
+ if (wholeNumber === value) {
+ return value
+ }
+
+ let fraction = value - wholeNumber
+ let wholeNumberText = wholeNumber === 0 ? '' : `${wholeNumber}`
+ if (fraction === 1 / 3) return `${wholeNumberText} 1/3`.trim()
+ if (fraction === 2 / 3) return `${wholeNumberText} 2/3`.trim()
+ return parseFloat(value.toFixed(digits))
+ }
+ return value
+ })
+
+ /**
+ * Helper for ADD wounding modifier row of the results table.
+ */
+ Handlebars.registerHelper('woundModifierText', function (calc) {
+ let add = calc.additionalWoundModifier ? ` + ${calc.additionalWoundModifier} add` : ''
+ let vul = calc.isVulnerable ? ` × ${calc.vulnerabilityMultiple} (Vuln.)` : ''
+
+ if (vul.length + add.length === 0) return calc.damageType
+
+ if (vul.length === 0) return `${calc.damageType}${add}`.trim()
+
+ if (add.length === 0) return `${calc.damageType}${vul}`.trim()
+
+ return `(${calc.damageType}${add})${vul}`.trim()
+ })
+
+ Handlebars.registerHelper('isWoundModAdjForLocation', function (calc) {
+ if (calc.isWoundModifierAdjustedForLocation) {
+ let location = calc.effectiveWoundModifiers[calc.damageType]
+ return !!location && location.changed === 'hitlocation'
+ }
+ return false
+ })
+
+ Handlebars.registerHelper('isWoundModAdjForInjuryTol', function (calc) {
+ if (calc.isWoundModifierAdjustedForInjuryTolerance) {
+ let location = calc.effectiveWoundModifiers[calc.damageType]
+ return !!location && location.changed === 'injury-tolerance'
+ }
+ return false
+ })
+
+ Handlebars.registerHelper('filter', function (objects, key) {
+ // objects - array of object to filter
+ // key - property to filter on
+ // @ts-ignore
+ if (isArray(objects)) return objects.filter(!isEmpty)
+
+ // assume this is an object with numeric keys
+ if (typeof objects === 'object' && objects !== null) {
+ let results = []
+ let index = 0
+ let entry = objects[`${index}`]
+
+ while (entry) {
+ if (!isEmpty(entry.name)) results.push(entry)
+ index++
+ entry = objects[`${index}`]
+ }
+ return results
+ }
+ return []
+ })
+
+ Handlebars.registerHelper('listAllBodyPlans', function () {
+ return HitLocations.getHitLocationTableNames()
+ })
+
+ Handlebars.registerHelper('listAllManeuvers', function () {
+ return Maneuvers.getAllData()
+ })
+
+ Handlebars.registerHelper('listAllPostures', function () {
+ let postures = GURPS.StatusEffect.getAllPostures()
+ return postures
+ })
+
+ Handlebars.registerHelper('showTheMath', function () {
+ return game.settings.get(settings.SYSTEM_NAME, settings.SETTING_SHOW_THE_MATH) ? 'checked' : ''
+ })
+
+ Handlebars.registerHelper('inCombat', function (data) {
+ if (data.actor && !!game.combats.active) {
+ return game.combats.active.combatants.contents
+ .map(it => it.actor?.id)
+ .filter(e => !!e)
+ .includes(data?.actor?.id)
+ }
+ return false
+ })
+
+ // Allows handling of multiple page refs, e.g."B101,MA150"
+ Handlebars.registerHelper('pdflink', function (link) {
+ let txt = link
+ if (Array.isArray(link)) txt = link.join(',')
+ return !!txt
+ ? txt
+ .split(',')
+ .map((/** @type {string} */ l) => gurpslink(`[PDF:${l}]`))
+ .join(', ')
+ : ''
+ })
+
+ // Allows handling of multiple page refs, e.g."B101,MA150" and external links
+ Handlebars.registerHelper('pdflinkext', function (obj) {
+ if (!obj) return ''
+ let txt = obj.pageref
+ if (Array.isArray(txt)) txt = txt.join(',')
+ if (!txt) return ''
+ return txt
+ .split(',')
+ .map((/** @type {string} */ l) => {
+ if (!!obj.externallink) return `*Link`
+ else if (l.match(/https?:\/\//i)) {
+ return `*Link`
+ } else return gurpslink(`[PDF:${l}]`)
+ })
+ .join(', ')
+ })
+
+ Handlebars.registerHelper('round', function (num) {
+ // remove any commas, the grab any leading signed number
+ let temp = (num + '')
+ .trim()
+ .replace(',', '')
+ .replace(/^(-?\d+(?:\.\d+)*?) +.*/, '$1')
+ // @ts-ignore
+ return +(Math.round(temp + 'e+2') + 'e-2')
+ })
+
+ Handlebars.registerHelper('toLocaleString', function (number) {
+ return !!number ? number.toLocaleString() : '' // Add data protection
+ })
+
+ Handlebars.registerHelper('displayNumber', function (num, options) {
+ let showPlus = options.hash?.showPlus ?? false
+ if (num != null) {
+ if (parseInt(num) === 0) return showPlus ? '+0' : '0'
+ if (parseInt(num) < 0) return num.toString().replace('-', '−')
+ if (arguments[1] != false && num.toString()[0] !== '+') return `+${num}`
+ return num.toString()
+ } else return '' // null or undefined
+ })
+
+ Handlebars.registerHelper('invoke', function (object, options) {
+ let name = options.hash?.method
+ return object[name]()
+ })
+
+ Handlebars.registerHelper('displayDecimal', function (num, options) {
+ if (num != null) {
+ num = parseFloat(num.toString())
+
+ let places = options.hash?.number ?? 1
+ num = num.toFixed(places).toString()
+ if (options.hash?.removeZeros) {
+ while (num.toString().endsWith('0')) num = num.substr(0, num.length - 1)
+ if (num.toString().endsWith('.')) num = num.substr(0, num.length - 1)
+ }
+
+ if (parseFloat(num) < 0) return num.toString().replace('-', '−')
+
+ if (options.hash?.forceSign && num.toString()[0] !== '+') return `+${num}`
+ return num.toString()
+ } else return '' // null or undefined
+ })
+
+ Handlebars.registerHelper('optionSetStyle', function (boolean) {
+ return !!boolean ? 'buttonpulsatingred' : 'buttongrey'
+ })
+
+ /**
+ * Find the key of the tracker with the given name.
+ */
+ Handlebars.registerHelper('trackerIndex', function (data, trackerName) {
+ if (!!data && !!data.additionalresources?.tracker) {
+ let tracker = data.additionalresources.tracker
+ // find the tracker with trackerName
+ let found = Object.keys(tracker).find(it => tracker[it].name === trackerName)
+ if (!!found) {
+ return found
+ }
+ }
+ return null
+ })
+
+ /**
+ * Find the tracker with the given name.
+ */
+ Handlebars.registerHelper('tracker', function (data, trackerName) {
+ if (!!data && !!data.additionalresources?.tracker) {
+ // find the tracker with name 'Control Points'
+ let tracker = Object.values(data.additionalresources?.tracker).find(it => it.name === trackerName)
+ if (!!tracker) {
+ return tracker
+ }
+ }
+ return null
+ })
+
+ /**
+ * Returns the index of the first threshold that matches the value.
+ */
+ Handlebars.registerHelper('threshold-of', function (thresholds, max, value) {
+ // return the index of the threshold that the value falls into
+ let result = null
+ thresholds.some(function (
/** @type {{ operator: string; comparison: string; value: number; }} */ threshold,
/** @type {number} */ index
- ) {
- let op = getOperation(threshold.operator)
- let comparison = getComparison(threshold.comparison)
- let testValue = op(max, threshold.value)
- return comparison(value, testValue) ? ((result = index), true) : false
- })
- return result
- })
-
- /**
- * Unlike the 'threshold-of' method above, this returns the *last* threshold whose condition matches.
- */
- Handlebars.registerHelper('breakpoint-of', function(thresholds, max, value) {
- // return the index of the threshold that the value falls into
- let matches = thresholds.filter(function(threshold, index) {
- let op = getOperation(threshold.operator)
- let comparison = getComparison(threshold.comparison)
- let testValue = op(max, threshold.value)
- return comparison(value, testValue)
- })
-
- return matches.pop()
- })
-
- /**
- * Unlike the 'threshold-of' method above, this returns the index of the *last* threshold whose condition matches.
- */
- Handlebars.registerHelper('breakpointIndex-of', function(thresholds, max, value) {
- // return the index of the threshold that the value falls into
- let matches = thresholds.filter(function(threshold, index) {
- let op = getOperation(threshold.operator)
- let comparison = getComparison(threshold.comparison)
- let testValue = op(max, threshold.value)
- return comparison(value, testValue)
- })
-
- return thresholds.lastIndexOf(matches.pop())
- })
-
- /**
- * Return an array of the calculated breakpoint values along with the matching threshold.
- */
- Handlebars.registerHelper('thresholdBreakpoints', function(tracker) {
- let results = []
- tracker.thresholds.forEach(threshold => {
- let op = getOperation(threshold.operator)
- let temp = op(tracker.max, threshold.value)
- let value = tracker.isDamageTracker ? Math.ceil(temp) : Math.floor(temp)
-
- results.push({
- breakpoint: value,
- threshold: threshold,
- })
- })
- return results
- })
-
- Handlebars.registerHelper('truthy', function(value) {
- return !!value
- })
-
- /**
- * TODO Maybe unnecessary -- just use 'thresholBreakpoints', above??
- */
- Handlebars.registerHelper('controlBreakpoints', function(tracker) {
- let results = []
- tracker.thresholds.forEach(threshold => {
- let op = getOperation(threshold.operator)
- let temp = op(tracker.max, threshold.value)
- let value = Math.ceil(temp)
-
- results.push({
- breakpoint: value,
- label: threshold.condition,
- comparison: threshold.comparison,
- color: threshold.color,
- abbreviation: threshold.abbreviation,
- })
- })
- return results
- })
-
- Handlebars.registerHelper('include-if', function(condition, iftrue, iffalse) {
- if (arguments.length == 3) iffalse = ''
- return !!condition ? iftrue : iffalse
- })
-
- Handlebars.registerHelper('select-if', function(value, expected) {
- return value == expected ? 'selected' : ''
- })
-
- Handlebars.registerHelper('disabled', function(value) {
- return !!value ? 'disabled' : ''
- })
-
- Handlebars.registerHelper('gmod', function(value) {
- return !!value ? 'gmod' : ''
- })
-
- Handlebars.registerHelper('rollable', function(value) {
- return !!value ? 'rollable' : ''
- })
-
- Handlebars.registerHelper('isUserCreated', function(obj) {
- return game.settings.get(settings.SYSTEM_NAME, settings.SETTING_SHOW_USER_CREATED) && !!obj.save
- })
-
- Handlebars.registerHelper('isFoundryItem', function(obj) {
- return game.settings.get(settings.SYSTEM_NAME, settings.SETTING_SHOW_FOUNDRY_CREATED) && !!obj.itemid
- })
-
- Handlebars.registerHelper('ignoreImportQty', function(obj) {
- return game.settings.get(settings.SYSTEM_NAME, settings.SETTING_ignoreImportQty) && !!obj.ignoreImportQty
- })
-
- Handlebars.registerHelper('displayItemHover', function(obj) {
- return (
- game.settings.get(settings.SYSTEM_NAME, settings.SETTING_SHOW_FOUNDRY_CREATED) &&
- !!obj.img &&
- obj.img != 'icons/svg/item-bag.svg'
- )
- })
-
- Handlebars.registerHelper('automaticEncumbrance', function() {
- return game.settings.get(settings.SYSTEM_NAME, settings.SETTING_AUTOMATIC_ENCUMBRANCE)
- })
-
- Handlebars.registerHelper('first', function(array) {
- return array[0]
- })
-
- Handlebars.registerHelper('multiplyDice', function(formula, count) {
- return multiplyDice(formula, count)
- })
-
- Handlebars.registerHelper('collapsible-content', function(id, data, group, options) {
- let title = data[0]
- let type = !!group && group.length > 0 ? `type='radio' name='${group}'` : `type='checkbox'`
- let content = data
- .slice(1)
- .map((/** @type {string} */ it) =>
- it.startsWith('*')
- ? ` ${it.slice(1)}`
- : ` ${it}`
- )
- .join('\n')
-
- let template = `
+ ) {
+ let op = getOperation(threshold.operator)
+ let comparison = getComparison(threshold.comparison)
+ let testValue = op(max, threshold.value)
+ return comparison(value, testValue) ? ((result = index), true) : false
+ })
+ return result
+ })
+
+ /**
+ * Unlike the 'threshold-of' method above, this returns the *last* threshold whose condition matches.
+ */
+ Handlebars.registerHelper('breakpoint-of', function (thresholds, max, value) {
+ // return the index of the threshold that the value falls into
+ let matches = thresholds.filter(function (threshold, index) {
+ let op = getOperation(threshold.operator)
+ let comparison = getComparison(threshold.comparison)
+ let testValue = op(max, threshold.value)
+ return comparison(value, testValue)
+ })
+
+ return matches.pop()
+ })
+
+ /**
+ * Unlike the 'threshold-of' method above, this returns the index of the *last* threshold whose condition matches.
+ */
+ Handlebars.registerHelper('breakpointIndex-of', function (thresholds, max, value) {
+ // return the index of the threshold that the value falls into
+ let matches = thresholds.filter(function (threshold, index) {
+ let op = getOperation(threshold.operator)
+ let comparison = getComparison(threshold.comparison)
+ let testValue = op(max, threshold.value)
+ return comparison(value, testValue)
+ })
+
+ return thresholds.lastIndexOf(matches.pop())
+ })
+
+ /**
+ * Return an array of the calculated breakpoint values along with the matching threshold.
+ */
+ Handlebars.registerHelper('thresholdBreakpoints', function (tracker) {
+ let results = []
+ tracker.thresholds.forEach(threshold => {
+ let op = getOperation(threshold.operator)
+ let temp = op(tracker.max, threshold.value)
+ let value = tracker.isDamageTracker ? Math.ceil(temp) : Math.floor(temp)
+
+ results.push({
+ breakpoint: value,
+ threshold: threshold,
+ })
+ })
+ return results
+ })
+
+ Handlebars.registerHelper('truthy', function (value) {
+ return !!value
+ })
+
+ /**
+ * TODO Maybe unnecessary -- just use 'thresholBreakpoints', above??
+ */
+ Handlebars.registerHelper('controlBreakpoints', function (tracker) {
+ let results = []
+ tracker.thresholds.forEach(threshold => {
+ let op = getOperation(threshold.operator)
+ let temp = op(tracker.max, threshold.value)
+ let value = Math.ceil(temp)
+
+ results.push({
+ breakpoint: value,
+ label: threshold.condition,
+ comparison: threshold.comparison,
+ color: threshold.color,
+ abbreviation: threshold.abbreviation,
+ })
+ })
+ return results
+ })
+
+ Handlebars.registerHelper('include-if', function (condition, iftrue, iffalse) {
+ if (arguments.length == 3) iffalse = ''
+ return !!condition ? iftrue : iffalse
+ })
+
+ Handlebars.registerHelper('select-if', function (value, expected) {
+ return value == expected ? 'selected' : ''
+ })
+
+ Handlebars.registerHelper('disabled', function (value) {
+ return !!value ? 'disabled' : ''
+ })
+
+ Handlebars.registerHelper('gmod', function (value) {
+ return !!value ? 'gmod' : ''
+ })
+
+ Handlebars.registerHelper('rollable', function (value) {
+ return !!value ? 'rollable' : ''
+ })
+
+ Handlebars.registerHelper('isUserCreated', function (obj) {
+ return game.settings.get(settings.SYSTEM_NAME, settings.SETTING_SHOW_USER_CREATED) && !!obj.save
+ })
+
+ Handlebars.registerHelper('isFoundryItem', function (obj) {
+ return game.settings.get(settings.SYSTEM_NAME, settings.SETTING_SHOW_FOUNDRY_CREATED) && !!obj.itemid
+ })
+
+ Handlebars.registerHelper('ignoreImportQty', function (obj) {
+ return game.settings.get(settings.SYSTEM_NAME, settings.SETTING_ignoreImportQty) && !!obj.ignoreImportQty
+ })
+
+ Handlebars.registerHelper('displayItemHover', function (obj) {
+ return (
+ game.settings.get(settings.SYSTEM_NAME, settings.SETTING_SHOW_FOUNDRY_CREATED) &&
+ !!obj.img &&
+ obj.img != 'icons/svg/item-bag.svg'
+ )
+ })
+
+ Handlebars.registerHelper('automaticEncumbrance', function () {
+ return game.settings.get(settings.SYSTEM_NAME, settings.SETTING_AUTOMATIC_ENCUMBRANCE)
+ })
+
+ Handlebars.registerHelper('first', function (array) {
+ return array[0]
+ })
+
+ Handlebars.registerHelper('multiplyDice', function (formula, count) {
+ return multiplyDice(formula, count)
+ })
+
+ Handlebars.registerHelper('collapsible-content', function (id, data, group, options) {
+ let title = data[0]
+ let type = !!group && group.length > 0 ? `type='radio' name='${group}'` : `type='checkbox'`
+ let content = data
+ .slice(1)
+ .map((/** @type {string} */ it) =>
+ it.startsWith('*')
+ ? ` ${it.slice(1)}`
+ : ` ${it}`
+ )
+ .join('\n')
+
+ let template = `
@@ -728,98 +731,98 @@ ${content}
`
- return new Handlebars.SafeString(template)
- })
-
- Handlebars.registerHelper('damageTerm', function(calc, options) {
- let armorDivisor =
- calc.useArmorDivisor && calc.armorDivisor //
- ? calc.armorDivisor == -1
- ? '(∞)'
- : `(${calc.armorDivisor})` //
- : ''
-
- let damageType =
- calc.damageType !== 'dmg' && calc.damageType !== 'injury' && calc.damageType !== 'none' ? calc.damageType : ''
- let damageModifier = calc.damageModifier || ''
- return [armorDivisor, damageType, damageModifier].join(' ').trim()
- })
-
- /**
- * Added to color the rollable parts of the character sheet.
- * Made this part eslint compatible...
- * ~Stevil
- */
- // eslint-disable-next-line no-undef
- Handlebars.registerHelper('switch', function(value, options) {
- this.switch_value = value
- this.switch_break = false
- return options.fn(this)
- })
-
- // eslint-disable-next-line no-undef
- Handlebars.registerHelper('case', function(value, options) {
- if (value === this.switch_value) {
- this.switch_break = true
- return options.fn(this)
- }
- })
-
- // eslint-disable-next-line no-undef
- Handlebars.registerHelper('default', function(value, options) {
- if (this.switch_break == false) {
- return value
- }
- })
-
- Handlebars.registerHelper('quotedAttackName', function(prefix, item) {
- return prefix + ':' + quotedAttackName(item)
- })
-
- // === register Handlebars partials ===
- // Partial name will be the last component of the path name, e.g.: 'systems/gurps/templates/actor/foo.hbs" -- the name is "foo".
- // Use it in an HTML/HBS file like this: {{> foo }}.
- // See https://handlebarsjs.com/guide/partials.html#partials for more documentation.
- const templates = [
- 'systems/gurps/templates/actor/sections/advantages.hbs',
- 'systems/gurps/templates/actor/sections/attributes.hbs',
- 'systems/gurps/templates/actor/sections/basic-attributes.hbs',
- 'systems/gurps/templates/actor/sections/ci-editor.hbs',
- 'systems/gurps/templates/actor/sections/conditional-injury.hbs',
- 'systems/gurps/templates/actor/sections/conditionalmods.hbs',
- 'systems/gurps/templates/actor/sections/conditions.hbs',
- 'systems/gurps/templates/actor/sections/description.hbs',
- 'systems/gurps/templates/actor/sections/encumbrance.hbs',
- 'systems/gurps/templates/actor/sections/footer.hbs',
- 'systems/gurps/templates/actor/sections/equipment.hbs',
- 'systems/gurps/templates/actor/sections/hpfp-editor.hbs',
- 'systems/gurps/templates/actor/sections/hpfp-tracker.hbs',
- 'systems/gurps/templates/actor/sections/identity.hbs',
- 'systems/gurps/templates/actor/sections/lifting.hbs',
- 'systems/gurps/templates/actor/sections/locations.hbs',
- 'systems/gurps/templates/actor/sections/melee.hbs',
- 'systems/gurps/templates/actor/sections/miscellaneous.hbs',
- 'systems/gurps/templates/actor/sections/notes.hbs',
- 'systems/gurps/templates/actor/sections/points.hbs',
- 'systems/gurps/templates/actor/sections/portrait.hbs',
- 'systems/gurps/templates/actor/sections/quicknote.hbs',
- 'systems/gurps/templates/actor/sections/ranged.hbs',
- 'systems/gurps/templates/actor/sections/reactions.hbs',
- 'systems/gurps/templates/actor/sections/resource-controls.hbs',
- 'systems/gurps/templates/actor/sections/resource-tracker.hbs',
- 'systems/gurps/templates/actor/sections/secondary-attributes.hbs',
- 'systems/gurps/templates/actor/sections/skills.hbs',
- 'systems/gurps/templates/actor/sections/speed-range-table.hbs',
- 'systems/gurps/templates/actor/sections/spells.hbs',
- 'systems/gurps/templates/actor/sections/trackers.hbs',
- ]
-
- templates.forEach(filename => {
- let name = filename.substr(filename.lastIndexOf('/') + 1).replace(/(.*)\.hbs/, '$1')
- fetch(filename)
- .then(it => it.text())
- .then(async text => {
- Handlebars.registerPartial(name, text)
- })
- })
+ return new Handlebars.SafeString(template)
+ })
+
+ Handlebars.registerHelper('damageTerm', function (calc, options) {
+ let armorDivisor =
+ calc.useArmorDivisor && calc.armorDivisor //
+ ? calc.armorDivisor == -1
+ ? '(∞)'
+ : `(${calc.armorDivisor})` //
+ : ''
+
+ let damageType =
+ calc.damageType !== 'dmg' && calc.damageType !== 'injury' && calc.damageType !== 'none' ? calc.damageType : ''
+ let damageModifier = calc.damageModifier || ''
+ return [armorDivisor, damageType, damageModifier].join(' ').trim()
+ })
+
+ /**
+ * Added to color the rollable parts of the character sheet.
+ * Made this part eslint compatible...
+ * ~Stevil
+ */
+ // eslint-disable-next-line no-undef
+ Handlebars.registerHelper('switch', function (value, options) {
+ this.switch_value = value
+ this.switch_break = false
+ return options.fn(this)
+ })
+
+ // eslint-disable-next-line no-undef
+ Handlebars.registerHelper('case', function (value, options) {
+ if (value === this.switch_value) {
+ this.switch_break = true
+ return options.fn(this)
+ }
+ })
+
+ // eslint-disable-next-line no-undef
+ Handlebars.registerHelper('default', function (value, options) {
+ if (this.switch_break == false) {
+ return value
+ }
+ })
+
+ Handlebars.registerHelper('quotedAttackName', function (prefix, item) {
+ return prefix + ':' + quotedAttackName(item)
+ })
+
+ // === register Handlebars partials ===
+ // Partial name will be the last component of the path name, e.g.: 'systems/gurps/templates/actor/foo.hbs" -- the name is "foo".
+ // Use it in an HTML/HBS file like this: {{> foo }}.
+ // See https://handlebarsjs.com/guide/partials.html#partials for more documentation.
+ const templates = [
+ 'systems/gurps/templates/actor/sections/advantages.hbs',
+ 'systems/gurps/templates/actor/sections/attributes.hbs',
+ 'systems/gurps/templates/actor/sections/basic-attributes.hbs',
+ 'systems/gurps/templates/actor/sections/ci-editor.hbs',
+ 'systems/gurps/templates/actor/sections/conditional-injury.hbs',
+ 'systems/gurps/templates/actor/sections/conditionalmods.hbs',
+ 'systems/gurps/templates/actor/sections/conditions.hbs',
+ 'systems/gurps/templates/actor/sections/description.hbs',
+ 'systems/gurps/templates/actor/sections/encumbrance.hbs',
+ 'systems/gurps/templates/actor/sections/footer.hbs',
+ 'systems/gurps/templates/actor/sections/equipment.hbs',
+ 'systems/gurps/templates/actor/sections/hpfp-editor.hbs',
+ 'systems/gurps/templates/actor/sections/hpfp-tracker.hbs',
+ 'systems/gurps/templates/actor/sections/identity.hbs',
+ 'systems/gurps/templates/actor/sections/lifting.hbs',
+ 'systems/gurps/templates/actor/sections/locations.hbs',
+ 'systems/gurps/templates/actor/sections/melee.hbs',
+ 'systems/gurps/templates/actor/sections/miscellaneous.hbs',
+ 'systems/gurps/templates/actor/sections/notes.hbs',
+ 'systems/gurps/templates/actor/sections/points.hbs',
+ 'systems/gurps/templates/actor/sections/portrait.hbs',
+ 'systems/gurps/templates/actor/sections/quicknote.hbs',
+ 'systems/gurps/templates/actor/sections/ranged.hbs',
+ 'systems/gurps/templates/actor/sections/reactions.hbs',
+ 'systems/gurps/templates/actor/sections/resource-controls.hbs',
+ 'systems/gurps/templates/actor/sections/resource-tracker.hbs',
+ 'systems/gurps/templates/actor/sections/secondary-attributes.hbs',
+ 'systems/gurps/templates/actor/sections/skills.hbs',
+ 'systems/gurps/templates/actor/sections/speed-range-table.hbs',
+ 'systems/gurps/templates/actor/sections/spells.hbs',
+ 'systems/gurps/templates/actor/sections/trackers.hbs',
+ ]
+
+ templates.forEach(filename => {
+ let name = filename.substr(filename.lastIndexOf('/') + 1).replace(/(.*)\.hbs/, '$1')
+ fetch(filename)
+ .then(it => it.text())
+ .then(async text => {
+ Handlebars.registerPartial(name, text)
+ })
+ })
}
diff --git a/lib/npc-input.js b/lib/npc-input.js
index a1c6a5693..0cae27b24 100755
--- a/lib/npc-input.js
+++ b/lib/npc-input.js
@@ -7,27 +7,27 @@ import * as HitLocations from '../module/hitlocation/hitlocation.js'
import { i18n, sanitize } from './utilities.js'
import * as settings from '../lib/miscellaneous-settings.js'
-Hooks.once('init', async function() {
- game.settings.registerMenu(settings.SYSTEM_NAME, settings.SETTING_MOOK_DEFAULT_EDITOR, {
- name: i18n('GURPS.settingMookGenerator'),
- label: i18n('GURPS.settingLabelMookGenerator'),
- hint: i18n('GURPS.settingHintMookGenerator'),
- type: NpcInputDefaultEditor,
- restricted: true,
- })
-
- game.settings.register(settings.SYSTEM_NAME, settings.SETTING_MOOK_DEFAULT, {
- name: 'Mook Default',
- scope: 'world',
- config: false,
- type: Object,
- default: new Mook(),
- onChange: value => console.log(`Updated Mook Default: ${value}`),
- })
+Hooks.once('init', async function () {
+ game.settings.registerMenu(settings.SYSTEM_NAME, settings.SETTING_MOOK_DEFAULT_EDITOR, {
+ name: i18n('GURPS.settingMookGenerator'),
+ label: i18n('GURPS.settingLabelMookGenerator'),
+ hint: i18n('GURPS.settingHintMookGenerator'),
+ type: NpcInputDefaultEditor,
+ restricted: true,
+ })
+
+ game.settings.register(settings.SYSTEM_NAME, settings.SETTING_MOOK_DEFAULT, {
+ name: 'Mook Default',
+ scope: 'world',
+ config: false,
+ type: Object,
+ default: new Mook(),
+ onChange: value => console.log(`Updated Mook Default: ${value}`),
+ })
})
Hooks.on(`renderNpcInput`, (app, html, data) => {
- $(html).find('#npc-input-name').focus()
+ $(html).find('#npc-input-name').focus()
})
// Hooks.once("ready", () => { new NpcInput().render(true) });
@@ -37,1209 +37,1209 @@ const ERR = `???:`
// Keys we might see during attribute parsing, and whether we should skip them when looking for data
const POSSIBLE_ATTRIBUTE_KEYS = {
- basic: true, // This is the prefix to "basic speed", "basic move"
- speed: false,
- move: false,
- dodge: false,
- sm: false,
- parry: false,
- block: false,
- dr: false,
- damage: false,
- bl: false,
- fright: true, // prefix to "fright check"
- check: false,
- height: false,
- weight: false,
- age: false,
- dmg: false,
- hp: false,
- fp: false,
- skills: true,
- attributes: true,
- secondary: true,
- characteristics: true,
- advantages: true,
+ basic: true, // This is the prefix to "basic speed", "basic move"
+ speed: false,
+ move: false,
+ dodge: false,
+ sm: false,
+ parry: false,
+ block: false,
+ dr: false,
+ damage: false,
+ bl: false,
+ fright: true, // prefix to "fright check"
+ check: false,
+ height: false,
+ weight: false,
+ age: false,
+ dmg: false,
+ hp: false,
+ fp: false,
+ skills: true,
+ attributes: true,
+ secondary: true,
+ characteristics: true,
+ advantages: true,
}
export class NpcInput extends FormApplication {
- constructor(actor, options = {}) {
- super(options)
- let m = game.settings.get(settings.SYSTEM_NAME, settings.SETTING_MOOK_DEFAULT)
- this.mook = m || new Mook()
- this.testing = true
- }
-
- static get defaultOptions() {
- return mergeObject(super.defaultOptions, {
- classes: ['npc-input', 'sheet', 'actor', 'form'],
- id: 'npc-input',
- template: 'systems/gurps/templates/actor/npc-input.hbs',
- resizable: true,
- minimizable: false,
- width: 800,
- height: 700,
- title: 'Mook Generator',
- })
- }
- getData(options) {
- let data = super.getData(options)
- data.mook = this.mook
- data.mode = this.testing ? 'Test Mook' : 'Create Mook'
- data.displaybuttons = true
- return data
- }
-
- setTesting(t = true) {
- this.testing = t
- this.createButton.innerText = this.testing ? 'Test Mook' : 'Create Mook'
- }
-
- activateListeners(html) {
- super.activateListeners(html)
-
- html.find('.gcs-input-sm2').inputFilter(value => digitsOnly.test(value))
- html.find('input[type=text]').on('change paste keyup', ev => {
- let el = ev.currentTarget
- let k = el.dataset.key
- if (!!k) {
- this.mook[k] = el.value
- this.setTesting()
- }
- })
-
- html.find('.npc-input-ta').on('change', ev => {
- let el = ev.currentTarget
- let k = el.dataset.key
- if (!!k) {
- this.mook[k] = el.value
- this.setTesting()
- }
- })
-
- html.find('#npc-input-create').on('click keydown focusout', ev => {
- if (ev.type == 'click' || (ev.type == 'keydown' && ev.which == 13)) this.createMook(ev)
- else {
- ev.preventDefault()
- $(html).find('#npc-input-name').focus()
- }
- })
- html.find('#npc-input-import').on('click keydown', ev => {
- if (ev.type == 'click' || (ev.type == 'keydown' && ev.which == 13)) this.importStatBlock(ev)
- })
- this.createButton = html.find('#npc-input-create')[0]
-
- const frame = html[0]?.querySelector('.npc-input')
- if (!!frame)
- frame.addEventListener('drop', event => {
- event.preventDefault()
- if (event.originalEvent) event = event.originalEvent
- this.applyDrop(JSON.parse(event.dataTransfer.getData('text/plain')))
- })
- }
-
- applyDrop(data) {
- if (data.actorid) {
- const actorData = game.actors.get(data.actorid).data
- let element = getProperty(actorData, data.key)
- let key = data.key.match(/^[^\.]+\.([^\.]+)/)[1]
- let tmp = ''
- let tmp2 = ''
- let notes = element.notes || ''
- switch (key) {
- case 'skills':
- case 'spells': {
- tmp += element.name + '-' + element.level
- break
- }
- case 'melee':
- case 'ranged': {
- if (element.acc) tmp2 += ' acc ' + element.acc
- if (element.range) tmp2 += ' range ' + element.range
- if (element.rcl) tmp2 += ' rcl ' + element.rcl
- if (element.rof) tmp2 += ' rof ' + element.rof
- if (element.shots) tmp2 += ' shots ' + element.shots
- if (element.st) tmp2 += ' st ' + element.st
- if (element.usage) tmp2 += ' usage' + element.usage
- if (element.bulk) tmp2 += ' bulk ' + element.bulk
- if (element.halfd) tmp2 += ' halfd ' + element.halfd
- if (element.max) tmp2 += ' max ' + element.max
- if (element.parry) tmp2 += ' parry ' + element.parry
- if (element.reach) tmp2 += ' reach ' + element.reach
- if (element.block) tmp2 += ' block ' + element.block
- tmp += element.name + ' (' + element.level + ') ' + element.damage
- break
- }
- case 'ads': {
- key = 'traits'
- tmp += element.name
- if (element.pageref) tmp += ' Page Ref: ' + element.pageref
- break
- }
- case 'notes': {
- tmp += element.notes
- notes = ''
- break
- }
- case 'equipment': {
- tmp += `${element.name}; ${element.count}; $${element.cost}; ${element.weight} lb`
- break
- }
- }
- let orig = this.mook[key]
- tmp = orig + (orig ? '\n' : '') + tmp
- tmp += tmp2
- if (notes) tmp += '\n# ' + notes.split('\n').join('\n# ').replaceAll(';', ',')
- this.mook[key] = tmp
- } else {
- if (data.otf) {
- this.mook.notes += ' [' + data.otf + ']'
- }
- }
- this.setTesting()
- this.render(true)
- }
-
- async importStatBlock(ev) {
- ev.preventDefault()
- let self = this
- let b = this.savedStatBlock || ''
- let d = new Dialog(
- {
- title: `Import Stat Block`,
- content: await renderTemplate('systems/gurps/templates/import-stat-block.html', { block: b }),
- buttons: {
- import: {
- icon: '',
- label: 'Import',
- callback: html => {
- let ta = html.find('#npc-input-import-ta')[0]
- let t = ta.value
- if (t.length < 3) t = EX[parseInt(t)]
- if (!!t) this.parseStatBlock(t)
- self.render(true)
- },
- },
- no: {
- icon: '',
- label: 'Cancel',
- },
- },
- default: false,
- },
- {
- width: 800,
- height: 800,
- }
- )
- d.render(true)
- }
-
- async createMook(ev) {
- ev.preventDefault()
- if (this.testing) {
- let err = this.check()
- if (!!err) ui.notifications.warn('Unable to create Mook: ' + err)
- else this.setTesting(false)
- } else {
- let data = { name: this.mook.name, type: 'character' }
- let a = await GurpsActor.create(data, { renderSheet: false })
- await this.populate(a)
- await a.setFlag('core', 'sheetClass', 'gurps.GurpsActorNpcSheet')
- a.sheet.render(true)
- }
- this.render(true)
- }
-
- async populate(a) {
- let m = this.mook
- let data = a.system
- let att = data.attributes
-
- // + is a trick to force strings to ints
- att.ST.import = +m.st
- att.DX.import = +m.dx
- att.IQ.import = +m.iq
- att.HT.import = +m.ht
- att.WILL.import = +m.will
- att.PER.import = +m.per
-
- data.HP.max = +m.hp
- data.HP.value = +m.hp
- data.FP.max = +m.fp
- data.FP.value = +m.fp
-
- data.basicmove.value = parseInt(m.move)
- data.basicspeed.value = m.speed
- data.frightcheck = m.will
- if (!!m.check) data.frightcheck = m.check // Imported "fright check"
-
- data.hearing = m.per
- data.tastesmell = m.per
- data.touch = m.per
- data.vision = m.per
- if (!!m.parry) data.parry = parseInt(m.parry)
- if (!!m.block) data.block = parseInt(m.block)
-
- let ns = {}
- let nt = new Note(m.notes.trim())
- GURPS.put(ns, nt)
-
- // Since we removed the default hitlocations from template.json, we need to create at least one entry for the mook
- // But to maintain a similar look, we will just recreate the humanoid locations.
- let hls = {}
- for (const [key, value] of Object.entries(HitLocations.hitlocationDictionary.humanoid)) {
- let loc = { ...value, ...{ where: key } }
- if (key == HitLocations.HitLocation.TORSO) loc.import = m.dr
- GURPS.put(hls, loc)
- }
-
- let es = {}
- let e = new Encumbrance()
- e.level = 0
- e.current = true
- e.key = 'enc0'
- e.weight = 0
- e.move = parseInt(m.move)
- e.dodge = parseInt(m.dodge)
- GURPS.put(es, e)
-
- let melee = {}
- m.a_melee.forEach(me => GURPS.put(melee, me))
-
- let ranged = {}
- m.a_ranged.forEach(r => GURPS.put(ranged, r))
-
- let ts = {}
- ts.title = m.title
- let dt = new Date().toString().split(' ').splice(1, 3).join(' ')
- ts.createdon = dt
- if (!!m.sm) ts.sizemod = m.sm[0] == '-' ? m.sm : m.sm[0] == '+' ? '' : '+' + m.sm
- ts.appearance = m.desc
- ts.height = m.height
- ts.weight = m.weight
- ts.age = m.age
-
- let skills = {}
- m.a_skills.forEach(s => GURPS.put(skills, s))
-
- let spells = {}
- m.a_spells.forEach(s => GURPS.put(spells, s))
-
- let ads = {}
- m.a_traits.forEach(a => GURPS.put(ads, a))
-
- let eqt = {}
- m.a_equipment.forEach(e => GURPS.put(eqt, e))
-
- let dmg = m.damage || m.dmg || ''
- let thrst = dmg.split('/')[0]
- let swng = dmg.split('/')[1]
- if (!swng && !!thrst) {
- swng = thrst
- thrst = ''
- }
-
- let commit = {
- 'data.attributes': att,
- 'data.HP': data.HP,
- 'data.FP': data.FP,
- 'data.basicmove': data.basicmove,
- 'data.basicspeed': data.basicspeed,
- 'data.currentmove': parseInt(m.move),
- 'data.currentdodge': parseInt(m.dodge),
- 'data.frightcheck': data.frightcheck,
- 'data.hearing': data.hearing,
- 'data.tastesmell': data.tastesmell,
- 'data.touch': data.touch,
- 'data.vision': data.vision,
- 'data.equippedparry': data.parry,
- 'data.parry': data.parry,
- 'data.equippedblock': data.block,
- 'data.block': data.block,
- 'data.notes': ns,
- 'data.hitlocations': hls,
- 'data.encumbrance': es,
- 'data.melee': melee,
- 'data.ranged': ranged,
- 'data.traits': ts,
- 'data.skills': skills,
- 'data.spells': spells,
- 'data.ads': ads,
- 'data.swing': swng,
- 'data.thrust': thrst,
- 'data.equipment.carried': eqt,
- }
-
- await a.update(commit)
- await a.postImport()
- console.log('Created Mook:')
- console.log(a)
- }
-
- sanit(key) {
- this.mook[key] = sanitize(this.mook[key])
- }
-
- check() {
- let e = ''
- if (!this.mook.name) e = ', No Name'
- this.sanit('melee')
- this.sanit('ranged')
- this.sanit('traits')
- this.sanit('skills')
- this.sanit('spells')
- this.sanit('equipment')
-
- if (this.checkTraits()) e += ', Error in Traits'
- if (this.checkSkills()) e += ', Error in Skills'
- if (this.checkMelee()) e += ', Error in Melee'
- if (this.checkRanged()) e += ', Error in Ranged'
- if (this.checkSpells()) e += ', Error in Spells'
- if (this.checkEquipment()) e += ', Error in Equipment'
- return e.substr(2)
- }
-
- // return an array of string representing each line
- prep(text, delim) {
- var ans
- if (!!delim) ans = this.parseDelimLines(text, delim)
- else ans = text.split('\n')
- return ans.map(e => this.cleanLine(e)).filter(e => e.length > 0)
- }
-
- // Allow () to include delims without breaking line
- parseDelimLines(str, delim) {
- let arr = []
- let i = 0
- let line = ''
- let d = 0
- while (i < str.length) {
- let c = str[i++]
- if ((c == delim && d == 0) || c == '\n') {
- arr.push(line)
- line = ''
- } else {
- line += c
- if (c == '(') d++
- if (c == ')') d--
- }
- }
- if (!!line) arr.push(line)
- return arr
- }
-
- checkSkills() {
- const m = this.mook
- let txt = ''
- let arr = []
- this.prep(m.skills, ';').forEach(e => {
- if (e.includes(ERR)) return
- txt += '\n' + e
- if (e.startsWith(COMMENT_CHAR)) {
- if (arr.length > 0) this.addToNotes(arr, e.substr(1), ' ')
- return
- }
- const i = e.lastIndexOf('-')
- if (i < 1) return (txt += `\n${ERR} missing '-'`)
- const n = e.substring(0, i).trim()
- const v = e.substr(i + 1).trim()
- if (!v) return (txt += `\n${ERR} missing skill level`)
- if (isNaN(v)) return (txt += `\n${ERR} "${v}" is not a number`)
- arr.push(new Skill(n, v))
- })
- m.skills = txt.substr(1)
- m.a_skills = arr
- return txt.includes(ERR)
- }
-
- checkSpells() {
- const m = this.mook
- let txt = ''
- let arr = []
- this.prep(m.spells, ';').forEach(e => {
- if (e.includes(ERR)) return
- txt += '\n' + e
- if (e.startsWith(COMMENT_CHAR)) {
- if (arr.length > 0) this.addToNotes(arr, e.substr(1), ' ')
- return
- }
- const i = e.lastIndexOf('-')
- if (i < 1) return (txt += `\n${ERR} missing '-'`)
- const n = e.substring(0, i).trim()
- const v = e.substr(i + 1).trim()
- if (!v) return (txt += `\n${ERR} missing spell level`)
- if (isNaN(v)) return (txt += `\n${ERR} "${v}" is not a number`)
- arr.push(new Skill(n, v))
- })
- m.spell = txt.substr(1)
- m.a_spells = arr
- return txt.includes(ERR)
- }
-
- checkMelee() {
- const pats = [
- { regex: '(^usage|^Usage|^mode|^Mode)\\w+', var: 'mode' },
- { regex: '(^parry|^Parry)\\d+', var: 'parry' },
- { regex: '(^reach|^Reach)[\\w,]+', var: 'reach' },
- { regex: '(^st|^ST|^St)\\d+', var: 'st' },
- { regex: '(^block|^Block)\\d+', var: 'block' },
- ]
- const m = this.mook
- let txt = ''
- let arr = []
- this.prep(m.melee).forEach(e => {
- if (e.includes(ERR)) return
- txt += '\n' + e
- if (e.startsWith(COMMENT_CHAR)) {
- if (arr.length > 0) this.addToNotes(arr, e.substr(1), ' ')
- return
- }
- var me, remain
- let parse = e.replace(
- /(.*) ?\((\d+)\) (\d+)d(\d*)([-+]\d+)?([xX\*]\d+)?(\([.\d]+\))?(!)? ?(\w+\+?\+?)(.*)$/g,
- '$1~$2~$3~$4~$5~$6~$7~$8~$9~$10'
- )
- if (e != parse) {
- parse = parse.split('~')
- me = new Melee(
- parse[0].trim(),
- parse[1],
- parse[2] + 'd' + parse[3] + parse[4] + parse[5] + parse[6] + parse[7] + ' ' + parse[8]
- )
- remain = parse[9].trim()
- } else {
- parse = e.replace(/(.*) ?\(([ \w]+)\) "([^"]+)" ?(.*)$/g, '$1~$2~$3~$4')
- if (e == parse) return (txt += `\n${ERR} unable to find (level) and damage`)
- parse = parse.split('~')
- me = new Melee(parse[0].trim(), parse[1], parse[2])
- remain = parse[3].trim()
- }
- if (!!remain) {
- let ext = remain.replace(/ +/g, ' ').split(' ')
- if (ext.length % 2 != 0) return (txt += `\n${ERR} unable to parse "${remain}"`)
- for (let i = 0; i < ext.length; i += 2) {
- let s = ext[i] + ext[i + 1]
- let found = false
- pats.forEach(p => {
- if (s.match(new RegExp(p.regex))) {
- me[p.var] = ext[i + 1]
- found = true
- }
- })
- if (!found) return (txt += `\n${ERR} unknown pattern "${ext[i]} ${ext[i + 1]}"`)
- }
- }
- arr.push(me)
- })
- m.melee = txt.substr(1)
- m.a_melee = arr
- return txt.includes(ERR)
- }
-
- checkRanged() {
- const pats = [
- { regex: '(^acc|^Acc)\\d+', var: 'acc' },
- { regex: '(^rof|^RoF|^Rof)\\d+', var: 'rof' },
- { regex: '(^rcl|^Rcl)\\d+', var: 'rcl' },
- { regex: '(^usage|^Usage|^mode|^Mode)\\w+', var: 'mode' },
- { regex: '(^range|^Range)\\d+(\\/\\d+)?', var: 'range' },
- { regex: '(^shots|^Shots)[\\w\\)\\(]+', var: 'shots' },
- { regex: '(^bulk|^Bulk)[\\w-]+', var: 'bulk' },
- { regex: '(^st|^ST|^St)\\d+', var: 'st' },
- { regex: '^halfd\\d+', var: 'halfd' },
- { regex: '^max\\d+', var: 'max' },
- ]
- const m = this.mook
- let txt = ''
- let arr = []
- this.prep(m.ranged).forEach(e => {
- if (e.includes(ERR)) return
- txt += '\n' + e
- if (e.startsWith(COMMENT_CHAR)) {
- if (arr.length > 0) this.addToNotes(arr, e.substr(1), ' ')
- return
- }
- let parse = e.replace(
- /(.*) ?\((\d+)\) (\d+)d(\d*)([-+]\d+)?([xX\*]\d+)?(\([.\d]+\))?(!)?:? ?([\w-+]+)(.*)/g,
- '$1~$2~$3~$4~$5~$6~$7~$8~$9~$10'
- )
-
- var r, remain
- if (e != parse) {
- parse = parse.split('~')
- r = new Ranged(
- parse[0].trim(),
- parse[1],
- parse[2] + 'd' + parse[3] + parse[4] + parse[5] + parse[6] + parse[7] + ' ' + parse[8]
- )
- remain = parse[9].trim()
- } else {
- parse = e.replace(/(.*) ?\(([ \w]+)\):? "([^"]+)" ?(.*)$/g, '$1~$2~$3~$4')
- if (e == parse) return (txt += `\n${ERR} unable to find (level) and damage`)
- parse = parse.split('~')
- r = new Ranged(parse[0].trim(), parse[1], parse[2])
- remain = parse[3].trim()
- }
- if (!!remain) {
- let ext = remain.trim().replace(/ +/g, ' ').split(' ')
- if (ext.length % 2 != 0) return (txt += `\n${ERR} unable to parse for `)
- for (let i = 0; i < ext.length; i += 2) {
- let s = ext[i] + ext[i + 1]
- let found = false
- pats.forEach(p => {
- if (s.match(new RegExp(p.regex))) {
- r[p.var] = ext[i + 1]
- found = true
- }
- })
- if (!found) return (txt += `\n${ERR} unknown pattern "${ext[i]} ${ext[i + 1]}"`)
- }
- }
- r.checkRange()
- arr.push(r)
- })
- m.ranged = txt.substr(1)
- m.a_ranged = arr
- return txt.includes(ERR)
- }
-
- addToNotes(arr, note, delim) {
- if (arr.length == 0) return
- let n = arr[arr.length - 1].notes
- if (!!n) n += delim + note
- else n = note
- arr[arr.length - 1].notes = n
- }
-
- checkTraits() {
- const m = this.mook
- let txt = ''
- let arr = []
- this.prep(m.traits, ';').forEach(e => {
- txt += '\n' + e
- if (e.startsWith(COMMENT_CHAR)) {
- if (arr.length > 0) this.addToNotes(arr, e.substr(1), '\n')
- return
- }
- arr.push(new Advantage(e))
- })
- m.traits = txt.substr(1)
- m.a_traits = arr
- return false
- }
-
- checkEquipment() {
- const m = this.mook
- let txt = ''
- let arr = []
- this.prep(m.equipment).forEach(e => {
- if (e.includes(ERR)) return
- txt += '\n' + e
- if (e.startsWith(COMMENT_CHAR)) {
- this.addToNotes(arr, e.substr(1), '\n')
- return
- }
- let a = e.split(';')
- if (a.length != 4) {
- return (txt += `\n${ERR} Expecting example';
- * XRegExp.matchRecursive(str2, 'an', start: 8, end: 13},
- * // {name: 'match', value: ' ', start: 27, end: 33},
- * // {name: 'between', value: ' example', start: 33, end: 41}
- * // ]
- *
- * // Omitting unneeded parts with null valueNames, and using escapeChar
- * const str3 = '...{1}.\\{{function(x,y){return {y:x}}}';
- * XRegExp.matchRecursive(str3, '{', '}', 'g', {
- * valueNames: ['literal', null, 'value', null],
- * escapeChar: '\\'
- * });
- * // -> [
- * // {name: 'literal', value: '...', start: 0, end: 3},
- * // {name: 'value', value: '1', start: 4, end: 5},
- * // {name: 'literal', value: '.\\{', start: 6, end: 9},
- * // {name: 'value', value: 'function(x,y){return {y:x}}', start: 10, end: 37}
- * // ]
- *
- * // Sticky mode via flag y
- * const str4 = '<1><<<2>>><3>4<5>';
- * XRegExp.matchRecursive(str4, '<', '>', 'gy');
- * // -> ['1', '<<2>>', '3']
- *
- * // Skipping unbalanced delimiters instead of erroring
- * const str5 = 'Here is an', start: 13, end: 27},
- * // {name: 'right', value: ' ', 'gi', {
- * unbalanced: 'skip'
- * });
- * // -> ['an']
- */
-
-
- XRegExp.matchRecursive = function (str, left, right, flags, options) {
- flags = flags || '';
- options = options || {};
- var global = (0, _indexOf["default"])(flags).call(flags, 'g') !== -1;
- var sticky = (0, _indexOf["default"])(flags).call(flags, 'y') !== -1; // Flag `y` is handled manually
-
- var basicFlags = flags.replace(/y/g, '');
- left = XRegExp(left, basicFlags);
- right = XRegExp(right, basicFlags);
- var esc;
- var _options = options,
- escapeChar = _options.escapeChar;
-
- if (escapeChar) {
- var _context, _context2;
-
- if (escapeChar.length > 1) {
- throw new Error('Cannot use more than one escape character');
- }
-
- escapeChar = XRegExp.escape(escapeChar); // Example of concatenated `esc` regex:
- // `escapeChar`: '%'
- // `left`: '<'
- // `right`: '>'
- // Regex is: /(?:%[\S\s]|(?:(?!<|>)[^%])+)+/
-
- esc = new RegExp((0, _concat["default"])(_context = (0, _concat["default"])(_context2 = "(?:".concat(escapeChar, "[\\S\\s]|(?:(?!")).call(_context2, // Using `XRegExp.union` safely rewrites backreferences in `left` and `right`.
- // Intentionally not passing `basicFlags` to `XRegExp.union` since any syntax
- // transformation resulting from those flags was already applied to `left` and
- // `right` when they were passed through the XRegExp constructor above.
- XRegExp.union([left, right], '', {
- conjunction: 'or'
- }).source, ")[^")).call(_context, escapeChar, "])+)+"), // Flags `gy` not needed here
- flags.replace(XRegExp._hasNativeFlag('s') ? /[^imsu]/g : /[^imu]/g, ''));
- }
-
- var openTokens = 0;
- var delimStart = 0;
- var delimEnd = 0;
- var lastOuterEnd = 0;
- var outerStart;
- var innerStart;
- var leftMatch;
- var rightMatch;
- var vN = options.valueNames;
- var output = [];
-
- while (true) {
- // If using an escape character, advance to the delimiter's next starting position,
- // skipping any escaped characters in between
- if (escapeChar) {
- delimEnd += (XRegExp.exec(str, esc, delimEnd, 'sticky') || [''])[0].length;
- }
-
- leftMatch = XRegExp.exec(str, left, delimEnd);
- rightMatch = XRegExp.exec(str, right, delimEnd); // Keep the leftmost match only
-
- if (leftMatch && rightMatch) {
- if (leftMatch.index <= rightMatch.index) {
- rightMatch = null;
- } else {
- leftMatch = null;
+ var p = (n[i] = { exports: {} })
+ e[i][0].call(
+ p.exports,
+ function (r) {
+ var n = e[i][1][r]
+ return o(n || r)
+ },
+ p,
+ p.exports,
+ r,
+ e,
+ n,
+ t
+ )
}
- } // Paths (LM: leftMatch, RM: rightMatch, OT: openTokens):
- // LM | RM | OT | Result
- // 1 | 0 | 1 | loop
- // 1 | 0 | 0 | loop
- // 0 | 1 | 1 | loop
- // 0 | 1 | 0 | throw
- // 0 | 0 | 1 | throw
- // 0 | 0 | 0 | break
- // The paths above don't include the sticky mode special case. The loop ends after the
- // first completed match if not `global`.
-
-
- if (leftMatch || rightMatch) {
- delimStart = (leftMatch || rightMatch).index;
- delimEnd = delimStart + (leftMatch || rightMatch)[0].length;
- } else if (!openTokens) {
- break;
+ return n[i].exports
}
-
- if (sticky && !openTokens && delimStart > lastOuterEnd) {
- break;
- }
-
- if (leftMatch) {
- if (!openTokens) {
- outerStart = delimStart;
- innerStart = delimEnd;
- }
-
- openTokens += 1;
- } else if (rightMatch && openTokens) {
- openTokens -= 1;
-
- if (!openTokens) {
- if (vN) {
- if (vN[0] && outerStart > lastOuterEnd) {
- output.push(row(vN[0], (0, _slice["default"])(str).call(str, lastOuterEnd, outerStart), lastOuterEnd, outerStart));
+ for (var u = 'function' == typeof require && require, i = 0; i < t.length; i++) o(t[i])
+ return o
+ }
+ return r
+ })()(
+ {
+ 1: [
+ function (require, module, exports) {
+ 'use strict'
+
+ var _Object$defineProperty = require('@babel/runtime-corejs3/core-js-stable/object/define-property')
+
+ var _interopRequireDefault = require('@babel/runtime-corejs3/helpers/interopRequireDefault')
+
+ _Object$defineProperty(exports, '__esModule', {
+ value: true,
+ })
+
+ exports['default'] = void 0
+
+ var _reduce = _interopRequireDefault(require('@babel/runtime-corejs3/core-js-stable/instance/reduce'))
+
+ var _map = _interopRequireDefault(require('@babel/runtime-corejs3/core-js-stable/instance/map'))
+
+ var _indexOf = _interopRequireDefault(require('@babel/runtime-corejs3/core-js-stable/instance/index-of'))
+
+ var _concat = _interopRequireDefault(require('@babel/runtime-corejs3/core-js-stable/instance/concat'))
+
+ /*!
+ * XRegExp.build 5.1.0
+ * an unbalanced example';
- * XRegExp.matchRecursive(str5, ' example';
+ * XRegExp.matchRecursive(str2, 'an', start: 8, end: 13},
+ * // {name: 'match', value: ' ', start: 27, end: 33},
+ * // {name: 'between', value: ' example', start: 33, end: 41}
+ * // ]
+ *
+ * // Omitting unneeded parts with null valueNames, and using escapeChar
+ * const str3 = '...{1}.\\{{function(x,y){return {y:x}}}';
+ * XRegExp.matchRecursive(str3, '{', '}', 'g', {
+ * valueNames: ['literal', null, 'value', null],
+ * escapeChar: '\\'
+ * });
+ * // -> [
+ * // {name: 'literal', value: '...', start: 0, end: 3},
+ * // {name: 'value', value: '1', start: 4, end: 5},
+ * // {name: 'literal', value: '.\\{', start: 6, end: 9},
+ * // {name: 'value', value: 'function(x,y){return {y:x}}', start: 10, end: 37}
+ * // ]
+ *
+ * // Sticky mode via flag y
+ * const str4 = '<1><<<2>>><3>4<5>';
+ * XRegExp.matchRecursive(str4, '<', '>', 'gy');
+ * // -> ['1', '<<2>>', '3']
+ *
+ * // Skipping unbalanced delimiters instead of erroring
+ * const str5 = 'Here is an', start: 13, end: 27},
+ * // {name: 'right', value: ' ', 'gi', {
+ * unbalanced: 'skip'
+ * });
+ * // -> ['an']
+ */
+
+ XRegExp.matchRecursive = function (str, left, right, flags, options) {
+ flags = flags || ''
+ options = options || {}
+ var global = (0, _indexOf['default'])(flags).call(flags, 'g') !== -1
+ var sticky = (0, _indexOf['default'])(flags).call(flags, 'y') !== -1 // Flag `y` is handled manually
+
+ var basicFlags = flags.replace(/y/g, '')
+ left = XRegExp(left, basicFlags)
+ right = XRegExp(right, basicFlags)
+ var esc
+ var _options = options,
+ escapeChar = _options.escapeChar
+
+ if (escapeChar) {
+ var _context, _context2
+
+ if (escapeChar.length > 1) {
+ throw new Error('Cannot use more than one escape character')
+ }
+
+ escapeChar = XRegExp.escape(escapeChar) // Example of concatenated `esc` regex:
+ // `escapeChar`: '%'
+ // `left`: '<'
+ // `right`: '>'
+ // Regex is: /(?:%[\S\s]|(?:(?!<|>)[^%])+)+/
+
+ esc = new RegExp(
+ (0, _concat['default'])(
+ (_context = (0, _concat['default'])((_context2 = '(?:'.concat(escapeChar, '[\\S\\s]|(?:(?!'))).call(
+ _context2, // Using `XRegExp.union` safely rewrites backreferences in `left` and `right`.
+ // Intentionally not passing `basicFlags` to `XRegExp.union` since any syntax
+ // transformation resulting from those flags was already applied to `left` and
+ // `right` when they were passed through the XRegExp constructor above.
+ XRegExp.union([left, right], '', {
+ conjunction: 'or',
+ }).source,
+ ')[^'
+ ))
+ ).call(_context, escapeChar, '])+)+'), // Flags `gy` not needed here
+ flags.replace(XRegExp._hasNativeFlag('s') ? /[^imsu]/g : /[^imu]/g, '')
+ )
+ }
+
+ var openTokens = 0
+ var delimStart = 0
+ var delimEnd = 0
+ var lastOuterEnd = 0
+ var outerStart
+ var innerStart
+ var leftMatch
+ var rightMatch
+ var vN = options.valueNames
+ var output = []
+
+ while (true) {
+ // If using an escape character, advance to the delimiter's next starting position,
+ // skipping any escaped characters in between
+ if (escapeChar) {
+ delimEnd += (XRegExp.exec(str, esc, delimEnd, 'sticky') || [''])[0].length
+ }
+
+ leftMatch = XRegExp.exec(str, left, delimEnd)
+ rightMatch = XRegExp.exec(str, right, delimEnd) // Keep the leftmost match only
+
+ if (leftMatch && rightMatch) {
+ if (leftMatch.index <= rightMatch.index) {
+ rightMatch = null
+ } else {
+ leftMatch = null
+ }
+ } // Paths (LM: leftMatch, RM: rightMatch, OT: openTokens):
+ // LM | RM | OT | Result
+ // 1 | 0 | 1 | loop
+ // 1 | 0 | 0 | loop
+ // 0 | 1 | 1 | loop
+ // 0 | 1 | 0 | throw
+ // 0 | 0 | 1 | throw
+ // 0 | 0 | 0 | break
+ // The paths above don't include the sticky mode special case. The loop ends after the
+ // first completed match if not `global`.
+
+ if (leftMatch || rightMatch) {
+ delimStart = (leftMatch || rightMatch).index
+ delimEnd = delimStart + (leftMatch || rightMatch)[0].length
+ } else if (!openTokens) {
+ break
+ }
+
+ if (sticky && !openTokens && delimStart > lastOuterEnd) {
+ break
+ }
+
+ if (leftMatch) {
+ if (!openTokens) {
+ outerStart = delimStart
+ innerStart = delimEnd
+ }
+
+ openTokens += 1
+ } else if (rightMatch && openTokens) {
+ openTokens -= 1
+
+ if (!openTokens) {
+ if (vN) {
+ if (vN[0] && outerStart > lastOuterEnd) {
+ output.push(
+ row(
+ vN[0],
+ (0, _slice['default'])(str).call(str, lastOuterEnd, outerStart),
+ lastOuterEnd,
+ outerStart
+ )
+ )
+ }
+
+ if (vN[1]) {
+ output.push(
+ row(
+ vN[1],
+ (0, _slice['default'])(str).call(str, outerStart, innerStart),
+ outerStart,
+ innerStart
+ )
+ )
+ }
+
+ if (vN[2]) {
+ output.push(
+ row(
+ vN[2],
+ (0, _slice['default'])(str).call(str, innerStart, delimStart),
+ innerStart,
+ delimStart
+ )
+ )
+ }
+
+ if (vN[3]) {
+ output.push(
+ row(vN[3], (0, _slice['default'])(str).call(str, delimStart, delimEnd), delimStart, delimEnd)
+ )
+ }
+ } else {
+ output.push((0, _slice['default'])(str).call(str, innerStart, delimStart))
+ }
+
+ lastOuterEnd = delimEnd
+
+ if (!global) {
+ break
+ }
+ } // Found unbalanced delimiter
+ } else {
+ var unbalanced = options.unbalanced || 'error'
+
+ if (unbalanced === 'skip' || unbalanced === 'skip-lazy') {
+ if (rightMatch) {
+ rightMatch = null // No `leftMatch` for unbalanced left delimiter because we've reached the string end
+ } else {
+ if (unbalanced === 'skip') {
+ var outerStartDelimLength = XRegExp.exec(str, left, outerStart, 'sticky')[0].length
+ delimEnd = outerStart + (outerStartDelimLength || 1)
+ } else {
+ delimEnd = outerStart + 1
+ }
+
+ openTokens = 0
+ }
+ } else if (unbalanced === 'error') {
+ var _context3
+
+ var delimSide = rightMatch ? 'right' : 'left'
+ var errorPos = rightMatch ? delimStart : outerStart
+ throw new Error(
+ (0, _concat['default'])(
+ (_context3 = 'Unbalanced '.concat(delimSide, ' delimiter found in string at position '))
+ ).call(_context3, errorPos)
+ )
+ } else {
+ throw new Error('Unsupported value for unbalanced: '.concat(unbalanced))
+ }
+ } // If the delimiter matched an empty string, avoid an infinite loop
+
+ if (delimStart === delimEnd) {
+ delimEnd += 1
+ }
+ }
+
+ if (global && output.length > 0 && !sticky && vN && vN[0] && str.length > lastOuterEnd) {
+ output.push(row(vN[0], (0, _slice['default'])(str).call(str, lastOuterEnd), lastOuterEnd, str.length))
+ }
+
+ return output
+ }
}
- } // Found unbalanced delimiter
- } else {
- var unbalanced = options.unbalanced || 'error';
-
- if (unbalanced === 'skip' || unbalanced === 'skip-lazy') {
- if (rightMatch) {
- rightMatch = null; // No `leftMatch` for unbalanced left delimiter because we've reached the string end
- } else {
- if (unbalanced === 'skip') {
- var outerStartDelimLength = XRegExp.exec(str, left, outerStart, 'sticky')[0].length;
- delimEnd = outerStart + (outerStartDelimLength || 1);
- } else {
- delimEnd = outerStart + 1;
+ exports['default'] = _default
+ module.exports = exports.default
+ },
+ {
+ '@babel/runtime-corejs3/core-js-stable/instance/concat': 11,
+ '@babel/runtime-corejs3/core-js-stable/instance/index-of': 14,
+ '@babel/runtime-corejs3/core-js-stable/instance/slice': 17,
+ '@babel/runtime-corejs3/core-js-stable/object/define-property': 20,
+ '@babel/runtime-corejs3/helpers/interopRequireDefault': 30,
+ },
+ ],
+ 3: [
+ function (require, module, exports) {
+ 'use strict'
+
+ var _sliceInstanceProperty = require('@babel/runtime-corejs3/core-js-stable/instance/slice')
+
+ var _Array$from = require('@babel/runtime-corejs3/core-js-stable/array/from')
+
+ var _Symbol = require('@babel/runtime-corejs3/core-js-stable/symbol')
+
+ var _getIteratorMethod = require('@babel/runtime-corejs3/core-js/get-iterator-method')
+
+ var _Array$isArray = require('@babel/runtime-corejs3/core-js-stable/array/is-array')
+
+ var _Object$defineProperty = require('@babel/runtime-corejs3/core-js-stable/object/define-property')
+
+ var _interopRequireDefault = require('@babel/runtime-corejs3/helpers/interopRequireDefault')
+
+ _Object$defineProperty(exports, '__esModule', {
+ value: true,
+ })
+
+ exports['default'] = void 0
+
+ var _slicedToArray2 = _interopRequireDefault(require('@babel/runtime-corejs3/helpers/slicedToArray'))
+
+ var _forEach = _interopRequireDefault(require('@babel/runtime-corejs3/core-js-stable/instance/for-each'))
+
+ var _concat = _interopRequireDefault(require('@babel/runtime-corejs3/core-js-stable/instance/concat'))
+
+ var _indexOf = _interopRequireDefault(require('@babel/runtime-corejs3/core-js-stable/instance/index-of'))
+
+ function _createForOfIteratorHelper(o, allowArrayLike) {
+ var it = (typeof _Symbol !== 'undefined' && _getIteratorMethod(o)) || o['@@iterator']
+ if (!it) {
+ if (
+ _Array$isArray(o) ||
+ (it = _unsupportedIterableToArray(o)) ||
+ (allowArrayLike && o && typeof o.length === 'number')
+ ) {
+ if (it) o = it
+ var i = 0
+ var F = function F() {}
+ return {
+ s: F,
+ n: function n() {
+ if (i >= o.length) return { done: true }
+ return { done: false, value: o[i++] }
+ },
+ e: function e(_e) {
+ throw _e
+ },
+ f: F,
+ }
+ }
+ throw new TypeError(
+ 'Invalid attempt to iterate non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.'
+ )
+ }
+ var normalCompletion = true,
+ didErr = false,
+ err
+ return {
+ s: function s() {
+ it = it.call(o)
+ },
+ n: function n() {
+ var step = it.next()
+ normalCompletion = step.done
+ return step
+ },
+ e: function e(_e2) {
+ didErr = true
+ err = _e2
+ },
+ f: function f() {
+ try {
+ if (!normalCompletion && it['return'] != null) it['return']()
+ } finally {
+ if (didErr) throw err
+ }
+ },
}
-
- openTokens = 0;
}
- } else if (unbalanced === 'error') {
- var _context3;
- var delimSide = rightMatch ? 'right' : 'left';
- var errorPos = rightMatch ? delimStart : outerStart;
- throw new Error((0, _concat["default"])(_context3 = "Unbalanced ".concat(delimSide, " delimiter found in string at position ")).call(_context3, errorPos));
- } else {
- throw new Error("Unsupported value for unbalanced: ".concat(unbalanced));
- }
- } // If the delimiter matched an empty string, avoid an infinite loop
+ function _unsupportedIterableToArray(o, minLen) {
+ var _context4
+ if (!o) return
+ if (typeof o === 'string') return _arrayLikeToArray(o, minLen)
+ var n = _sliceInstanceProperty((_context4 = Object.prototype.toString.call(o))).call(_context4, 8, -1)
+ if (n === 'Object' && o.constructor) n = o.constructor.name
+ if (n === 'Map' || n === 'Set') return _Array$from(o)
+ if (n === 'Arguments' || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n))
+ return _arrayLikeToArray(o, minLen)
+ }
+ function _arrayLikeToArray(arr, len) {
+ if (len == null || len > arr.length) len = arr.length
+ for (var i = 0, arr2 = new Array(len); i < len; i++) {
+ arr2[i] = arr[i]
+ }
+ return arr2
+ }
- if (delimStart === delimEnd) {
- delimEnd += 1;
- }
- }
+ /*!
+ * XRegExp Unicode Base 5.1.0
+ * an unbalanced example';
+ * XRegExp.matchRecursive(str5, '${msg}`
- )
- )
- },
- function() {
- $(this).find('div').last().remove()
- }
- )
-
- html.find('#qnotes').dblclick(ex => {
- let n = this.actor.system.additionalresources.qnotes || ''
- n = n.replace(/
/g, '\n')
- let actor = this.actor
- new Dialog({
- title: 'Edit Quick Note',
- content: `Enter a Quick Note (a great place to put an On-the-Fly formula!):
Examples:
+ /** @override */
+ static get defaultOptions() {
+ return mergeObject(super.defaultOptions, {
+ classes: ['gurps', 'sheet', 'actor'],
+ width: 800,
+ height: 800,
+ tabs: [{ navSelector: '.gurps-sheet-tabs', contentSelector: '.sheet-body', initial: 'description' }],
+ scrollY: [
+ '.gurpsactorsheet #advantages #reactions #melee #ranged #skills #spells #equipmentcarried #equipmentother #notes',
+ ],
+ dragDrop: [{ dragSelector: '.item-list .item', dropSelector: null }],
+ })
+ }
+
+ /* -------------------------------------------- */
+
+ /** @override */
+ get template() {
+ if (!game.user.isGM && this.actor.limited) return 'systems/gurps/templates/actor/actor-sheet-gcs-limited.hbs'
+ return 'systems/gurps/templates/actor/actor-sheet-gcs.hbs'
+ }
+
+ /* -------------------------------------------- */
+
+ async close(options = {}) {
+ await super.close(options)
+ GURPS.ClearLastActor(this.actor)
+ }
+
+ // Hack to keep sheet from flashing during multiple DB updates
+ async _render(...args) {
+ //console.log("IgnoreRender: " + this.object?.ignoreRender)
+ if (!!this.object?.ignoreRender) return
+ await super._render(...args)
+ }
+
+ update(data, options) {
+ super.update(data, options)
+ }
+
+ /** @override */
+ getData() {
+ const sheetData = super.getData()
+ sheetData.olddata = sheetData.data
+ sheetData.data = this.actor.system
+ sheetData.ranges = GURPS.rangeObject.ranges
+ sheetData.useCI = GURPS.ConditionalInjury.isInUse()
+ sheetData.conditionalEffectsTable = GURPS.ConditionalInjury.conditionalEffectsTable()
+ GURPS.SetLastActor(this.actor)
+ sheetData.eqtsummary = this.actor.system.eqtsummary
+ sheetData.navigateVisible = game.settings.get(settings.SYSTEM_NAME, settings.SETTING_SHOW_SHEET_NAVIGATION)
+ sheetData.isGM = game.user.isGM
+ sheetData._id = sheetData.olddata._id
+ sheetData.effects = this.actor.getEmbeddedCollection('ActiveEffect').contents
+ sheetData.useQN = game.settings.get(settings.SYSTEM_NAME, settings.SETTING_USE_QUINTESSENCE)
+
+ return sheetData
+ }
+
+ /* -------------------------------------------- */
+
+ /**
+ * @inheritdoc
+ * @param {JQuery${msg}`
+ )
+ )
+ },
+ function () {
+ $(this).find('div').last().remove()
+ }
+ )
+
+ html.find('#qnotes').dblclick(ex => {
+ let n = this.actor.system.additionalresources.qnotes || ''
+ n = n.replace(/
/g, '\n')
+ let actor = this.actor
+ new Dialog({
+ title: 'Edit Quick Note',
+ content: `Enter a Quick Note (a great place to put an On-the-Fly formula!):
Examples:
[+1 due to shield]
[Dodge +3 retreat]
[Dodge +2 Feverish Defense *Cost 1FP]`,
- buttons: {
- save: {
- icon: '',
- label: 'Save',
- callback: html => {
- const i = html[0].querySelector('#i')
- actor.update({ 'data.additionalresources.qnotes': i.value.replace(/\n/g, '
') })
- },
- },
- },
- render: h => {
- $(h).find('textarea').on('drop', this.dropFoundryLinks)
- $(h).find('input').on('drop', this.dropFoundryLinks)
- },
- }).render(true)
- })
-
- html.find('#qnotes').on('drop', this.handleQnoteDrop.bind(this))
-
- html.find('#maneuver').on('change', ev => {
- let target = $(ev.currentTarget)
- this.actor.replaceManeuver(target.val())
- })
-
- html.find('#posture').on('change', ev => {
- let target = $(ev.currentTarget)
- this.actor.replacePosture(target.val())
- })
-
- html.find('#move-mode').on('change', ev => {
- let target = $(ev.currentTarget)
- this.actor.setMoveDefault(target.val())
- })
-
- html.find('#open-modifier-popup').on('click', this._showActiveEffectsListPopup.bind(this))
- html.find('#edit-move-modes').on('click', this._showMoveModeEditorPopup.bind(this))
-
- html.find('#addFirstResourceTracker').on('click', ev => this._addTracker())
- }
-
- _createHeaderMenus(html) {
- // add the default menu items for all tables with a headermenu
- let tables = html.find('.headermenu').closest('.gga-table')
- for (const table of tables) {
- let id = `#${table.id}`
- let items = this.getMenuItems(id)
- this._makeHeaderMenu($(table), '.headermenu', items, ClickAndContextMenu)
- }
-
- let trackermenu = html.find('#combat-trackers')
- this._makeHeaderMenu(
- $(trackermenu[0]),
- '.headermenu',
- [
- {
- name: i18n('GURPS.addTracker'),
- icon: '',
- callback: e => {
- this._addTracker()
- },
- },
- ],
- ClickAndContextMenu
- )
- }
-
- _createEquipmentItemMenus(html) {
- let includeCollapsed = this instanceof GurpsActorEditorSheet
-
- let opts = [
- this._createMenu(i18n('GURPS.edit'), '', this._editEquipment.bind(this)),
- this._createMenu(
- i18n('GURPS.sortContentsAscending'),
- '',
- this._sortContentAscending.bind(this),
- this._isSortable.bind(this, includeCollapsed)
- ),
- this._createMenu(
- i18n('GURPS.sortContentsDescending'),
- '',
- this._sortContentDescending.bind(this),
- this._isSortable.bind(this, includeCollapsed)
- ),
- this._createMenu(i18n('GURPS.delete'), '', this._deleteItem.bind(this)),
- ]
-
- let movedown = this._createMenu(
- i18n('GURPS.moveToOtherEquipment'),
- '',
- this._moveEquipment.bind(this, 'data.equipment.other')
- )
- new ContextMenu(html, '.equipmenucarried', [movedown, ...opts], { eventName: 'contextmenu' })
-
- let moveup = this._createMenu(
- i18n('GURPS.moveToCarriedEquipment'),
- '',
- this._moveEquipment.bind(this, 'data.equipment.carried')
- )
- new ContextMenu(html, '.equipmenuother', [moveup, ...opts], { eventName: 'contextmenu' })
- }
-
- _editEquipment(target) {
- let path = target[0].dataset.key
- let o = duplicate(GURPS.decode(this.actor, path))
- this.editEquipment(this.actor, path, o)
- }
-
- _createMenu(label, icon, callback, condition = () => true) {
- return {
- name: label,
- icon: icon,
- callback: callback,
- condition: condition,
- }
- }
-
- _deleteItem(target) {
- let key = target[0].dataset.key
- if (key.includes('.equipment.')) this.actor.deleteEquipment(key)
- else GURPS.removeKey(this.actor, key)
- }
-
- _sortContentAscending(target) {
- this._sortContent(target[0].dataset.key, 'contains', false)
- this._sortContent(target[0].dataset.key, 'collapsed', false)
- }
-
- async _sortContent(parentpath, objkey, reverse) {
- let key = parentpath + '.' + objkey
- let list = getProperty(this.actor, key)
- let t = parentpath + '.-=' + objkey
-
- await this.actor.update({ [t]: null }) // Delete the whole object
-
- let sortedobj = {}
- let index = 0
- Object.values(list)
- .sort((a, b) => (reverse ? b.name.localeCompare(a.name) : a.name.localeCompare(b.name)))
- .forEach(o => GURPS.put(sortedobj, o, index++))
- await this.actor.update({ [key]: sortedobj })
- }
-
- _sortContentDescending(target) {
- this._sortContent(target[0].dataset.key, 'contains', true)
- this._sortContent(target[0].dataset.key, 'collapsed', true)
- }
-
- _moveEquipment(list, target) {
- let path = target[0].dataset.key
- this.actor.moveEquipment(path, list)
- }
-
- _hasContents(target) {
- let path = target[0].dataset.key
- let elements = $(target).siblings(`.desc[data-key="${path}.contains"]`)
- return elements.length > 0
- }
-
- /**
- *
- * @param {*} target
- * @returns true if the object is a container ... ie, it has a non-empty contains collection
- */
- _isSortable(includeCollapsed, target) {
- let path = target[0].dataset.key
- let x = GURPS.decode(this.actor, path)
- if (x?.contains && Object.keys(x.contains).length > 1) return true
- if (includeCollapsed) return x?.collapsed && Object.keys(x.collapsed).length > 1
- return false
- }
-
- getMenuItems(elementid) {
- const map = {
- '#ranged': [this.sortAscendingMenu('data.ranged'), this.sortDescendingMenu('data.ranged')],
- '#melee': [this.sortAscendingMenu('data.melee'), this.sortDescendingMenu('data.melee')],
- '#advantages': [this.sortAscendingMenu('data.ads'), this.sortDescendingMenu('data.ads')],
- '#skills': [this.sortAscendingMenu('data.skills'), this.sortDescendingMenu('data.skills')],
- '#spells': [this.sortAscendingMenu('data.spells'), this.sortDescendingMenu('data.spells')],
- '#equipmentcarried': [
- this.addItemMenu(
- i18n('GURPS.equipment'),
- new Equipment(`${i18n('GURPS.equipment')}...`, true),
- 'data.equipment.carried'
- ),
- this.sortAscendingMenu('data.equipment.carried'),
- this.sortDescendingMenu('data.equipment.carried'),
- ],
- '#equipmentother': [
- this.addItemMenu(
- i18n('GURPS.equipment'),
- new Equipment(`${i18n('GURPS.equipment')}...`, true),
- 'data.equipment.other'
- ),
- this.sortAscendingMenu('data.equipment.other'),
- this.sortDescendingMenu('data.equipment.other'),
- ],
- }
- return map[elementid] ?? []
- }
-
- addItemMenu(name, obj, path) {
- return {
- name: i18n_f('GURPS.editorAddItem', { name: name }, 'Add {name} at the end'),
- icon: '',
- callback: e => {
- let o = GURPS.decode(this.actor, path) || {}
- GURPS.put(o, duplicate(obj))
- this.actor.update({ [path]: o })
- },
- }
- }
-
- makelistdrag(html, cls, type) {
- html.find(cls).each((i, li) => {
- li.setAttribute('draggable', true)
-
- li.addEventListener('dragstart', ev => {
- let oldd = ev.dataTransfer.getData('text/plain')
- let eqtkey = ev.currentTarget.dataset.key
- let eqt = getProperty(this.actor, eqtkey) // FYI, may not actually be Equipment
-
- if (!eqt) return
- if (!!eqt.eqtkey) {
- eqtkey = eqt.eqtkey
- eqt = GURPS.decode(this.actor, eqtkey) // Features added by equipment will point to the equipment
- type = 'equipment'
- }
-
- var itemData
- if (!!eqt.itemid) {
- itemData = this.actor.items.get(eqt.itemid) // We have to get it now, as the source of the drag, since the target may not be owned by us
- let img = new Image()
- img.src = itemData.img
- const w = 50
- const h = 50
- const preview = DragDrop.createDragImage(img, w, h)
- ev.dataTransfer.setDragImage(preview, 0, 0)
- }
-
- let newd = {
- actorid: this.actor.id, // may not be useful if this is an unlinked token
- // actor: this.actor, // so send the actor,
- isLinked: !this.actor.isToken,
- type: type,
- key: eqtkey,
- itemid: eqt.itemid,
- itemData: itemData,
- }
- if (!!oldd) mergeObject(newd, JSON.parse(oldd)) // May need to merge in OTF drag info
-
- let payload = JSON.stringify(newd)
- //console.log(payload)
- return ev.dataTransfer.setData('text/plain', payload)
- })
- })
- }
-
- async _addNote(event) {
- let parent = $(event.currentTarget).closest('.header')
- let path = parent.attr('data-key')
- let actor = this.actor
- let list = duplicate(getProperty(actor, path))
- let obj = new Note('', true)
- let dlgHtml = await renderTemplate('systems/gurps/templates/note-editor-popup.html', obj)
-
- let d = new Dialog(
- {
- title: 'Note Editor',
- content: dlgHtml,
- buttons: {
- one: {
- label: 'Create',
- callback: async html => {
- ;['notes', 'pageref', 'title'].forEach(a => (obj[a] = html.find(`.${a}`).val()))
- let u = html.find('.save') // Should only find in Note (or equipment)
- if (!!u) obj.save = u.is(':checked')
- GURPS.put(list, obj)
- await actor.update({ [path]: list })
- },
- },
- },
- default: 'one',
- },
- {
- width: 730,
- popOut: true,
- minimizable: false,
- jQuery: true,
- }
- )
- d.render(true)
- }
-
- async _addTracker(event) {
- this.actor.addTracker()
- }
-
- handleDblclickeditDrop(ev) {
- let parent = $(ev.currentTarget).closest('[data-key]')
- let path = parent[0].dataset.key
- this.dropFoundryLinks(ev, path + '.notes')
- }
-
- handleQnoteDrop(ev) {
- this.dropFoundryLinks(ev, 'data.additionalresources.qnotes')
- }
-
- dropFoundryLinks(ev, modelkey) {
- if (!!ev.originalEvent) ev = ev.originalEvent
- let dragData = JSON.parse(ev.dataTransfer.getData('text/plain'))
- let add = ''
- var n
- if (dragData.type == 'JournalEntry') {
- n = game.journal.get(dragData.id).name
- }
- if (dragData.type == 'Actor') {
- n = game.actors.get(dragData.id).name
- }
- if (dragData.type == 'RollTable') {
- n = game.tables.get(dragData.id).name
- }
- if (dragData.type == 'Item') {
- n = game.items.get(dragData.id).name
- }
- if (!!n) add = ` [${dragData.type}[${dragData.id}]` + '{' + n + '}]'
-
- if (!!dragData.otf) {
- let prefix = ''
- if (!!dragData.displayname) {
- let q = '"'
- if (dragData.displayname.includes(q)) q = "'"
- prefix = q + dragData.displayname + q
- }
- add = '[' + prefix + dragData.otf + ']'
- }
- if (!!dragData.bucket) {
- add = '["Modifier Bucket"'
- let sep = ''
- dragData.bucket.forEach(otf => {
- add += sep + '/r [' + otf + ']'
- sep = '\\\\'
- })
- add += ']'
- }
-
- if (!!add)
- if (!!modelkey) {
- let t = getProperty(this.actor, modelkey) || ''
- this.actor.update({ [modelkey]: t + (t ? ' ' : '') + add })
- } else {
- let t = $(ev.currentTarget).val()
- $(ev.currentTarget).val(t + (t ? ' ' : '') + add)
- }
- }
-
- /**
- *
- * @param {*} ev
- */
- async editTracker(ev) {
- ev.preventDefault()
-
- let path = $(ev.currentTarget).closest('[data-gurps-resource]').attr('data-gurps-resource')
- let templates = ResourceTrackerManager.getAllTemplates()
- if (!templates || templates.length == 0) templates = null
-
- let selectTracker = async function(html) {
- let name = html.find('select option:selected').text().trim()
- let template = templates.find(template => template.tracker.name === name)
- await this.actor.applyTrackerTemplate(path, template)
- }
-
- // show dialog asking if they want to apply a standard tracker, or edit this tracker
- let buttons = {
- edit: {
- icon: '',
- label: game.i18n.localize('GURPS.resourceEditTracker'),
- callback: () => ResourceTrackerEditor.editForActor(this.actor, path),
- },
- remove: {
- icon: '',
- label: game.i18n.localize('GURPS.resourceDeleteTracker'),
- callback: async () => await this.actor.removeTracker(path),
- },
- }
-
- if (!!templates) {
- buttons.apply = {
- icon: '',
- label: game.i18n.localize('GURPS.resourceCopyTemplate'),
- callback: selectTracker.bind(this),
- }
- }
-
- let d = new Dialog(
- {
- title: game.i18n.localize('GURPS.resourceUpdateTrackerSlot'),
- content: await renderTemplate('systems/gurps/templates/actor/update-tracker.html', { templates: templates }),
- buttons: buttons,
- default: 'edit',
- templates: templates,
- },
- { width: 600 }
- )
- d.render(true)
- }
-
- async _showActiveEffectsListPopup(ev) {
- ev.preventDefault()
- new GurpsActiveEffectListSheet(this.actor).render(true)
- }
-
- async _showMoveModeEditorPopup(ev) {
- ev.preventDefault()
- new MoveModeEditor(this.actor).render(true)
- }
-
- async editEquipment(actor, path, obj) {
- // NOTE: This code is duplicated above. Haven't refactored yet
- obj.f_count = obj.count // Hack to get around The Furnace's "helpful" Handlebar helper {{count}}
- let dlgHtml = await renderTemplate('systems/gurps/templates/equipment-editor-popup.html', obj)
-
- let d = new Dialog(
- {
- title: 'Equipment Editor',
- content: dlgHtml,
- buttons: {
- one: {
- label: 'Update',
- callback: async html => {
- ;['name', 'uses', 'maxuses', 'techlevel', 'notes', 'pageref'].forEach(
- a => (obj[a] = html.find(`.${a}`).val())
- )
- ;['count', 'cost', 'weight'].forEach(a => (obj[a] = parseFloat(html.find(`.${a}`).val())))
- let u = html.find('.save') // Should only find in Note (or equipment)
- if (!!u && obj.save != null) obj.save = u.is(':checked') // only set 'saved' if it was already defined
- let v = html.find('.ignoreImportQty') // Should only find in equipment
- if (!!v) obj.ignoreImportQty = v.is(':checked')
- await actor.update({ [path]: obj })
- await actor.updateParentOf(path, false)
- },
- },
- },
- render: h => {
- $(h).find('textarea').on('drop', this.dropFoundryLinks)
- $(h).find('input').on('drop', this.dropFoundryLinks)
- },
- default: 'one',
- },
- {
- width: 530,
- popOut: true,
- minimizable: false,
- jQuery: true,
- }
- )
- d.render(true)
- }
-
- async editMelee(actor, path, obj) {
- this.editItem(
- actor,
- path,
- obj,
- 'systems/gurps/templates/melee-editor-popup.html',
- 'Melee Weapon Editor',
- [
- 'name',
- 'mode',
- 'parry',
- 'block',
- 'damage',
- 'reach',
- 'st',
- 'notes',
- 'import',
- 'checkotf',
- 'duringotf',
- 'passotf',
- 'failotf',
- ],
- []
- )
- }
-
- async editRanged(actor, path, obj) {
- this.editItem(
- actor,
- path,
- obj,
- 'systems/gurps/templates/ranged-editor-popup.html',
- 'Ranged Weapon Editor',
- [
- 'name',
- 'mode',
- 'range',
- 'rof',
- 'damage',
- 'shots',
- 'rcl',
- 'st',
- 'notes',
- 'import',
- 'checkotf',
- 'duringotf',
- 'passotf',
- 'failotf',
- ],
- ['acc', 'bulk']
- )
- }
-
- async editAds(actor, path, obj) {
- this.editItem(
- actor,
- path,
- obj,
- 'systems/gurps/templates/advantage-editor-popup.html',
- 'Advantage / Disadvantage / Perk / Quirk Editor',
- ['name', 'notes', 'pageref'],
- ['points']
- )
- }
-
- async editSkills(actor, path, obj) {
- this.editItem(
- actor,
- path,
- obj,
- 'systems/gurps/templates/skill-editor-popup.html',
- 'Skill Editor',
- ['name', 'import', 'relativelevel', 'pageref', 'notes', 'checkotf', 'duringotf', 'passotf', 'failotf'],
- ['points']
- )
- }
-
- async editSpells(actor, path, obj) {
- this.editItem(
- actor,
- path,
- obj,
- 'systems/gurps/templates/spell-editor-popup.html',
- 'Spell Editor',
- [
- 'name',
- 'import',
- 'difficulty',
- 'pageref',
- 'notes',
- 'resist',
- 'class',
- 'cost',
- 'maintain',
- 'casttime',
- 'duration',
- 'college',
- 'checkotf',
- 'duringotf',
- 'passotf',
- 'failotf',
- ],
- ['points']
- )
- }
-
- async editNotes(actor, path, obj) {
- this.editItem(
- actor,
- path,
- obj,
- 'systems/gurps/templates/note-editor-popup.html',
- 'Note Editor',
- ['pageref', 'notes', 'title'],
- [],
- 730
- )
- }
-
- async editItem(actor, path, obj, html, title, strprops, numprops, width = 560) {
- let dlgHtml = await renderTemplate(html, obj)
- let d = new Dialog(
- {
- title: title,
- content: dlgHtml,
- buttons: {
- one: {
- label: 'Update',
- callback: async html => {
- strprops.forEach(a => (obj[a] = html.find(`.${a}`).val()))
- numprops.forEach(a => (obj[a] = parseFloat(html.find(`.${a}`).val())))
-
- let u = html.find('.save') // Should only find in Note (or equipment)
- if (!!u) obj.save = u.is(':checked')
- actor.update({ [path]: obj })
- },
- },
- },
- render: h => {
- $(h).find('textarea').on('drop', this.dropFoundryLinks)
- $(h).find('input').on('drop', this.dropFoundryLinks)
- },
- },
- {
- width: width,
- popOut: true,
- minimizable: false,
- jQuery: true,
- }
- )
- d.render(true)
- }
-
- _makeHeaderMenu(html, cssclass, menuitems, eventname = 'contextmenu') {
- new ContextMenu(html, cssclass, menuitems, { eventName: eventname })
- }
-
- sortAscendingMenu(key) {
- return {
- name: i18n('GURPS.sortAscending'),
- icon: '',
- callback: e => this.sortAscending(key),
- }
- }
-
- sortDescendingMenu(key) {
- return {
- name: i18n('GURPS.sortDescending'),
- icon: '',
- callback: e => this.sortDescending(key),
- }
- }
-
- async sortAscending(key) {
- let i = key.lastIndexOf('.')
- let parentpath = key.substring(0, i)
- let objkey = key.substr(i + 1)
- let object = GURPS.decode(this.actor, key)
- let t = parentpath + '.-=' + objkey
- await this.actor.update({ [t]: null }) // Delete the whole object
- let sortedobj = {}
- let index = 0
- Object.values(object)
- .sort((a, b) => a.name.localeCompare(b.name))
- .forEach(o => GURPS.put(sortedobj, o, index++))
- await this.actor.update({ [key]: sortedobj })
- }
-
- async sortDescending(key) {
- let i = key.lastIndexOf('.')
- let parentpath = key.substring(0, i)
- let objkey = key.substr(i + 1)
- let object = GURPS.decode(this.actor, key)
- let t = parentpath + '.-=' + objkey
- await this.actor.update({ [t]: null }) // Delete the whole object
- let sortedobj = {}
- let index = 0
- Object.values(object)
- .sort((a, b) => b.name.localeCompare(a.name))
- .forEach(o => GURPS.put(sortedobj, o, index++))
- await this.actor.update({ [key]: sortedobj })
- }
-
- /* -------------------------------------------- */
-
- /** @override */
- async _onDrop(event) {
- let dragData = JSON.parse(event.dataTransfer.getData('text/plain'))
-
- if (dragData.type === 'damageItem') this.actor.handleDamageDrop(dragData.payload)
- if (dragData.type === 'Item') this.actor.handleItemDrop(dragData)
-
- this.handleDragFor(event, dragData, 'ranged', 'rangeddraggable')
- this.handleDragFor(event, dragData, 'melee', 'meleedraggable')
- this.handleDragFor(event, dragData, 'ads', 'adsdraggable')
- this.handleDragFor(event, dragData, 'skills', 'skldraggable')
- this.handleDragFor(event, dragData, 'spells', 'spldraggable')
- this.handleDragFor(event, dragData, 'note', 'notedraggable')
- this.handleDragFor(event, dragData, 'reactions', 'reactdraggable')
- this.handleDragFor(event, dragData, 'condmod', 'condmoddraggable')
-
- if (dragData.type === 'equipment') {
- if ((await this.actor.handleEquipmentDrop(dragData)) != false) return // handle external drag/drop
-
- // drag/drop in same character sheet
- // Validate that the target is valid for the drop.
- let dropTargetElements = $(event.target).closest('.eqtdraggable, .eqtdragtarget')
- if (dropTargetElements?.length === 0) return
-
- // Get the target element.
- let dropTarget = dropTargetElements[0]
-
- let targetkey = dropTarget.dataset.key
- if (!!targetkey) {
- let srckey = dragData.key
- this.actor.moveEquipment(srckey, targetkey, event.shiftKey)
- }
- }
- }
-
- // Non-equipment list drags
- async handleDragFor(event, dragData, type, cls) {
- if (dragData.type === type) {
- // Validate that the target is valid for the drop.
- let dropTargetElements = $(event.target).closest(`.${cls}`)
- if (dropTargetElements?.length === 0) return
-
- // Get the target element.
- let dropTarget = dropTargetElements[0]
-
- // Dropping an item into a container that already contains it does nothing; tell the user and bail.
- let targetkey = dropTarget.dataset.key
- if (!!targetkey) {
- let sourceKey = dragData.key
- if (sourceKey.includes(targetkey) || targetkey.includes(sourceKey)) {
- ui.notifications.error(i18n('GURPS.dragSameContainer'))
- return
- }
-
- let object = GURPS.decode(this.actor, sourceKey)
-
- // Because we may be modifing the same list, we have to check the order of the keys and
- // apply the operation that occurs later in the list, first (to keep the indexes the same).
- let sourceTermsArray = sourceKey.split('.')
- sourceTermsArray.splice(0, 2) // Remove the first two elements: data.xxxx
- let targetTermsArray = targetkey.split('.')
- targetTermsArray.splice(0, 2)
- let max = Math.min(sourceTermsArray.length, targetTermsArray.length)
-
- let isSrcFirst = false
- for (let i = 0; i < max; i++) {
- // Could be a term like parseInt('contains') < parseInt('contains'), which in typical JS jankiness, reduces
- // to NaN < NaN, which is false.
- if (parseInt(sourceTermsArray[i]) < parseInt(targetTermsArray[i])) {
- isSrcFirst = true
- break
- }
- }
-
- let d = new Dialog({
- title: object.name,
- content: `
') })
+ },
+ },
+ },
+ render: h => {
+ $(h).find('textarea').on('drop', this.dropFoundryLinks)
+ $(h).find('input').on('drop', this.dropFoundryLinks)
+ },
+ }).render(true)
+ })
+
+ html.find('#qnotes').on('drop', this.handleQnoteDrop.bind(this))
+
+ html.find('#maneuver').on('change', ev => {
+ let target = $(ev.currentTarget)
+ this.actor.replaceManeuver(target.val())
+ })
+
+ html.find('#posture').on('change', ev => {
+ let target = $(ev.currentTarget)
+ this.actor.replacePosture(target.val())
+ })
+
+ html.find('#move-mode').on('change', ev => {
+ let target = $(ev.currentTarget)
+ this.actor.setMoveDefault(target.val())
+ })
+
+ html.find('#open-modifier-popup').on('click', this._showActiveEffectsListPopup.bind(this))
+ html.find('#edit-move-modes').on('click', this._showMoveModeEditorPopup.bind(this))
+
+ html.find('#addFirstResourceTracker').on('click', ev => this._addTracker())
+ }
+
+ _createHeaderMenus(html) {
+ // add the default menu items for all tables with a headermenu
+ let tables = html.find('.headermenu').closest('.gga-table')
+ for (const table of tables) {
+ let id = `#${table.id}`
+ let items = this.getMenuItems(id)
+ this._makeHeaderMenu($(table), '.headermenu', items, ClickAndContextMenu)
+ }
+
+ let trackermenu = html.find('#combat-trackers')
+ this._makeHeaderMenu(
+ $(trackermenu[0]),
+ '.headermenu',
+ [
+ {
+ name: i18n('GURPS.addTracker'),
+ icon: '',
+ callback: e => {
+ this._addTracker()
+ },
+ },
+ ],
+ ClickAndContextMenu
+ )
+ }
+
+ _createEquipmentItemMenus(html) {
+ let includeCollapsed = this instanceof GurpsActorEditorSheet
+
+ let opts = [
+ this._createMenu(i18n('GURPS.edit'), '', this._editEquipment.bind(this)),
+ this._createMenu(
+ i18n('GURPS.sortContentsAscending'),
+ '',
+ this._sortContentAscending.bind(this),
+ this._isSortable.bind(this, includeCollapsed)
+ ),
+ this._createMenu(
+ i18n('GURPS.sortContentsDescending'),
+ '',
+ this._sortContentDescending.bind(this),
+ this._isSortable.bind(this, includeCollapsed)
+ ),
+ this._createMenu(i18n('GURPS.delete'), '', this._deleteItem.bind(this)),
+ ]
+
+ let movedown = this._createMenu(
+ i18n('GURPS.moveToOtherEquipment'),
+ '',
+ this._moveEquipment.bind(this, 'data.equipment.other')
+ )
+ new ContextMenu(html, '.equipmenucarried', [movedown, ...opts], { eventName: 'contextmenu' })
+
+ let moveup = this._createMenu(
+ i18n('GURPS.moveToCarriedEquipment'),
+ '',
+ this._moveEquipment.bind(this, 'data.equipment.carried')
+ )
+ new ContextMenu(html, '.equipmenuother', [moveup, ...opts], { eventName: 'contextmenu' })
+ }
+
+ _editEquipment(target) {
+ let path = target[0].dataset.key
+ let o = duplicate(GURPS.decode(this.actor, path))
+ this.editEquipment(this.actor, path, o)
+ }
+
+ _createMenu(label, icon, callback, condition = () => true) {
+ return {
+ name: label,
+ icon: icon,
+ callback: callback,
+ condition: condition,
+ }
+ }
+
+ _deleteItem(target) {
+ let key = target[0].dataset.key
+ if (key.includes('.equipment.')) this.actor.deleteEquipment(key)
+ else GURPS.removeKey(this.actor, key)
+ }
+
+ _sortContentAscending(target) {
+ this._sortContent(target[0].dataset.key, 'contains', false)
+ this._sortContent(target[0].dataset.key, 'collapsed', false)
+ }
+
+ async _sortContent(parentpath, objkey, reverse) {
+ let key = parentpath + '.' + objkey
+ let list = getProperty(this.actor, key)
+ let t = parentpath + '.-=' + objkey
+
+ await this.actor.update({ [t]: null }) // Delete the whole object
+
+ let sortedobj = {}
+ let index = 0
+ Object.values(list)
+ .sort((a, b) => (reverse ? b.name.localeCompare(a.name) : a.name.localeCompare(b.name)))
+ .forEach(o => GURPS.put(sortedobj, o, index++))
+ await this.actor.update({ [key]: sortedobj })
+ }
+
+ _sortContentDescending(target) {
+ this._sortContent(target[0].dataset.key, 'contains', true)
+ this._sortContent(target[0].dataset.key, 'collapsed', true)
+ }
+
+ _moveEquipment(list, target) {
+ let path = target[0].dataset.key
+ this.actor.moveEquipment(path, list)
+ }
+
+ _hasContents(target) {
+ let path = target[0].dataset.key
+ let elements = $(target).siblings(`.desc[data-key="${path}.contains"]`)
+ return elements.length > 0
+ }
+
+ /**
+ *
+ * @param {*} target
+ * @returns true if the object is a container ... ie, it has a non-empty contains collection
+ */
+ _isSortable(includeCollapsed, target) {
+ let path = target[0].dataset.key
+ let x = GURPS.decode(this.actor, path)
+ if (x?.contains && Object.keys(x.contains).length > 1) return true
+ if (includeCollapsed) return x?.collapsed && Object.keys(x.collapsed).length > 1
+ return false
+ }
+
+ getMenuItems(elementid) {
+ const map = {
+ '#ranged': [this.sortAscendingMenu('data.ranged'), this.sortDescendingMenu('data.ranged')],
+ '#melee': [this.sortAscendingMenu('data.melee'), this.sortDescendingMenu('data.melee')],
+ '#advantages': [this.sortAscendingMenu('data.ads'), this.sortDescendingMenu('data.ads')],
+ '#skills': [this.sortAscendingMenu('data.skills'), this.sortDescendingMenu('data.skills')],
+ '#spells': [this.sortAscendingMenu('data.spells'), this.sortDescendingMenu('data.spells')],
+ '#equipmentcarried': [
+ this.addItemMenu(
+ i18n('GURPS.equipment'),
+ new Equipment(`${i18n('GURPS.equipment')}...`, true),
+ 'data.equipment.carried'
+ ),
+ this.sortAscendingMenu('data.equipment.carried'),
+ this.sortDescendingMenu('data.equipment.carried'),
+ ],
+ '#equipmentother': [
+ this.addItemMenu(
+ i18n('GURPS.equipment'),
+ new Equipment(`${i18n('GURPS.equipment')}...`, true),
+ 'data.equipment.other'
+ ),
+ this.sortAscendingMenu('data.equipment.other'),
+ this.sortDescendingMenu('data.equipment.other'),
+ ],
+ }
+ return map[elementid] ?? []
+ }
+
+ addItemMenu(name, obj, path) {
+ return {
+ name: i18n_f('GURPS.editorAddItem', { name: name }, 'Add {name} at the end'),
+ icon: '',
+ callback: e => {
+ let o = GURPS.decode(this.actor, path) || {}
+ GURPS.put(o, duplicate(obj))
+ this.actor.update({ [path]: o })
+ },
+ }
+ }
+
+ makelistdrag(html, cls, type) {
+ html.find(cls).each((i, li) => {
+ li.setAttribute('draggable', true)
+
+ li.addEventListener('dragstart', ev => {
+ let oldd = ev.dataTransfer.getData('text/plain')
+ let eqtkey = ev.currentTarget.dataset.key
+ let eqt = getProperty(this.actor, eqtkey) // FYI, may not actually be Equipment
+
+ if (!eqt) return
+ if (!!eqt.eqtkey) {
+ eqtkey = eqt.eqtkey
+ eqt = GURPS.decode(this.actor, eqtkey) // Features added by equipment will point to the equipment
+ type = 'equipment'
+ }
+
+ var itemData
+ if (!!eqt.itemid) {
+ itemData = this.actor.items.get(eqt.itemid) // We have to get it now, as the source of the drag, since the target may not be owned by us
+ let img = new Image()
+ img.src = itemData.img
+ const w = 50
+ const h = 50
+ const preview = DragDrop.createDragImage(img, w, h)
+ ev.dataTransfer.setDragImage(preview, 0, 0)
+ }
+
+ let newd = {
+ actorid: this.actor.id, // may not be useful if this is an unlinked token
+ // actor: this.actor, // so send the actor,
+ isLinked: !this.actor.isToken,
+ type: type,
+ key: eqtkey,
+ itemid: eqt.itemid,
+ itemData: itemData,
+ }
+ if (!!oldd) mergeObject(newd, JSON.parse(oldd)) // May need to merge in OTF drag info
+
+ let payload = JSON.stringify(newd)
+ //console.log(payload)
+ return ev.dataTransfer.setData('text/plain', payload)
+ })
+ })
+ }
+
+ async _addNote(event) {
+ let parent = $(event.currentTarget).closest('.header')
+ let path = parent.attr('data-key')
+ let actor = this.actor
+ let list = duplicate(getProperty(actor, path))
+ let obj = new Note('', true)
+ let dlgHtml = await renderTemplate('systems/gurps/templates/note-editor-popup.html', obj)
+
+ let d = new Dialog(
+ {
+ title: 'Note Editor',
+ content: dlgHtml,
+ buttons: {
+ one: {
+ label: 'Create',
+ callback: async html => {
+ ;['notes', 'pageref', 'title'].forEach(a => (obj[a] = html.find(`.${a}`).val()))
+ let u = html.find('.save') // Should only find in Note (or equipment)
+ if (!!u) obj.save = u.is(':checked')
+ GURPS.put(list, obj)
+ await actor.update({ [path]: list })
+ },
+ },
+ },
+ default: 'one',
+ },
+ {
+ width: 730,
+ popOut: true,
+ minimizable: false,
+ jQuery: true,
+ }
+ )
+ d.render(true)
+ }
+
+ async _addTracker(event) {
+ this.actor.addTracker()
+ }
+
+ handleDblclickeditDrop(ev) {
+ let parent = $(ev.currentTarget).closest('[data-key]')
+ let path = parent[0].dataset.key
+ this.dropFoundryLinks(ev, path + '.notes')
+ }
+
+ handleQnoteDrop(ev) {
+ this.dropFoundryLinks(ev, 'data.additionalresources.qnotes')
+ }
+
+ dropFoundryLinks(ev, modelkey) {
+ if (!!ev.originalEvent) ev = ev.originalEvent
+ let dragData = JSON.parse(ev.dataTransfer.getData('text/plain'))
+ let add = ''
+ var n
+ if (dragData.type == 'JournalEntry') {
+ n = game.journal.get(dragData.id).name
+ }
+ if (dragData.type == 'Actor') {
+ n = game.actors.get(dragData.id).name
+ }
+ if (dragData.type == 'RollTable') {
+ n = game.tables.get(dragData.id).name
+ }
+ if (dragData.type == 'Item') {
+ n = game.items.get(dragData.id).name
+ }
+ if (!!n) add = ` [${dragData.type}[${dragData.id}]` + '{' + n + '}]'
+
+ if (!!dragData.otf) {
+ let prefix = ''
+ if (!!dragData.displayname) {
+ let q = '"'
+ if (dragData.displayname.includes(q)) q = "'"
+ prefix = q + dragData.displayname + q
+ }
+ add = '[' + prefix + dragData.otf + ']'
+ }
+ if (!!dragData.bucket) {
+ add = '["Modifier Bucket"'
+ let sep = ''
+ dragData.bucket.forEach(otf => {
+ add += sep + '/r [' + otf + ']'
+ sep = '\\\\'
+ })
+ add += ']'
+ }
+
+ if (!!add)
+ if (!!modelkey) {
+ let t = getProperty(this.actor, modelkey) || ''
+ this.actor.update({ [modelkey]: t + (t ? ' ' : '') + add })
+ } else {
+ let t = $(ev.currentTarget).val()
+ $(ev.currentTarget).val(t + (t ? ' ' : '') + add)
+ }
+ }
+
+ /**
+ *
+ * @param {*} ev
+ */
+ async editTracker(ev) {
+ ev.preventDefault()
+
+ let path = $(ev.currentTarget).closest('[data-gurps-resource]').attr('data-gurps-resource')
+ let templates = ResourceTrackerManager.getAllTemplates()
+ if (!templates || templates.length == 0) templates = null
+
+ let selectTracker = async function (html) {
+ let name = html.find('select option:selected').text().trim()
+ let template = templates.find(template => template.tracker.name === name)
+ await this.actor.applyTrackerTemplate(path, template)
+ }
+
+ // show dialog asking if they want to apply a standard tracker, or edit this tracker
+ let buttons = {
+ edit: {
+ icon: '',
+ label: game.i18n.localize('GURPS.resourceEditTracker'),
+ callback: () => ResourceTrackerEditor.editForActor(this.actor, path),
+ },
+ remove: {
+ icon: '',
+ label: game.i18n.localize('GURPS.resourceDeleteTracker'),
+ callback: async () => await this.actor.removeTracker(path),
+ },
+ }
+
+ if (!!templates) {
+ buttons.apply = {
+ icon: '',
+ label: game.i18n.localize('GURPS.resourceCopyTemplate'),
+ callback: selectTracker.bind(this),
+ }
+ }
+
+ let d = new Dialog(
+ {
+ title: game.i18n.localize('GURPS.resourceUpdateTrackerSlot'),
+ content: await renderTemplate('systems/gurps/templates/actor/update-tracker.html', { templates: templates }),
+ buttons: buttons,
+ default: 'edit',
+ templates: templates,
+ },
+ { width: 600 }
+ )
+ d.render(true)
+ }
+
+ async _showActiveEffectsListPopup(ev) {
+ ev.preventDefault()
+ new GurpsActiveEffectListSheet(this.actor).render(true)
+ }
+
+ async _showMoveModeEditorPopup(ev) {
+ ev.preventDefault()
+ new MoveModeEditor(this.actor).render(true)
+ }
+
+ async editEquipment(actor, path, obj) {
+ // NOTE: This code is duplicated above. Haven't refactored yet
+ obj.f_count = obj.count // Hack to get around The Furnace's "helpful" Handlebar helper {{count}}
+ let dlgHtml = await renderTemplate('systems/gurps/templates/equipment-editor-popup.html', obj)
+
+ let d = new Dialog(
+ {
+ title: 'Equipment Editor',
+ content: dlgHtml,
+ buttons: {
+ one: {
+ label: 'Update',
+ callback: async html => {
+ ;['name', 'uses', 'maxuses', 'techlevel', 'notes', 'pageref'].forEach(
+ a => (obj[a] = html.find(`.${a}`).val())
+ )
+ ;['count', 'cost', 'weight'].forEach(a => (obj[a] = parseFloat(html.find(`.${a}`).val())))
+ let u = html.find('.save') // Should only find in Note (or equipment)
+ if (!!u && obj.save != null) obj.save = u.is(':checked') // only set 'saved' if it was already defined
+ let v = html.find('.ignoreImportQty') // Should only find in equipment
+ if (!!v) obj.ignoreImportQty = v.is(':checked')
+ await actor.update({ [path]: obj })
+ await actor.updateParentOf(path, false)
+ },
+ },
+ },
+ render: h => {
+ $(h).find('textarea').on('drop', this.dropFoundryLinks)
+ $(h).find('input').on('drop', this.dropFoundryLinks)
+ },
+ default: 'one',
+ },
+ {
+ width: 530,
+ popOut: true,
+ minimizable: false,
+ jQuery: true,
+ }
+ )
+ d.render(true)
+ }
+
+ async editMelee(actor, path, obj) {
+ this.editItem(
+ actor,
+ path,
+ obj,
+ 'systems/gurps/templates/melee-editor-popup.html',
+ 'Melee Weapon Editor',
+ [
+ 'name',
+ 'mode',
+ 'parry',
+ 'block',
+ 'damage',
+ 'reach',
+ 'st',
+ 'notes',
+ 'import',
+ 'checkotf',
+ 'duringotf',
+ 'passotf',
+ 'failotf',
+ ],
+ []
+ )
+ }
+
+ async editRanged(actor, path, obj) {
+ this.editItem(
+ actor,
+ path,
+ obj,
+ 'systems/gurps/templates/ranged-editor-popup.html',
+ 'Ranged Weapon Editor',
+ [
+ 'name',
+ 'mode',
+ 'range',
+ 'rof',
+ 'damage',
+ 'shots',
+ 'rcl',
+ 'st',
+ 'notes',
+ 'import',
+ 'checkotf',
+ 'duringotf',
+ 'passotf',
+ 'failotf',
+ ],
+ ['acc', 'bulk']
+ )
+ }
+
+ async editAds(actor, path, obj) {
+ this.editItem(
+ actor,
+ path,
+ obj,
+ 'systems/gurps/templates/advantage-editor-popup.html',
+ 'Advantage / Disadvantage / Perk / Quirk Editor',
+ ['name', 'notes', 'pageref'],
+ ['points']
+ )
+ }
+
+ async editSkills(actor, path, obj) {
+ this.editItem(
+ actor,
+ path,
+ obj,
+ 'systems/gurps/templates/skill-editor-popup.html',
+ 'Skill Editor',
+ ['name', 'import', 'relativelevel', 'pageref', 'notes', 'checkotf', 'duringotf', 'passotf', 'failotf'],
+ ['points']
+ )
+ }
+
+ async editSpells(actor, path, obj) {
+ this.editItem(
+ actor,
+ path,
+ obj,
+ 'systems/gurps/templates/spell-editor-popup.html',
+ 'Spell Editor',
+ [
+ 'name',
+ 'import',
+ 'difficulty',
+ 'pageref',
+ 'notes',
+ 'resist',
+ 'class',
+ 'cost',
+ 'maintain',
+ 'casttime',
+ 'duration',
+ 'college',
+ 'checkotf',
+ 'duringotf',
+ 'passotf',
+ 'failotf',
+ ],
+ ['points']
+ )
+ }
+
+ async editNotes(actor, path, obj) {
+ this.editItem(
+ actor,
+ path,
+ obj,
+ 'systems/gurps/templates/note-editor-popup.html',
+ 'Note Editor',
+ ['pageref', 'notes', 'title'],
+ [],
+ 730
+ )
+ }
+
+ async editItem(actor, path, obj, html, title, strprops, numprops, width = 560) {
+ let dlgHtml = await renderTemplate(html, obj)
+ let d = new Dialog(
+ {
+ title: title,
+ content: dlgHtml,
+ buttons: {
+ one: {
+ label: 'Update',
+ callback: async html => {
+ strprops.forEach(a => (obj[a] = html.find(`.${a}`).val()))
+ numprops.forEach(a => (obj[a] = parseFloat(html.find(`.${a}`).val())))
+
+ let u = html.find('.save') // Should only find in Note (or equipment)
+ if (!!u) obj.save = u.is(':checked')
+ actor.update({ [path]: obj })
+ },
+ },
+ },
+ render: h => {
+ $(h).find('textarea').on('drop', this.dropFoundryLinks)
+ $(h).find('input').on('drop', this.dropFoundryLinks)
+ },
+ },
+ {
+ width: width,
+ popOut: true,
+ minimizable: false,
+ jQuery: true,
+ }
+ )
+ d.render(true)
+ }
+
+ _makeHeaderMenu(html, cssclass, menuitems, eventname = 'contextmenu') {
+ new ContextMenu(html, cssclass, menuitems, { eventName: eventname })
+ }
+
+ sortAscendingMenu(key) {
+ return {
+ name: i18n('GURPS.sortAscending'),
+ icon: '',
+ callback: e => this.sortAscending(key),
+ }
+ }
+
+ sortDescendingMenu(key) {
+ return {
+ name: i18n('GURPS.sortDescending'),
+ icon: '',
+ callback: e => this.sortDescending(key),
+ }
+ }
+
+ async sortAscending(key) {
+ let i = key.lastIndexOf('.')
+ let parentpath = key.substring(0, i)
+ let objkey = key.substr(i + 1)
+ let object = GURPS.decode(this.actor, key)
+ let t = parentpath + '.-=' + objkey
+ await this.actor.update({ [t]: null }) // Delete the whole object
+ let sortedobj = {}
+ let index = 0
+ Object.values(object)
+ .sort((a, b) => a.name.localeCompare(b.name))
+ .forEach(o => GURPS.put(sortedobj, o, index++))
+ await this.actor.update({ [key]: sortedobj })
+ }
+
+ async sortDescending(key) {
+ let i = key.lastIndexOf('.')
+ let parentpath = key.substring(0, i)
+ let objkey = key.substr(i + 1)
+ let object = GURPS.decode(this.actor, key)
+ let t = parentpath + '.-=' + objkey
+ await this.actor.update({ [t]: null }) // Delete the whole object
+ let sortedobj = {}
+ let index = 0
+ Object.values(object)
+ .sort((a, b) => b.name.localeCompare(a.name))
+ .forEach(o => GURPS.put(sortedobj, o, index++))
+ await this.actor.update({ [key]: sortedobj })
+ }
+
+ /* -------------------------------------------- */
+
+ /** @override */
+ async _onDrop(event) {
+ let dragData = JSON.parse(event.dataTransfer.getData('text/plain'))
+
+ if (dragData.type === 'damageItem') this.actor.handleDamageDrop(dragData.payload)
+ if (dragData.type === 'Item') this.actor.handleItemDrop(dragData)
+
+ this.handleDragFor(event, dragData, 'ranged', 'rangeddraggable')
+ this.handleDragFor(event, dragData, 'melee', 'meleedraggable')
+ this.handleDragFor(event, dragData, 'ads', 'adsdraggable')
+ this.handleDragFor(event, dragData, 'skills', 'skldraggable')
+ this.handleDragFor(event, dragData, 'spells', 'spldraggable')
+ this.handleDragFor(event, dragData, 'note', 'notedraggable')
+ this.handleDragFor(event, dragData, 'reactions', 'reactdraggable')
+ this.handleDragFor(event, dragData, 'condmod', 'condmoddraggable')
+
+ if (dragData.type === 'equipment') {
+ if ((await this.actor.handleEquipmentDrop(dragData)) != false) return // handle external drag/drop
+
+ // drag/drop in same character sheet
+ // Validate that the target is valid for the drop.
+ let dropTargetElements = $(event.target).closest('.eqtdraggable, .eqtdragtarget')
+ if (dropTargetElements?.length === 0) return
+
+ // Get the target element.
+ let dropTarget = dropTargetElements[0]
+
+ let targetkey = dropTarget.dataset.key
+ if (!!targetkey) {
+ let srckey = dragData.key
+ this.actor.moveEquipment(srckey, targetkey, event.shiftKey)
+ }
+ }
+ }
+
+ // Non-equipment list drags
+ async handleDragFor(event, dragData, type, cls) {
+ if (dragData.type === type) {
+ // Validate that the target is valid for the drop.
+ let dropTargetElements = $(event.target).closest(`.${cls}`)
+ if (dropTargetElements?.length === 0) return
+
+ // Get the target element.
+ let dropTarget = dropTargetElements[0]
+
+ // Dropping an item into a container that already contains it does nothing; tell the user and bail.
+ let targetkey = dropTarget.dataset.key
+ if (!!targetkey) {
+ let sourceKey = dragData.key
+ if (sourceKey.includes(targetkey) || targetkey.includes(sourceKey)) {
+ ui.notifications.error(i18n('GURPS.dragSameContainer'))
+ return
+ }
+
+ let object = GURPS.decode(this.actor, sourceKey)
+
+ // Because we may be modifing the same list, we have to check the order of the keys and
+ // apply the operation that occurs later in the list, first (to keep the indexes the same).
+ let sourceTermsArray = sourceKey.split('.')
+ sourceTermsArray.splice(0, 2) // Remove the first two elements: data.xxxx
+ let targetTermsArray = targetkey.split('.')
+ targetTermsArray.splice(0, 2)
+ let max = Math.min(sourceTermsArray.length, targetTermsArray.length)
+
+ let isSrcFirst = false
+ for (let i = 0; i < max; i++) {
+ // Could be a term like parseInt('contains') < parseInt('contains'), which in typical JS jankiness, reduces
+ // to NaN < NaN, which is false.
+ if (parseInt(sourceTermsArray[i]) < parseInt(targetTermsArray[i])) {
+ isSrcFirst = true
+ break
+ }
+ }
+
+ let d = new Dialog({
+ title: object.name,
+ content: `
Either use the Import button to enter data, or delete this Actor and use the /mook chat command to create NPCs.
Press Ok to open the Full View.',
- label: 'Ok',
- callback: async () => {
- sheet.actor.openSheet('gurps.GurpsActorSheet')
- },
- rejectClose: false,
- }),
- 500
- )
- }
+ if (sheet.actor.isEmptyActor()) {
+ ui.notifications.error('You are editing an EMPTY Actor!')
+ setTimeout(
+ () =>
+ Dialog.prompt({
+ title: 'Empty Actor',
+ content:
+ 'You are editing an EMPTY Actor!
Either use the Import button to enter data, or delete this Actor and use the /mook chat command to create NPCs.
Press Ok to open the Full View.',
+ label: 'Ok',
+ callback: async () => {
+ sheet.actor.openSheet('gurps.GurpsActorSheet')
+ },
+ rejectClose: false,
+ }),
+ 500
+ )
+ }
})
const ClickAndContextMenu = 'click contextmenu'
export class GurpsActorEditorSheet extends GurpsActorSheet {
- /** @override */
- static get defaultOptions() {
- return mergeObject(super.defaultOptions, {
- classes: ['gurps', 'gurpsactorsheet', 'sheet', 'actor'],
- scrollY: [
- '.gurpsactorsheet #advantages #reactions #melee #ranged #skills #spells #equipmentcarried #equipmentother #notes',
- ],
- width: 880,
- height: 800,
- tabs: [{ navSelector: '.gurps-sheet-tabs', contentSelector: '.sheet-body', initial: 'description' }],
- dragDrop: [{ dragSelector: '.item-list .item', dropSelector: null }],
- })
- }
-
- /* -------------------------------------------- */
-
- /** @override */
- get template() {
- if (!game.user.isGM && this.actor.limited) return 'systems/gurps/templates/actor/actor-sheet-gcs-limited.hbs'
- return 'systems/gurps/templates/actor/actor-sheet-gcs-editor.hbs'
- }
-
- //TODO: Don't let user change the sheet in case of user having limited access and the sheet is left in editor mode by someone else
-
- getData() {
- const sheetData = super.getData()
- sheetData.isEditing = true
- return sheetData
- }
-
- makeDeleteMenu(html, cssclass, obj, eventname = 'contextmenu') {
- new ContextMenu(html, cssclass, this.deleteItemMenu(obj), { eventName: eventname })
- }
-
- makeHeaderMenu(html, cssclass, name, obj, path, eventname = 'contextmenu') {
- new ContextMenu(html, cssclass, [this.addItemMenu(name, obj, path)], { eventName: eventname })
- }
-
- activateListeners(html) {
- super.activateListeners(html)
- html.find('textarea').on('drop', this.dropFoundryLinks)
- html.find('input').on('drop', this.dropFoundryLinks)
-
- html.find('#ignoreinputbodyplan').on('click', this._onClickIgnoreImportBodyPlan.bind(this))
- html.find('label[for="ignoreinputbodyplan"]').on('click', this._onClickIgnoreImportBodyPlan.bind(this))
-
- html.find('#showflightmove').on('click', this._onClickShowFlightMove.bind(this))
- html.find('label[for="showflightmove"]').on('click', this._onClickShowFlightMove.bind(this))
-
- html.find('#showflightmove').click(ev => {
- ev.preventDefault()
- let element = ev.currentTarget
- let show = element.checked
- this.actor.update({ 'data.additionalresources.showflightmove': show })
- })
-
- this.makeDeleteMenu(html, '.hlmenu', new HitLocation('???'), ClickAndContextMenu)
- this.makeDeleteMenu(html, '.reactmenu', new Reaction('+0', '???'), ClickAndContextMenu)
- this.makeDeleteMenu(html, '.condmodmenu', new Modifier('+0', '???'), ClickAndContextMenu)
- this.makeDeleteMenu(html, '.meleemenu', new Melee('???'), ClickAndContextMenu)
- this.makeDeleteMenu(html, '.rangedmenu', new Ranged('???'), 'click context')
- this.makeDeleteMenu(html, '.adsmenu', new Advantage('???'), ClickAndContextMenu)
- this.makeDeleteMenu(html, '.skillmenu', new Skill('???'), ClickAndContextMenu)
- this.makeDeleteMenu(html, '.spellmenu', new Spell('???'), ClickAndContextMenu)
- this.makeDeleteMenu(html, '.notemenu', new Note('???', true), 'contextmenu')
-
- html.find('#body-plan').change(async e => {
- let bodyplan = e.currentTarget.value
- if (bodyplan !== this.actor.system.additionalresources.bodyplan) {
- let hitlocationTable = hitlocationDictionary[bodyplan]
- if (!hitlocationTable) {
- ui.notifications.error(`Unsupported bodyplan value: ${bodyplan}`)
- } else {
- // Try to copy any DR values from hit locations that match
- let hitlocations = {}
- let oldlocations = this.actor.system.hitlocations || {}
- let count = 0
- for (let loc in hitlocationTable) {
- let hit = hitlocationTable[loc]
- let originalLoc = Object.values(oldlocations).filter(it => it.where === loc)
- let dr = originalLoc.length === 0 ? 0 : originalLoc[0]?.dr
- let it = new HitLocation(loc, dr, hit.penalty, hit.roll)
- GURPS.put(hitlocations, it, count++)
- }
- this.actor.ignoreRender = true
- await this.actor.update({
- 'data.-=hitlocations': null,
- 'data.additionalresources.bodyplan': bodyplan,
- })
- await this.actor.update({ 'data.hitlocations': 0 }) // A hack. The delete above doesn't always get rid of the properties, so set it to Zero
- this.actor.ignoreRender = false
- await this.actor.update({ 'data.hitlocations': hitlocations })
- }
- }
- })
- }
-
- /**
- * @override
- * @param {*} elementid
- * @returns
- */
- getMenuItems(elementid) {
- // returns an array of menuitems
- let menu = super.getMenuItems(elementid)
-
- // add any additional items to the menu
- switch (elementid) {
- case '#location':
- return [this.addItemMenu(i18n('GURPS.hitLocation'), new HitLocation('???'), 'data.hitlocations'), ...menu]
-
- case '#reactions':
- return [
- this.addItemMenu(i18n('GURPS.reaction'), new Reaction('+0', i18n('GURPS.fromEllipses')), 'data.reactions'),
- ...menu,
- ]
-
- case '#conditionalmods':
- return [
- this.addItemMenu(
- i18n('GURPS.conditionalModifier'),
- new Modifier('+0', i18n('GURPS.fromEllipses')),
- 'data.conditionalmods'
- ),
- ...menu,
- ]
-
- case '#melee':
- return [
- this.addItemMenu(i18n('GURPS.meleeAttack'), new Ranged(`${i18n('GURPS.meleeAttack')}...`), 'data.melee'),
- ...menu,
- ]
-
- case '#ranged':
- return [
- this.addItemMenu(i18n('GURPS.rangedAttack'), new Ranged(`${i18n('GURPS.rangedAttack')}...`), 'data.ranged'),
- ...menu,
- ]
-
- case '#advantages':
- return [
- this.addItemMenu(i18n('GURPS.adDisadQuirkPerk'), new Advantage(`${i18n('GURPS.adDisad')}...`), 'data.ads'),
- ...menu,
- ]
-
- case '#skills':
- return [this.addItemMenu(i18n('GURPS.skill'), new Skill(`${i18n('GURPS.skill')}...`), 'data.skills'), ...menu]
-
- case '#spells':
- return [this.addItemMenu(i18n('GURPS.spell'), new Spell(`${i18n('GURPS.spell')}...`), 'data.spells'), ...menu]
-
- default:
- return menu
- }
- }
-
- async _onClickIgnoreImportBodyPlan(ev) {
- ev.preventDefault()
- let current = this.actor.system.additionalresources.ignoreinputbodyplan
- let ignore = !current
- await this.actor.update({ 'data.additionalresources.ignoreinputbodyplan': ignore })
- }
-
- async _onClickShowFlightMove(ev) {
- ev.preventDefault()
- let current = this.actor.system.additionalresources.showflightmove
- let show = !current
- await this.actor.update({ 'data.additionalresources.showflightmove': show })
- }
+ /** @override */
+ static get defaultOptions() {
+ return mergeObject(super.defaultOptions, {
+ classes: ['gurps', 'gurpsactorsheet', 'sheet', 'actor'],
+ scrollY: [
+ '.gurpsactorsheet #advantages #reactions #melee #ranged #skills #spells #equipmentcarried #equipmentother #notes',
+ ],
+ width: 880,
+ height: 800,
+ tabs: [{ navSelector: '.gurps-sheet-tabs', contentSelector: '.sheet-body', initial: 'description' }],
+ dragDrop: [{ dragSelector: '.item-list .item', dropSelector: null }],
+ })
+ }
+
+ /* -------------------------------------------- */
+
+ /** @override */
+ get template() {
+ if (!game.user.isGM && this.actor.limited) return 'systems/gurps/templates/actor/actor-sheet-gcs-limited.hbs'
+ return 'systems/gurps/templates/actor/actor-sheet-gcs-editor.hbs'
+ }
+
+ //TODO: Don't let user change the sheet in case of user having limited access and the sheet is left in editor mode by someone else
+
+ getData() {
+ const sheetData = super.getData()
+ sheetData.isEditing = true
+ return sheetData
+ }
+
+ makeDeleteMenu(html, cssclass, obj, eventname = 'contextmenu') {
+ new ContextMenu(html, cssclass, this.deleteItemMenu(obj), { eventName: eventname })
+ }
+
+ makeHeaderMenu(html, cssclass, name, obj, path, eventname = 'contextmenu') {
+ new ContextMenu(html, cssclass, [this.addItemMenu(name, obj, path)], { eventName: eventname })
+ }
+
+ activateListeners(html) {
+ super.activateListeners(html)
+ html.find('textarea').on('drop', this.dropFoundryLinks)
+ html.find('input').on('drop', this.dropFoundryLinks)
+
+ html.find('#ignoreinputbodyplan').on('click', this._onClickIgnoreImportBodyPlan.bind(this))
+ html.find('label[for="ignoreinputbodyplan"]').on('click', this._onClickIgnoreImportBodyPlan.bind(this))
+
+ html.find('#showflightmove').on('click', this._onClickShowFlightMove.bind(this))
+ html.find('label[for="showflightmove"]').on('click', this._onClickShowFlightMove.bind(this))
+
+ html.find('#showflightmove').click(ev => {
+ ev.preventDefault()
+ let element = ev.currentTarget
+ let show = element.checked
+ this.actor.update({ 'data.additionalresources.showflightmove': show })
+ })
+
+ this.makeDeleteMenu(html, '.hlmenu', new HitLocation('???'), ClickAndContextMenu)
+ this.makeDeleteMenu(html, '.reactmenu', new Reaction('+0', '???'), ClickAndContextMenu)
+ this.makeDeleteMenu(html, '.condmodmenu', new Modifier('+0', '???'), ClickAndContextMenu)
+ this.makeDeleteMenu(html, '.meleemenu', new Melee('???'), ClickAndContextMenu)
+ this.makeDeleteMenu(html, '.rangedmenu', new Ranged('???'), 'click context')
+ this.makeDeleteMenu(html, '.adsmenu', new Advantage('???'), ClickAndContextMenu)
+ this.makeDeleteMenu(html, '.skillmenu', new Skill('???'), ClickAndContextMenu)
+ this.makeDeleteMenu(html, '.spellmenu', new Spell('???'), ClickAndContextMenu)
+ this.makeDeleteMenu(html, '.notemenu', new Note('???', true), 'contextmenu')
+
+ html.find('#body-plan').change(async e => {
+ let bodyplan = e.currentTarget.value
+ if (bodyplan !== this.actor.system.additionalresources.bodyplan) {
+ let hitlocationTable = hitlocationDictionary[bodyplan]
+ if (!hitlocationTable) {
+ ui.notifications.error(`Unsupported bodyplan value: ${bodyplan}`)
+ } else {
+ // Try to copy any DR values from hit locations that match
+ let hitlocations = {}
+ let oldlocations = this.actor.system.hitlocations || {}
+ let count = 0
+ for (let loc in hitlocationTable) {
+ let hit = hitlocationTable[loc]
+ let originalLoc = Object.values(oldlocations).filter(it => it.where === loc)
+ let dr = originalLoc.length === 0 ? 0 : originalLoc[0]?.dr
+ let it = new HitLocation(loc, dr, hit.penalty, hit.roll)
+ GURPS.put(hitlocations, it, count++)
+ }
+ this.actor.ignoreRender = true
+ await this.actor.update({
+ 'data.-=hitlocations': null,
+ 'data.additionalresources.bodyplan': bodyplan,
+ })
+ await this.actor.update({ 'data.hitlocations': 0 }) // A hack. The delete above doesn't always get rid of the properties, so set it to Zero
+ this.actor.ignoreRender = false
+ await this.actor.update({ 'data.hitlocations': hitlocations })
+ }
+ }
+ })
+ }
+
+ /**
+ * @override
+ * @param {*} elementid
+ * @returns
+ */
+ getMenuItems(elementid) {
+ // returns an array of menuitems
+ let menu = super.getMenuItems(elementid)
+
+ // add any additional items to the menu
+ switch (elementid) {
+ case '#location':
+ return [this.addItemMenu(i18n('GURPS.hitLocation'), new HitLocation('???'), 'data.hitlocations'), ...menu]
+
+ case '#reactions':
+ return [
+ this.addItemMenu(i18n('GURPS.reaction'), new Reaction('+0', i18n('GURPS.fromEllipses')), 'data.reactions'),
+ ...menu,
+ ]
+
+ case '#conditionalmods':
+ return [
+ this.addItemMenu(
+ i18n('GURPS.conditionalModifier'),
+ new Modifier('+0', i18n('GURPS.fromEllipses')),
+ 'data.conditionalmods'
+ ),
+ ...menu,
+ ]
+
+ case '#melee':
+ return [
+ this.addItemMenu(i18n('GURPS.meleeAttack'), new Ranged(`${i18n('GURPS.meleeAttack')}...`), 'data.melee'),
+ ...menu,
+ ]
+
+ case '#ranged':
+ return [
+ this.addItemMenu(i18n('GURPS.rangedAttack'), new Ranged(`${i18n('GURPS.rangedAttack')}...`), 'data.ranged'),
+ ...menu,
+ ]
+
+ case '#advantages':
+ return [
+ this.addItemMenu(i18n('GURPS.adDisadQuirkPerk'), new Advantage(`${i18n('GURPS.adDisad')}...`), 'data.ads'),
+ ...menu,
+ ]
+
+ case '#skills':
+ return [this.addItemMenu(i18n('GURPS.skill'), new Skill(`${i18n('GURPS.skill')}...`), 'data.skills'), ...menu]
+
+ case '#spells':
+ return [this.addItemMenu(i18n('GURPS.spell'), new Spell(`${i18n('GURPS.spell')}...`), 'data.spells'), ...menu]
+
+ default:
+ return menu
+ }
+ }
+
+ async _onClickIgnoreImportBodyPlan(ev) {
+ ev.preventDefault()
+ let current = this.actor.system.additionalresources.ignoreinputbodyplan
+ let ignore = !current
+ await this.actor.update({ 'data.additionalresources.ignoreinputbodyplan': ignore })
+ }
+
+ async _onClickShowFlightMove(ev) {
+ ev.preventDefault()
+ let current = this.actor.system.additionalresources.showflightmove
+ let show = !current
+ await this.actor.update({ 'data.additionalresources.showflightmove': show })
+ }
}
export class GurpsActorSimplifiedSheet extends GurpsActorSheet {
- /** @override */
- static get defaultOptions() {
- return mergeObject(super.defaultOptions, {
- classes: ['gurps', 'sheet', 'actor'],
- width: 820,
- height: 900,
- tabs: [{ navSelector: '.gurps-sheet-tabs', contentSelector: '.sheet-body', initial: 'description' }],
- dragDrop: [{ dragSelector: '.item-list .item', dropSelector: null }],
- })
- }
-
- /* -------------------------------------------- */
-
- /** @override */
- get template() {
- if (!game.user.isGM && this.actor.limited) return 'systems/gurps/templates/actor/actor-sheet-gcs-limited.hbs'
- return 'systems/gurps/templates/simplified.html'
- }
-
- getData() {
- const data = super.getData()
- data.dodge = this.actor.getCurrentDodge()
- data.defense = this.actor.getTorsoDr()
- return data
- }
-
- activateListeners(html) {
- super.activateListeners(html)
- html.find('.rollableicon').click(this._onClickRollableIcon.bind(this))
- }
-
- async _onClickRollableIcon(ev) {
- ev.preventDefault()
- let element = ev.currentTarget
- let val = element.dataset.value
- let parsed = parselink(val)
- GURPS.performAction(parsed.action, this.actor, ev)
- }
+ /** @override */
+ static get defaultOptions() {
+ return mergeObject(super.defaultOptions, {
+ classes: ['gurps', 'sheet', 'actor'],
+ width: 820,
+ height: 900,
+ tabs: [{ navSelector: '.gurps-sheet-tabs', contentSelector: '.sheet-body', initial: 'description' }],
+ dragDrop: [{ dragSelector: '.item-list .item', dropSelector: null }],
+ })
+ }
+
+ /* -------------------------------------------- */
+
+ /** @override */
+ get template() {
+ if (!game.user.isGM && this.actor.limited) return 'systems/gurps/templates/actor/actor-sheet-gcs-limited.hbs'
+ return 'systems/gurps/templates/simplified.html'
+ }
+
+ getData() {
+ const data = super.getData()
+ data.dodge = this.actor.getCurrentDodge()
+ data.defense = this.actor.getTorsoDr()
+ return data
+ }
+
+ activateListeners(html) {
+ super.activateListeners(html)
+ html.find('.rollableicon').click(this._onClickRollableIcon.bind(this))
+ }
+
+ async _onClickRollableIcon(ev) {
+ ev.preventDefault()
+ let element = ev.currentTarget
+ let val = element.dataset.value
+ let parsed = parselink(val)
+ GURPS.performAction(parsed.action, this.actor, ev)
+ }
}
export class GurpsActorNpcSheet extends GurpsActorSheet {
- /** @override */
- static get defaultOptions() {
- return mergeObject(super.defaultOptions, {
- classes: ['npc-sheet', 'sheet', 'actor'],
- width: 750,
- height: 450,
- dragDrop: [{ dragSelector: '.item-list .item', dropSelector: null }],
- })
- }
-
- /* -------------------------------------------- */
-
- /** @override */
- get template() {
- if (!game.user.isGM && this.actor.limited) return 'systems/gurps/templates/actor/actor-sheet-gcs-limited.hbs'
- return 'systems/gurps/templates/actor/npc-sheet-ci.hbs'
- }
-
- getData() {
- const data = super.getData()
- data.currentdodge = this.actor.system.currentdodge
- data.currentmove = this.actor.system.currentmove
- data.defense = this.actor.getTorsoDr()
- let p = this.actor.getEquippedParry()
- // let b = this.actor.getEquippedBlock(); // Don't have a good way to display block yet
- // if (b > 0)
- // data.parryblock = p + "/" + b;
- // else
- data.parryblock = p
-
- return data
- }
-
- activateListeners(html) {
- super.activateListeners(html)
- html.find('.npc-sheet').click(ev => {
- this._onfocus(ev)
- })
- html.find('.rollableicon').click(this._onClickRollableIcon.bind(this))
- }
-
- async _onClickRollableIcon(ev) {
- ev.preventDefault()
- let element = ev.currentTarget
- let val = element.dataset.value
- let parsed = parselink(val)
- GURPS.performAction(parsed.action, this.actor, ev)
- }
+ /** @override */
+ static get defaultOptions() {
+ return mergeObject(super.defaultOptions, {
+ classes: ['npc-sheet', 'sheet', 'actor'],
+ width: 750,
+ height: 450,
+ dragDrop: [{ dragSelector: '.item-list .item', dropSelector: null }],
+ })
+ }
+
+ /* -------------------------------------------- */
+
+ /** @override */
+ get template() {
+ if (!game.user.isGM && this.actor.limited) return 'systems/gurps/templates/actor/actor-sheet-gcs-limited.hbs'
+ return 'systems/gurps/templates/actor/npc-sheet-ci.hbs'
+ }
+
+ getData() {
+ const data = super.getData()
+ data.currentdodge = this.actor.system.currentdodge
+ data.currentmove = this.actor.system.currentmove
+ data.defense = this.actor.getTorsoDr()
+ let p = this.actor.getEquippedParry()
+ // let b = this.actor.getEquippedBlock(); // Don't have a good way to display block yet
+ // if (b > 0)
+ // data.parryblock = p + "/" + b;
+ // else
+ data.parryblock = p
+
+ return data
+ }
+
+ activateListeners(html) {
+ super.activateListeners(html)
+ html.find('.npc-sheet').click(ev => {
+ this._onfocus(ev)
+ })
+ html.find('.rollableicon').click(this._onClickRollableIcon.bind(this))
+ }
+
+ async _onClickRollableIcon(ev) {
+ ev.preventDefault()
+ let element = ev.currentTarget
+ let val = element.dataset.value
+ let parsed = parselink(val)
+ GURPS.performAction(parsed.action, this.actor, ev)
+ }
}
export class GurpsInventorySheet extends GurpsActorSheet {
- /** @override */
- static get defaultOptions() {
- return mergeObject(super.defaultOptions, {
- classes: ['gurps', 'sheet', 'actor'],
- width: 700,
- height: 400,
- tabs: [],
- scrollY: [],
- dragDrop: [{ dragSelector: 'item-list .item', dropSelector: null }],
- })
- }
-
- /* -------------------------------------------- */
-
- /** @override */
- get template() {
- if (!game.user.isGM && this.actor.limited) return 'systems/gurps/templates/actor/actor-sheet-gcs-limited.hbs'
- return 'systems/gurps/templates/inventory-sheet.html'
- }
+ /** @override */
+ static get defaultOptions() {
+ return mergeObject(super.defaultOptions, {
+ classes: ['gurps', 'sheet', 'actor'],
+ width: 700,
+ height: 400,
+ tabs: [],
+ scrollY: [],
+ dragDrop: [{ dragSelector: 'item-list .item', dropSelector: null }],
+ })
+ }
+
+ /* -------------------------------------------- */
+
+ /** @override */
+ get template() {
+ if (!game.user.isGM && this.actor.limited) return 'systems/gurps/templates/actor/actor-sheet-gcs-limited.hbs'
+ return 'systems/gurps/templates/inventory-sheet.html'
+ }
}
diff --git a/module/actor/actor.js b/module/actor/actor.js
index 79c55928e..3df95cfaf 100755
--- a/module/actor/actor.js
+++ b/module/actor/actor.js
@@ -1,18 +1,18 @@
'use strict'
import {
- xmlTextToJson,
- convertRollStringToArrayOfInt,
- recurselist,
- makeRegexPatternFrom,
- i18n,
- i18n_f,
- splitArgs,
- generateUniqueId,
- objectToArray,
- arrayToObject,
- zeroFill,
- arrayBuffertoBase64,
+ xmlTextToJson,
+ convertRollStringToArrayOfInt,
+ recurselist,
+ makeRegexPatternFrom,
+ i18n,
+ i18n_f,
+ splitArgs,
+ generateUniqueId,
+ objectToArray,
+ arrayToObject,
+ zeroFill,
+ arrayBuffertoBase64,
} from '../../lib/utilities.js'
import { parselink, COSTS_REGEX } from '../../lib/parselink.js'
import { ResourceTrackerManager } from './resource-tracker-manager.js'
@@ -21,4351 +21,4349 @@ import * as HitLocations from '../hitlocation/hitlocation.js'
import * as settings from '../../lib/miscellaneous-settings.js'
import { SemanticVersion } from '../../lib/semver.js'
import {
- MOVE_NONE,
- MOVE_ONE,
- MOVE_STEP,
- MOVE_ONETHIRD,
- MOVE_HALF,
- MOVE_TWOTHIRDS,
- PROPERTY_MOVEOVERRIDE_MANEUVER,
- PROPERTY_MOVEOVERRIDE_POSTURE,
+ MOVE_NONE,
+ MOVE_ONE,
+ MOVE_STEP,
+ MOVE_ONETHIRD,
+ MOVE_HALF,
+ MOVE_TWOTHIRDS,
+ PROPERTY_MOVEOVERRIDE_MANEUVER,
+ PROPERTY_MOVEOVERRIDE_POSTURE,
} from './maneuver.js'
import { SmartImporter } from '../smart-importer.js'
import { GurpsItem } from '../item.js'
import GurpsToken from '../token.js'
import { parseDecimalNumber } from '../../lib/parse-decimal-number/parse-decimal-number.js'
import {
- _Base,
- Skill,
- Spell,
- Advantage,
- Ranged,
- Note,
- Encumbrance,
- Equipment,
- Reaction,
- Modifier,
- Melee,
- HitLocationEntry,
- Language,
+ _Base,
+ Skill,
+ Spell,
+ Advantage,
+ Ranged,
+ Note,
+ Encumbrance,
+ Equipment,
+ Reaction,
+ Modifier,
+ Melee,
+ HitLocationEntry,
+ Language,
} from './actor-components.js'
import { multiplyDice } from '../utilities/damage-utils.js'
// Ensure that ALL actors has the current version loaded into them (for migration purposes)
-Hooks.on('createActor', async function(/** @type {Actor} */ actor) {
- await actor.update({ "_stats.systemVersion": game.system.version })
+Hooks.on('createActor', async function (/** @type {Actor} */ actor) {
+ await actor.update({ '_stats.systemVersion': game.system.version })
})
export const MoveModes = {
- Ground: 'GURPS.moveModeGround',
- Air: 'GURPS.moveModeAir',
- Water: 'GURPS.moveModeWater',
- Space: 'GURPS.moveModeSpace',
+ Ground: 'GURPS.moveModeGround',
+ Air: 'GURPS.moveModeAir',
+ Water: 'GURPS.moveModeWater',
+ Space: 'GURPS.moveModeSpace',
}
export class GurpsActor extends Actor {
- /** @override */
- getRollData() {
- const data = super.getRollData()
- return data
- }
-
- /**
- * @returns {GurpsActor}
- */
- asGurpsActor() {
- // @ts-ignore
- return /** @type {GurpsActor} */ (this)
- }
-
- // Return collection os Users that have ownership on this actor
- getOwners() {
- return game.users?.contents.filter(u => this.getUserLevel(u) >= CONST.DOCUMENT_PERMISSION_LEVELS.OWNER)
- }
-
- // 0.8.x added steps necessary to switch sheets
- /**
- * @param {Application} newSheet
- */
- async openSheet(newSheet) {
- const sheet = this.sheet
- if (!!sheet) {
- await sheet.close()
- this._sheet = null
- delete this.apps[sheet.appId]
- await this.setFlag('core', 'sheetClass', newSheet)
- this.ignoreRender = false
- this.sheet.render(true)
- }
- }
-
- prepareData() {
- super.prepareData()
- // By default, it does this:
- // this.data.reset()
- // this.prepareBaseData()
- // this.prepareEmbeddedEntities()
- // this.prepareDerivedData()
- }
-
- prepareBaseData() {
- super.prepareBaseData()
-
- this.system.conditions.posture = 'standing'
- this.system.conditions.self = { modifiers: [] }
- this.system.conditions.target = { modifiers: [] }
- this.system.conditions.exhausted = false
- this.system.conditions.reeling = false
-
- {
- // Oh how I wish we had a typesafe model!
- // I hate treating everything as "maybe its a number, maybe its a string...?!"
-
- let sizemod = this.system.traits?.sizemod.toString() || '+0'
- if (sizemod.match(/^\d/g)) sizemod = `+${sizemod}`
- if (sizemod !== '0' && sizemod !== '+0') {
- this.system.conditions.target.modifiers.push(
- i18n_f('GURPS.modifiersSize', { sm: sizemod }, '{sm} for Size Modifier')
- )
- }
- }
-
- let attributes = this.system.attributes
- if (foundry.utils.getType(attributes.ST.import) === 'string')
- this.system.attributes.ST.import = parseInt(attributes.ST.import)
- }
-
- prepareEmbeddedEntities() {
- // Calls this.applyActiveEffects()
- super.prepareEmbeddedEntities()
- }
-
- prepareDerivedData() {
- super.prepareDerivedData()
-
- // Handle new move data -- if data.move exists, use the default value in that object to set the move
- // value in the first entry of the encumbrance object.
- if (this.system.encumbrance) {
- let move = this.system.move
- if (!move) {
- let currentMove = this.system.encumbrance['00000'].move ?? this.system.basicmove.value
- let value = { mode: MoveModes.Ground, basic: currentMove, default: true }
- setProperty(this.system, 'move.00000', value)
- move = this.system.move
- }
-
- let current = Object.values(move).find(it => it.default)
- if (current) {
- // This is nonpersistent, derived values only.
- this.system.encumbrance['00000'].move = current.basic
- }
- }
-
- this.calculateDerivedValues()
- }
-
- // execute after every import.
- async postImport() {
- this.calculateDerivedValues()
-
- // Convoluted code to add Items (and features) into the equipment list
- // @ts-ignore
- let orig = /** @type {GurpsItem[]} */ (this.items.contents.slice().sort((a, b) => b.name.localeCompare(a.name))) // in case items are in the same list... add them alphabetically
- /**
- * @type {any[]}
- */
- let good = []
- while (orig.length > 0) {
- // We are trying to place 'parent' items before we place 'children' items
- let left = []
- let atLeastOne = false
- for (const i of orig) {
- // @ts-ignore
- if (!i.system.eqt.parentuuid || good.find(e => e.system.eqt.uuid == i.system.eqt.parentuuid)) {
- atLeastOne = true
- good.push(i) // Add items in 'parent' order... parents before children (so children can find parent when inserted into list)
- } else left.push(i)
- }
- if (atLeastOne) orig = left
- else {
- // if unable to move at least one, just copy the rest and hope for the best
- good = [...good, ...left]
- orig = []
- }
- }
- for (const item of good) await this.addItemData(item.data) // re-add the item equipment and features
-
- await this.update({ "_stats.systemVersion": game.system.version }, { diff: false, render: false })
- // Set custom trackers based on templates. should be last because it may need other data to initialize...
- await this.setResourceTrackers()
- await this.syncLanguages()
- }
-
- // Ensure Language Advantages conform to a standard (for Polygot module)
- async syncLanguages() {
- if (this.system.languages) {
- let updated = false
- let newads = { ...this.system.ads }
- let langn = new RegExp('Language:?', 'i')
- let langt = new RegExp(i18n('GURPS.language') + ':?', 'i')
- recurselist(this.system.languages, (e, k, d) => {
- let a = GURPS.findAdDisad(this, '*' + e.name) // is there an Adv including the same name
- if (a) {
- if (!a.name.match(langn) && !a.name.match(langt)) {
- // GCA4/GCS style
- a.name = i18n('GURPS.language') + ': ' + a.name
- updated = true
- }
- } else {
- // GCA5 style (Language without Adv)
- let n = i18n('GURPS.language') + ': ' + e.name
- if (e.spoken == e.written)
- // If equal, then just report single level
- n += ' (' + e.spoken + ')'
- else if (!!e.spoken)
- // Otherwise, report type and level (like GCA4)
- n += ' (' + i18n('GURPS.spoken') + ') (' + e.spoken + ')'
- else n += ' (' + i18n('GURPS.written') + ') (' + e.written + ')'
- let a = new Advantage()
- a.name = n
- a.points = e.points
- GURPS.put(newads, a)
- updated = true
- }
- })
- if (updated) {
- await this.update({ 'data.ads': newads })
- }
- }
- }
-
- // This will ensure that every characater at least starts with these new data values. actor-sheet.js may change them.
- calculateDerivedValues() {
- let saved = !!this.ignoreRender
- this.ignoreRender = true
- this._initializeStartingValues()
- this._applyItemBonuses()
-
- // Must be done after bonuses, but before weights
- this._calculateEncumbranceIssues()
-
- // Must be after bonuses and encumbrance effects on ST
- this._recalcItemFeatures()
- this._calculateRangedRanges()
-
- // Must be done at end
- this._calculateWeights()
-
- let maneuver = this.effects.contents.find(it => it.data.flags?.core?.statusId === 'maneuver')
- this.system.conditions.maneuver = !!maneuver ? maneuver.data.flags.gurps.name : 'undefined'
- this.ignoreRender = saved
- if (!saved) setTimeout(() => this._forceRender(), 500)
- }
-
- // Initialize the attribute starting values/levels. The code is expecting 'value' or 'level' for many things, and instead of changing all of the GUIs and OTF logic
- // we are just going to switch the rug out from underneath. "Import" data will be in the 'import' key and then we will calculate value/level when the actor is loaded.
- _initializeStartingValues() {
- const data = this.system
- data.currentdodge = 0 // start at zero, and bonuses will add, and then they will be finalized later
- if (!!data.equipment && !data.equipment.carried) data.equipment.carried = {} // data protection
- if (!!data.equipment && !data.equipment.other) data.equipment.other = {}
-
- if (!data.migrationversion) return // Prior to v0.9.6, this did not exist
- let v = /** @type {SemanticVersion} */ (SemanticVersion.fromString(data.migrationversion))
-
- // Attributes need to have 'value' set because Foundry expects objs with value and max to be attributes (so we can't use currentvalue)
- // Need to protect against data errors
- for (const attr in data.attributes) {
- if (typeof data.attributes[attr] === 'object' && data.attributes[attr] !== null)
- if (isNaN(data.attributes[attr].import)) data.attributes[attr].value = 0
- else data.attributes[attr].value = parseInt(data.attributes[attr].import)
- }
- // After all of the attributes are copied over, apply tired to ST
- // if (!!data.conditions.exhausted)
- // data.attributes.ST.value = Math.ceil(parseInt(data.attributes.ST.value.toString()) / 2)
- recurselist(data.skills, (e, k, d) => {
- // @ts-ignore
- if (!!e.import) e.level = parseInt(+e.import)
- })
- recurselist(data.spells, (e, k, d) => {
- // @ts-ignore
- if (!!e.import) e.level = parseInt(+e.import)
- })
-
- // we don't really need to use recurselist for melee/ranged... but who knows, they may become hierarchical in the future
- recurselist(data.melee, (e, k, d) => {
- if (!!e.import) {
- e.level = parseInt(e.import)
- if (!isNaN(parseInt(e.parry))) {
- // allows for '14f' and 'no'
- let base = 3 + Math.floor(e.level / 2)
- let bonus = parseInt(e.parry) - base
- if (bonus != 0) {
- e.parrybonus = (bonus > 0 ? '+' : '') + bonus
- }
- }
- if (!isNaN(parseInt(e.block))) {
- let base = 3 + Math.floor(e.level / 2)
- let bonus = parseInt(e.block) - base
- if (bonus != 0) {
- e.blockbonus = (bonus > 0 ? '+' : '') + bonus
- }
- }
- } else {
- e.parrybonus = e.parry
- e.blockbonus = e.block
- }
- })
-
- recurselist(data.ranged, (e, k, d) => {
- e.level = parseInt(e.import)
- })
-
- // Only prep hitlocation DRs from v0.9.7 or higher (we don't really need to use recurselist... but who knows, hitlocations may become hierarchical in the future)
- if (!v.isLowerThan(settings.VERSION_097))
- recurselist(data.hitlocations, (e, k, d) => {
- e.dr = e.import
- })
- }
-
- _applyItemBonuses() {
- let pi = (/** @type {string | undefined} */ n) => (!!n ? parseInt(n) : 0)
- /** @type {string[]} */
- let gids = [] //only allow each global bonus to add once
- const data = this.system
- for (const item of this.items.contents) {
- let itemData = GurpsItem.asGurpsItem(item).system
- if (itemData.equipped && itemData.carried && !!itemData.bonuses && !gids.includes(itemData.globalid)) {
- gids.push(itemData.globalid)
- let bonuses = itemData.bonuses.split('\n')
- for (let bonus of bonuses) {
- let m = bonus.match(/\[(.*)\]/)
- if (!!m) bonus = m[1] // remove extranious [ ]
- let link = parselink(bonus) // ATM, we only support attribute and skill
- if (!!link.action) {
- // start OTF
- recurselist(data.melee, (e, k, d) => {
- e.level = pi(e.level)
- if (link.action.type == 'attribute' && link.action.attrkey == 'DX') {
- // All melee attack skills affected by DX
- e.level += pi(link.action.mod)
- if (!isNaN(parseInt(e.parry))) {
- // handles '11f'
- let m = (e.parry + '').match(/(\d+)(.*)/)
- e.parry = 3 + Math.floor(e.level / 2)
- if (!!e.parrybonus) e.parry += pi(e.parrybonus)
- if (!!m) e.parry += m[2]
- }
- if (!isNaN(parseInt(e.block))) {
- // handles 'no'
- e.block = 3 + Math.floor(e.level / 2)
- if (!!e.blockbonus) e.block += pi(e.blockbonus)
- }
- }
- if (link.action.type == 'attack' && !!link.action.isMelee) {
- if (e.name.match(makeRegexPatternFrom(link.action.name, false))) {
- e.level += pi(link.action.mod)
- if (!isNaN(parseInt(e.parry))) {
- // handles '11f'
- let m = (e.parry + '').match(/(\d+)(.*)/)
- e.parry = 3 + Math.floor(e.level / 2)
- if (!!e.parrybonus) e.parry += pi(e.parrybonus)
- if (!!m) e.parry += m[2]
- }
- if (!isNaN(parseInt(e.block))) {
- // handles 'no'
- e.block = 3 + Math.floor(e.level / 2)
- if (!!e.blockbonus) e.block += pi(e.blockbonus)
- }
- }
- }
- }) // end melee
- recurselist(data.ranged, (e, k, d) => {
- e.level = pi(e.level)
- if (link.action.type == 'attribute' && link.action.attrkey == 'DX') e.level += pi(link.action.mod)
- if (link.action.type == 'attack' && !!link.action.isRanged) {
- if (e.name.match(makeRegexPatternFrom(link.action.name, false))) e.level += pi(link.action.mod)
- }
- }) // end ranged
- recurselist(data.skills, (e, k, d) => {
- e.level = pi(e.level)
- if (link.action.type == 'attribute') {
- // skills affected by attribute changes
- if (e.relativelevel?.toUpperCase().startsWith(link.action.attrkey)) e.level += pi(link.action.mod)
- }
- if (link.action.type == 'skill-spell' && !link.action.isSpellOnly) {
- if (e.name.match(makeRegexPatternFrom(link.action.name, false))) e.level += pi(link.action.mod)
- }
- }) // end skills
- recurselist(data.spells, (e, k, d) => {
- e.level = pi(e.level)
- if (link.action.type == 'attribute') {
- // spells affected by attribute changes
- if (e.relativelevel?.toUpperCase().startsWith(link.action.attrkey)) e.level += pi(link.action.mod)
- }
- if (link.action.type == 'skill-spell' && !link.action.isSkillOnly) {
- if (e.name.match(makeRegexPatternFrom(link.action.name, false))) e.level += pi(link.action.mod)
- }
- }) // end spells
- if (link.action.type == 'attribute') {
- let paths = link.action.path.split('.')
- let last = paths.pop()
- let data = this.system
- if (paths.length > 0) data = getProperty(data, paths.join('.'))
- // regular attributes have a path
- else {
- // only accept DODGE
- if (link.action.attrkey != 'DODGE') break
- }
- data[last] = pi(data[last]) + pi(link.action.mod) // enforce that attribute is int
- } // end attributes & Dodge
- } // end OTF
-
- // parse bonus for other forms, DR+x?
- m = bonus.match(/DR *([+-]\d+) *(.*)/) // DR+1 *Arms "Left Leg" ...
- if (!!m) {
- let delta = parseInt(m[1])
- let locpatterns = null
- if (!!m[2]) {
- let locs = splitArgs(m[2])
- locpatterns = locs.map(l => new RegExp(makeRegexPatternFrom(l), 'i'))
- }
- recurselist(data.hitlocations, (e, k, d) => {
- if (!locpatterns || locpatterns.find(p => !!e.where && e.where.match(p)) != null) {
- let dr = e.dr ?? ''
- dr += ''
- let m = dr.match(/(\d+) *([/\|]) *(\d+)/) // check for split DR 5|3 or 5/3
- if (!!m) {
- dr = parseInt(m[1]) + delta
- let dr2 = parseInt(m[3]) + delta
- e.dr = dr + m[2] + dr2
- } else if (!isNaN(parseInt(dr))) e.dr = parseInt(dr) + delta
- }
- })
- } // end DR
- }
- }
- }
- }
-
- /**
- * @param {string} key
- * @param {any} id
- * @returns {string | undefined}
- */
- _findEqtkeyForId(key, id) {
- var eqtkey
- let data = this.system
- recurselist(data.equipment.carried, (e, k, d) => {
- if (e[key] == id) eqtkey = 'data.equipment.carried.' + k
- })
- if (!eqtkey)
- recurselist(data.equipment.other, (e, k, d) => {
- if (e[key] == id) eqtkey = 'data.equipment.other.' + k
- })
- return eqtkey
- }
-
- /**
- * @param {{ [key: string]: any }} dict
- * @param {string} type
- * @returns {number}
- */
- _sumeqt(dict, type, checkEquipped = false) {
- if (!dict) return 0.0
- let flt = (/** @type {string} */ str) => (!!str ? parseFloat(str) : 0)
- let sum = 0
- for (let k in dict) {
- let e = dict[k]
- let c = flt(e.count)
- let t = flt(e[type])
- if (!checkEquipped || !!e.equipped) sum += c * t
- sum += this._sumeqt(e.contains, type, checkEquipped)
- sum += this._sumeqt(e.collapsed, type, checkEquipped)
- }
- // @ts-ignore
- return parseInt(sum * 100) / 100
- }
-
- _calculateWeights() {
- let data = this.system
- let eqt = data.equipment || {}
- let eqtsummary = {
- eqtcost: this._sumeqt(eqt.carried, 'cost'),
- eqtlbs: this._sumeqt(
- eqt.carried,
- 'weight',
- game.settings.get(settings.SYSTEM_NAME, settings.SETTING_CHECK_EQUIPPED)
- ),
- othercost: this._sumeqt(eqt.other, 'cost'),
- }
- if (game.settings.get(settings.SYSTEM_NAME, settings.SETTING_AUTOMATIC_ENCUMBRANCE))
- this.checkEncumbance(eqtsummary.eqtlbs)
- data.eqtsummary = eqtsummary
- }
-
- _calculateEncumbranceIssues() {
- const data = this.system
- const encs = data.encumbrance
- const isReeling = !!data.conditions.reeling
- const isTired = !!data.conditions.exhausted
-
- // We must assume that the first level of encumbrance has the finally calculated move and dodge settings
- if (!!encs) {
- const level0 = encs[zeroFill(0)] // if there are encumbrances, there will always be a level0
- let effectiveMove = parseInt(level0.move)
- let effectiveDodge = isNaN(parseInt(level0.dodge)) ? '–' : parseInt(level0.dodge) + data.currentdodge
- let effectiveSprint = this._getSprintMove()
-
- if (isReeling) {
- effectiveMove = Math.ceil(effectiveMove / 2)
- effectiveDodge = isNaN(effectiveDodge) ? '–' : Math.ceil(effectiveDodge / 2)
- effectiveSprint = Math.ceil(effectiveSprint / 2)
- }
-
- if (isTired) {
- effectiveMove = Math.ceil(effectiveMove / 2)
- effectiveDodge = isNaN(effectiveDodge) ? '–' : Math.ceil(effectiveDodge / 2)
- effectiveSprint = Math.ceil(effectiveSprint / 2)
- }
-
- for (let enckey in encs) {
- let enc = encs[enckey]
- let threshold = 1.0 - 0.2 * parseInt(enc.level) // each encumbrance level reduces move by 20%
- enc.currentmove = this._getCurrentMove(effectiveMove, threshold) //Math.max(1, Math.floor(m * t))
- enc.currentdodge = isNaN(effectiveDodge) ? '–' : Math.max(1, effectiveDodge - parseInt(enc.level))
- enc.currentsprint = Math.max(1, Math.floor(effectiveSprint * threshold))
- enc.currentmovedisplay = enc.currentmove
- // TODO remove additionalresources.showflightmove
- // if (!!data.additionalresources?.showflightmove)
- enc.currentmovedisplay = this._isEnhancedMove() ? enc.currentmove + '/' + enc.currentsprint : enc.currentmove
- if (enc.current) {
- // Save the global move/dodge
- data.currentmove = enc.currentmove
- data.currentdodge = enc.currentdodge
- data.currentsprint = enc.currentsprint
- }
- }
- }
-
- if (!data.equippedparry) data.equippedparry = this.getEquippedParry()
- if (!data.equippedblock) data.equippedblock = this.getEquippedBlock()
- // catch for older actors that may not have these values set
- if (!data.currentmove) data.currentmove = parseInt(data.basicmove.value.toString())
- if (!data.currentdodge && data.dodge.value) data.currentdodge = parseInt(data.dodge.value.toString())
- if (!data.currentflight) data.currentflight = parseFloat(data.basicspeed.value.toString()) * 2
- }
-
- _isEnhancedMove() {
- return !!this._getCurrentMoveMode()?.enhanced
- }
-
- _getSprintMove() {
- let current = this._getCurrentMoveMode()
- if (!current) return 0
- if (current?.enhanced) return current.enhanced
- return Math.floor(current.basic * 1.2)
- }
-
- _getCurrentMoveMode() {
- let move = this.system.move
- let current = Object.values(move).find(it => it.default)
- if (!current && Object.keys(move).length > 0) return move['00000']
- return current
- }
-
- /**
- * @param {number} move
- * @param {number} threshold
- * @returns {number}
- */
- _getCurrentMove(move, threshold) {
- let inCombat = false
- try {
- inCombat = !!game.combat?.combatants.filter(c => c.actorId == this.id)
- } catch (err) { } // During game startup, an exception is being thrown trying to access 'game.combat'
- let updateMove = game.settings.get(settings.SYSTEM_NAME, settings.SETTING_MANEUVER_UPDATES_MOVE) && inCombat
-
- let maneuver = this._getMoveAdjustedForManeuver(move, threshold)
- let posture = this._getMoveAdjustedForPosture(move, threshold)
-
- if (threshold == 1.0)
- this.system.conditions.move = maneuver.move < posture.move ? maneuver.text : posture.text
- return updateMove
- ? maneuver.move < posture.move
- ? maneuver.move
- : posture.move
- : Math.max(1, Math.floor(move * threshold))
- }
-
- _getMoveAdjustedForManeuver(move, threshold) {
- let adjustment = null
-
- if (foundry.utils.getProperty(this, PROPERTY_MOVEOVERRIDE_MANEUVER)) {
- let value = foundry.utils.getProperty(this, PROPERTY_MOVEOVERRIDE_MANEUVER)
- let mv = GURPS.Maneuvers.get(this.system.conditions.maneuver)
- let reason = !!mv ? i18n(mv.label) : ''
-
- adjustment = this._adjustMove(move, threshold, value, reason)
- }
- return !!adjustment
- ? adjustment
- : {
- move: Math.max(1, Math.floor(move * threshold)),
- text: i18n('GURPS.moveFull'),
- }
- }
-
- _adjustMove(move, threshold, value, reason) {
- switch (value) {
- case MOVE_NONE:
- return { move: 0, text: i18n_f('GURPS.moveNone', { reason: reason }) }
-
- case MOVE_ONE:
- return {
- move: 1,
- text: i18n_f('GURPS.moveConstant', { value: 1, unit: 'yard', reason: reason }, '1 {unit}/second'),
- }
-
- case MOVE_STEP:
- return { move: this._getStep(), text: i18n_f('GURPS.moveStep', { reason: reason }) }
-
- case MOVE_ONETHIRD:
- return {
- move: Math.max(1, Math.ceil((move / 3) * threshold)),
- text: i18n_f('GURPS.moveOneThird', { reason: reason }),
- }
-
- case MOVE_HALF:
- return {
- move: Math.max(1, Math.ceil((move / 2) * threshold)),
- text: i18n_f('GURPS.moveHalf', { reason: reason }),
- }
-
- case MOVE_TWOTHIRDS:
- return {
- move: Math.max(1, Math.ceil(((2 * move) / 3) * threshold)),
- text: i18n_f('GURPS.moveTwoThirds', { reason: reason }),
- }
- }
-
- return null
- }
-
- _getMoveAdjustedForPosture(move, threshold) {
- let adjustment = null
-
- if (foundry.utils.getProperty(this, PROPERTY_MOVEOVERRIDE_POSTURE)) {
- let value = foundry.utils.getProperty(this, PROPERTY_MOVEOVERRIDE_POSTURE)
- let reason = i18n(GURPS.StatusEffect.lookup(this.system.conditions.posture).label)
- adjustment = this._adjustMove(move, threshold, value, reason)
- }
-
- return !!adjustment
- ? adjustment
- : {
- move: Math.max(1, Math.floor(move * threshold)),
- text: i18n('GURPS.moveFull'),
- }
- }
-
- _calculateRangedRanges() {
- if (!game.settings.get(settings.SYSTEM_NAME, settings.SETTING_CONVERT_RANGED)) return
- let st = +this.system.attributes.ST.value
- recurselist(this.system.ranged, r => {
- let rng = r.range || '' // Data protection
- rng = rng + '' // force to string
- let m = rng.match(/^ *[xX]([\d\.]+) *$/)
- if (m) {
- rng = parseFloat(m[1]) * st
- } else {
- m = rng.match(/^ *[xX]([\d\.]+) *\/ *[xX]([\d\.]+) *$/)
- if (m) {
- rng = `${parseFloat(m[1]) * st}/${parseFloat(m[2]) * st}`
- }
- }
- r.range = rng
- })
- }
-
- // Once all of the bonuses are applied, determine the actual level for each feature
- _recalcItemFeatures() {
- let data = this.system
- this._collapseQuantumEq(data.melee, true)
- this._collapseQuantumEq(data.ranged)
- this._collapseQuantumEq(data.skills)
- this._collapseQuantumEq(data.spells)
- }
-
- // convert Item feature OTF formulas into actual skill levels.
- /**
- * @param {Object} list
- */
- _collapseQuantumEq(list, isMelee = false) {
- recurselist(list, async e => {
- let otf = e.otf
- if (!!otf) {
- let m = otf.match(/\[(.*)\]/)
- if (!!m) otf = m[1] // remove extranious [ ]
- if (otf.match(/^ *\d+ *$/)) {
- // just a number
- e.import = parseInt(otf)
- } else {
- let action = parselink(otf)
- if (!!action.action) {
- this.ignoreRender = true
- action.action.calcOnly = true
- GURPS.performAction(action.action, this).then(ret => {
- // @ts-ignore
- e.level = ret.target
- if (isMelee) {
- if (!isNaN(parseInt(e.parry))) {
- let p = '' + e.parry
- let m = p.match(/([+-]\d+)(.*)/)
- // @ts-ignore
- if (!m && p.trim() == '0') m = [0, 0] // allow '0' to mean 'no bonus', not skill level = 0
- if (!!m) {
- e.parrybonus = parseInt(m[1])
- e.parry = e.parrybonus + 3 + Math.floor(e.level / 2)
- }
- if (!!m && !!m[2]) e.parry = `${e.parry}${m[2]}`
- }
- if (!isNaN(parseInt(e.block))) {
- let b = '' + e.block
- let m = b.match(/([+-]\d+)(.*)/)
- // @ts-ignore
- if (!m && b.trim() == '0') m = [0, 0] // allow '0' to mean 'no bonus', not skill level = 0
- if (!!m) {
- e.blockbonus = parseInt(m[1])
- e.block = e.blockbonus + 3 + Math.floor(e.level / 2)
- }
- if (!!m && !!m[2]) e.block = `${e.block}${m[2]}`
- }
- }
- })
- }
- }
- }
- })
- }
-
- _getStep() {
- let step = Math.ceil(parseInt(this.system.basicmove.value.toString()) / 10)
- return Math.max(1, step)
- }
-
- /**
- * For every application associated to this actor, refresh it to reflect any updates.
- */
- _renderAllApps() {
- Object.values(this.apps).forEach(it => it.render(false))
- }
-
- /**
- * Update this Document using incremental data, saving it to the database.
- * @see {@link Document.updateDocuments}
- * @param {any} data - Differential update data which modifies the existing values of this document data
- * (default: `{}`)
- * @param {any} [context] - Additional context which customizes the update workflow (default: `{}`)
- * @returns {Promise
Save the current HP (${data.HP.value}) & FP (${data.FP.value}) values or
Overwrite it with the import data, HP (${hp}) & FP (${fp})?
`,
- buttons: {
- save: {
- icon: '',
- label: 'Save',
- callback: () => resolve(true),
- },
- overwrite: {
- icon: '',
- label: 'Overwrite',
- callback: () => resolve(false),
- },
- },
- default: 'save',
- close: () => resolve(false), // just assume overwrite. Error handling would be too much work right now.
- })
- d.render(true)
- })
- }
- }
- if (!saveCurrent) {
- data.HP.value = hp
- data.FP.value = fp
- }
- data.QP.value = qp
-
- let bl_value = parseFloat(calc?.basic_lift.match(/[\d\.]+/g))
- let bl_unit = calc?.basic_lift.replace(bl_value + ' ', '')
-
- let lm = {}
- lm.basiclift = (bl_value * 1).toString() + ' ' + bl_unit
- lm.carryonback = (bl_value * 15).toString() + ' ' + bl_unit
- lm.onehandedlift = (bl_value * 2).toString() + ' ' + bl_unit
- lm.runningshove = (bl_value * 24).toString() + ' ' + bl_unit
- lm.shiftslightly = (bl_value * 50).toString() + ' ' + bl_unit
- lm.shove = (bl_value * 12).toString() + ' ' + bl_unit
- lm.twohandedlift = (bl_value * 8).toString() + ' ' + bl_unit
-
- let bm = atts.find(e => e.attr_id === 'basic_move')?.calc?.value || 0
- data.basicmove.value = bm.toString()
- data.basicmove.points = atts.find(e => e.attr_id === 'basic_move')?.calc?.points || 0
- let bs = atts.find(e => e.attr_id === 'basic_speed')?.calc?.value || 0
- data.basicspeed.value = bs.toString()
- data.basicspeed.points = atts.find(e => e.attr_id === 'basic_speed')?.calc?.points || 0
-
- data.thrust = calc?.thrust
- data.swing = calc?.swing
- data.currentmove = data.basicmove.value
- data.frightcheck = atts.find(e => e.attr_id === 'fright_check')?.calc?.value || 0
-
- data.hearing = atts.find(e => e.attr_id === 'hearing')?.calc?.value || 0
- data.tastesmell = atts.find(e => e.attr_id === 'taste_smell')?.calc?.value || 0
- data.touch = atts.find(e => e.attr_id === 'touch')?.calc?.value || 0
- data.vision = atts.find(e => e.attr_id === 'vision')?.calc?.value || 0
-
- let cm = 0
- let cd = 0
- let es = {}
- let ew = [1, 2, 3, 6, 10]
- let index = 0
- let total_carried = this.calcTotalCarried(eqp)
- for (let i = 0; i <= 4; i++) {
- let e = new Encumbrance()
- e.level = i
- e.current = false
- e.key = 'enc' + i
- let weight_value = bl_value * ew[i]
- // e.current = total_carried <= weight_value && (i == 4 || total_carried < bl_value*ew[i+1]);
- e.current =
- (total_carried < weight_value || i == 4 || bl_value == 0) && (i == 0 || total_carried > bl_value * ew[i - 1])
- e.weight = weight_value.toString() + ' ' + bl_unit
- e.move = calc?.move[i].toString()
- e.dodge = calc?.dodge[i]
- if (e.current) {
- cm = e.move
- cd = e.dodge
- }
- GURPS.put(es, e, index++)
- }
-
- return {
- 'data.attributes': att,
- 'data.HP': data.HP,
- 'data.FP': data.FP,
- 'data.basiclift': data.basiclift,
- 'data.basicmove': data.basicmove,
- 'data.basicspeed': data.basicspeed,
- 'data.thrust': data.thrust,
- 'data.swing': data.swing,
- 'data.currentmove': data.currentmove,
- 'data.frightcheck': data.frightcheck,
- 'data.hearing': data.hearing,
- 'data.tastesmell': data.tastesmell,
- 'data.touch': data.touch,
- 'data.vision': data.vision,
- 'data.liftingmoving': lm,
- 'data.currentmove': cm,
- 'data.currentdodge': cd,
- 'data.-=encumbrance': null,
- 'data.encumbrance': es,
- 'data.QP': data.QP,
- }
- }
-
- calcTotalCarried(eqp) {
- let t = 0
- if (!eqp) return t
- for (let i of eqp) {
- let w = 0
- w += parseFloat(i.weight || '0') * (i.type == 'equipment_container' ? 1 : i.quantity || 0)
- if (i.children?.length) w += this.calcTotalCarried(i.children)
- t += w
- }
- return t
- }
-
- async importTraitsFromGCSv2(p, cd, md) {
- if (!p) return
- let ts = {}
- ts.race = ''
- ts.height = p.height || ''
- ts.weight = p.weight || ''
- ts.age = p.age || ''
- ts.title = p.title || ''
- ts.player = p.player_name || ''
- ts.createdon = cd || ''
- ts.modifiedon = md || ''
- ts.religion = p.religion || ''
- ts.birthday = p.birthday || ''
- ts.hand = p.handedness || ''
- ts.techlevel = p.tech_level || ''
- ts.gender = p.gender || ''
- ts.eyes = p.eyes || ''
- ts.hair = p.hair || ''
- ts.skin = p.skin || ''
-
- const r = {
- 'data.-=traits': null,
- 'data.traits': ts,
- }
-
- if (!!p.portrait && game.settings.get(settings.SYSTEM_NAME, settings.SETTING_OVERWRITE_PORTRAITS)) {
- const path = this.getPortraitPath()
- let currentDir = ''
- for (let i = 0; i < path.split('/').length; i++) {
- try {
- currentDir += path.split('/')[i] + '/'
- await FilePicker.createDirectory('data', currentDir)
- } catch (err) {
- continue
- }
- }
- const filename = `${this.removeAccents(p.name)}${this.id}_portrait.png`.replaceAll(' ', '_')
- const url = `data:image/png;base64,${p.portrait}`
- await fetch(url)
- .then(res => res.blob())
- .then(blob => {
- const file = new File([blob], filename)
- FilePicker.upload('data', path, file, {}, { notify: false })
- })
- r.img = (path + '/' + filename).replaceAll(' ', '_').replaceAll('//', '/')
- }
- return r
- }
-
- getPortraitPath() {
- if (game.settings.get(settings.SYSTEM_NAME, settings.SETTING_PORTRAIT_PATH) == 'global') return 'images/portraits/'
- return `worlds/${game.world.id}/images/portraits`
- }
-
- removeAccents(str) {
- return str
- .normalize('NFD')
- .replace(/[\u0300-\u036f]/g, '') // Remove accents
- .replace(/([^\w]+|\s+)/g, '-') // Replace space and other characters by hyphen
- .replace(/\-\-+/g, '-') // Replaces multiple hyphens by one hyphen
- .replace(/(^-+|-+$)/g, '')
- }
-
- signedNum(x) {
- if (x >= 0) return `+${x}`
- else return x.toString()
- }
-
- importSizeFromGCSv1(commit, profile, ads, skills, equipment) {
- let ts = commit['data.traits']
- let final = profile.SM || 0
- let temp = [].concat(ads, skills, equipment)
- let all = []
- for (let i of temp) {
- all = all.concat(this.recursiveGet(i))
- }
- for (let i of all) {
- if (i.features?.length)
- for (let f of i.features) {
- if (f.type == 'attribute_bonus' && f.attribute == 'sm')
- final += f.amount * (!!i.levels ? parseFloat(i.levels) : 1)
- }
- }
- ts.sizemod = this.signedNum(final)
- return {
- 'data.-=traits': null,
- 'data.traits': ts,
- }
- }
-
- importAdsFromGCSv3(ads) {
- let temp = []
- if (!!ads)
- for (let i of ads) {
- temp = temp.concat(this.importAd(i, ''))
- }
- return {
- 'data.-=ads': null,
- 'data.ads': this.foldList(temp),
- }
- }
-
- importAd(i, p) {
- let a = new Advantage()
- a.name = i.name + (i.levels ? ' ' + i.levels.toString() : '') || 'Advantage'
- a.points = i.calc?.points
- a.note = i.notes
- a.userdesc = i.userdesc
- a.notes = ''
-
- if (i.cr != null) {
- a.notes = '[' + game.i18n.localize('GURPS.CR' + i.cr.toString()) + ': ' + a.name + ']'
- }
- if (i.modifiers?.length) {
- for (let j of i.modifiers)
- if (!j.disabled) a.notes += `${!!a.notes ? '; ' : ''}${j.name}${!!j.notes ? ' (' + j.notes + ')' : ''}`
- }
- if (!!a.note) a.notes += (!!a.notes ? '\n' : '') + a.note
- if (!!a.userdesc) a.notes += (!!a.notes ? '\n' : '') + a.userdesc
- a.pageRef(i.reference)
- a.uuid = i.id
- a.parentuuid = p
-
- let old = this._findElementIn('ads', a.uuid)
- this._migrateOtfsAndNotes(old, a, i.vtt_notes)
-
- let ch = []
- if (i.children?.length) {
- for (let j of i.children) ch = ch.concat(this.importAd(j, i.id))
- }
- return [a].concat(ch)
- }
-
- importSkillsFromGCSv2(sks) {
- if (!sks) return
- let temp = []
- for (let i of sks) {
- temp = temp.concat(this.importSk(i, ''))
- }
- return {
- 'data.-=skills': null,
- 'data.skills': this.foldList(temp),
- }
- }
-
- importSk(i, p) {
- let name =
- i.name + (!!i.tech_level ? `/TL${i.tech_level}` : '') + (!!i.specialization ? ` (${i.specialization})` : '') ||
- 'Skill'
- if (i.type == 'technique' && !!i.default) {
- let addition = ''
- addition = ' (' + i.default.name
- if (!!i.default.specialization) {
- addition += ' (' + i.default.specialization + ')'
- }
- name += addition + ')'
- }
- let s = new Skill(name, '')
- s.pageRef(i.reference || '')
- s.uuid = i.id
- s.parentuuid = p
- if (['skill', 'technique'].includes(i.type)) {
- s.type = i.type.toUpperCase()
- s.import = !!i.calc ? i.calc.level : ''
- if (s.level == 0) s.level = ''
- s.points = i.points
- s.relativelevel = i.calc?.rsl
- s.notes = i.notes || ''
- } else {
- // Usually containers
- s.level = ''
- }
- let old = this._findElementIn('skills', s.uuid)
- this._migrateOtfsAndNotes(old, s, i.vtt_notes)
-
- let ch = []
- if (i.children?.length) {
- for (let j of i.children) ch = ch.concat(this.importSk(j, i.id))
- }
- return [s].concat(ch)
- }
-
- importSpellsFromGCSv2(sps) {
- if (!sps) return
- let temp = []
- for (let i of sps) {
- temp = temp.concat(this.importSp(i, ''))
- }
- return {
- 'data.-=spells': null,
- 'data.spells': this.foldList(temp),
- }
- }
-
- importSp(i, p) {
- let s = new Spell()
- s.name = i.name || 'Spell'
- s.uuid = i.id
- s.parentuuid = p
- s.pageRef(i.reference || '')
- if (['spell', 'ritual_magic_spell'].includes(i.type)) {
- s.class = i.spell_class || ''
- s.college = i.college || ''
- s.cost = i.casting_cost || ''
- s.maintain = i.maintenance_cost || ''
- s.difficulty = i.difficulty.toUpperCase()
- s.relativelevel = i.calc?.rsl
- s.notes = i.notes || ''
- s.duration = i.duration || ''
- s.points = i.points || ''
- s.casttime = i.casting_time || ''
- s.import = i.calc?.level || 0
- }
-
- let old = this._findElementIn('spells', s.uuid)
- this._migrateOtfsAndNotes(old, s, i.vtt_notes)
-
- let ch = []
- if (i.children?.length) {
- for (let j of i.children) ch = ch.concat(this.importSp(j, i.id))
- }
- return [s].concat(ch)
- }
-
- importEquipmentFromGCSv2(eq, oeq) {
- if (!eq && !oeq) return
- let temp = []
- if (!!eq)
- for (let i of eq) {
- temp = temp.concat(this.importEq(i, '', true))
- }
- if (!!oeq)
- for (let i of oeq) {
- temp = temp.concat(this.importEq(i, '', false))
- }
-
- recurselist(this.system.equipment?.carried, t => {
- t.carried = true
- if (!!t.save) temp.push(t)
- })
- recurselist(this.system.equipment?.other, t => {
- t.carried = false
- if (!!t.save) temp.push(t)
- })
-
- temp.forEach(e => {
- e.contains = {}
- e.collapsed = {}
- })
-
- temp.forEach(e => {
- if (!!e.parentuuid) {
- let parent = null
- parent = temp.find(f => f.uuid === e.parentuuid)
- if (!!parent) GURPS.put(parent.contains, e)
- else e.parentuuid = ''
- }
- })
-
- let equipment = {
- carried: {},
- other: {},
- }
- let cindex = 0
- let oindex = 0
-
- temp.forEach(eqt => {
- Equipment.calc(eqt)
- if (!eqt.parentuuid) {
- if (eqt.carried) GURPS.put(equipment.carried, eqt, cindex++)
- else GURPS.put(equipment.other, eqt, oindex++)
- }
- })
- return {
- 'data.-=equipment': null,
- 'data.equipment': equipment,
- }
- }
-
- importEq(i, p, carried) {
- let e = new Equipment()
- e.name = i.description || 'Equipment'
- e.count = i.type == 'equipment_container' ? '1' : i.quantity || '0'
- e.cost =
- (parseFloat(i.calc?.extended_value) / (i.type == 'equipment_container' ? 1 : i.quantity || 1)).toString() || ''
- e.carried = carried
- e.equipped = i.equipped
- e.techlevel = i.tech_level || ''
- e.legalityclass = i.legality_class || '4'
- e.categories = i.categories?.join(', ') || ''
- e.uses = i.uses || 0
- e.maxuses = i.max_uses || 0
- e.uuid = i.id
- e.parentuuid = p
- e.notes = ''
- e.note = i.notes || ''
- if (i.modifiers?.length) {
- for (let j of i.modifiers)
- if (!j.disabled) e.notes += `${!!e.notes ? '; ' : ''}${j.name}${!!j.notes ? ' (' + j.notes + ')' : ''}`
- }
- if (!!e.note) e.notes += (!!e.notes ? '\n' : '') + e.note
- e.weight =
- (parseFloat(i.calc?.extended_weight) / (i.type == 'equipment_container' ? 1 : i.quantity || 1)).toString() || '0'
- e.pageRef(i.reference || '')
- let old = this._findElementIn('equipment.carried', e.uuid)
- if (!old) old = this._findElementIn('equipment.other', e.uuid)
- this._migrateOtfsAndNotes(old, e, i.vtt_notes)
- if (!!old) {
- e.carried = old.carried
- e.equipped = old.equipped
- e.parentuuid = old.parentuuid
- if (old.ignoreImportQty) {
- e.count = old.count
- e.uses = old.uses
- e.maxuses = old.maxuses
- e.ignoreImportQty = true
- }
- }
- let ch = []
- if (i.children?.length) {
- for (let j of i.children) ch = ch.concat(this.importEq(j, i.id, carried))
- for (let j of ch) {
- e.cost -= j.cost * j.count
- e.weight -= j.weight * j.count
- }
- // let weight_reduction = 0;
- // if (!!i.modifiers?.length) for (let m of i.modifiers) if (!m.disabled && !!m.features?.length) for (let mf of m.features) if (mf.type == "contained_weight_reduction") weight_reduction += parseFloat(mf.reduction);
- // if (!!i.features?.length) for (let f of i.features) if (f.type == "contained_weight_reduction") weight_reduction += parseFloat(f.reduction);
- // for (let j of ch) {
- // e.cost -= j.cost*j.count;
- // if (weight_reduction == 0) e.weight -= j.weight*j.count;
- // else {
- // weight_reduction -= j.weight*j.count;
- // if (weight_reduction < 0) {
- // e.weight += weight_reduction;
- // weight_reduction = 0;
- // }
- // }
- // }
- }
- return [e].concat(ch)
- }
-
- importNotesFromGCSv2(notes) {
- if (!notes) return
- let temp = []
- for (let i of notes) {
- temp = temp.concat(this.importNote(i, ''))
- }
- recurselist(this.system.notes, t => {
- if (!!t.save) temp.push(t)
- })
- return {
- 'data.-=notes': null,
- 'data.notes': this.foldList(temp),
- }
- }
-
- importNote(i, p) {
- let n = new Note()
- n.notes = i.text || ''
- n.uuid = i.id
- n.parentuuid = p
- n.pageRef(i.reference || '')
- let old = this._findElementIn('notes', n.uuid)
- this._migrateOtfsAndNotes(old, n)
- let ch = []
- if (i.children?.length) {
- for (let j of i.children) ch = ch.concat(this.importNote(j, i.id))
- }
- return [n].concat(ch)
- }
-
- async importProtectionFromGCSv2(hls) {
- if (!hls) return
- let data = this.system
- if (!!data.additionalresources.ignoreinputbodyplan) return
-
- /** @type {HitLocations.HitLocation[]} */
- let locations = []
- for (let i of hls.locations) {
- let l = new HitLocations.HitLocation(i.table_name)
- l.import = i.calc?.dr.all?.toString() || '0'
- for (let [key, value] of Object.entries(i.calc?.dr))
- if (key != 'all') {
- let damtype = GURPS.DamageTables.damageTypeMap[key]
- if (!l.split) l.split = {}
- l.split[damtype] = +l.import + value
- }
- l.penalty = i.hit_penalty.toString()
- while (locations.filter(it => it.where == l.where).length > 0) {
- l.where = l.where + '*'
- }
- locations.push(l)
- }
- let vitals = locations.filter(value => value.where === HitLocations.HitLocation.VITALS)
- if (vitals.length === 0) {
- let hl = new HitLocations.HitLocation(HitLocations.HitLocation.VITALS)
- hl.penalty = HitLocations.hitlocationRolls[HitLocations.HitLocation.VITALS].penalty
- hl.roll = HitLocations.hitlocationRolls[HitLocations.HitLocation.VITALS].roll
- hl.import = '0'
- locations.push(hl)
- }
- // Hit Locations MUST come from an existing bodyplan hit location table, or else ADD (and
- // potentially other features) will not work. Sometime in the future, we will look at
- // user-entered hit locations.
- let bodyplan = hls.id // Was a body plan actually in the import?
- if (bodyplan === 'snakemen') bodyplan = 'snakeman'
- let table = HitLocations.hitlocationDictionary[bodyplan] // If so, try to use it.
-
- /** @type {HitLocations.HitLocation[]} */
- let locs = []
- locations.forEach(e => {
- if (!!table && !!table[e.where]) {
- // if e.where already exists in table, don't map
- locs.push(e)
- } else {
- // map to new name(s) ... sometimes we map 'Legs' to ['Right Leg', 'Left Leg'], for example.
- e.locations(false).forEach(l => locs.push(l)) // Map to new names
- }
- })
- locations = locs
-
- if (!table) {
- locs = []
- locations.forEach(e => {
- e.locations(true).forEach(l => locs.push(l)) // Map to new names, but include original to help match against tables
- })
- bodyplan = this._getBodyPlan(locs)
- table = HitLocations.hitlocationDictionary[bodyplan]
- }
- // update location's roll and penalty based on the bodyplan
-
- if (!!table) {
- Object.values(locations).forEach(it => {
- let [lbl, entry] = HitLocations.HitLocation.findTableEntry(table, it.where)
- if (!!entry) {
- it.where = lbl // It might be renamed (ex: Skull -> Brain)
- if (!it.penalty) it.penalty = entry.penalty
- if (!it.roll || it.roll.length === 0 || it.roll === HitLocations.HitLocation.DEFAULT) it.roll = entry.roll
- }
- })
- }
-
- // write the hit locations out in bodyplan hit location table order. If there are
- // other entries, append them at the end.
- /** @type {HitLocations.HitLocation[]} */
- let temp = []
- Object.keys(table).forEach(key => {
- let results = Object.values(locations).filter(loc => loc.where === key)
- if (results.length > 0) {
- if (results.length > 1) {
- // If multiple locs have same where, concat the DRs. Leg 7 & Leg 8 both map to "Leg 7-8"
- let d = ''
-
- /** @type {string | null} */
- let last = null
- results.forEach(r => {
- if (r.import != last) {
- d += '|' + r.import
- last = r.import
- }
- })
-
- if (!!d) d = d.substr(1)
- results[0].import = d
- }
- temp.push(results[0])
- locations = locations.filter(it => it.where !== key)
- } else {
- // Didn't find loc that should be in the table. Make a default entry
- temp.push(new HitLocations.HitLocation(key, '0', table[key].penalty, table[key].roll))
- }
- })
- locations.forEach(it => temp.push(it))
-
- let prot = {}
- let index = 0
- temp.forEach(it => GURPS.put(prot, it, index++))
-
- let saveprot = true
- if (!!data.lastImport && !!data.additionalresources.bodyplan && bodyplan != data.additionalresources.bodyplan) {
- let option = game.settings.get(settings.SYSTEM_NAME, settings.SETTING_IMPORT_BODYPLAN)
- if (option == 1) {
- saveprot = false
- }
- if (option == 2) {
- saveprot = await new Promise((resolve, reject) => {
- let d = new Dialog({
- title: 'Hit Location Body Plan',
- content:
- `Do you want to
Save the current Body Plan (${game.i18n.localize(
- 'GURPS.BODYPLAN' + data.additionalresources.bodyplan
- )}) or ` +
- `
Overwrite it with the Body Plan from the import: (${game.i18n.localize(
- 'GURPS.BODYPLAN' + bodyplan
- )})?
`,
- buttons: {
- save: {
- icon: '',
- label: 'Save',
- callback: () => resolve(false),
- },
- overwrite: {
- icon: '',
- label: 'Overwrite',
- callback: () => resolve(true),
- },
- },
- default: 'save',
- close: () => resolve(false), // just assume overwrite. Error handling would be too much work right now.
- })
- d.render(true)
- })
- }
- }
- if (saveprot) {
- return {
- 'data.-=hitlocations': null,
- 'data.hitlocations': prot,
- 'data.additionalresources.bodyplan': bodyplan,
- }
- } else return {}
- }
-
- importPointTotalsFromGCSv2(total, atts, ads, skills, spells) {
- if (!ads) ads = []
- if (!skills) skills = []
- if (!spells) spells = []
- let p_atts = 0
- let p_ads = 0
- let p_disads = 0
- let p_quirks = 0
- let p_skills = 0
- let p_spells = 0
- let p_unspent = total
- let p_total = total
- let p_race = 0
- for (let i of atts) p_atts += i.calc?.points
- for (let i of ads)
- [p_ads, p_disads, p_quirks, p_race] = this.adPointCount(i, p_ads, p_disads, p_quirks, p_race, true)
- for (let i of skills) p_skills = this.skPointCount(i, p_skills)
- for (let i of spells) p_spells = this.skPointCount(i, p_spells)
- p_unspent -= p_atts + p_ads + p_disads + p_quirks + p_skills + p_spells + p_race
- return {
- 'data.totalpoints.attributes': p_atts,
- 'data.totalpoints.ads': p_ads,
- 'data.totalpoints.disads': p_disads,
- 'data.totalpoints.quirks': p_quirks,
- 'data.totalpoints.skills': p_skills,
- 'data.totalpoints.spells': p_spells,
- 'data.totalpoints.unspent': p_unspent,
- 'data.totalpoints.total': p_total,
- 'data.totalpoints.race': p_race,
- }
- }
-
- importReactionsFromGCSv3(ads, skills, equipment) {
- let rs = {}
- let cs = {}
- let index_r = 0
- let index_c = 0
- let temp = [].concat(ads, skills, equipment)
- let all = []
- for (let i of temp) {
- all = all.concat(this.recursiveGet(i))
- }
- let temp_r = []
- let temp_c = []
- for (let i of all) {
- if (i.features?.length)
- for (let f of i.features) {
- if (f.type == 'reaction_bonus') {
- temp_r.push({
- modifier: f.amount * (f.per_level && !!i.levels ? parseInt(i.levels) : 1),
- situation: f.situation,
- })
- } else if (f.type == 'conditional_modifier') {
- temp_c.push({
- modifier: f.amount * (f.per_level && !!i.levels ? parseInt(i.levels) : 1),
- situation: f.situation,
- })
- }
- }
- }
- let temp_r2 = []
- let temp_c2 = []
- for (let i of temp_r) {
- let existing_condition = temp_r2.find(e => e.situation == i.situation)
- if (!!existing_condition) existing_condition.modifier += i.modifier
- else temp_r2.push(i)
- }
- for (let i of temp_c) {
- let existing_condition = temp_c2.find(e => e.situation == i.situation)
- if (!!existing_condition) existing_condition.modifier += i.modifier
- else temp_c2.push(i)
- }
- for (let i of temp_r2) {
- let r = new Reaction()
- r.modifier = i.modifier.toString()
- r.situation = i.situation
- GURPS.put(rs, r, index_r++)
- }
- for (let i of temp_c2) {
- let c = new Modifier()
- c.modifier = i.modifier.toString()
- c.situation = i.situation
- GURPS.put(cs, c, index_c++)
- }
- return {
- 'data.-=reactions': null,
- 'data.reactions': rs,
- 'data.-=conditionalmods': null,
- 'data.conditionalmods': cs,
- }
- }
-
- importCombatFromGCSv2(ads, skills, spells, equipment) {
- let melee = {}
- let ranged = {}
- let m_index = 0
- let r_index = 0
- let temp = [].concat(ads, skills, spells, equipment)
- let all = []
- for (let i of temp) {
- all = all.concat(this.recursiveGet(i))
- }
- for (let i of all) {
- if (i.weapons?.length)
- for (let w of i.weapons) {
- if (w.type == 'melee_weapon') {
- let m = new Melee()
- m.name = i.name || i.description || ''
- m.st = w.strength || ''
- m.weight = i.weight || ''
- m.techlevel = i.tech_level || ''
- m.cost = i.value || ''
- m.notes = i.notes || ''
- if (!!m.notes && w.usage_notes) m.notes += '\n' + w.usage_notes
- m.pageRef(i.reference || '')
- m.mode = w.usage || ''
- m.import = w.calc?.level.toString() || '0'
- m.damage = w.calc?.damage || ''
- m.reach = w.reach || ''
- m.parry = w.calc?.parry || ''
- m.block = w.calc?.block || ''
- let old = this._findElementIn('melee', false, m.name, m.mode)
- this._migrateOtfsAndNotes(old, m, i.vtt_notes)
-
- GURPS.put(melee, m, m_index++)
- } else if (w.type == 'ranged_weapon') {
- let r = new Ranged()
- r.name = i.name || i.description || ''
- r.st = w.strength || ''
- r.bulk = w.bulk || ''
- r.legalityclass = i.legality_class || '4'
- r.ammo = 0
- r.notes = i.notes || ''
- if (!!r.notes && w.usage_notes) r.notes += '\n' + w.usage_notes
- r.pageRef(i.reference || '')
- r.mode = w.usage || ''
- r.import = w.calc?.level || '0'
- r.damage = w.calc?.damage || ''
- r.acc = w.accuracy || ''
- r.rof = w.rate_of_fire || ''
- r.shots = w.shots || ''
- r.rcl = w.recoil || ''
- r.range = w.calc?.range || ''
- let old = this._findElementIn('ranged', false, r.name, r.mode)
- this._migrateOtfsAndNotes(old, r, i.vtt_notes)
-
- GURPS.put(ranged, r, r_index++)
- }
- }
- }
- return {
- 'data.-=melee': null,
- 'data.melee': melee,
- 'data.-=ranged': null,
- 'data.ranged': ranged,
- }
- }
-
- recursiveGet(i) {
- if (!i) return []
- let ch = []
- if (i.children?.length) for (let j of i.children) ch = ch.concat(this.recursiveGet(j))
- if (i.modifiers?.length) for (let j of i.modifiers) ch = ch.concat(this.recursiveGet(j))
- if (!!i.disabled || (i.equipped != null && i.equipped == false)) return []
- return [i].concat(ch)
- }
-
- adPointCount(i, ads, disads, quirks, race, toplevel = false) {
- if (i.type == 'advantage_container' && i.container_type == 'race') race += i.calc?.points
- else if (i.type == 'advantage_container' && i.container_type == 'alternative_abilities') ads += i.calc?.points
- else if (i.type == 'advantage_container' && !!i.children?.length) {
- var [a, d] = [0, 0]
- for (let j of i.children) [a, d, quirks, race] = this.adPointCount(j, a, d, quirks, race)
- if (toplevel) {
- if (a > 0) ads += a
- else disads += a
- } else ads += a + d
- } else if (i.calc?.points == -1) quirks += i.calc?.points
- else if (i.calc?.points > 0) ads += i.calc?.points
- else disads += i.calc?.points
- return [ads, disads, quirks, race]
- }
-
- skPointCount(i, skills) {
- if (i.type == ('skill_container' || 'spell_container') && i.children?.length)
- for (let j of i.children) skills = this.skPointCount(j, skills)
- else skills += i.points
- return skills
- }
-
- /**
- * @param {string} json
- * @param {string} importname
- * @param {string | undefined} [importpath]
- */
- async importFromGCSv2(json, importname, importpath, suppressMessage = false, GCAVersion, GCSVersion) {
- let r
- let msg = []
- let version = 'Direct GCS Import'
- let exit = false
- try {
- r = JSON.parse(json)
- } catch (err) {
- msg.push(i18n('GURPS.importNoJSONDetected'))
- exit = true
- }
- if (!!r) {
- if (!r.calc) {
- msg.push(i18n('GURPS.importOldGCSFile'))
- exit = true
- }
- }
-
- if (msg.length > 0) {
- ui.notifications?.error(msg.join('
'))
- let content = await renderTemplate('systems/gurps/templates/chat-import-actor-errors.html', {
- lines: msg,
- version: version,
- GCAVersion: GCAVersion,
- GCSVersion: GCSVersion,
- url: GURPS.USER_GUIDE_URL,
- })
- ChatMessage.create({
- content: content,
- user: game.user.id,
- type: CONST.CHAT_MESSAGE_TYPES.WHISPER,
- whisper: [game.user.id],
- })
- if (exit) return false
- }
-
- let nm = r['profile']['name']
- console.log("Importing '" + nm + "'")
- let starttime = performance.now()
- let commit = {}
-
- commit = { ...commit, ...{ 'data.lastImport': new Date().toString().split(' ').splice(1, 4).join(' ') } }
- let ar = this.system.additionalresources || {}
- ar.importname = importname || ar.importname
- ar.importpath = importpath || ar.importpath
- try {
- commit = { ...commit, ...{ 'data.additionalresources': ar } }
- commit = { ...commit, ...(await this.importAttributesFromGCSv2(r.attributes, r.equipment, r.calc)) }
- commit = { ...commit, ...(await this.importTraitsFromGCSv2(r.profile, r.created_date, r.modified_date)) }
- commit = { ...commit, ...this.importSizeFromGCSv1(commit, r.profile, r.advantages, r.skills, r.equipment) }
- commit = { ...commit, ...this.importAdsFromGCSv3(r.advantages) }
- commit = { ...commit, ...this.importSkillsFromGCSv2(r.skills) }
- commit = { ...commit, ...this.importSpellsFromGCSv2(r.spells) }
- commit = { ...commit, ...this.importEquipmentFromGCSv2(r.equipment, r.other_equipment) }
- commit = { ...commit, ...this.importNotesFromGCSv2(r.notes) }
-
- commit = { ...commit, ...(await this.importProtectionFromGCSv2(r.settings.hit_locations)) }
- commit = {
- ...commit,
- ...this.importPointTotalsFromGCSv2(r.total_points, r.attributes, r.advantages, r.skills, r.spells),
- }
- commit = { ...commit, ...this.importReactionsFromGCSv3(r.advantages, r.skills, r.equipment) }
- commit = { ...commit, ...this.importCombatFromGCSv2(r.advantages, r.skills, r.spells, r.equipment) }
- } catch (err) {
- console.log(err.stack)
- msg.push(
- i18n_f('GURPS.importGenericError', {
- name: nm,
- error: err.name,
- message: err.message,
- })
- )
- let content = await renderTemplate('systems/gurps/templates/chat-import-actor-errors.html', {
- lines: [msg],
- version: version,
- GCAVersion: GCAVersion,
- GCSVersion: GCSVersion,
- url: GURPS.USER_GUIDE_URL,
- })
- ui.notifications?.warn(msg)
- let chatData = {
- user: game.user.id,
- type: CONST.CHAT_MESSAGE_TYPES.WHISPER,
- content: content,
- whisper: [game.user.id],
- }
- ChatMessage.create(chatData, {})
- // Don't return
- }
-
- console.log('Starting commit')
- let deletes = Object.fromEntries(Object.entries(commit).filter(([key, value]) => key.includes('.-=')))
- let adds = Object.fromEntries(Object.entries(commit).filter(([key, value]) => !key.includes('.-=')))
-
- try {
- this.ignoreRender = true
- await this.internalUpdate(deletes, { diff: false })
- await this.internalUpdate(adds, { diff: false })
- // This has to be done after everything is loaded
- await this.postImport()
- this._forceRender()
-
- // Must update name outside of protection so that Actors list (and other external views) update correctly
- if (!game.settings.get(settings.SYSTEM_NAME, settings.SETTING_IGNORE_IMPORT_NAME)) {
- await this.update({ name: nm, 'token.name': nm })
- }
-
- if (!suppressMessage) ui.notifications?.info(i18n_f('GURPS.importSuccessful', { name: nm }))
- console.log(
- 'Done importing (' +
- Math.round(performance.now() - starttime) +
- 'ms.) You can inspect the character data below:'
- )
- console.log(this)
- return true
- } catch (err) {
- console.log(err.stack)
- let msg = [i18n_f('GURPS.importGenericError', { name: nm, error: err.name, message: err.message })]
- if (err.message == 'Maximum depth exceeded') msg.push(i18n('GURPS.importTooManyContainers'))
- ui.notifications?.warn(msg.join('
'))
- let content = await renderTemplate('systems/gurps/templates/chat-import-actor-errors.html', {
- lines: msg,
- version: 'GCS Direct',
- GCAVersion: GCAVersion,
- GCSVersion: GCSVersion,
- url: GURPS.USER_GUIDE_URL,
- })
-
- let user = game.user
- let chatData = {
- user: game.user.id,
- type: CONST.CHAT_MESSAGE_TYPES.WHISPER,
- content: content,
- whisper: [game.user.id],
- }
- ChatMessage.create(chatData, {})
- return false
- }
- }
-
- // First attempt at import GCS FG XML export data.
- /**
- * @param {string} xml
- * @param {string} importname
- * @param {string | undefined} [importpath]
- */
- async importFromGCSv1(xml, importname, importpath, suppressMessage = false) {
- const GCA5Version = 'GCA5-14'
- const GCAVersion = 'GCA-11'
- const GCSVersion = 'GCS-5'
- if (importname.endsWith('.gcs'))
- return this.importFromGCSv2(xml, importname, importpath, suppressMessage, GCAVersion, GCSVersion)
- var c, ra // The character json, release attributes
- let isFoundryGCS = false
- let isFoundryGCA = false
- let isFoundryGCA5 = false
- // need to remove
'))
- let content = await renderTemplate('systems/gurps/templates/chat-import-actor-errors.html', {
- lines: msg,
- version: version,
- GCAVersion: GCAVersion,
- GCSVersion: GCSVersion,
- url: GURPS.USER_GUIDE_URL,
- })
-
- let user = game.user
- ChatMessage.create({
- content: content,
- user: game.user.id,
- type: CONST.CHAT_MESSAGE_TYPES.WHISPER,
- whisper: [game.user.id],
- })
- if (exit) return false // Some errors cannot be forgiven ;-)
- }
- let nm = this.textFrom(c.name)
- console.log("Importing '" + nm + "'")
- let starttime = performance.now()
- let commit = {}
-
- commit = { ...commit, ...{ 'data.lastImport': new Date().toString().split(' ').splice(1, 4).join(' ') } }
- let ar = this.system.additionalresources || {}
- ar.importname = importname || ar.importname
- ar.importpath = importpath || ar.importpath
- ar.importversion = ra.version
- commit = { ...commit, ...{ 'data.additionalresources': ar } }
-
- try {
- // This is going to get ugly, so break out various data into different methods
- commit = { ...commit, ...(await this.importAttributesFromCGSv1(c.attributes)) }
- commit = { ...commit, ...this.importSkillsFromGCSv1(c.abilities?.skilllist, isFoundryGCS) }
- commit = { ...commit, ...this.importTraitsfromGCSv1(c.traits) }
- commit = { ...commit, ...this.importCombatMeleeFromGCSv1(c.combat?.meleecombatlist, isFoundryGCS) }
- commit = { ...commit, ...this.importCombatRangedFromGCSv1(c.combat?.rangedcombatlist, isFoundryGCS) }
- commit = { ...commit, ...this.importSpellsFromGCSv1(c.abilities?.spelllist, isFoundryGCS) }
- if (isFoundryGCS) {
- commit = { ...commit, ...this.importAdsFromGCSv2(c.traits?.adslist) }
- commit = { ...commit, ...this.importReactionsFromGCSv2(c.reactions) }
- commit = { ...commit, ...this.importConditionalModifiersFromGCSv2(c.conditionalmods) }
- }
- if (isFoundryGCA) {
- commit = { ...commit, ...this.importLangFromGCA(c.traits?.languagelist) }
- commit = { ...commit, ...this.importAdsFromGCA(c.traits?.adslist, c.traits?.disadslist) }
- commit = { ...commit, ...this.importReactionsFromGCA(c.traits?.reactionmodifiers, vernum) }
- }
- commit = { ...commit, ...this.importEncumbranceFromGCSv1(c.encumbrance) }
- commit = { ...commit, ...this.importPointTotalsFromGCSv1(c.pointtotals) }
- commit = { ...commit, ...this.importNotesFromGCSv1(c.description, c.notelist) }
- commit = { ...commit, ...this.importEquipmentFromGCSv1(c.inventorylist, isFoundryGCS) }
- commit = { ...commit, ...(await this.importProtectionFromGCSv1(c.combat?.protectionlist, isFoundryGCA)) }
- } catch (err) {
- console.log(err.stack)
- let msg = i18n_f('GURPS.importGenericError', { name: nm, error: err.name, message: err.message })
- let content = await renderTemplate('systems/gurps/templates/chat-import-actor-errors.html', {
- lines: [msg],
- version: version,
- GCAVersion: GCAVersion,
- GCSVersion: GCSVersion,
- url: GURPS.USER_GUIDE_URL,
- })
-
- ui.notifications?.warn(msg)
- let user = game.user
- let chatData = {
- user: game.user.id,
- type: CONST.CHAT_MESSAGE_TYPES.WHISPER,
- content: content,
- whisper: [game.user.id],
- }
- ChatMessage.create(chatData, {})
- // Don't return, because we want to see how much actually gets committed.
- }
- console.log('Starting commit')
-
- let deletes = Object.fromEntries(Object.entries(commit).filter(([key, value]) => key.includes('.-=')))
- let adds = Object.fromEntries(Object.entries(commit).filter(([key, value]) => !key.includes('.-=')))
-
- try {
- this.ignoreRender = true
- await this.internalUpdate(deletes, { diff: false })
- await this.internalUpdate(adds, { diff: false })
- // This has to be done after everything is loaded
- await this.postImport()
- this._forceRender()
-
- // Must update name outside of protection so that Actors list (and other external views) update correctly
- if (!game.settings.get(settings.SYSTEM_NAME, settings.SETTING_IGNORE_IMPORT_NAME)) {
- await this.update({ name: nm, 'token.name': nm })
- }
-
- if (!suppressMessage) ui.notifications?.info(i18n_f('GURPS.importSuccessful', { name: nm }))
- console.log(
- 'Done importing (' +
- Math.round(performance.now() - starttime) +
- 'ms.) You can inspect the character data below:'
- )
- console.log(this)
- return true
- } catch (err) {
- console.log(err.stack)
- let msg = [i18n_f('GURPS.importGenericError', { name: nm, error: err.name, message: err.message })]
- if (err.message == 'Maximum depth exceeded') msg.push(i18n('GURPS.importTooManyContainers'))
- if (!supressMessage) ui.notifications?.warn(msg.join('
'))
- let content = await renderTemplate('systems/gurps/templates/chat-import-actor-errors.html', {
- lines: msg,
- version: version,
- GCAVersion: GCAVersion,
- GCSVersion: GCSVersion,
- url: GURPS.USER_GUIDE_URL,
- })
-
- let user = game.user
- let chatData = {
- user: game.user.id,
- type: CONST.CHAT_MESSAGE_TYPES.WHISPER,
- content: content,
- whisper: [game.user.id],
- }
- ChatMessage.create(chatData, {})
- return false
- }
- }
-
- // hack to get to private text element created by xml->json method.
- /**
- * @param {{ [key: string]: any }} o
- */
- textFrom(o) {
- if (!o) return ''
- let t = o['#text']
- if (!t) return ''
- return t.trim()
- }
-
- // similar hack to get text as integer.
- /**
- * @param {{ [key: string]: any }} o
- */
- intFrom(o) {
- if (!o) return 0
- let i = o['#text']
- if (!i) return 0
- return parseInt(i)
- }
-
- /**
- * @param {{[key: string] : any}} o
- */
- floatFrom(o) {
- if (!o) return 0
- let f = o['#text'].trim()
- if (!f) return 0
- return f.includes(',') ? parseDecimalNumber(f, { thousands: '.', decimal: ',' }) : parseDecimalNumber(f)
- }
-
- /**
- * @param {string} list
- * @param {string|boolean} uuid
- */
- _findElementIn(list, uuid, name = '', mode = '') {
- var foundkey
- let l = getProperty(this, list)
- recurselist(l, (e, k, d) => {
- if ((uuid && e.uuid == uuid) || (!!e.name && e.name.startsWith(name) && e.mode == mode)) foundkey = k
- })
- return foundkey == null ? foundkey : getProperty(this, list + '.' + foundkey)
- }
-
- /**
- * @param {{ [key: string]: any }} json
- */
- importReactionsFromGCSv2(json) {
- if (!json) return
- let t = this.textFrom
- let rs = {}
- let index = 0
- for (let key in json) {
- if (key.startsWith('id-')) {
- // Allows us to skip over junk elements created by xml->json code, and only select the skills.
- let j = json[key]
- let r = new Reaction()
- r.modifier = t(j.modifier)
- r.situation = t(j.situation)
- GURPS.put(rs, r, index++)
- }
- }
- return {
- 'data.-=reactions': null,
- 'data.reactions': rs,
- }
- }
-
- importConditionalModifiersFromGCSv2(json) {
- if (!json) return
- let t = this.textFrom
- let rs = {}
- let index = 0
- for (let key in json) {
- if (key.startsWith('id-')) {
- let j = json[key]
- let r = new Reaction() // ConditionalModifiers are the same format
- r.modifier = t(j.modifier)
- r.situation = t(j.situation)
- GURPS.put(rs, r, index++)
- }
- }
- return {
- 'data.-=conditionalmods': null,
- 'data.conditionalmods': rs,
- }
- }
-
- /**
- * @param {{ [key: string]: any }} json
- */
- importReactionsFromGCA(json, vernum) {
- if (!json) return
- let text = this.textFrom(json)
- let a = vernum <= 9 ? text.split(',') : text.split('|')
- let rs = {}
- let index = 0
- a.forEach((/** @type {string} */ m) => {
- if (!!m) {
- let t = m.trim()
- let i = t.indexOf(' ')
- let mod = t.substring(0, i)
- let sit = t.substr(i + 1)
- let r = new Reaction(mod, sit)
- GURPS.put(rs, r, index++)
- }
- })
- return {
- 'data.-=reactions': null,
- 'data.reactions': rs,
- }
- }
-
- importLangFromGCA(json) {
- if (!json) return
- let langs = {}
- let index = 0
- let t = this.textFrom
- for (let key in json) {
- if (key.startsWith('id-')) {
- let j = json[key]
- let n = t(j.name)
- let s = t(j.spoken)
- let w = t(j.written)
- let p = t(j.points)
- let l = new Language(n, s, w, p)
- GURPS.put(langs, l, index++)
- }
- }
- return {
- 'data.-=languages': null,
- 'data.languages': langs,
- }
- }
-
- /**
- * @param {{ attributes: Record
Save the current Body Plan (${game.i18n.localize(
- 'GURPS.BODYPLAN' + data.additionalresources.bodyplan
- )}) or ` +
- `
Overwrite it with the Body Plan from the import: (${game.i18n.localize(
- 'GURPS.BODYPLAN' + bodyplan
- )})?
`,
- buttons: {
- save: {
- icon: '',
- label: 'Save',
- callback: () => resolve(false),
- },
- overwrite: {
- icon: '',
- label: 'Overwrite',
- callback: () => resolve(true),
- },
- },
- default: 'save',
- close: () => resolve(false), // just assume overwrite. Error handling would be too much work right now.
- })
- d.render(true)
- })
- }
- }
- if (saveprot)
- return {
- 'data.-=hitlocations': null,
- 'data.hitlocations': prot,
- 'data.additionalresources.bodyplan': bodyplan,
- }
- else return {}
- }
-
- /**
- *
- * @param {Array
Save the current HP (${data.HP.value}) & FP (${data.FP.value}) values or
Overwrite it with the import data, HP (${hp}) & FP (${fp})?
`,
- buttons: {
- save: {
- icon: '',
- label: 'Save',
- callback: () => resolve(true),
- },
- overwrite: {
- icon: '',
- label: 'Overwrite',
- callback: () => resolve(false),
- },
- },
- default: 'save',
- close: () => resolve(false), // just assume overwrite. Error handling would be too much work right now.
- })
- d.render(true)
- })
- }
- }
- if (!saveCurrent) {
- data.HP.value = hp
- data.FP.value = fp
- }
-
- let lm = {}
- lm.basiclift = t(json.basiclift)
- lm.carryonback = t(json.carryonback)
- lm.onehandedlift = t(json.onehandedlift)
- lm.runningshove = t(json.runningshove)
- lm.shiftslightly = t(json.shiftslightly)
- lm.shove = t(json.shove)
- lm.twohandedlift = t(json.twohandedlift)
-
- data.basicmove.value = t(json.basicmove)
- data.basicmove.points = i(json.basicmove_points)
- // data.basicspeed.value = t(json.basicspeed)
- data.basicspeed.value = this.floatFrom(json.basicspeed)
-
- data.basicspeed.points = i(json.basicspeed_points)
- data.thrust = t(json.thrust)
- data.swing = t(json.swing)
- data.currentmove = t(json.move)
- data.frightcheck = i(json.frightcheck)
-
- data.hearing = i(json.hearing)
- data.tastesmell = i(json.tastesmell)
- data.touch = i(json.touch)
- data.vision = i(json.vision)
-
- return {
- 'data.attributes': att,
- 'data.HP': data.HP,
- 'data.FP': data.FP,
- 'data.basiclift': data.basiclift,
- 'data.basicmove': data.basicmove,
- 'data.basicspeed': data.basicspeed,
- 'data.thrust': data.thrust,
- 'data.swing': data.swing,
- 'data.currentmove': data.currentmove,
- 'data.frightcheck': data.frightcheck,
- 'data.hearing': data.hearing,
- 'data.tastesmell': data.tastesmell,
- 'data.touch': data.touch,
- 'data.vision': data.vision,
- 'data.liftingmoving': lm,
- }
- }
-
- // create/update the skills.
- // NOTE: For the update to work correctly, no two skills can have the same name.
- // When reading data, use "this.system.skills", however, when updating, use "system.skills".
- /**
- * @param {{ [key: string]: any }} json
- * @param {boolean} isFoundryGCS
- */
- importSkillsFromGCSv1(json, isFoundryGCS) {
- if (!json) return
- let temp = []
- let t = this.textFrom /// shortcut to make code smaller
- for (let key in json) {
- if (key.startsWith('id-')) {
- // Allows us to skip over junk elements created by xml->json code, and only select the skills.
- let j = json[key]
- let sk = new Skill()
- sk.name = t(j.name)
- sk.type = t(j.type)
- sk.import = t(j.level)
- if (sk.level == 0) sk.level = ''
- sk.points = this.intFrom(j.points)
- sk.relativelevel = t(j.relativelevel)
- if (isFoundryGCS) {
- sk.notes = t(j.notes)
- sk.pageRef(t(j.pageref))
- } else sk.setNotes(t(j.text))
- if (!!j.pageref) sk.pageRef(t(j.pageref))
- sk.uuid = t(j.uuid)
- sk.parentuuid = t(j.parentuuid)
- let old = this._findElementIn('skills', sk.uuid)
- this._migrateOtfsAndNotes(old, sk, t(j.vtt_notes))
-
- temp.push(sk)
- }
- }
- return {
- 'data.-=skills': null,
- 'data.skills': this.foldList(temp),
- }
- }
-
- // create/update the spells.
- // NOTE: For the update to work correctly, no two spells can have the same name.
- // When reading data, use "this.system.spells", however, when updating, use "system.spells".
- /**
- * @param {{ [key: string]: any }} json
- * @param {boolean} isFoundryGCS
- */
- importSpellsFromGCSv1(json, isFoundryGCS) {
- if (!json) return
- let temp = []
- let t = this.textFrom /// shortcut to make code smaller
- for (let key in json) {
- if (key.startsWith('id-')) {
- // Allows us to skip over junk elements created by xml->json code, and only select the skills.
- let j = json[key]
- let sp = new Spell()
- sp.name = t(j.name)
- sp.class = t(j.class)
- sp.college = t(j.college)
- if (isFoundryGCS) {
- sp.cost = t(j.cost)
- sp.maintain = t(j.maintain)
- sp.difficulty = t(j.difficulty)
- sp.relativelevel = t(j.relativelevel)
- sp.notes = t(j.notes)
- } else {
- let cm = t(j.costmaintain)
- let i = cm.indexOf('/')
- if (i >= 0) {
- sp.cost = cm.substring(0, i)
- sp.maintain = cm.substr(i + 1)
- } else {
- sp.cost = cm
- }
- sp.setNotes(t(j.text))
- }
- sp.pageRef(t(j.pageref))
- sp.duration = t(j.duration)
- sp.points = t(j.points)
- sp.casttime = t(j.time)
- sp.import = t(j.level)
- sp.uuid = t(j.uuid)
- sp.parentuuid = t(j.parentuuid)
- let old = this._findElementIn('spells', sp.uuid)
- this._migrateOtfsAndNotes(old, sp, t(j.vtt_notes))
- temp.push(sp)
- }
- }
- return {
- 'data.-=spells': null,
- 'data.spells': this.foldList(temp),
- }
- }
-
- /**
- * @param {{ [key: string]: any }} adsjson
- * @param {{ [key: string]: any }} disadsjson
- */
- importAdsFromGCA(adsjson, disadsjson) {
- /** @type {Advantage[]} */
- let list = []
- this.importBaseAdvantages(list, adsjson)
- this.importBaseAdvantages(list, disadsjson)
- return {
- 'data.-=ads': null,
- 'data.ads': this.foldList(list),
- }
- }
-
- /**
- * @param {Advantage[]} datalist
- * @param {{ [key: string]: any }} json
- */
- importBaseAdvantages(datalist, json) {
- if (!json) return
- let t = this.textFrom /// shortcut to make code smaller
- for (let key in json) {
- if (key.startsWith('id-')) {
- // Allows us to skip over junk elements created by xml->json code, and only select the skills.
- let j = json[key]
- let a = new Advantage()
- a.name = t(j.name)
- a.points = this.intFrom(j.points)
- a.setNotes(t(j.text))
- a.pageRef(t(j.pageref) || a.pageref)
- a.uuid = t(j.uuid)
- a.parentuuid = t(j.parentuuid)
- let old = this._findElementIn('ads', a.uuid)
- this._migrateOtfsAndNotes(old, a, t(j.vtt_notes))
- datalist.push(a)
- }
- }
- }
-
- // In the new GCS import, all ads/disad/quirks/perks are in one list.
- /**
- * @param {{ [key: string]: any }} json
- */
- importAdsFromGCSv2(json) {
- let t = this.textFrom /// shortcut to make code smaller
- let temp = []
- for (let key in json) {
- if (key.startsWith('id-')) {
- // Allows us to skip over junk elements created by xml->json code, and only select the skills.
- let j = json[key]
- let a = new Advantage()
- a.name = t(j.name)
- a.points = this.intFrom(j.points)
- a.note = t(j.notes)
- a.userdesc = t(j.userdesc)
- a.notes = ''
- if (!!a.note && !!a.userdesc) a.notes = a.note + '\n' + a.userdesc
- else if (!!a.note) a.notes = a.note
- else if (!!a.userdesc) a.notes = a.userdesc
- a.pageRef(t(j.pageref))
- a.uuid = t(j.uuid)
- a.parentuuid = t(j.parentuuid)
- let old = this._findElementIn('ads', a.uuid)
- this._migrateOtfsAndNotes(old, a, t(j.vtt_notes))
- temp.push(a)
- }
- }
- return {
- 'data.-=ads': null,
- 'data.ads': this.foldList(temp),
- }
- }
-
- /**
- * Adds any assigned resource trackers to the actor data and sheet.
- */
- async setResourceTrackers() {
- // find those with non-blank slots
- let templates = ResourceTrackerManager.getAllTemplates().filter(it => !!it.slot)
-
- for (const template of templates) {
- // find the matching data on this actor
- let index = zeroFill(template.slot, 4)
- let path = `additionalresources.tracker.${index}`
- let tracker = getProperty(this, path)
-
- while (!tracker) {
- await this.addTracker()
- tracker = getProperty(this, path)
- }
-
- // skip if already set
- if (!!tracker && tracker.name === template.tracker.name) {
- return
- }
-
- // if not blank, don't overwrite
- if (!!tracker && !!tracker.name) {
- ui.notifications?.warn(
- `Will not overwrite Tracker ${template.slot} as its name is set to ${tracker.name}. Create Tracker for ${template.tracker.name} failed.`
- )
- return
- }
-
- await this.applyTrackerTemplate(path, template)
- }
- }
-
- /**
- * Update this tracker slot with the contents of the template.
- * @param {String} path JSON data path to the tracker; must start with 'additionalresources.tracker.'
- * @param {*} template to apply
- */
- async applyTrackerTemplate(path, template) {
- // is there an initializer? If so calculate its value
- let value = 0
- if (!!template.initialValue) {
- value = parseInt(template.initialValue, 10)
- if (Number.isNaN(value)) {
- // try to use initialValue as a path to another value
- value = getProperty(this, template.initialValue)
- }
- }
- template.tracker.max = value
- template.tracker.value = template.tracker.isDamageTracker ? template.tracker.min : value
-
- // remove whatever is there
- await this.clearTracker(path)
-
- // add the new tracker
- /** @type {{ [key: string]: any }} */
- let update = {}
- update[`data.${path}`] = template.tracker
- await this.update(update)
- }
-
- /**
- * Overwrites the tracker pointed to by the path with default/blank values.
- * @param {String} path JSON data path to the tracker; must start with 'additionalresources.tracker.'
- */
- async clearTracker(path) {
- // verify that this is a Tracker
- const prefix = 'additionalresources.tracker.'
- if (!path.startsWith(prefix)) throw `Invalid actor data path, actor=[${this.id}] path=[${path}]`
-
- /** @type {{[key: string]: string}} */
- let update = {}
- update[`data.${path}`] = {
- name: '',
- alias: '',
- pdf: '',
- max: 0,
- min: 0,
- value: 0,
- isDamageTracker: false,
- isDamageType: false,
- initialValue: '',
- thresholds: [],
- }
- await this.update(update)
- }
-
- /**
- * Removes the indicated tracker from the object, reindexing the keys.
- * @param {String} path JSON data path to the tracker; must start with 'additionalresources.tracker.'
- */
- async removeTracker(path) {
- this.ignoreRender = true
- const prefix = 'additionalresources.tracker.'
-
- // verify that this is a Tracker
- if (!path.startsWith(prefix)) throw `Invalid actor data path, actor=[${this.id}] path=[${path}]`
-
- let key = path.replace(prefix, '')
- let trackerData = this.system.additionalresources.tracker
- delete trackerData[key]
- let trackers = objectToArray(trackerData)
- let data = arrayToObject(trackers)
-
- // remove all trackers
- await this.update({ 'data.additionalresources.-=tracker': null })
- // add the new "array" of trackers
- if (data) this.update({ 'data.additionalresources.tracker': data })
- else this.update('data.additionalresources.tracker', {})
-
- this._forceRender()
- }
-
- async addTracker() {
- this.ignoreRender = true
-
- let trackerData = { name: '', value: 0, min: 0, max: 0, points: 0 }
- let data = GurpsActor.addTrackerToDataObject(this.system, trackerData)
-
- await this.update({ 'data.additionalresources.-=tracker': null })
- await this.update({ 'data.additionalresources.tracker': data })
-
- this._forceRender()
- }
-
- static addTrackerToDataObject(data, trackerData) {
- let trackers = GurpsActor.getTrackersAsArray(data)
- trackers.push(trackerData)
- return arrayToObject(trackers)
- }
-
- static getTrackersAsArray(data) {
- let trackerArray = data.additionalresources.tracker
- if (!trackerArray) trackerArray = {}
- return objectToArray(trackerArray)
- }
-
- async setMoveDefault(value) {
- this.ignoreRender = true
- let move = this.system.move
- for (const key in move) {
- move[key].default = value === key
- }
- await this.update({ 'data.-=move': null })
- await this.update({ 'data.move': move })
- this._forceRender()
- }
-
- // --- Functions to handle events on actor ---
-
- /**
- * @param {any[]} damageData
- */
- handleDamageDrop(damageData) {
- if (game.user.isGM || !game.settings.get(settings.SYSTEM_NAME, settings.SETTING_ONLY_GMS_OPEN_ADD))
- new ApplyDamageDialog(this, damageData).render(true)
- else ui.notifications?.warn('Only GMs are allowed to Apply Damage.')
- }
-
- // Drag and drop from Item colletion
- /**
- * @param {{ type: any; x?: number; y?: number; payload?: any; pack?: any; id?: any; data?: any; }} dragData
- */
- async handleItemDrop(dragData) {
- if (!this.isOwner) {
- ui.notifications?.warn(i18n('GURPS.youDoNotHavePermssion'))
- return
- }
- const uuid =
- typeof dragData.pack === 'string'
- ? `Compendium.${dragData.pack}.${dragData.id}`
- : `${dragData.type}.${dragData.id}`
- let global = await fromUuid(uuid)
- let data = !!global ? global.data : dragData.data
- if (!data) {
- ui.notifications?.warn('NO ITEM DATA!')
- return
- }
- ui.notifications?.info(data.name + ' => ' + this.name)
- if (!data.data.globalid) await data.update({ _id: data._id, 'data.globalid': uuid })
- this.ignoreRender = true
- await this.addNewItemData(data)
- this._forceRender()
- }
-
- _forceRender() {
- this.ignoreRender = false
- //console.log("Force Render")
- this.render()
- }
-
- // Drag and drop from an equipment list
- /**
- * @param {{ type?: string; x?: number; y?: number; payload?: any; actorid?: any; itemid?: any; isLinked?: any; key?: any; itemData?: any; }} dragData
- */
- async handleEquipmentDrop(dragData) {
- if (dragData.actorid == this.id) return false // same sheet drag and drop handled elsewhere
- if (!dragData.itemid) {
- ui.notifications?.warn(i18n('GURPS.cannotDragNonFoundryEqt'))
- return
- }
- if (!dragData.isLinked) {
- ui.notifications?.warn("You cannot drag from an un-linked token. The source must have 'Linked Actor Data'")
- return
- }
- let srcActor = game.actors.get(dragData.actorid)
- let eqt = getProperty(srcActor, dragData.key)
- if (
- (!!eqt.contains && Object.keys(eqt.contains).length > 0) ||
- (!!eqt.collapsed && Object.keys(eqt.collapsed).length > 0)
- ) {
- ui.notifications?.warn('You cannot transfer an Item that contains other equipment.')
- return
- }
-
- if (!!this.isOwner && !!srcActor.isOwner) {
- // same owner
- if (eqt.count < 2) {
- let destKey = this._findEqtkeyForId('globalid', eqt.globalid)
- if (!!destKey) {
- // already have some
- let destEqt = getProperty(this, destKey)
- await this.updateEqtCount(destKey, destEqt.count + eqt.count)
- await srcActor.deleteEquipment(dragData.key)
- } else {
- let item = await srcActor.deleteEquipment(dragData.key)
- await this.addNewItemData(item.data)
- }
- } else {
- let content = await renderTemplate('systems/gurps/templates/transfer-equipment.html', { eqt: eqt })
- let callback = async (/** @type {JQuery
Save the current HP (${data.HP.value}) & FP (${data.FP.value}) values or
Overwrite it with the import data, HP (${hp}) & FP (${fp})?
`,
+ buttons: {
+ save: {
+ icon: '',
+ label: 'Save',
+ callback: () => resolve(true),
+ },
+ overwrite: {
+ icon: '',
+ label: 'Overwrite',
+ callback: () => resolve(false),
+ },
+ },
+ default: 'save',
+ close: () => resolve(false), // just assume overwrite. Error handling would be too much work right now.
+ })
+ d.render(true)
+ })
+ }
+ }
+ if (!saveCurrent) {
+ data.HP.value = hp
+ data.FP.value = fp
+ }
+ data.QP.value = qp
+
+ let bl_value = parseFloat(calc?.basic_lift.match(/[\d\.]+/g))
+ let bl_unit = calc?.basic_lift.replace(bl_value + ' ', '')
+
+ let lm = {}
+ lm.basiclift = (bl_value * 1).toString() + ' ' + bl_unit
+ lm.carryonback = (bl_value * 15).toString() + ' ' + bl_unit
+ lm.onehandedlift = (bl_value * 2).toString() + ' ' + bl_unit
+ lm.runningshove = (bl_value * 24).toString() + ' ' + bl_unit
+ lm.shiftslightly = (bl_value * 50).toString() + ' ' + bl_unit
+ lm.shove = (bl_value * 12).toString() + ' ' + bl_unit
+ lm.twohandedlift = (bl_value * 8).toString() + ' ' + bl_unit
+
+ let bm = atts.find(e => e.attr_id === 'basic_move')?.calc?.value || 0
+ data.basicmove.value = bm.toString()
+ data.basicmove.points = atts.find(e => e.attr_id === 'basic_move')?.calc?.points || 0
+ let bs = atts.find(e => e.attr_id === 'basic_speed')?.calc?.value || 0
+ data.basicspeed.value = bs.toString()
+ data.basicspeed.points = atts.find(e => e.attr_id === 'basic_speed')?.calc?.points || 0
+
+ data.thrust = calc?.thrust
+ data.swing = calc?.swing
+ data.currentmove = data.basicmove.value
+ data.frightcheck = atts.find(e => e.attr_id === 'fright_check')?.calc?.value || 0
+
+ data.hearing = atts.find(e => e.attr_id === 'hearing')?.calc?.value || 0
+ data.tastesmell = atts.find(e => e.attr_id === 'taste_smell')?.calc?.value || 0
+ data.touch = atts.find(e => e.attr_id === 'touch')?.calc?.value || 0
+ data.vision = atts.find(e => e.attr_id === 'vision')?.calc?.value || 0
+
+ let cm = 0
+ let cd = 0
+ let es = {}
+ let ew = [1, 2, 3, 6, 10]
+ let index = 0
+ let total_carried = this.calcTotalCarried(eqp)
+ for (let i = 0; i <= 4; i++) {
+ let e = new Encumbrance()
+ e.level = i
+ e.current = false
+ e.key = 'enc' + i
+ let weight_value = bl_value * ew[i]
+ // e.current = total_carried <= weight_value && (i == 4 || total_carried < bl_value*ew[i+1]);
+ e.current =
+ (total_carried < weight_value || i == 4 || bl_value == 0) && (i == 0 || total_carried > bl_value * ew[i - 1])
+ e.weight = weight_value.toString() + ' ' + bl_unit
+ e.move = calc?.move[i].toString()
+ e.dodge = calc?.dodge[i]
+ if (e.current) {
+ cm = e.move
+ cd = e.dodge
+ }
+ GURPS.put(es, e, index++)
+ }
+
+ return {
+ 'data.attributes': att,
+ 'data.HP': data.HP,
+ 'data.FP': data.FP,
+ 'data.basiclift': data.basiclift,
+ 'data.basicmove': data.basicmove,
+ 'data.basicspeed': data.basicspeed,
+ 'data.thrust': data.thrust,
+ 'data.swing': data.swing,
+ 'data.currentmove': data.currentmove,
+ 'data.frightcheck': data.frightcheck,
+ 'data.hearing': data.hearing,
+ 'data.tastesmell': data.tastesmell,
+ 'data.touch': data.touch,
+ 'data.vision': data.vision,
+ 'data.liftingmoving': lm,
+ 'data.currentmove': cm,
+ 'data.currentdodge': cd,
+ 'data.-=encumbrance': null,
+ 'data.encumbrance': es,
+ 'data.QP': data.QP,
+ }
+ }
+
+ calcTotalCarried(eqp) {
+ let t = 0
+ if (!eqp) return t
+ for (let i of eqp) {
+ let w = 0
+ w += parseFloat(i.weight || '0') * (i.type == 'equipment_container' ? 1 : i.quantity || 0)
+ if (i.children?.length) w += this.calcTotalCarried(i.children)
+ t += w
+ }
+ return t
+ }
+
+ async importTraitsFromGCSv2(p, cd, md) {
+ if (!p) return
+ let ts = {}
+ ts.race = ''
+ ts.height = p.height || ''
+ ts.weight = p.weight || ''
+ ts.age = p.age || ''
+ ts.title = p.title || ''
+ ts.player = p.player_name || ''
+ ts.createdon = cd || ''
+ ts.modifiedon = md || ''
+ ts.religion = p.religion || ''
+ ts.birthday = p.birthday || ''
+ ts.hand = p.handedness || ''
+ ts.techlevel = p.tech_level || ''
+ ts.gender = p.gender || ''
+ ts.eyes = p.eyes || ''
+ ts.hair = p.hair || ''
+ ts.skin = p.skin || ''
+
+ const r = {
+ 'data.-=traits': null,
+ 'data.traits': ts,
+ }
+
+ if (!!p.portrait && game.settings.get(settings.SYSTEM_NAME, settings.SETTING_OVERWRITE_PORTRAITS)) {
+ const path = this.getPortraitPath()
+ let currentDir = ''
+ for (let i = 0; i < path.split('/').length; i++) {
+ try {
+ currentDir += path.split('/')[i] + '/'
+ await FilePicker.createDirectory('data', currentDir)
+ } catch (err) {
+ continue
+ }
+ }
+ const filename = `${this.removeAccents(p.name)}${this.id}_portrait.png`.replaceAll(' ', '_')
+ const url = `data:image/png;base64,${p.portrait}`
+ await fetch(url)
+ .then(res => res.blob())
+ .then(blob => {
+ const file = new File([blob], filename)
+ FilePicker.upload('data', path, file, {}, { notify: false })
+ })
+ r.img = (path + '/' + filename).replaceAll(' ', '_').replaceAll('//', '/')
+ }
+ return r
+ }
+
+ getPortraitPath() {
+ if (game.settings.get(settings.SYSTEM_NAME, settings.SETTING_PORTRAIT_PATH) == 'global') return 'images/portraits/'
+ return `worlds/${game.world.id}/images/portraits`
+ }
+
+ removeAccents(str) {
+ return str
+ .normalize('NFD')
+ .replace(/[\u0300-\u036f]/g, '') // Remove accents
+ .replace(/([^\w]+|\s+)/g, '-') // Replace space and other characters by hyphen
+ .replace(/\-\-+/g, '-') // Replaces multiple hyphens by one hyphen
+ .replace(/(^-+|-+$)/g, '')
+ }
+
+ signedNum(x) {
+ if (x >= 0) return `+${x}`
+ else return x.toString()
+ }
+
+ importSizeFromGCSv1(commit, profile, ads, skills, equipment) {
+ let ts = commit['data.traits']
+ let final = profile.SM || 0
+ let temp = [].concat(ads, skills, equipment)
+ let all = []
+ for (let i of temp) {
+ all = all.concat(this.recursiveGet(i))
+ }
+ for (let i of all) {
+ if (i.features?.length)
+ for (let f of i.features) {
+ if (f.type == 'attribute_bonus' && f.attribute == 'sm')
+ final += f.amount * (!!i.levels ? parseFloat(i.levels) : 1)
+ }
+ }
+ ts.sizemod = this.signedNum(final)
+ return {
+ 'data.-=traits': null,
+ 'data.traits': ts,
+ }
+ }
+
+ importAdsFromGCSv3(ads) {
+ let temp = []
+ if (!!ads)
+ for (let i of ads) {
+ temp = temp.concat(this.importAd(i, ''))
+ }
+ return {
+ 'data.-=ads': null,
+ 'data.ads': this.foldList(temp),
+ }
+ }
+
+ importAd(i, p) {
+ let a = new Advantage()
+ a.name = i.name + (i.levels ? ' ' + i.levels.toString() : '') || 'Advantage'
+ a.points = i.calc?.points
+ a.note = i.notes
+ a.userdesc = i.userdesc
+ a.notes = ''
+
+ if (i.cr != null) {
+ a.notes = '[' + game.i18n.localize('GURPS.CR' + i.cr.toString()) + ': ' + a.name + ']'
+ }
+ if (i.modifiers?.length) {
+ for (let j of i.modifiers)
+ if (!j.disabled) a.notes += `${!!a.notes ? '; ' : ''}${j.name}${!!j.notes ? ' (' + j.notes + ')' : ''}`
+ }
+ if (!!a.note) a.notes += (!!a.notes ? '\n' : '') + a.note
+ if (!!a.userdesc) a.notes += (!!a.notes ? '\n' : '') + a.userdesc
+ a.pageRef(i.reference)
+ a.uuid = i.id
+ a.parentuuid = p
+
+ let old = this._findElementIn('ads', a.uuid)
+ this._migrateOtfsAndNotes(old, a, i.vtt_notes)
+
+ let ch = []
+ if (i.children?.length) {
+ for (let j of i.children) ch = ch.concat(this.importAd(j, i.id))
+ }
+ return [a].concat(ch)
+ }
+
+ importSkillsFromGCSv2(sks) {
+ if (!sks) return
+ let temp = []
+ for (let i of sks) {
+ temp = temp.concat(this.importSk(i, ''))
+ }
+ return {
+ 'data.-=skills': null,
+ 'data.skills': this.foldList(temp),
+ }
+ }
+
+ importSk(i, p) {
+ let name =
+ i.name + (!!i.tech_level ? `/TL${i.tech_level}` : '') + (!!i.specialization ? ` (${i.specialization})` : '') ||
+ 'Skill'
+ if (i.type == 'technique' && !!i.default) {
+ let addition = ''
+ addition = ' (' + i.default.name
+ if (!!i.default.specialization) {
+ addition += ' (' + i.default.specialization + ')'
+ }
+ name += addition + ')'
+ }
+ let s = new Skill(name, '')
+ s.pageRef(i.reference || '')
+ s.uuid = i.id
+ s.parentuuid = p
+ if (['skill', 'technique'].includes(i.type)) {
+ s.type = i.type.toUpperCase()
+ s.import = !!i.calc ? i.calc.level : ''
+ if (s.level == 0) s.level = ''
+ s.points = i.points
+ s.relativelevel = i.calc?.rsl
+ s.notes = i.notes || ''
+ } else {
+ // Usually containers
+ s.level = ''
+ }
+ let old = this._findElementIn('skills', s.uuid)
+ this._migrateOtfsAndNotes(old, s, i.vtt_notes)
+
+ let ch = []
+ if (i.children?.length) {
+ for (let j of i.children) ch = ch.concat(this.importSk(j, i.id))
+ }
+ return [s].concat(ch)
+ }
+
+ importSpellsFromGCSv2(sps) {
+ if (!sps) return
+ let temp = []
+ for (let i of sps) {
+ temp = temp.concat(this.importSp(i, ''))
+ }
+ return {
+ 'data.-=spells': null,
+ 'data.spells': this.foldList(temp),
+ }
+ }
+
+ importSp(i, p) {
+ let s = new Spell()
+ s.name = i.name || 'Spell'
+ s.uuid = i.id
+ s.parentuuid = p
+ s.pageRef(i.reference || '')
+ if (['spell', 'ritual_magic_spell'].includes(i.type)) {
+ s.class = i.spell_class || ''
+ s.college = i.college || ''
+ s.cost = i.casting_cost || ''
+ s.maintain = i.maintenance_cost || ''
+ s.difficulty = i.difficulty.toUpperCase()
+ s.relativelevel = i.calc?.rsl
+ s.notes = i.notes || ''
+ s.duration = i.duration || ''
+ s.points = i.points || ''
+ s.casttime = i.casting_time || ''
+ s.import = i.calc?.level || 0
+ }
+
+ let old = this._findElementIn('spells', s.uuid)
+ this._migrateOtfsAndNotes(old, s, i.vtt_notes)
+
+ let ch = []
+ if (i.children?.length) {
+ for (let j of i.children) ch = ch.concat(this.importSp(j, i.id))
+ }
+ return [s].concat(ch)
+ }
+
+ importEquipmentFromGCSv2(eq, oeq) {
+ if (!eq && !oeq) return
+ let temp = []
+ if (!!eq)
+ for (let i of eq) {
+ temp = temp.concat(this.importEq(i, '', true))
+ }
+ if (!!oeq)
+ for (let i of oeq) {
+ temp = temp.concat(this.importEq(i, '', false))
+ }
+
+ recurselist(this.system.equipment?.carried, t => {
+ t.carried = true
+ if (!!t.save) temp.push(t)
+ })
+ recurselist(this.system.equipment?.other, t => {
+ t.carried = false
+ if (!!t.save) temp.push(t)
+ })
+
+ temp.forEach(e => {
+ e.contains = {}
+ e.collapsed = {}
+ })
+
+ temp.forEach(e => {
+ if (!!e.parentuuid) {
+ let parent = null
+ parent = temp.find(f => f.uuid === e.parentuuid)
+ if (!!parent) GURPS.put(parent.contains, e)
+ else e.parentuuid = ''
+ }
+ })
+
+ let equipment = {
+ carried: {},
+ other: {},
+ }
+ let cindex = 0
+ let oindex = 0
+
+ temp.forEach(eqt => {
+ Equipment.calc(eqt)
+ if (!eqt.parentuuid) {
+ if (eqt.carried) GURPS.put(equipment.carried, eqt, cindex++)
+ else GURPS.put(equipment.other, eqt, oindex++)
+ }
+ })
+ return {
+ 'data.-=equipment': null,
+ 'data.equipment': equipment,
+ }
+ }
+
+ importEq(i, p, carried) {
+ let e = new Equipment()
+ e.name = i.description || 'Equipment'
+ e.count = i.type == 'equipment_container' ? '1' : i.quantity || '0'
+ e.cost =
+ (parseFloat(i.calc?.extended_value) / (i.type == 'equipment_container' ? 1 : i.quantity || 1)).toString() || ''
+ e.carried = carried
+ e.equipped = i.equipped
+ e.techlevel = i.tech_level || ''
+ e.legalityclass = i.legality_class || '4'
+ e.categories = i.categories?.join(', ') || ''
+ e.uses = i.uses || 0
+ e.maxuses = i.max_uses || 0
+ e.uuid = i.id
+ e.parentuuid = p
+ e.notes = ''
+ e.note = i.notes || ''
+ if (i.modifiers?.length) {
+ for (let j of i.modifiers)
+ if (!j.disabled) e.notes += `${!!e.notes ? '; ' : ''}${j.name}${!!j.notes ? ' (' + j.notes + ')' : ''}`
+ }
+ if (!!e.note) e.notes += (!!e.notes ? '\n' : '') + e.note
+ e.weight =
+ (parseFloat(i.calc?.extended_weight) / (i.type == 'equipment_container' ? 1 : i.quantity || 1)).toString() || '0'
+ e.pageRef(i.reference || '')
+ let old = this._findElementIn('equipment.carried', e.uuid)
+ if (!old) old = this._findElementIn('equipment.other', e.uuid)
+ this._migrateOtfsAndNotes(old, e, i.vtt_notes)
+ if (!!old) {
+ e.carried = old.carried
+ e.equipped = old.equipped
+ e.parentuuid = old.parentuuid
+ if (old.ignoreImportQty) {
+ e.count = old.count
+ e.uses = old.uses
+ e.maxuses = old.maxuses
+ e.ignoreImportQty = true
+ }
+ }
+ let ch = []
+ if (i.children?.length) {
+ for (let j of i.children) ch = ch.concat(this.importEq(j, i.id, carried))
+ for (let j of ch) {
+ e.cost -= j.cost * j.count
+ e.weight -= j.weight * j.count
+ }
+ // let weight_reduction = 0;
+ // if (!!i.modifiers?.length) for (let m of i.modifiers) if (!m.disabled && !!m.features?.length) for (let mf of m.features) if (mf.type == "contained_weight_reduction") weight_reduction += parseFloat(mf.reduction);
+ // if (!!i.features?.length) for (let f of i.features) if (f.type == "contained_weight_reduction") weight_reduction += parseFloat(f.reduction);
+ // for (let j of ch) {
+ // e.cost -= j.cost*j.count;
+ // if (weight_reduction == 0) e.weight -= j.weight*j.count;
+ // else {
+ // weight_reduction -= j.weight*j.count;
+ // if (weight_reduction < 0) {
+ // e.weight += weight_reduction;
+ // weight_reduction = 0;
+ // }
+ // }
+ // }
+ }
+ return [e].concat(ch)
+ }
+
+ importNotesFromGCSv2(notes) {
+ if (!notes) return
+ let temp = []
+ for (let i of notes) {
+ temp = temp.concat(this.importNote(i, ''))
+ }
+ recurselist(this.system.notes, t => {
+ if (!!t.save) temp.push(t)
+ })
+ return {
+ 'data.-=notes': null,
+ 'data.notes': this.foldList(temp),
+ }
+ }
+
+ importNote(i, p) {
+ let n = new Note()
+ n.notes = i.text || ''
+ n.uuid = i.id
+ n.parentuuid = p
+ n.pageRef(i.reference || '')
+ let old = this._findElementIn('notes', n.uuid)
+ this._migrateOtfsAndNotes(old, n)
+ let ch = []
+ if (i.children?.length) {
+ for (let j of i.children) ch = ch.concat(this.importNote(j, i.id))
+ }
+ return [n].concat(ch)
+ }
+
+ async importProtectionFromGCSv2(hls) {
+ if (!hls) return
+ let data = this.system
+ if (!!data.additionalresources.ignoreinputbodyplan) return
+
+ /** @type {HitLocations.HitLocation[]} */
+ let locations = []
+ for (let i of hls.locations) {
+ let l = new HitLocations.HitLocation(i.table_name)
+ l.import = i.calc?.dr.all?.toString() || '0'
+ for (let [key, value] of Object.entries(i.calc?.dr))
+ if (key != 'all') {
+ let damtype = GURPS.DamageTables.damageTypeMap[key]
+ if (!l.split) l.split = {}
+ l.split[damtype] = +l.import + value
+ }
+ l.penalty = i.hit_penalty.toString()
+ while (locations.filter(it => it.where == l.where).length > 0) {
+ l.where = l.where + '*'
+ }
+ locations.push(l)
+ }
+ let vitals = locations.filter(value => value.where === HitLocations.HitLocation.VITALS)
+ if (vitals.length === 0) {
+ let hl = new HitLocations.HitLocation(HitLocations.HitLocation.VITALS)
+ hl.penalty = HitLocations.hitlocationRolls[HitLocations.HitLocation.VITALS].penalty
+ hl.roll = HitLocations.hitlocationRolls[HitLocations.HitLocation.VITALS].roll
+ hl.import = '0'
+ locations.push(hl)
+ }
+ // Hit Locations MUST come from an existing bodyplan hit location table, or else ADD (and
+ // potentially other features) will not work. Sometime in the future, we will look at
+ // user-entered hit locations.
+ let bodyplan = hls.id // Was a body plan actually in the import?
+ if (bodyplan === 'snakemen') bodyplan = 'snakeman'
+ let table = HitLocations.hitlocationDictionary[bodyplan] // If so, try to use it.
+
+ /** @type {HitLocations.HitLocation[]} */
+ let locs = []
+ locations.forEach(e => {
+ if (!!table && !!table[e.where]) {
+ // if e.where already exists in table, don't map
+ locs.push(e)
+ } else {
+ // map to new name(s) ... sometimes we map 'Legs' to ['Right Leg', 'Left Leg'], for example.
+ e.locations(false).forEach(l => locs.push(l)) // Map to new names
+ }
+ })
+ locations = locs
+
+ if (!table) {
+ locs = []
+ locations.forEach(e => {
+ e.locations(true).forEach(l => locs.push(l)) // Map to new names, but include original to help match against tables
+ })
+ bodyplan = this._getBodyPlan(locs)
+ table = HitLocations.hitlocationDictionary[bodyplan]
+ }
+ // update location's roll and penalty based on the bodyplan
+
+ if (!!table) {
+ Object.values(locations).forEach(it => {
+ let [lbl, entry] = HitLocations.HitLocation.findTableEntry(table, it.where)
+ if (!!entry) {
+ it.where = lbl // It might be renamed (ex: Skull -> Brain)
+ if (!it.penalty) it.penalty = entry.penalty
+ if (!it.roll || it.roll.length === 0 || it.roll === HitLocations.HitLocation.DEFAULT) it.roll = entry.roll
+ }
+ })
+ }
+
+ // write the hit locations out in bodyplan hit location table order. If there are
+ // other entries, append them at the end.
+ /** @type {HitLocations.HitLocation[]} */
+ let temp = []
+ Object.keys(table).forEach(key => {
+ let results = Object.values(locations).filter(loc => loc.where === key)
+ if (results.length > 0) {
+ if (results.length > 1) {
+ // If multiple locs have same where, concat the DRs. Leg 7 & Leg 8 both map to "Leg 7-8"
+ let d = ''
+
+ /** @type {string | null} */
+ let last = null
+ results.forEach(r => {
+ if (r.import != last) {
+ d += '|' + r.import
+ last = r.import
+ }
+ })
+
+ if (!!d) d = d.substr(1)
+ results[0].import = d
+ }
+ temp.push(results[0])
+ locations = locations.filter(it => it.where !== key)
+ } else {
+ // Didn't find loc that should be in the table. Make a default entry
+ temp.push(new HitLocations.HitLocation(key, '0', table[key].penalty, table[key].roll))
+ }
+ })
+ locations.forEach(it => temp.push(it))
+
+ let prot = {}
+ let index = 0
+ temp.forEach(it => GURPS.put(prot, it, index++))
+
+ let saveprot = true
+ if (!!data.lastImport && !!data.additionalresources.bodyplan && bodyplan != data.additionalresources.bodyplan) {
+ let option = game.settings.get(settings.SYSTEM_NAME, settings.SETTING_IMPORT_BODYPLAN)
+ if (option == 1) {
+ saveprot = false
+ }
+ if (option == 2) {
+ saveprot = await new Promise((resolve, reject) => {
+ let d = new Dialog({
+ title: 'Hit Location Body Plan',
+ content:
+ `Do you want to
Save the current Body Plan (${game.i18n.localize(
+ 'GURPS.BODYPLAN' + data.additionalresources.bodyplan
+ )}) or ` +
+ `
Overwrite it with the Body Plan from the import: (${game.i18n.localize(
+ 'GURPS.BODYPLAN' + bodyplan
+ )})?
`,
+ buttons: {
+ save: {
+ icon: '',
+ label: 'Save',
+ callback: () => resolve(false),
+ },
+ overwrite: {
+ icon: '',
+ label: 'Overwrite',
+ callback: () => resolve(true),
+ },
+ },
+ default: 'save',
+ close: () => resolve(false), // just assume overwrite. Error handling would be too much work right now.
+ })
+ d.render(true)
+ })
+ }
+ }
+ if (saveprot) {
+ return {
+ 'data.-=hitlocations': null,
+ 'data.hitlocations': prot,
+ 'data.additionalresources.bodyplan': bodyplan,
+ }
+ } else return {}
+ }
+
+ importPointTotalsFromGCSv2(total, atts, ads, skills, spells) {
+ if (!ads) ads = []
+ if (!skills) skills = []
+ if (!spells) spells = []
+ let p_atts = 0
+ let p_ads = 0
+ let p_disads = 0
+ let p_quirks = 0
+ let p_skills = 0
+ let p_spells = 0
+ let p_unspent = total
+ let p_total = total
+ let p_race = 0
+ for (let i of atts) p_atts += i.calc?.points
+ for (let i of ads)
+ [p_ads, p_disads, p_quirks, p_race] = this.adPointCount(i, p_ads, p_disads, p_quirks, p_race, true)
+ for (let i of skills) p_skills = this.skPointCount(i, p_skills)
+ for (let i of spells) p_spells = this.skPointCount(i, p_spells)
+ p_unspent -= p_atts + p_ads + p_disads + p_quirks + p_skills + p_spells + p_race
+ return {
+ 'data.totalpoints.attributes': p_atts,
+ 'data.totalpoints.ads': p_ads,
+ 'data.totalpoints.disads': p_disads,
+ 'data.totalpoints.quirks': p_quirks,
+ 'data.totalpoints.skills': p_skills,
+ 'data.totalpoints.spells': p_spells,
+ 'data.totalpoints.unspent': p_unspent,
+ 'data.totalpoints.total': p_total,
+ 'data.totalpoints.race': p_race,
+ }
+ }
+
+ importReactionsFromGCSv3(ads, skills, equipment) {
+ let rs = {}
+ let cs = {}
+ let index_r = 0
+ let index_c = 0
+ let temp = [].concat(ads, skills, equipment)
+ let all = []
+ for (let i of temp) {
+ all = all.concat(this.recursiveGet(i))
+ }
+ let temp_r = []
+ let temp_c = []
+ for (let i of all) {
+ if (i.features?.length)
+ for (let f of i.features) {
+ if (f.type == 'reaction_bonus') {
+ temp_r.push({
+ modifier: f.amount * (f.per_level && !!i.levels ? parseInt(i.levels) : 1),
+ situation: f.situation,
+ })
+ } else if (f.type == 'conditional_modifier') {
+ temp_c.push({
+ modifier: f.amount * (f.per_level && !!i.levels ? parseInt(i.levels) : 1),
+ situation: f.situation,
+ })
+ }
+ }
+ }
+ let temp_r2 = []
+ let temp_c2 = []
+ for (let i of temp_r) {
+ let existing_condition = temp_r2.find(e => e.situation == i.situation)
+ if (!!existing_condition) existing_condition.modifier += i.modifier
+ else temp_r2.push(i)
+ }
+ for (let i of temp_c) {
+ let existing_condition = temp_c2.find(e => e.situation == i.situation)
+ if (!!existing_condition) existing_condition.modifier += i.modifier
+ else temp_c2.push(i)
+ }
+ for (let i of temp_r2) {
+ let r = new Reaction()
+ r.modifier = i.modifier.toString()
+ r.situation = i.situation
+ GURPS.put(rs, r, index_r++)
+ }
+ for (let i of temp_c2) {
+ let c = new Modifier()
+ c.modifier = i.modifier.toString()
+ c.situation = i.situation
+ GURPS.put(cs, c, index_c++)
+ }
+ return {
+ 'data.-=reactions': null,
+ 'data.reactions': rs,
+ 'data.-=conditionalmods': null,
+ 'data.conditionalmods': cs,
+ }
+ }
+
+ importCombatFromGCSv2(ads, skills, spells, equipment) {
+ let melee = {}
+ let ranged = {}
+ let m_index = 0
+ let r_index = 0
+ let temp = [].concat(ads, skills, spells, equipment)
+ let all = []
+ for (let i of temp) {
+ all = all.concat(this.recursiveGet(i))
+ }
+ for (let i of all) {
+ if (i.weapons?.length)
+ for (let w of i.weapons) {
+ if (w.type == 'melee_weapon') {
+ let m = new Melee()
+ m.name = i.name || i.description || ''
+ m.st = w.strength || ''
+ m.weight = i.weight || ''
+ m.techlevel = i.tech_level || ''
+ m.cost = i.value || ''
+ m.notes = i.notes || ''
+ if (!!m.notes && w.usage_notes) m.notes += '\n' + w.usage_notes
+ m.pageRef(i.reference || '')
+ m.mode = w.usage || ''
+ m.import = w.calc?.level.toString() || '0'
+ m.damage = w.calc?.damage || ''
+ m.reach = w.reach || ''
+ m.parry = w.calc?.parry || ''
+ m.block = w.calc?.block || ''
+ let old = this._findElementIn('melee', false, m.name, m.mode)
+ this._migrateOtfsAndNotes(old, m, i.vtt_notes)
+
+ GURPS.put(melee, m, m_index++)
+ } else if (w.type == 'ranged_weapon') {
+ let r = new Ranged()
+ r.name = i.name || i.description || ''
+ r.st = w.strength || ''
+ r.bulk = w.bulk || ''
+ r.legalityclass = i.legality_class || '4'
+ r.ammo = 0
+ r.notes = i.notes || ''
+ if (!!r.notes && w.usage_notes) r.notes += '\n' + w.usage_notes
+ r.pageRef(i.reference || '')
+ r.mode = w.usage || ''
+ r.import = w.calc?.level || '0'
+ r.damage = w.calc?.damage || ''
+ r.acc = w.accuracy || ''
+ r.rof = w.rate_of_fire || ''
+ r.shots = w.shots || ''
+ r.rcl = w.recoil || ''
+ r.range = w.calc?.range || ''
+ let old = this._findElementIn('ranged', false, r.name, r.mode)
+ this._migrateOtfsAndNotes(old, r, i.vtt_notes)
+
+ GURPS.put(ranged, r, r_index++)
+ }
+ }
+ }
+ return {
+ 'data.-=melee': null,
+ 'data.melee': melee,
+ 'data.-=ranged': null,
+ 'data.ranged': ranged,
+ }
+ }
+
+ recursiveGet(i) {
+ if (!i) return []
+ let ch = []
+ if (i.children?.length) for (let j of i.children) ch = ch.concat(this.recursiveGet(j))
+ if (i.modifiers?.length) for (let j of i.modifiers) ch = ch.concat(this.recursiveGet(j))
+ if (!!i.disabled || (i.equipped != null && i.equipped == false)) return []
+ return [i].concat(ch)
+ }
+
+ adPointCount(i, ads, disads, quirks, race, toplevel = false) {
+ if (i.type == 'advantage_container' && i.container_type == 'race') race += i.calc?.points
+ else if (i.type == 'advantage_container' && i.container_type == 'alternative_abilities') ads += i.calc?.points
+ else if (i.type == 'advantage_container' && !!i.children?.length) {
+ var [a, d] = [0, 0]
+ for (let j of i.children) [a, d, quirks, race] = this.adPointCount(j, a, d, quirks, race)
+ if (toplevel) {
+ if (a > 0) ads += a
+ else disads += a
+ } else ads += a + d
+ } else if (i.calc?.points == -1) quirks += i.calc?.points
+ else if (i.calc?.points > 0) ads += i.calc?.points
+ else disads += i.calc?.points
+ return [ads, disads, quirks, race]
+ }
+
+ skPointCount(i, skills) {
+ if (i.type == ('skill_container' || 'spell_container') && i.children?.length)
+ for (let j of i.children) skills = this.skPointCount(j, skills)
+ else skills += i.points
+ return skills
+ }
+
+ /**
+ * @param {string} json
+ * @param {string} importname
+ * @param {string | undefined} [importpath]
+ */
+ async importFromGCSv2(json, importname, importpath, suppressMessage = false, GCAVersion, GCSVersion) {
+ let r
+ let msg = []
+ let version = 'Direct GCS Import'
+ let exit = false
+ try {
+ r = JSON.parse(json)
+ } catch (err) {
+ msg.push(i18n('GURPS.importNoJSONDetected'))
+ exit = true
+ }
+ if (!!r) {
+ if (!r.calc) {
+ msg.push(i18n('GURPS.importOldGCSFile'))
+ exit = true
+ }
+ }
+
+ if (msg.length > 0) {
+ ui.notifications?.error(msg.join('
'))
+ let content = await renderTemplate('systems/gurps/templates/chat-import-actor-errors.html', {
+ lines: msg,
+ version: version,
+ GCAVersion: GCAVersion,
+ GCSVersion: GCSVersion,
+ url: GURPS.USER_GUIDE_URL,
+ })
+ ChatMessage.create({
+ content: content,
+ user: game.user.id,
+ type: CONST.CHAT_MESSAGE_TYPES.WHISPER,
+ whisper: [game.user.id],
+ })
+ if (exit) return false
+ }
+
+ let nm = r['profile']['name']
+ console.log("Importing '" + nm + "'")
+ let starttime = performance.now()
+ let commit = {}
+
+ commit = { ...commit, ...{ 'data.lastImport': new Date().toString().split(' ').splice(1, 4).join(' ') } }
+ let ar = this.system.additionalresources || {}
+ ar.importname = importname || ar.importname
+ ar.importpath = importpath || ar.importpath
+ try {
+ commit = { ...commit, ...{ 'data.additionalresources': ar } }
+ commit = { ...commit, ...(await this.importAttributesFromGCSv2(r.attributes, r.equipment, r.calc)) }
+ commit = { ...commit, ...(await this.importTraitsFromGCSv2(r.profile, r.created_date, r.modified_date)) }
+ commit = { ...commit, ...this.importSizeFromGCSv1(commit, r.profile, r.advantages, r.skills, r.equipment) }
+ commit = { ...commit, ...this.importAdsFromGCSv3(r.advantages) }
+ commit = { ...commit, ...this.importSkillsFromGCSv2(r.skills) }
+ commit = { ...commit, ...this.importSpellsFromGCSv2(r.spells) }
+ commit = { ...commit, ...this.importEquipmentFromGCSv2(r.equipment, r.other_equipment) }
+ commit = { ...commit, ...this.importNotesFromGCSv2(r.notes) }
+
+ commit = { ...commit, ...(await this.importProtectionFromGCSv2(r.settings.hit_locations)) }
+ commit = {
+ ...commit,
+ ...this.importPointTotalsFromGCSv2(r.total_points, r.attributes, r.advantages, r.skills, r.spells),
+ }
+ commit = { ...commit, ...this.importReactionsFromGCSv3(r.advantages, r.skills, r.equipment) }
+ commit = { ...commit, ...this.importCombatFromGCSv2(r.advantages, r.skills, r.spells, r.equipment) }
+ } catch (err) {
+ console.log(err.stack)
+ msg.push(
+ i18n_f('GURPS.importGenericError', {
+ name: nm,
+ error: err.name,
+ message: err.message,
+ })
+ )
+ let content = await renderTemplate('systems/gurps/templates/chat-import-actor-errors.html', {
+ lines: [msg],
+ version: version,
+ GCAVersion: GCAVersion,
+ GCSVersion: GCSVersion,
+ url: GURPS.USER_GUIDE_URL,
+ })
+ ui.notifications?.warn(msg)
+ let chatData = {
+ user: game.user.id,
+ type: CONST.CHAT_MESSAGE_TYPES.WHISPER,
+ content: content,
+ whisper: [game.user.id],
+ }
+ ChatMessage.create(chatData, {})
+ // Don't return
+ }
+
+ console.log('Starting commit')
+ let deletes = Object.fromEntries(Object.entries(commit).filter(([key, value]) => key.includes('.-=')))
+ let adds = Object.fromEntries(Object.entries(commit).filter(([key, value]) => !key.includes('.-=')))
+
+ try {
+ this.ignoreRender = true
+ await this.internalUpdate(deletes, { diff: false })
+ await this.internalUpdate(adds, { diff: false })
+ // This has to be done after everything is loaded
+ await this.postImport()
+ this._forceRender()
+
+ // Must update name outside of protection so that Actors list (and other external views) update correctly
+ if (!game.settings.get(settings.SYSTEM_NAME, settings.SETTING_IGNORE_IMPORT_NAME)) {
+ await this.update({ name: nm, 'token.name': nm })
+ }
+
+ if (!suppressMessage) ui.notifications?.info(i18n_f('GURPS.importSuccessful', { name: nm }))
+ console.log(
+ 'Done importing (' +
+ Math.round(performance.now() - starttime) +
+ 'ms.) You can inspect the character data below:'
+ )
+ console.log(this)
+ return true
+ } catch (err) {
+ console.log(err.stack)
+ let msg = [i18n_f('GURPS.importGenericError', { name: nm, error: err.name, message: err.message })]
+ if (err.message == 'Maximum depth exceeded') msg.push(i18n('GURPS.importTooManyContainers'))
+ ui.notifications?.warn(msg.join('
'))
+ let content = await renderTemplate('systems/gurps/templates/chat-import-actor-errors.html', {
+ lines: msg,
+ version: 'GCS Direct',
+ GCAVersion: GCAVersion,
+ GCSVersion: GCSVersion,
+ url: GURPS.USER_GUIDE_URL,
+ })
+
+ let user = game.user
+ let chatData = {
+ user: game.user.id,
+ type: CONST.CHAT_MESSAGE_TYPES.WHISPER,
+ content: content,
+ whisper: [game.user.id],
+ }
+ ChatMessage.create(chatData, {})
+ return false
+ }
+ }
+
+ // First attempt at import GCS FG XML export data.
+ /**
+ * @param {string} xml
+ * @param {string} importname
+ * @param {string | undefined} [importpath]
+ */
+ async importFromGCSv1(xml, importname, importpath, suppressMessage = false) {
+ const GCA5Version = 'GCA5-14'
+ const GCAVersion = 'GCA-11'
+ const GCSVersion = 'GCS-5'
+ if (importname.endsWith('.gcs'))
+ return this.importFromGCSv2(xml, importname, importpath, suppressMessage, GCAVersion, GCSVersion)
+ var c, ra // The character json, release attributes
+ let isFoundryGCS = false
+ let isFoundryGCA = false
+ let isFoundryGCA5 = false
+ // need to remove
'))
+ let content = await renderTemplate('systems/gurps/templates/chat-import-actor-errors.html', {
+ lines: msg,
+ version: version,
+ GCAVersion: GCAVersion,
+ GCSVersion: GCSVersion,
+ url: GURPS.USER_GUIDE_URL,
+ })
+
+ let user = game.user
+ ChatMessage.create({
+ content: content,
+ user: game.user.id,
+ type: CONST.CHAT_MESSAGE_TYPES.WHISPER,
+ whisper: [game.user.id],
+ })
+ if (exit) return false // Some errors cannot be forgiven ;-)
+ }
+ let nm = this.textFrom(c.name)
+ console.log("Importing '" + nm + "'")
+ let starttime = performance.now()
+ let commit = {}
+
+ commit = { ...commit, ...{ 'data.lastImport': new Date().toString().split(' ').splice(1, 4).join(' ') } }
+ let ar = this.system.additionalresources || {}
+ ar.importname = importname || ar.importname
+ ar.importpath = importpath || ar.importpath
+ ar.importversion = ra.version
+ commit = { ...commit, ...{ 'data.additionalresources': ar } }
+
+ try {
+ // This is going to get ugly, so break out various data into different methods
+ commit = { ...commit, ...(await this.importAttributesFromCGSv1(c.attributes)) }
+ commit = { ...commit, ...this.importSkillsFromGCSv1(c.abilities?.skilllist, isFoundryGCS) }
+ commit = { ...commit, ...this.importTraitsfromGCSv1(c.traits) }
+ commit = { ...commit, ...this.importCombatMeleeFromGCSv1(c.combat?.meleecombatlist, isFoundryGCS) }
+ commit = { ...commit, ...this.importCombatRangedFromGCSv1(c.combat?.rangedcombatlist, isFoundryGCS) }
+ commit = { ...commit, ...this.importSpellsFromGCSv1(c.abilities?.spelllist, isFoundryGCS) }
+ if (isFoundryGCS) {
+ commit = { ...commit, ...this.importAdsFromGCSv2(c.traits?.adslist) }
+ commit = { ...commit, ...this.importReactionsFromGCSv2(c.reactions) }
+ commit = { ...commit, ...this.importConditionalModifiersFromGCSv2(c.conditionalmods) }
+ }
+ if (isFoundryGCA) {
+ commit = { ...commit, ...this.importLangFromGCA(c.traits?.languagelist) }
+ commit = { ...commit, ...this.importAdsFromGCA(c.traits?.adslist, c.traits?.disadslist) }
+ commit = { ...commit, ...this.importReactionsFromGCA(c.traits?.reactionmodifiers, vernum) }
+ }
+ commit = { ...commit, ...this.importEncumbranceFromGCSv1(c.encumbrance) }
+ commit = { ...commit, ...this.importPointTotalsFromGCSv1(c.pointtotals) }
+ commit = { ...commit, ...this.importNotesFromGCSv1(c.description, c.notelist) }
+ commit = { ...commit, ...this.importEquipmentFromGCSv1(c.inventorylist, isFoundryGCS) }
+ commit = { ...commit, ...(await this.importProtectionFromGCSv1(c.combat?.protectionlist, isFoundryGCA)) }
+ } catch (err) {
+ console.log(err.stack)
+ let msg = i18n_f('GURPS.importGenericError', { name: nm, error: err.name, message: err.message })
+ let content = await renderTemplate('systems/gurps/templates/chat-import-actor-errors.html', {
+ lines: [msg],
+ version: version,
+ GCAVersion: GCAVersion,
+ GCSVersion: GCSVersion,
+ url: GURPS.USER_GUIDE_URL,
+ })
+
+ ui.notifications?.warn(msg)
+ let user = game.user
+ let chatData = {
+ user: game.user.id,
+ type: CONST.CHAT_MESSAGE_TYPES.WHISPER,
+ content: content,
+ whisper: [game.user.id],
+ }
+ ChatMessage.create(chatData, {})
+ // Don't return, because we want to see how much actually gets committed.
+ }
+ console.log('Starting commit')
+
+ let deletes = Object.fromEntries(Object.entries(commit).filter(([key, value]) => key.includes('.-=')))
+ let adds = Object.fromEntries(Object.entries(commit).filter(([key, value]) => !key.includes('.-=')))
+
+ try {
+ this.ignoreRender = true
+ await this.internalUpdate(deletes, { diff: false })
+ await this.internalUpdate(adds, { diff: false })
+ // This has to be done after everything is loaded
+ await this.postImport()
+ this._forceRender()
+
+ // Must update name outside of protection so that Actors list (and other external views) update correctly
+ if (!game.settings.get(settings.SYSTEM_NAME, settings.SETTING_IGNORE_IMPORT_NAME)) {
+ await this.update({ name: nm, 'token.name': nm })
+ }
+
+ if (!suppressMessage) ui.notifications?.info(i18n_f('GURPS.importSuccessful', { name: nm }))
+ console.log(
+ 'Done importing (' +
+ Math.round(performance.now() - starttime) +
+ 'ms.) You can inspect the character data below:'
+ )
+ console.log(this)
+ return true
+ } catch (err) {
+ console.log(err.stack)
+ let msg = [i18n_f('GURPS.importGenericError', { name: nm, error: err.name, message: err.message })]
+ if (err.message == 'Maximum depth exceeded') msg.push(i18n('GURPS.importTooManyContainers'))
+ if (!supressMessage) ui.notifications?.warn(msg.join('
'))
+ let content = await renderTemplate('systems/gurps/templates/chat-import-actor-errors.html', {
+ lines: msg,
+ version: version,
+ GCAVersion: GCAVersion,
+ GCSVersion: GCSVersion,
+ url: GURPS.USER_GUIDE_URL,
+ })
+
+ let user = game.user
+ let chatData = {
+ user: game.user.id,
+ type: CONST.CHAT_MESSAGE_TYPES.WHISPER,
+ content: content,
+ whisper: [game.user.id],
+ }
+ ChatMessage.create(chatData, {})
+ return false
+ }
+ }
+
+ // hack to get to private text element created by xml->json method.
+ /**
+ * @param {{ [key: string]: any }} o
+ */
+ textFrom(o) {
+ if (!o) return ''
+ let t = o['#text']
+ if (!t) return ''
+ return t.trim()
+ }
+
+ // similar hack to get text as integer.
+ /**
+ * @param {{ [key: string]: any }} o
+ */
+ intFrom(o) {
+ if (!o) return 0
+ let i = o['#text']
+ if (!i) return 0
+ return parseInt(i)
+ }
+
+ /**
+ * @param {{[key: string] : any}} o
+ */
+ floatFrom(o) {
+ if (!o) return 0
+ let f = o['#text'].trim()
+ if (!f) return 0
+ return f.includes(',') ? parseDecimalNumber(f, { thousands: '.', decimal: ',' }) : parseDecimalNumber(f)
+ }
+
+ /**
+ * @param {string} list
+ * @param {string|boolean} uuid
+ */
+ _findElementIn(list, uuid, name = '', mode = '') {
+ var foundkey
+ let l = getProperty(this, list)
+ recurselist(l, (e, k, d) => {
+ if ((uuid && e.uuid == uuid) || (!!e.name && e.name.startsWith(name) && e.mode == mode)) foundkey = k
+ })
+ return foundkey == null ? foundkey : getProperty(this, list + '.' + foundkey)
+ }
+
+ /**
+ * @param {{ [key: string]: any }} json
+ */
+ importReactionsFromGCSv2(json) {
+ if (!json) return
+ let t = this.textFrom
+ let rs = {}
+ let index = 0
+ for (let key in json) {
+ if (key.startsWith('id-')) {
+ // Allows us to skip over junk elements created by xml->json code, and only select the skills.
+ let j = json[key]
+ let r = new Reaction()
+ r.modifier = t(j.modifier)
+ r.situation = t(j.situation)
+ GURPS.put(rs, r, index++)
+ }
+ }
+ return {
+ 'data.-=reactions': null,
+ 'data.reactions': rs,
+ }
+ }
+
+ importConditionalModifiersFromGCSv2(json) {
+ if (!json) return
+ let t = this.textFrom
+ let rs = {}
+ let index = 0
+ for (let key in json) {
+ if (key.startsWith('id-')) {
+ let j = json[key]
+ let r = new Reaction() // ConditionalModifiers are the same format
+ r.modifier = t(j.modifier)
+ r.situation = t(j.situation)
+ GURPS.put(rs, r, index++)
+ }
+ }
+ return {
+ 'data.-=conditionalmods': null,
+ 'data.conditionalmods': rs,
+ }
+ }
+
+ /**
+ * @param {{ [key: string]: any }} json
+ */
+ importReactionsFromGCA(json, vernum) {
+ if (!json) return
+ let text = this.textFrom(json)
+ let a = vernum <= 9 ? text.split(',') : text.split('|')
+ let rs = {}
+ let index = 0
+ a.forEach((/** @type {string} */ m) => {
+ if (!!m) {
+ let t = m.trim()
+ let i = t.indexOf(' ')
+ let mod = t.substring(0, i)
+ let sit = t.substr(i + 1)
+ let r = new Reaction(mod, sit)
+ GURPS.put(rs, r, index++)
+ }
+ })
+ return {
+ 'data.-=reactions': null,
+ 'data.reactions': rs,
+ }
+ }
+
+ importLangFromGCA(json) {
+ if (!json) return
+ let langs = {}
+ let index = 0
+ let t = this.textFrom
+ for (let key in json) {
+ if (key.startsWith('id-')) {
+ let j = json[key]
+ let n = t(j.name)
+ let s = t(j.spoken)
+ let w = t(j.written)
+ let p = t(j.points)
+ let l = new Language(n, s, w, p)
+ GURPS.put(langs, l, index++)
+ }
+ }
+ return {
+ 'data.-=languages': null,
+ 'data.languages': langs,
+ }
+ }
+
+ /**
+ * @param {{ attributes: Record
Save the current Body Plan (${game.i18n.localize(
+ 'GURPS.BODYPLAN' + data.additionalresources.bodyplan
+ )}) or ` +
+ `
Overwrite it with the Body Plan from the import: (${game.i18n.localize(
+ 'GURPS.BODYPLAN' + bodyplan
+ )})?
`,
+ buttons: {
+ save: {
+ icon: '',
+ label: 'Save',
+ callback: () => resolve(false),
+ },
+ overwrite: {
+ icon: '',
+ label: 'Overwrite',
+ callback: () => resolve(true),
+ },
+ },
+ default: 'save',
+ close: () => resolve(false), // just assume overwrite. Error handling would be too much work right now.
+ })
+ d.render(true)
+ })
+ }
+ }
+ if (saveprot)
+ return {
+ 'data.-=hitlocations': null,
+ 'data.hitlocations': prot,
+ 'data.additionalresources.bodyplan': bodyplan,
+ }
+ else return {}
+ }
+
+ /**
+ *
+ * @param {Array
Save the current HP (${data.HP.value}) & FP (${data.FP.value}) values or
Overwrite it with the import data, HP (${hp}) & FP (${fp})?
`,
+ buttons: {
+ save: {
+ icon: '',
+ label: 'Save',
+ callback: () => resolve(true),
+ },
+ overwrite: {
+ icon: '',
+ label: 'Overwrite',
+ callback: () => resolve(false),
+ },
+ },
+ default: 'save',
+ close: () => resolve(false), // just assume overwrite. Error handling would be too much work right now.
+ })
+ d.render(true)
+ })
+ }
+ }
+ if (!saveCurrent) {
+ data.HP.value = hp
+ data.FP.value = fp
+ }
+
+ let lm = {}
+ lm.basiclift = t(json.basiclift)
+ lm.carryonback = t(json.carryonback)
+ lm.onehandedlift = t(json.onehandedlift)
+ lm.runningshove = t(json.runningshove)
+ lm.shiftslightly = t(json.shiftslightly)
+ lm.shove = t(json.shove)
+ lm.twohandedlift = t(json.twohandedlift)
+
+ data.basicmove.value = t(json.basicmove)
+ data.basicmove.points = i(json.basicmove_points)
+ // data.basicspeed.value = t(json.basicspeed)
+ data.basicspeed.value = this.floatFrom(json.basicspeed)
+
+ data.basicspeed.points = i(json.basicspeed_points)
+ data.thrust = t(json.thrust)
+ data.swing = t(json.swing)
+ data.currentmove = t(json.move)
+ data.frightcheck = i(json.frightcheck)
+
+ data.hearing = i(json.hearing)
+ data.tastesmell = i(json.tastesmell)
+ data.touch = i(json.touch)
+ data.vision = i(json.vision)
+
+ return {
+ 'data.attributes': att,
+ 'data.HP': data.HP,
+ 'data.FP': data.FP,
+ 'data.basiclift': data.basiclift,
+ 'data.basicmove': data.basicmove,
+ 'data.basicspeed': data.basicspeed,
+ 'data.thrust': data.thrust,
+ 'data.swing': data.swing,
+ 'data.currentmove': data.currentmove,
+ 'data.frightcheck': data.frightcheck,
+ 'data.hearing': data.hearing,
+ 'data.tastesmell': data.tastesmell,
+ 'data.touch': data.touch,
+ 'data.vision': data.vision,
+ 'data.liftingmoving': lm,
+ }
+ }
+
+ // create/update the skills.
+ // NOTE: For the update to work correctly, no two skills can have the same name.
+ // When reading data, use "this.system.skills", however, when updating, use "system.skills".
+ /**
+ * @param {{ [key: string]: any }} json
+ * @param {boolean} isFoundryGCS
+ */
+ importSkillsFromGCSv1(json, isFoundryGCS) {
+ if (!json) return
+ let temp = []
+ let t = this.textFrom /// shortcut to make code smaller
+ for (let key in json) {
+ if (key.startsWith('id-')) {
+ // Allows us to skip over junk elements created by xml->json code, and only select the skills.
+ let j = json[key]
+ let sk = new Skill()
+ sk.name = t(j.name)
+ sk.type = t(j.type)
+ sk.import = t(j.level)
+ if (sk.level == 0) sk.level = ''
+ sk.points = this.intFrom(j.points)
+ sk.relativelevel = t(j.relativelevel)
+ if (isFoundryGCS) {
+ sk.notes = t(j.notes)
+ sk.pageRef(t(j.pageref))
+ } else sk.setNotes(t(j.text))
+ if (!!j.pageref) sk.pageRef(t(j.pageref))
+ sk.uuid = t(j.uuid)
+ sk.parentuuid = t(j.parentuuid)
+ let old = this._findElementIn('skills', sk.uuid)
+ this._migrateOtfsAndNotes(old, sk, t(j.vtt_notes))
+
+ temp.push(sk)
+ }
+ }
+ return {
+ 'data.-=skills': null,
+ 'data.skills': this.foldList(temp),
+ }
+ }
+
+ // create/update the spells.
+ // NOTE: For the update to work correctly, no two spells can have the same name.
+ // When reading data, use "this.system.spells", however, when updating, use "system.spells".
+ /**
+ * @param {{ [key: string]: any }} json
+ * @param {boolean} isFoundryGCS
+ */
+ importSpellsFromGCSv1(json, isFoundryGCS) {
+ if (!json) return
+ let temp = []
+ let t = this.textFrom /// shortcut to make code smaller
+ for (let key in json) {
+ if (key.startsWith('id-')) {
+ // Allows us to skip over junk elements created by xml->json code, and only select the skills.
+ let j = json[key]
+ let sp = new Spell()
+ sp.name = t(j.name)
+ sp.class = t(j.class)
+ sp.college = t(j.college)
+ if (isFoundryGCS) {
+ sp.cost = t(j.cost)
+ sp.maintain = t(j.maintain)
+ sp.difficulty = t(j.difficulty)
+ sp.relativelevel = t(j.relativelevel)
+ sp.notes = t(j.notes)
+ } else {
+ let cm = t(j.costmaintain)
+ let i = cm.indexOf('/')
+ if (i >= 0) {
+ sp.cost = cm.substring(0, i)
+ sp.maintain = cm.substr(i + 1)
+ } else {
+ sp.cost = cm
+ }
+ sp.setNotes(t(j.text))
+ }
+ sp.pageRef(t(j.pageref))
+ sp.duration = t(j.duration)
+ sp.points = t(j.points)
+ sp.casttime = t(j.time)
+ sp.import = t(j.level)
+ sp.uuid = t(j.uuid)
+ sp.parentuuid = t(j.parentuuid)
+ let old = this._findElementIn('spells', sp.uuid)
+ this._migrateOtfsAndNotes(old, sp, t(j.vtt_notes))
+ temp.push(sp)
+ }
+ }
+ return {
+ 'data.-=spells': null,
+ 'data.spells': this.foldList(temp),
+ }
+ }
+
+ /**
+ * @param {{ [key: string]: any }} adsjson
+ * @param {{ [key: string]: any }} disadsjson
+ */
+ importAdsFromGCA(adsjson, disadsjson) {
+ /** @type {Advantage[]} */
+ let list = []
+ this.importBaseAdvantages(list, adsjson)
+ this.importBaseAdvantages(list, disadsjson)
+ return {
+ 'data.-=ads': null,
+ 'data.ads': this.foldList(list),
+ }
+ }
+
+ /**
+ * @param {Advantage[]} datalist
+ * @param {{ [key: string]: any }} json
+ */
+ importBaseAdvantages(datalist, json) {
+ if (!json) return
+ let t = this.textFrom /// shortcut to make code smaller
+ for (let key in json) {
+ if (key.startsWith('id-')) {
+ // Allows us to skip over junk elements created by xml->json code, and only select the skills.
+ let j = json[key]
+ let a = new Advantage()
+ a.name = t(j.name)
+ a.points = this.intFrom(j.points)
+ a.setNotes(t(j.text))
+ a.pageRef(t(j.pageref) || a.pageref)
+ a.uuid = t(j.uuid)
+ a.parentuuid = t(j.parentuuid)
+ let old = this._findElementIn('ads', a.uuid)
+ this._migrateOtfsAndNotes(old, a, t(j.vtt_notes))
+ datalist.push(a)
+ }
+ }
+ }
+
+ // In the new GCS import, all ads/disad/quirks/perks are in one list.
+ /**
+ * @param {{ [key: string]: any }} json
+ */
+ importAdsFromGCSv2(json) {
+ let t = this.textFrom /// shortcut to make code smaller
+ let temp = []
+ for (let key in json) {
+ if (key.startsWith('id-')) {
+ // Allows us to skip over junk elements created by xml->json code, and only select the skills.
+ let j = json[key]
+ let a = new Advantage()
+ a.name = t(j.name)
+ a.points = this.intFrom(j.points)
+ a.note = t(j.notes)
+ a.userdesc = t(j.userdesc)
+ a.notes = ''
+ if (!!a.note && !!a.userdesc) a.notes = a.note + '\n' + a.userdesc
+ else if (!!a.note) a.notes = a.note
+ else if (!!a.userdesc) a.notes = a.userdesc
+ a.pageRef(t(j.pageref))
+ a.uuid = t(j.uuid)
+ a.parentuuid = t(j.parentuuid)
+ let old = this._findElementIn('ads', a.uuid)
+ this._migrateOtfsAndNotes(old, a, t(j.vtt_notes))
+ temp.push(a)
+ }
+ }
+ return {
+ 'data.-=ads': null,
+ 'data.ads': this.foldList(temp),
+ }
+ }
+
+ /**
+ * Adds any assigned resource trackers to the actor data and sheet.
+ */
+ async setResourceTrackers() {
+ // find those with non-blank slots
+ let templates = ResourceTrackerManager.getAllTemplates().filter(it => !!it.slot)
+
+ for (const template of templates) {
+ // find the matching data on this actor
+ let index = zeroFill(template.slot, 4)
+ let path = `additionalresources.tracker.${index}`
+ let tracker = getProperty(this, path)
+
+ while (!tracker) {
+ await this.addTracker()
+ tracker = getProperty(this, path)
+ }
+
+ // skip if already set
+ if (!!tracker && tracker.name === template.tracker.name) {
+ return
+ }
+
+ // if not blank, don't overwrite
+ if (!!tracker && !!tracker.name) {
+ ui.notifications?.warn(
+ `Will not overwrite Tracker ${template.slot} as its name is set to ${tracker.name}. Create Tracker for ${template.tracker.name} failed.`
+ )
+ return
+ }
+
+ await this.applyTrackerTemplate(path, template)
+ }
+ }
+
+ /**
+ * Update this tracker slot with the contents of the template.
+ * @param {String} path JSON data path to the tracker; must start with 'additionalresources.tracker.'
+ * @param {*} template to apply
+ */
+ async applyTrackerTemplate(path, template) {
+ // is there an initializer? If so calculate its value
+ let value = 0
+ if (!!template.initialValue) {
+ value = parseInt(template.initialValue, 10)
+ if (Number.isNaN(value)) {
+ // try to use initialValue as a path to another value
+ value = getProperty(this, template.initialValue)
+ }
+ }
+ template.tracker.max = value
+ template.tracker.value = template.tracker.isDamageTracker ? template.tracker.min : value
+
+ // remove whatever is there
+ await this.clearTracker(path)
+
+ // add the new tracker
+ /** @type {{ [key: string]: any }} */
+ let update = {}
+ update[`data.${path}`] = template.tracker
+ await this.update(update)
+ }
+
+ /**
+ * Overwrites the tracker pointed to by the path with default/blank values.
+ * @param {String} path JSON data path to the tracker; must start with 'additionalresources.tracker.'
+ */
+ async clearTracker(path) {
+ // verify that this is a Tracker
+ const prefix = 'additionalresources.tracker.'
+ if (!path.startsWith(prefix)) throw `Invalid actor data path, actor=[${this.id}] path=[${path}]`
+
+ /** @type {{[key: string]: string}} */
+ let update = {}
+ update[`data.${path}`] = {
+ name: '',
+ alias: '',
+ pdf: '',
+ max: 0,
+ min: 0,
+ value: 0,
+ isDamageTracker: false,
+ isDamageType: false,
+ initialValue: '',
+ thresholds: [],
+ }
+ await this.update(update)
+ }
+
+ /**
+ * Removes the indicated tracker from the object, reindexing the keys.
+ * @param {String} path JSON data path to the tracker; must start with 'additionalresources.tracker.'
+ */
+ async removeTracker(path) {
+ this.ignoreRender = true
+ const prefix = 'additionalresources.tracker.'
+
+ // verify that this is a Tracker
+ if (!path.startsWith(prefix)) throw `Invalid actor data path, actor=[${this.id}] path=[${path}]`
+
+ let key = path.replace(prefix, '')
+ let trackerData = this.system.additionalresources.tracker
+ delete trackerData[key]
+ let trackers = objectToArray(trackerData)
+ let data = arrayToObject(trackers)
+
+ // remove all trackers
+ await this.update({ 'data.additionalresources.-=tracker': null })
+ // add the new "array" of trackers
+ if (data) this.update({ 'data.additionalresources.tracker': data })
+ else this.update('data.additionalresources.tracker', {})
+
+ this._forceRender()
+ }
+
+ async addTracker() {
+ this.ignoreRender = true
+
+ let trackerData = { name: '', value: 0, min: 0, max: 0, points: 0 }
+ let data = GurpsActor.addTrackerToDataObject(this.system, trackerData)
+
+ await this.update({ 'data.additionalresources.-=tracker': null })
+ await this.update({ 'data.additionalresources.tracker': data })
+
+ this._forceRender()
+ }
+
+ static addTrackerToDataObject(data, trackerData) {
+ let trackers = GurpsActor.getTrackersAsArray(data)
+ trackers.push(trackerData)
+ return arrayToObject(trackers)
+ }
+
+ static getTrackersAsArray(data) {
+ let trackerArray = data.additionalresources.tracker
+ if (!trackerArray) trackerArray = {}
+ return objectToArray(trackerArray)
+ }
+
+ async setMoveDefault(value) {
+ this.ignoreRender = true
+ let move = this.system.move
+ for (const key in move) {
+ move[key].default = value === key
+ }
+ await this.update({ 'data.-=move': null })
+ await this.update({ 'data.move': move })
+ this._forceRender()
+ }
+
+ // --- Functions to handle events on actor ---
+
+ /**
+ * @param {any[]} damageData
+ */
+ handleDamageDrop(damageData) {
+ if (game.user.isGM || !game.settings.get(settings.SYSTEM_NAME, settings.SETTING_ONLY_GMS_OPEN_ADD))
+ new ApplyDamageDialog(this, damageData).render(true)
+ else ui.notifications?.warn('Only GMs are allowed to Apply Damage.')
+ }
+
+ // Drag and drop from Item colletion
+ /**
+ * @param {{ type: any; x?: number; y?: number; payload?: any; pack?: any; id?: any; data?: any; }} dragData
+ */
+ async handleItemDrop(dragData) {
+ if (!this.isOwner) {
+ ui.notifications?.warn(i18n('GURPS.youDoNotHavePermssion'))
+ return
+ }
+ const uuid =
+ typeof dragData.pack === 'string'
+ ? `Compendium.${dragData.pack}.${dragData.id}`
+ : `${dragData.type}.${dragData.id}`
+ let global = await fromUuid(uuid)
+ let data = !!global ? global.data : dragData.data
+ if (!data) {
+ ui.notifications?.warn('NO ITEM DATA!')
+ return
+ }
+ ui.notifications?.info(data.name + ' => ' + this.name)
+ if (!data.data.globalid) await data.update({ _id: data._id, 'data.globalid': uuid })
+ this.ignoreRender = true
+ await this.addNewItemData(data)
+ this._forceRender()
+ }
+
+ _forceRender() {
+ this.ignoreRender = false
+ //console.log("Force Render")
+ this.render()
+ }
+
+ // Drag and drop from an equipment list
+ /**
+ * @param {{ type?: string; x?: number; y?: number; payload?: any; actorid?: any; itemid?: any; isLinked?: any; key?: any; itemData?: any; }} dragData
+ */
+ async handleEquipmentDrop(dragData) {
+ if (dragData.actorid == this.id) return false // same sheet drag and drop handled elsewhere
+ if (!dragData.itemid) {
+ ui.notifications?.warn(i18n('GURPS.cannotDragNonFoundryEqt'))
+ return
+ }
+ if (!dragData.isLinked) {
+ ui.notifications?.warn("You cannot drag from an un-linked token. The source must have 'Linked Actor Data'")
+ return
+ }
+ let srcActor = game.actors.get(dragData.actorid)
+ let eqt = getProperty(srcActor, dragData.key)
+ if (
+ (!!eqt.contains && Object.keys(eqt.contains).length > 0) ||
+ (!!eqt.collapsed && Object.keys(eqt.collapsed).length > 0)
+ ) {
+ ui.notifications?.warn('You cannot transfer an Item that contains other equipment.')
+ return
+ }
+
+ if (!!this.isOwner && !!srcActor.isOwner) {
+ // same owner
+ if (eqt.count < 2) {
+ let destKey = this._findEqtkeyForId('globalid', eqt.globalid)
+ if (!!destKey) {
+ // already have some
+ let destEqt = getProperty(this, destKey)
+ await this.updateEqtCount(destKey, destEqt.count + eqt.count)
+ await srcActor.deleteEquipment(dragData.key)
+ } else {
+ let item = await srcActor.deleteEquipment(dragData.key)
+ await this.addNewItemData(item.data)
+ }
+ } else {
+ let content = await renderTemplate('systems/gurps/templates/transfer-equipment.html', { eqt: eqt })
+ let callback = async (/** @type {JQuery
`
- let all = ChatProcessors.processorsForAll()
- .filter(it => !!it.help())
- .map(it => it.help())
- let gmonly = ChatProcessors.processorsForGMOnly()
- .filter(it => !!it.help())
- .map(it => it.help())
- all.sort()
- t += all.join('
')
- if (gmonly.length > 0) {
- gmonly.sort()
- t += '
--- GM only ---
'
- t += gmonly.join('
')
- }
- t += '
' + i18n('GURPS.chatHelpHelp')
- this.priv(t)
- }
+ help() {
+ return null
+ }
+
+ /** @param {string} line */
+ matches(line) {
+ return line.match(/[!\/\?]help/i)
+ }
+
+ /**
+ * Override to process a chat command
+ * @param {string} _line
+ * @param {any} _msgs
+ */
+ async process(_line, _msgs) {
+ let l = _line.split(' ')
+ if (l.length > 1) return this.registry.handle('?' + l[1].trim())
+
+ let t = `${i18n('GURPS.gameAidUsersGuide')}
`
+ let all = ChatProcessors.processorsForAll()
+ .filter(it => !!it.help())
+ .map(it => it.help())
+ let gmonly = ChatProcessors.processorsForGMOnly()
+ .filter(it => !!it.help())
+ .map(it => it.help())
+ all.sort()
+ t += all.join('
')
+ if (gmonly.length > 0) {
+ gmonly.sort()
+ t += '
--- GM only ---
'
+ t += gmonly.join('
')
+ }
+ t += '
' + i18n('GURPS.chatHelpHelp')
+ this.priv(t)
+ }
}
class ChatProcessorRegistry {
- constructor() {
- /**
- * @type {ChatProcessor[]}
- */
- this._processors = []
-
- this.registerProcessor(new HelpChatProcessor())
-
- /** @type {{pub: string[], priv: string[], data: any, quiet?: boolean, oldQuiet?: boolean, event?: any}} */
- this.msgs = { pub: [], priv: [], data: null }
- }
-
- processorsForAll() {
- return this._processors.filter(it => !it.isGMOnly())
- }
- processorsForGMOnly() {
- return this._processors.filter(it => it.isGMOnly())
- }
-
- /**
- * Make a pre-emptive decision if we are going to handle any of the lines in this message
- * @param {string} message
- */
- willTryToHandle(message) {
- let lines = message.split('\n') // Just need a simple split by newline... more advanced splitting will occur later
- for (const line of lines)
- for (const p of this._processors) {
- if (p.usagematches(line) || (line[0] == '!' ? p.matches(line.substr(1)) : p.matches(line))) return true
- }
- return false
- }
-
- /**
- * At this point, we just have to assume that we are going to handle some (if not all) of the messages in lines.
- * From this point on, we want to be in a single thread... so we await any async methods to ensure that
- * we get a response.
- * @param {string} message
- * @param {{shiftKey: boolean;ctrlKey: boolean;data: {};} | undefined} [event]
- * @param {import('@league-of-foundry-developers/foundry-vtt-types/src/foundry/common/data/data.mjs/chatMessageData').ChatMessageDataConstructorData | { speaker: any}} chatmsgData
- * @returns {Promise
')
- this.priv(processor.usage().replaceAll('\n', '
'))
- return [true, true]
- }
- return [false, false]
- }
-
- /**
- * Register a chat processor
- * @param {ChatProcessor} processor
- */
- registerProcessor(processor) {
- processor.registry = this // Provide a back pointer so that processors can get access to the message structure
- this._processors.push(processor)
- }
-
- /**
- * @param {string[]} priv
- */
- _sendPriv(priv) {
- if (priv.length == 0) return
- let lines = priv.slice()
- renderTemplate('systems/gurps/templates/chat-processing.html', {
- lines: lines,
- }).then(content => {
- ChatMessage.create({
- alreadyProcessed: true,
- content: content,
- user: game.user?.id,
- type: CONST.CHAT_MESSAGE_TYPES.WHISPER,
- whisper: [game.user?.id || ''],
- })
- })
- priv.length = 0
- }
-
- /**
- * @param {string[]} pub
- * @param {any} chatData
- */
- _sendPub(pub, chatData) {
- if (pub.length == 0) return
-
- let d = duplicate(chatData) // duplicate the original chat data (to maintain speaker, etc.)
- d.alreadyProcessed = true
- let lines = pub.slice()
- renderTemplate('systems/gurps/templates/chat-processing.html', {
- lines: lines,
- }).then(content => {
- d.content = content
- ChatMessage.create(d)
- })
- pub.length = 0
- }
-
- // Dump everything we have saved in messages
- send() {
- this._sendPriv(this.msgs.priv)
- this._sendPub(this.msgs.pub, this.msgs.data)
- }
-
- // Stack up as many public messages as we can, until we need to print a private one (to reduce the number of chat messages)
- /**
- * @param {string} txt
- */
- pub(txt) {
- if (this.msgs.priv.length > 0) this.send()
- this.msgs.pub.push(txt)
- }
-
- // Stack up as many private messages as we can, until we need to print a public one (to reduce the number of chat messages)
- /**
- * @param {string} txt
- */
- priv(txt, force = false) {
- if (this.msgs.quiet && !force) return
- if (this.msgs.pub.length > 0) this.send()
- this.msgs.priv.push(txt)
- }
-
- // Uncertain if these should be priv or pub
- /**
- * @param {string} txt
- */
- prnt(txt) {
- let p_setting = game.settings.get(Settings.SYSTEM_NAME, Settings.SETTING_PLAYER_CHAT_PRIVATE)
- if (game.user?.isGM || p_setting) this.priv(txt)
- else this.pub(txt)
- }
-
- // Attempt to convert original chat data into a whisper (for use when the player presses SHIFT key to make roll private)
- /**
- * @param {boolean} quiet
- * @param {boolean} shift
- * @param {boolean} ctrl
- */
- setEventFlags(quiet, shift, ctrl) {
- this.msgs.quiet = quiet
- this.msgs.oldQuiet = quiet
- this.msgs.data.type = CONST.CHAT_MESSAGE_TYPES.WHISPER
- this.msgs.data.whisper = [game.user?.id]
- mergeObject(this.msgs.event, { shiftKey: shift, ctrlKey: ctrl })
- }
+ constructor() {
+ /**
+ * @type {ChatProcessor[]}
+ */
+ this._processors = []
+
+ this.registerProcessor(new HelpChatProcessor())
+
+ /** @type {{pub: string[], priv: string[], data: any, quiet?: boolean, oldQuiet?: boolean, event?: any}} */
+ this.msgs = { pub: [], priv: [], data: null }
+ }
+
+ processorsForAll() {
+ return this._processors.filter(it => !it.isGMOnly())
+ }
+ processorsForGMOnly() {
+ return this._processors.filter(it => it.isGMOnly())
+ }
+
+ /**
+ * Make a pre-emptive decision if we are going to handle any of the lines in this message
+ * @param {string} message
+ */
+ willTryToHandle(message) {
+ let lines = message.split('\n') // Just need a simple split by newline... more advanced splitting will occur later
+ for (const line of lines)
+ for (const p of this._processors) {
+ if (p.usagematches(line) || (line[0] == '!' ? p.matches(line.substr(1)) : p.matches(line))) return true
+ }
+ return false
+ }
+
+ /**
+ * At this point, we just have to assume that we are going to handle some (if not all) of the messages in lines.
+ * From this point on, we want to be in a single thread... so we await any async methods to ensure that
+ * we get a response.
+ * @param {string} message
+ * @param {{shiftKey: boolean;ctrlKey: boolean;data: {};} | undefined} [event]
+ * @param {import('@league-of-foundry-developers/foundry-vtt-types/src/foundry/common/data/data.mjs/chatMessageData').ChatMessageDataConstructorData | { speaker: any}} chatmsgData
+ * @returns {Promise
')
+ this.priv(processor.usage().replaceAll('\n', '
'))
+ return [true, true]
+ }
+ return [false, false]
+ }
+
+ /**
+ * Register a chat processor
+ * @param {ChatProcessor} processor
+ */
+ registerProcessor(processor) {
+ processor.registry = this // Provide a back pointer so that processors can get access to the message structure
+ this._processors.push(processor)
+ }
+
+ /**
+ * @param {string[]} priv
+ */
+ _sendPriv(priv) {
+ if (priv.length == 0) return
+ let lines = priv.slice()
+ renderTemplate('systems/gurps/templates/chat-processing.html', {
+ lines: lines,
+ }).then(content => {
+ ChatMessage.create({
+ alreadyProcessed: true,
+ content: content,
+ user: game.user?.id,
+ type: CONST.CHAT_MESSAGE_TYPES.WHISPER,
+ whisper: [game.user?.id || ''],
+ })
+ })
+ priv.length = 0
+ }
+
+ /**
+ * @param {string[]} pub
+ * @param {any} chatData
+ */
+ _sendPub(pub, chatData) {
+ if (pub.length == 0) return
+
+ let d = duplicate(chatData) // duplicate the original chat data (to maintain speaker, etc.)
+ d.alreadyProcessed = true
+ let lines = pub.slice()
+ renderTemplate('systems/gurps/templates/chat-processing.html', {
+ lines: lines,
+ }).then(content => {
+ d.content = content
+ ChatMessage.create(d)
+ })
+ pub.length = 0
+ }
+
+ // Dump everything we have saved in messages
+ send() {
+ this._sendPriv(this.msgs.priv)
+ this._sendPub(this.msgs.pub, this.msgs.data)
+ }
+
+ // Stack up as many public messages as we can, until we need to print a private one (to reduce the number of chat messages)
+ /**
+ * @param {string} txt
+ */
+ pub(txt) {
+ if (this.msgs.priv.length > 0) this.send()
+ this.msgs.pub.push(txt)
+ }
+
+ // Stack up as many private messages as we can, until we need to print a public one (to reduce the number of chat messages)
+ /**
+ * @param {string} txt
+ */
+ priv(txt, force = false) {
+ if (this.msgs.quiet && !force) return
+ if (this.msgs.pub.length > 0) this.send()
+ this.msgs.priv.push(txt)
+ }
+
+ // Uncertain if these should be priv or pub
+ /**
+ * @param {string} txt
+ */
+ prnt(txt) {
+ let p_setting = game.settings.get(Settings.SYSTEM_NAME, Settings.SETTING_PLAYER_CHAT_PRIVATE)
+ if (game.user?.isGM || p_setting) this.priv(txt)
+ else this.pub(txt)
+ }
+
+ // Attempt to convert original chat data into a whisper (for use when the player presses SHIFT key to make roll private)
+ /**
+ * @param {boolean} quiet
+ * @param {boolean} shift
+ * @param {boolean} ctrl
+ */
+ setEventFlags(quiet, shift, ctrl) {
+ this.msgs.quiet = quiet
+ this.msgs.oldQuiet = quiet
+ this.msgs.data.type = CONST.CHAT_MESSAGE_TYPES.WHISPER
+ this.msgs.data.whisper = [game.user?.id]
+ mergeObject(this.msgs.event, { shiftKey: shift, ctrlKey: ctrl })
+ }
}
export let ChatProcessors = new ChatProcessorRegistry()
export default function addChatHooks() {
- Hooks.once('init', async function() {
- GURPS.ChatProcessors = ChatProcessors
- Hooks.on('chatMessage', (_log, message, chatmsgData) => {
- // @ts-ignore
- if (!!chatmsgData.alreadyProcessed) return true // The chat message has already been parsed for GURPS commands show it should just be displayed
-
- if (GURPS.ChatCommandsInProcess.includes(message)) {
- GURPS.ChatCommandsInProcess = GURPS.ChatCommandsInProcess.filter(
- (/** @type {string} */ item) => item !== message
- )
- return true // Ok. this is a big hack, and only used for singe line chat commands... but since arrays are synchronous and I don't expect chat floods, this is safe
- }
-
- // Due to Foundry's non-async way of handling the 'chatMessage' response, we have to decide beforehand
- // if we are going to process this message, and if so, return false so Foundry doesn't
- if (ChatProcessors.willTryToHandle(message)) {
- // Now we can handle the processing of each line in an async method, so we can ensure a single thread
- // @ts-ignore
- ChatProcessors.startProcessingLines(message, chatmsgData)
- return false
- } else return true
- })
-
- // Look for blind messages with .message-results and remove them
- /* Hooks.on("renderChatMessage", (log, content, data) => {
+ Hooks.once('init', async function () {
+ GURPS.ChatProcessors = ChatProcessors
+ Hooks.on('chatMessage', (_log, message, chatmsgData) => {
+ // @ts-ignore
+ if (!!chatmsgData.alreadyProcessed) return true // The chat message has already been parsed for GURPS commands show it should just be displayed
+
+ if (GURPS.ChatCommandsInProcess.includes(message)) {
+ GURPS.ChatCommandsInProcess = GURPS.ChatCommandsInProcess.filter(
+ (/** @type {string} */ item) => item !== message
+ )
+ return true // Ok. this is a big hack, and only used for singe line chat commands... but since arrays are synchronous and I don't expect chat floods, this is safe
+ }
+
+ // Due to Foundry's non-async way of handling the 'chatMessage' response, we have to decide beforehand
+ // if we are going to process this message, and if so, return false so Foundry doesn't
+ if (ChatProcessors.willTryToHandle(message)) {
+ // Now we can handle the processing of each line in an async method, so we can ensure a single thread
+ // @ts-ignore
+ ChatProcessors.startProcessingLines(message, chatmsgData)
+ return false
+ } else return true
+ })
+
+ // Look for blind messages with .message-results and remove them
+ /* Hooks.on("renderChatMessage", (log, content, data) => {
if (!!data.message.blind) {
if (data.author?.isSelf && !data.author.isGm) { // We are rendering the chat message for the sender (and they are not the GM)
$(content).find(".gurps-results").html("..."); // Replace gurps-results with "...". Does nothing if not there.
@@ -341,82 +341,82 @@ export default function addChatHooks() {
}
}); */
- // Add the "for" attribute to a collapsible panel label. This is needed
- // because the server in 0.7.8 strips the "for" attribute in an attempt
- // to guard against weird security hacks. When "for" is whitelisted as
- // a valid attribute (future) we can remove this.
- Hooks.on('renderChatMessage', (_app, html, _msg) => {
- // this is a fucking hack
- let wrapper = html.find('.collapsible-wrapper')
- if (wrapper.length > 0) {
- //console.log($(wrapper).html())
- let input = $(wrapper).find('input.toggle')[0]
- let label = $(input).siblings('label.label-toggle')[0]
- let id = input.id
- let labelFor = $(label).attr('for')
- if (labelFor !== id) {
- $(label).attr('for', id)
- console.log(`add the 'for' attribute if needed: ${$(wrapper).html()}`)
- }
- }
- })
-
- // Look for RESULTS from a RollTable. RollTables do not generate regular chat messages
- Hooks.on(
- 'preCreateChatMessage',
- (/** @type {ChatMessage} */ chatMessage, /** @type {any} */ _options, /** @type {any} */ _userId) => {
- let c = chatMessage.content
- try {
- let html = $(c)
- let rt = html.find('.result-text') // Ugly hack to find results of a roll table to see if an OtF should be "rolled" /r /roll
- let re = /^(\/r|\/roll|\/pr|\/private) \[([^\]]+)\]/
- let t = rt[0]?.innerText
- if (!!t) {
- t.split('\n').forEach(e => {
- let m = e.match(re)
- if (!!m && !!m[2]) {
- let action = parselink(m[2])
- if (!!action.action) {
- GURPS.performAction(action.action, GURPS.LastActor, {
- shiftKey: e.startsWith('/pr'),
- })
- // return false; // Return false if we don't want the rolltable chat message displayed. But I think we want to display the rolltable result.
- }
- }
- })
- }
- } catch (e) { } // a dangerous game... but limited to GURPs /roll OtF
- let newContent = gurpslink(c)
- setProperty(chatMessage, "_source.content", newContent);
- return true
- }
- )
-
- Hooks.on('renderChatMessage', (_app, html, _msg) => {
- GurpsWiring.hookupAllEvents(html)
- // html.find('[data-otf]').each((_, li) => {
- // li.setAttribute('draggable', 'true')
- // li.addEventListener('dragstart', ev => {
- // return ev.dataTransfer?.setData(
- // 'text/plain',
- // JSON.stringify({
- // otf: li.getAttribute('data-otf'),
- // })
- // )
- // })
- // })
- })
-
- Hooks.on(
- 'diceSoNiceRollComplete',
- async (/** @type {any} */ _app, /** @type {any} */ _html, /** @type {any} */ _msg) => {
- let otf = GURPS.PendingOTFs.pop()
- while (otf) {
- let action = parselink(otf)
- if (!!action.action) await GURPS.performAction(action.action, GURPS.LastActor || game.user)
- otf = GURPS.PendingOTFs.pop()
- }
- }
- )
- }) // End of "init"
+ // Add the "for" attribute to a collapsible panel label. This is needed
+ // because the server in 0.7.8 strips the "for" attribute in an attempt
+ // to guard against weird security hacks. When "for" is whitelisted as
+ // a valid attribute (future) we can remove this.
+ Hooks.on('renderChatMessage', (_app, html, _msg) => {
+ // this is a fucking hack
+ let wrapper = html.find('.collapsible-wrapper')
+ if (wrapper.length > 0) {
+ //console.log($(wrapper).html())
+ let input = $(wrapper).find('input.toggle')[0]
+ let label = $(input).siblings('label.label-toggle')[0]
+ let id = input.id
+ let labelFor = $(label).attr('for')
+ if (labelFor !== id) {
+ $(label).attr('for', id)
+ console.log(`add the 'for' attribute if needed: ${$(wrapper).html()}`)
+ }
+ }
+ })
+
+ // Look for RESULTS from a RollTable. RollTables do not generate regular chat messages
+ Hooks.on(
+ 'preCreateChatMessage',
+ (/** @type {ChatMessage} */ chatMessage, /** @type {any} */ _options, /** @type {any} */ _userId) => {
+ let c = chatMessage.content
+ try {
+ let html = $(c)
+ let rt = html.find('.result-text') // Ugly hack to find results of a roll table to see if an OtF should be "rolled" /r /roll
+ let re = /^(\/r|\/roll|\/pr|\/private) \[([^\]]+)\]/
+ let t = rt[0]?.innerText
+ if (!!t) {
+ t.split('\n').forEach(e => {
+ let m = e.match(re)
+ if (!!m && !!m[2]) {
+ let action = parselink(m[2])
+ if (!!action.action) {
+ GURPS.performAction(action.action, GURPS.LastActor, {
+ shiftKey: e.startsWith('/pr'),
+ })
+ // return false; // Return false if we don't want the rolltable chat message displayed. But I think we want to display the rolltable result.
+ }
+ }
+ })
+ }
+ } catch (e) {} // a dangerous game... but limited to GURPs /roll OtF
+ let newContent = gurpslink(c)
+ setProperty(chatMessage, '_source.content', newContent)
+ return true
+ }
+ )
+
+ Hooks.on('renderChatMessage', (_app, html, _msg) => {
+ GurpsWiring.hookupAllEvents(html)
+ // html.find('[data-otf]').each((_, li) => {
+ // li.setAttribute('draggable', 'true')
+ // li.addEventListener('dragstart', ev => {
+ // return ev.dataTransfer?.setData(
+ // 'text/plain',
+ // JSON.stringify({
+ // otf: li.getAttribute('data-otf'),
+ // })
+ // )
+ // })
+ // })
+ })
+
+ Hooks.on(
+ 'diceSoNiceRollComplete',
+ async (/** @type {any} */ _app, /** @type {any} */ _html, /** @type {any} */ _msg) => {
+ let otf = GURPS.PendingOTFs.pop()
+ while (otf) {
+ let action = parselink(otf)
+ if (!!action.action) await GURPS.performAction(action.action, GURPS.LastActor || game.user)
+ otf = GURPS.PendingOTFs.pop()
+ }
+ }
+ )
+ }) // End of "init"
}
diff --git a/module/chat/anim.js b/module/chat/anim.js
index 2dbc4c542..ec583e4b4 100644
--- a/module/chat/anim.js
+++ b/module/chat/anim.js
@@ -2,7 +2,7 @@
import ChatProcessor from './chat-processor.js'
import { parselink } from '../../lib/parselink.js'
-import { i18n, makeRegexPatternFrom, splitArgs, wait} from '../../lib/utilities.js'
+import { i18n, makeRegexPatternFrom, splitArgs, wait } from '../../lib/utilities.js'
const JB2A_PATREON = 'jb2a_patreon'
const JB2A_FREE = 'JB2A_DnD5e'
@@ -13,8 +13,7 @@ const JAAMOD = 'jaamod'
let ANIM_LIBRARY = []
Hooks.on('ready', async () => {
- if (!addToLibrary(JB2A_PATREON))
- addToLibrary(JB2A_FREE)
+ if (!addToLibrary(JB2A_PATREON)) addToLibrary(JB2A_FREE)
addToLibrary(JK_ANIM_SPELL)
addToLibrary(JK_ANIM_SPELL_CARTOON)
addToLibrary(JAAMOD)
@@ -22,14 +21,14 @@ Hooks.on('ready', async () => {
function addToLibrary(module) {
if (game.modules.get(module)) {
- let xhr = new XMLHttpRequest();
- xhr.open('GET', 'systems/gurps/utils/' + module + '.txt', true);
- xhr.responseType = 'text';
+ let xhr = new XMLHttpRequest()
+ xhr.open('GET', 'systems/gurps/utils/' + module + '.txt', true)
+ xhr.responseType = 'text'
xhr.onload = function () {
if (xhr.readyState === xhr.DONE) {
if (xhr.status === 200) {
- let list = xhr.responseText.split('\n').map(s => s.replace(/^\.\//, ""))
- list = list.map(s => s.replace(/,width=/, ",W:"))
+ let list = xhr.responseText.split('\n').map(s => s.replace(/^\.\//, ''))
+ list = list.map(s => s.replace(/,width=/, ',W:'))
list = list.map(s => `modules/${module}/${s}`)
list = list.filter(f => fileWidth(f).width > 0)
console.log(`Loaded ${list.length} ${module} records`)
@@ -45,24 +44,24 @@ function addToLibrary(module) {
function fileWidth(entry) {
let m = entry.match(/\.webm,W:(\d+)/)
- if (!!m) return { file: entry.split(",")[0], width: +m[1] }
-// console.log("Unknown format: " + entry)
+ if (!!m) return { file: entry.split(',')[0], width: +m[1] }
+ // console.log("Unknown format: " + entry)
return { file: entry, width: 1 }
}
// stolen from the Ping module
function getMousePos(foundryCanvas) {
- const mouse = foundryCanvas.app.renderer.plugins.interaction.mouse.global;
- const t = foundryCanvas.stage.worldTransform;
+ const mouse = foundryCanvas.app.renderer.plugins.interaction.mouse.global
+ const t = foundryCanvas.stage.worldTransform
function calcCoord(axis) {
- return (mouse[axis] - t['t' + axis]) / foundryCanvas.stage.scale[axis];
+ return (mouse[axis] - t['t' + axis]) / foundryCanvas.stage.scale[axis]
}
return {
x: calcCoord('x'),
- y: calcCoord('y')
- };
+ y: calcCoord('y'),
+ }
}
export class AnimChatProcessor extends ChatProcessor {
@@ -73,34 +72,31 @@ export class AnimChatProcessor extends ChatProcessor {
async drawEffect(effect, fromToken, toTokensArray) {
let used = []
for (const to of toTokensArray)
- if (effect.centered)
- used = [...used, ...await this.drawSpecialToward(effect, to, fromToken)]
- else
- used = [...used, ...await this.drawSpecialToward(effect, fromToken, to)]
+ if (effect.centered) used = [...used, ...(await this.drawSpecialToward(effect, to, fromToken))]
+ else used = [...used, ...(await this.drawSpecialToward(effect, fromToken, to))]
return used
}
-
+
randFile(list) {
let i = Math.floor(Math.random() * list.length)
- return list.splice(i,1)
+ return list.splice(i, 1)
}
-
-
+
async drawSpecialToward(effect, tok1, tok2) {
const origin = {
x: tok1.position.x + tok1.w / 2,
- y: tok1.position.y + tok1.h / 2
+ y: tok1.position.y + tok1.h / 2,
}
const target = {
x: tok2.position.x + tok2.w / 2,
- y: tok2.position.y + tok2.h / 2
+ y: tok2.position.y + tok2.h / 2,
}
// Compute angle
const deltaX = target.x - origin.x
const deltaY = target.y - origin.y
- let rotation = (effect.noRotate || (effect.centered && !effect.move)) ? 0 : Math.atan2(deltaY, deltaX)
- let distance = (effect.centered && !effect.move) ? 0 : Math.sqrt(deltaX * deltaX + deltaY * deltaY)
-
+ let rotation = effect.noRotate || (effect.centered && !effect.move) ? 0 : Math.atan2(deltaY, deltaX)
+ let distance = effect.centered && !effect.move ? 0 : Math.sqrt(deltaX * deltaX + deltaY * deltaY)
+
let files = []
if (effect.centered) {
files = effect.files.map(f => fileWidth(f))
@@ -139,11 +135,11 @@ export class AnimChatProcessor extends ChatProcessor {
let effects = []
let stretch = 0
for (let i = 0; i < effect.count; i++) {
- const effectData = {...effect}
+ const effectData = { ...effect }
effectData.position = {
- x: origin.x,
- y: origin.y
- }
+ x: origin.x,
+ y: origin.y,
+ }
effectData.rotation = rotation
stretch = distance * (1 + effectData.stretch)
let file = this.randFile(possible)[0]
@@ -153,8 +149,8 @@ export class AnimChatProcessor extends ChatProcessor {
if (effectData.flip) effectData.scale.x *= -1
if (effectData.move) effectData.distance = stretch
} else {
- let s = stretch / file.width
- effectData.scale = {x: s, y: (Math.random() < 0.5 ? -effectData.scale.y : effectData.scale.y)} // randomly flip vert orientation
+ let s = stretch / file.width
+ effectData.scale = { x: s, y: Math.random() < 0.5 ? -effectData.scale.y : effectData.scale.y } // randomly flip vert orientation
}
effects.push(effectData)
used.push(effectData.file.split('/').pop())
@@ -162,54 +158,59 @@ export class AnimChatProcessor extends ChatProcessor {
this.executeEffects(effect.count, effects) // do NOT await this.
return [used, stretch]
}
-
+
async executeEffects(count, effects) {
for (let effectData of effects) {
count--
- game.socket.emit('module.fxmaster', effectData);
+ game.socket.emit('module.fxmaster', effectData)
// Throw effect locally
try {
canvas.specials.playVideo(effectData)
- } catch (e) { //in case people have older versions of fxmaster
+ } catch (e) {
+ //in case people have older versions of fxmaster
canvas.fxmaster.playVideo(effectData)
}
//console.log(GURPS.objToString(effectData))
if (count > 0) await wait(effectData.delay)
}
}
-
+
errorExit(str) {
- ui.notifications.error(str);
+ ui.notifications.error(str)
return false
}
-
+
async awaitClick(line) {
GURPS.IgnoreTokenSelect = true
- return new Promise( (resolve, reject) => {
- window.addEventListener('mousedown', (e) => {
- let pt = getMousePos(game.canvas)
- e.preventDefault()
- e.stopPropagation()
- let grid_size = canvas.scene.data.grid
- canvas.tokens.targetObjects({
- x: pt.x - grid_size / 2,
- y: pt.y - grid_size / 2,
- height: grid_size,
- width: grid_size,
- releaseOthers: true,
- })
- GURPS.IgnoreTokenSelect = false
- line = line + " @" + parseInt(pt.x) + "," + parseInt(pt.y)
- this.registry.processLine(line)
- resolve()
- }, {once: true})
+ return new Promise((resolve, reject) => {
+ window.addEventListener(
+ 'mousedown',
+ e => {
+ let pt = getMousePos(game.canvas)
+ e.preventDefault()
+ e.stopPropagation()
+ let grid_size = canvas.scene.data.grid
+ canvas.tokens.targetObjects({
+ x: pt.x - grid_size / 2,
+ y: pt.y - grid_size / 2,
+ height: grid_size,
+ width: grid_size,
+ releaseOthers: true,
+ })
+ GURPS.IgnoreTokenSelect = false
+ line = line + ' @' + parseInt(pt.x) + ',' + parseInt(pt.y)
+ this.registry.processLine(line)
+ resolve()
+ },
+ { once: true }
+ )
})
}
-
+
async displaylist() {
- let list = ANIM_LIBRARY.map(s => s.replace(/modules\//,""))
- list = [ "Total: " + ANIM_LIBRARY.length, ...list]
-
+ let list = ANIM_LIBRARY.map(s => s.replace(/modules\//, ''))
+ list = ['Total: ' + ANIM_LIBRARY.length, ...list]
+
let t = await renderTemplate('systems/gurps/templates/import-stat-block.html', { block: list.join('\n') })
//let t = await renderTemplate('systems/gurps/templates/chat-processing.html', { lines: list })
let d = new Dialog(
@@ -217,7 +218,7 @@ export class AnimChatProcessor extends ChatProcessor {
title: `Anim library`,
content: t,
buttons: {
- no: {
+ no: {
icon: '',
label: 'OK',
},
@@ -232,42 +233,47 @@ export class AnimChatProcessor extends ChatProcessor {
d.render(true)
}
- matches(line) {
-// this.match = line.match(/^\/anim *(?list)? *(?
list)? *(?
list)? *(?